farnesyl diphosphate
| SMILES | C/C(=C/COP(=O)(OP(=O)(O)O)O)/CC/C=C(\CCC=C(C)C)/C |
| InChIKey | VWFJDQUYCIWHTN-FBXUGWQNSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 11 |
| Molecular weight (Da) | 382.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Endogenous |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pKd | 6.81 | 6.81 | 6.81 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.68 | 5.68 | 5.68 | Guide to Pharmacology |
| LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.81 | 6.81 | 6.81 | Guide to Pharmacology |
| LPA4 | LPAR4 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
| LPA5 | LPAR5 | Human | Lysophospholipid (LPA) | A | pEC50 | 5.84 | 6.19 | 6.54 | Guide to Pharmacology |