Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 2733504 | 8216 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
| 7802 | 8216 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
| CHEMBL397686 | 8216 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
| 10883396 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| 5283560 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| 911 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| CHEMBL225155 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |