BMS-193884
SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 |
InChIKey | LJGUZUROJOJEMI-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 395.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ETA | EDNRA | Human | Endothelin | A | pKi | 8.85 | 8.85 | 8.85 | Guide to Pharmacology |
ETB | EDNRB | Human | Endothelin | A | pKi | 4.73 | 4.73 | 4.73 | Guide to Pharmacology |
ETB | EDNRB | Rat | Endothelin | A | pKi | 5.72 | 5.72 | 5.72 | ChEMBL |
ETA | EDNRA | Rat | Endothelin | A | pKi | 8.85 | 8.85 | 8.85 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pKi | 8.85 | 8.85 | 8.85 | ChEMBL |
ETB | EDNRB | Human | Endothelin | A | pKi | 4.73 | 4.73 | 4.73 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |