VU0360172
SMILES | Fc1cccc(c1)C#Cc1ccc(cn1)C(=O)NC1CCC1 |
InChIKey | NEMHWVUKNWAKTM-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 294.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Ligand site mutations | mGlu5 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.71 | 6.71 | 6.71 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.71 | 6.71 | 6.71 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKB | 6.6 | 6.8 | 7.0 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.8 | 7.8 | 7.8 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.41 | 7.61 | 7.8 | ChEMBL |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 7.8 | 7.8 | 7.8 | ChEMBL |