Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
10210629 | 8732 | 0 | None | 2 | 4 | Human | 9.9 | pIC50 | = | 9.9 | Functional | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL109644 | 8732 | 0 | None | 2 | 4 | Human | 9.9 | pIC50 | = | 9.9 | Functional | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
9870830 | 206691 | 38 | None | -1 | 5 | Human | 9.5 | pIC50 | = | 9.5 | Functional | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL8981 | 206691 | 38 | None | -1 | 5 | Human | 9.5 | pIC50 | = | 9.5 | Functional | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm00008a002 | ||
23670447 | 3007 | 2 | None | 1 | 4 | Human | 9.5 | pIC50 | = | 9.5 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm00008a002 | ||
999 | 3007 | 2 | None | 1 | 4 | Human | 9.5 | pIC50 | = | 9.5 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm00008a002 | ||
CHEMBL1204799 | 3007 | 2 | None | 1 | 4 | Human | 9.5 | pIC50 | = | 9.5 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm00008a002 | ||
CHEMBL25438 | 3007 | 2 | None | 1 | 4 | Human | 9.5 | pIC50 | = | 9.5 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm00008a002 | ||
10187997 | 109945 | 0 | None | 1 | 4 | Human | 9.4 | pIC50 | = | 9.4 | Functional | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL323464 | 109945 | 0 | None | 1 | 4 | Human | 9.4 | pIC50 | = | 9.4 | Functional | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
9916235 | 9321 | 1 | None | 1 | 4 | Human | 9.3 | pIC50 | = | 9.3 | Functional | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL111277 | 9321 | 1 | None | 1 | 4 | Human | 9.3 | pIC50 | = | 9.3 | Functional | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
10603409 | 110577 | 0 | None | 1 | 4 | Human | 9.3 | pIC50 | = | 9.3 | Functional | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
CHEMBL325581 | 110577 | 0 | None | 1 | 4 | Human | 9.3 | pIC50 | = | 9.3 | Functional | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
443289 | 708 | 47 | None | 1 | 4 | Human | 9.2 | pIC50 | = | 9.2 | Functional | ChEMBL | None | None | None | None | 10.1016/j.ejmech.2016.06.006 | ||||
997 | 708 | 47 | None | 1 | 4 | Human | 9.2 | pIC50 | = | 9.2 | Functional | ChEMBL | None | None | None | None | 10.1016/j.ejmech.2016.06.006 | ||||
CHEMBL314691 | 708 | 47 | None | 1 | 4 | Human | 9.2 | pIC50 | = | 9.2 | Functional | ChEMBL | None | None | None | None | 10.1016/j.ejmech.2016.06.006 | ||||
DB12054 | 708 | 47 | None | 1 | 4 | Human | 9.2 | pIC50 | = | 9.2 | Functional | ChEMBL | None | None | None | None | 10.1016/j.ejmech.2016.06.006 | ||||
CHEMBL3980643 | 212491 | 0 | None | -6 | 2 | Human | 9.2 | pIC50 | = | 9.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(N)=O)[C@@H](C)CC | 10.1016/j.ejmech.2016.06.006 | ||||
10230737 | 112293 | 0 | None | 16 | 2 | Human | 9.0 | pIC50 | = | 9.0 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cccc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL329251 | 112293 | 0 | None | 16 | 2 | Human | 9.0 | pIC50 | = | 9.0 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cccc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
11318978 | 167879 | 0 | None | 7 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Functional | ChEMBL | 560 | 7 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL431286 | 167879 | 0 | None | 7 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Functional | ChEMBL | 560 | 7 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
10651488 | 163355 | 0 | None | 1 | 4 | Human | 8.8 | pIC50 | = | 8.8 | Functional | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
CHEMBL419367 | 163355 | 0 | None | 1 | 4 | Human | 8.8 | pIC50 | = | 8.8 | Functional | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
CHEMBL412706 | 212996 | 0 | None | - | 1 | Pig | 8.8 | pIC50 | = | 8.8 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
9894443 | 112546 | 0 | None | 3 | 2 | Human | 8.7 | pIC50 | = | 8.7 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL330104 | 112546 | 0 | None | 3 | 2 | Human | 8.7 | pIC50 | = | 8.7 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
9955200 | 9300 | 0 | None | 53 | 3 | Human | 8.7 | pIC50 | = | 8.7 | Functional | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL11115 | 9300 | 0 | None | 53 | 3 | Human | 8.7 | pIC50 | = | 8.7 | Functional | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
70690542 | 76192 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8 | Functional | ChEMBL | 532 | 9 | 1 | 6 | 6.6 | CCCCc1nc2ccc(F)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058375 | 76192 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8 | Functional | ChEMBL | 532 | 9 | 1 | 6 | 6.6 | CCCCc1nc2ccc(F)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
70696781 | 76193 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8 | Functional | ChEMBL | 582 | 9 | 1 | 6 | 7.5 | CCCCc1nc2ccc(C(F)(F)F)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058376 | 76193 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8 | Functional | ChEMBL | 582 | 9 | 1 | 6 | 7.5 | CCCCc1nc2ccc(C(F)(F)F)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
11342089 | 107181 | 0 | None | 9 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 568 | 9 | 2 | 8 | 4.0 | COc1ccc(CN2C(=O)CN[C@](c3cccc(OC)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL316629 | 107181 | 0 | None | 9 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 568 | 9 | 2 | 8 | 4.0 | COc1ccc(CN2C(=O)CN[C@](c3cccc(OC)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
10230703 | 207836 | 0 | None | 4 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 542 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96472 | 207836 | 0 | None | 4 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 542 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
9957883 | 98629 | 0 | None | 25 | 2 | Human | 7.0 | pIC50 | = | 7 | Functional | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL27732 | 98629 | 0 | None | 25 | 2 | Human | 7.0 | pIC50 | = | 7 | Functional | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
