Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 3934 | 10091 | 0 | None | -6 | 2 | Human | 11.1 | pEC50 | = | 11.1 | Functional | Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 4356 | 10091 | 0 | None | -6 | 2 | Human | 11.1 | pEC50 | = | 11.1 | Functional | Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 73755062 | 10091 | 0 | None | -6 | 2 | Human | 11.1 | pEC50 | = | 11.1 | Functional | Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | ||
| 5555 | 10190 | 0 | None | -1 | 2 | Human | 11.3 | pEC50 | = | 11.3 | Functional | Guide to Pharmacology | 390 | 14 | 3 | 5 | 3.6 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O | 22449948 | ||
| 71519431 | 10190 | 0 | None | -1 | 2 | Human | 11.3 | pEC50 | = | 11.3 | Functional | Guide to Pharmacology | 390 | 14 | 3 | 5 | 3.6 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O | 22449948 | ||
| 1034 | 9171 | 27 | None | 10 | 2 | Human | 9.7 | pEC50 | = | 9.7 | Functional | Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | ||
| 5280914 | 9171 | 27 | None | 10 | 2 | Human | 9.7 | pEC50 | = | 9.7 | Functional | Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | ||
| CHEMBL392438 | 9171 | 27 | None | 10 | 2 | Human | 9.7 | pEC50 | = | 9.7 | Functional | Guide to Pharmacology | 352 | 14 | 4 | 4 | 3.1 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | 20080636 | ||
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 3934 | 10091 | 0 | None | - | 1 | Human | 9.7 | pKd | = | 9.7 | Binding | Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | |||
| 4356 | 10091 | 0 | None | - | 1 | Human | 9.7 | pKd | = | 9.7 | Binding | Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | |||
| 73755062 | 10091 | 0 | None | - | 1 | Human | 9.7 | pKd | = | 9.7 | Binding | Guide to Pharmacology | 376 | 14 | 4 | 4 | 3.5 | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@@H]([C@H](C/C=C\CCC(=O)O)O)O)O | 20080636 | |||