nalorphine
SMILES | C=CCN1CC[C@@]23[C@@H]4[C@H]1Cc1c3c(O[C@H]2[C@H](C=C4)O)c(cc1)O |
InChIKey | UIQMVEYFGZJHCZ-SSTWWWIQSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 2 |
Molecular weight (Da) | 311.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 7.4 | 7.4 | 7.4 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 7.9 | 8.5 | 9.1 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.9 | 8.9 | 8.9 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 8.19 | 8.45 | 8.7 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 6.92 | 6.92 | 6.92 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 8.7 | 9.06 | 9.42 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 9.44 | 9.58 | 9.72 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 8.16 | 8.16 | 8.16 | Drug Central |
κ | OPRK | Human | Opioid | A | pKi | 8.03 | 8.03 | 8.03 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.01 | 8.01 | 8.01 | Drug Central |
κ | OPRK | Guinea pig | Opioid | A | pKi | 8.11 | 8.11 | 8.11 | Drug Central |
μ | OPRM | Rat | Opioid | A | pKi | 8.06 | 8.06 | 8.06 | Drug Central |
κ | OPRK | Guinea pig | Opioid | A | pKi | 7.82 | 7.82 | 7.82 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |