LS-192629
SMILES | CO/N=C/1\CN([C@@H](C1)C(=O)NC[C@H](c1ccccc1)O)C(=O)c1ccc(cc1)c1ccccc1C |
InChIKey | IBXGJPAYWMFXSF-UEEONYLUSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 2 |
Rotatable bonds | 7 |
Molecular weight (Da) | 471.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.55 | 7.55 | 7.55 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.77 | 6.77 | 6.77 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.7 | 6.7 | 6.7 | Guide to Pharmacology |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.6 | 7.7 | 7.8 | Guide to Pharmacology |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKd | 7.8 | 7.8 | 7.8 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 6.87 | 6.87 | 6.87 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 6.9 | 6.9 | 6.9 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |