compound 16m [PMID: 19931453]
SMILES | CC[C@@H]1CCCCN1C(=O)c1cnc(c(c1)Cl)Nc1ccc(nc1)C |
InChIKey | QABUURICQJOWID-MRXNPFEDSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 4 |
Molecular weight (Da) | 358.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKi | 7.42 | 7.42 | 7.42 | Guide to Pharmacology |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKi | 7.42 | 7.42 | 7.42 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 7.52 | 7.52 | 7.52 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 7.49 | 7.49 | 7.49 | Guide to Pharmacology |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 7.44 | 7.47 | 7.5 | ChEMBL |