diquafosol
SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(OP(=O)(OC[C@H]2O[C@H]([C@@H]([C@@H]2O)O)n2ccc(=O)[nH]c2=O)O)O)O)O)O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1=O |
InChIKey | NMLMACJWHPHKGR-NCOIDOBVSA-N |
Chemical properties
Hydrogen bond acceptors | 21 |
Hydrogen bond donors | 10 |
Rotatable bonds | 14 |
Molecular weight (Da) | 790.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 6.4 | 6.4 | 6.4 | Guide to Pharmacology |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 6.06 | 6.63 | 6.89 | ChEMBL |
P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 4.7 | 5.45 | 5.94 | ChEMBL |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 5.88 | 6.71 | 7.22 | ChEMBL |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 8.19 | 8.19 | 8.19 | Drug Central |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 8.13 | 8.13 | 8.13 | Drug Central |