macitentan
SMILES | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br |
InChIKey | JGCMEBMXRHSZKX-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 8 |
Hydrogen bond donors | 2 |
Rotatable bonds | 11 |
Molecular weight (Da) | 586.0 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ETA | EDNRA | Human | Endothelin | A | pIC50 | 9.3 | 9.3 | 9.3 | Guide to Pharmacology |
ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.41 | 6.41 | 6.41 | Guide to Pharmacology |
ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.01 | 6.28 | 6.41 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pIC50 | 8.47 | 9.02 | 9.3 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pIC50 | 8.03 | 8.03 | 8.03 | Drug Central |
ETB | EDNRB | Human | Endothelin | A | pIC50 | 8.19 | 8.19 | 8.19 | Drug Central |