CHEMBL3763342
SMILES | Cc1cc(C(=O)N2Cc3cnn(C)c3Nc3ccccc32)ccc1CNC(=O)N1CCN(Cc2cc(O)cc(O)c2)CC1 |
InChIKey | HWPGRFRXZNLZEX-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 8 |
Hydrogen bond donors | 4 |
Rotatable bonds | 5 |
Molecular weight (Da) | 581.3 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Mouse | Vasopressin and oxytocin | A | pKi | 7.29 | 7.29 | 7.29 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.01 | 6.93 | 7.52 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.95 | 7.39 | 7.9 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Mouse | Vasopressin and oxytocin | A | pEC50 | 7.11 | 7.33 | 7.54 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 5.64 | 5.64 | 5.64 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pEC50 | 6.05 | 6.95 | 8.52 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pIC50 | 6.21 | 6.86 | 8.15 | ChEMBL |