2-(3-bromophenyl)histamine
SMILES | NCCc1cnc([nH]1)c1cccc(c1)Br |
InChIKey | VSKJPAMQPJDPLL-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 2 |
Rotatable bonds | 3 |
Molecular weight (Da) | 265.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Ligand site mutations | H1 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
H1 | HRH1 | Human | Histamine | A | pKi | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
H4 | HRH4 | Human | Histamine | A | pKi | 6.0 | 6.0 | 6.0 | Guide to Pharmacology |
H4 | HRH4 | Human | Histamine | A | pKi | 5.8 | 5.8 | 5.8 | ChEMBL |
H1 | HRH1 | Guinea pig | Histamine | A | pKd | 8.9 | 9.02 | 9.13 | ChEMBL |
H3 | HRH3 | Guinea pig | Histamine | A | pKd | 5.2 | 5.2 | 5.2 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
H1 | HRH1 | Human | Histamine | A | pEC50 | 6.7 | 6.7 | 6.7 | ChEMBL |
H4 | HRH4 | Human | Histamine | A | pEC50 | 5.0 | 5.0 | 5.0 | ChEMBL |