tramadol
SMILES | COc1cccc(c1)C1(O)CCCCC1CN(C)C |
InChIKey | TVYLLZQTGLZFBW-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 4 |
Molecular weight (Da) | 263.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 8.03 | 8.03 | 8.03 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 7.85 | 7.85 | 7.85 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 5.8 | 5.8 | 5.8 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 5.62 | 5.62 | 5.62 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 8.03 | 8.03 | 8.03 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 7.85 | 7.85 | 7.85 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 5.7 | 5.75 | 5.8 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pIC50 | 5.12 | 5.12 | 5.12 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 5.89 | 5.89 | 5.89 | ChEMBL |