AIDA
SMILES | OC(=O)c1ccc2c(c1)CCC2(N)C(=O)O |
InChIKey | LSTPKMWNRWCNLS-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 3 |
Rotatable bonds | 2 |
Molecular weight (Da) | 221.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 4.0 | 4.0 | 4.0 | Guide to Pharmacology |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 5.96 | 5.96 | 5.96 | PDSP Ki database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pA2 | 4.2 | 4.2 | 4.2 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 5.16 | 5.16 | 5.16 | ChEMBL |