dioctanoylglycerol pyrophosphate
SMILES | CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC)COP(=O)(OP(=O)(O)O)O |
InChIKey | MBDSUZSCJLRKPC-QGZVFWFLSA-N |
Chemical properties
Hydrogen bond acceptors | 8 |
Hydrogen bond donors | 3 |
Rotatable bonds | 20 |
Molecular weight (Da) | 504.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pKi | 5.15 | 5.16 | 5.18 | Guide to Pharmacology |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pKi | 5.37 | 5.37 | 5.37 | ChEMBL |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pKi | 6.7 | 6.7 | 6.7 | ChEMBL |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pKi | 5.5 | 6.25 | 7.0 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.26 | 5.26 | 5.26 | ChEMBL |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.34 | 6.34 | 6.34 | ChEMBL |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.97 | 6.97 | 6.97 | Guide to Pharmacology |