conessine
SMILES | CN([C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]24[C@H]3CC[C@@H]4[C@@H](N(C2)C)C)C1)C)C |
InChIKey | GPLGAQQQNWMVMM-MYAJQUOBSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 0 |
Rotatable bonds | 1 |
Molecular weight (Da) | 356.3 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
H1 | HRH1 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H2 | HRH2 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H3 | HRH3 | Human | Histamine | A | pKi | 8.3 | 8.3 | 8.3 | Guide to Pharmacology |
H4 | HRH4 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H3 | HRH3 | Rat | Histamine | A | pKi | 7.18 | 7.59 | 7.91 | ChEMBL |
α2A | ADA2A | Human | Adrenoceptors | A | pKi | 6.18 | 6.18 | 6.18 | ChEMBL |
H3 | HRH3 | Human | Histamine | A | pKi | 8.27 | 8.31 | 8.46 | ChEMBL |
α2C | ADA2C | Human | Adrenoceptors | A | pKi | 7.97 | 7.97 | 7.98 | ChEMBL |
H3 | HRH3 | Guinea pig | Histamine | A | pKd | 6.55 | 6.55 | 6.55 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 5.6 | 5.6 | 5.6 | ChEMBL |