VU0463841
SMILES | N#Cc1cc(NC(=O)Nc2ccc(cn2)Cl)cc(c1)F |
InChIKey | KDANLHLWAYNCMV-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 2 |
Rotatable bonds | 2 |
Molecular weight (Da) | 290.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 7.9 | 7.9 | 7.9 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.89 | 7.89 | 7.89 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 7.89 | 7.89 | 7.89 | ChEMBL |