44213651 | 4267 | 0 | None | - | 1 | Human | 5.0 | pIC50 | = | 5 | Functional | ChEMBL | 343 | 3 | 1 | 4 | 4.2 | OCC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100795 | 4267 | 0 | None | - | 1 | Human | 5.0 | pIC50 | = | 5 | Functional | ChEMBL | 343 | 3 | 1 | 4 | 4.2 | OCC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
11455999 | 207806 | 0 | None | 31 | 2 | Human | 7.0 | pIC50 | = | 7 | Functional | ChEMBL | 580 | 7 | 2 | 4 | 6.6 | O=C(O)[C@@H](Oc1cccc(Cl)c1)[C@@]1(c2ccccc2)NCC(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL96325 | 207806 | 0 | None | 31 | 2 | Human | 7.0 | pIC50 | = | 7 | Functional | ChEMBL | 580 | 7 | 2 | 4 | 6.6 | O=C(O)[C@@H](Oc1cccc(Cl)c1)[C@@]1(c2ccccc2)NCC(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 | 10.1021/jm031115r | ||
11490160 | 207478 | 0 | None | 5 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 584 | 8 | 2 | 6 | 5.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(-c4ccccc4)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94446 | 207478 | 0 | None | 5 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 584 | 8 | 2 | 6 | 5.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(-c4ccccc4)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11273181 | 207843 | 0 | None | -4 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3C(F)(F)F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96506 | 207843 | 0 | None | -4 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3C(F)(F)F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL386778 | 212367 | 0 | None | - | 1 | Pig | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL405337 | 212534 | 0 | None | - | 1 | Pig | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL405916 | 212562 | 0 | None | - | 1 | Pig | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL409180 | 212727 | 0 | None | - | 1 | Pig | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
6450144 | 122535 | 8 | None | - | 1 | Rat | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 632 | 5 | 3 | 6 | 8.1 | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(COC(=O)/C=C/c4ccc(O)c(O)c4)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 | 10.1016/j.bmc.2015.06.055 | ||
CHEMBL3601500 | 122535 | 8 | None | - | 1 | Rat | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 632 | 5 | 3 | 6 | 8.1 | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(COC(=O)/C=C/c4ccc(O)c(O)c4)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 | 10.1016/j.bmc.2015.06.055 | ||
70684240 | 76194 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 559 | 10 | 1 | 8 | 6.4 | CCCCc1nc2ccc([N+](=O)[O-])cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058377 | 76194 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 559 | 10 | 1 | 8 | 6.4 | CCCCc1nc2ccc([N+](=O)[O-])cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
11421972 | 207822 | 0 | None | 2 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 592 | 8 | 2 | 7 | 4.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(OC(F)(F)F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96422 | 207822 | 0 | None | 2 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 592 | 8 | 2 | 7 | 4.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(OC(F)(F)F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11342005 | 207526 | 0 | None | 2 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)c(F)c(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94766 | 207526 | 0 | None | 2 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)c(F)c(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11744509 | 5398 | 0 | None | 5 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 450 | 5 | 1 | 6 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10733 | 5398 | 0 | None | 5 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 450 | 5 | 1 | 6 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)cc2)cc1 | 10.1021/jm00008a002 | ||
122194935 | 124068 | 0 | None | - | 1 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 619 | 11 | 2 | 8 | 6.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(S(F)(F)(F)(F)F)cc2)cc(-c2ncccn2)cc1OCCO | 10.1021/acs.jmedchem.5b00258 | ||
CHEMBL3633040 | 124068 | 0 | None | - | 1 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 619 | 11 | 2 | 8 | 6.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(S(F)(F)(F)(F)F)cc2)cc(-c2ncccn2)cc1OCCO | 10.1021/acs.jmedchem.5b00258 | ||
11387205 | 111534 | 0 | None | -1 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 544 | 8 | 2 | 7 | 4.5 | COc1ccc(CN2C(=O)CN[C@](C3CCCCC3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL328073 | 111534 | 0 | None | -1 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 544 | 8 | 2 | 7 | 4.5 | COc1ccc(CN2C(=O)CN[C@](C3CCCCC3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL62302 | 215820 | 0 | None | - | 1 | Pig | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
10342643 | 5125 | 0 | None | 144 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm00008a002 | ||
CHEMBL10588 | 5125 | 0 | None | 144 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm00008a002 | ||
10342643 | 5125 | 0 | None | 144 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm00008a002 | ||
CHEMBL10588 | 5125 | 0 | None | 144 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm00008a002 | ||
10224745 | 112663 | 0 | None | 15 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 432 | 5 | 2 | 6 | 2.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL330425 | 112663 | 0 | None | 15 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 432 | 5 | 2 | 6 | 2.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1021/jm031115r | ||
9865706 | 98106 | 0 | None | 1 | 2 | Human | 5.9 | pIC50 | = | 5.9 | Functional | ChEMBL | 400 | 4 | 1 | 5 | 4.1 | Cc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL273613 | 98106 | 0 | None | 1 | 2 | Human | 5.9 | pIC50 | = | 5.9 | Functional | ChEMBL | 400 | 4 | 1 | 5 | 4.1 | Cc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
10452089 | 4533 | 0 | None | - | 1 | Human | 4.9 | pIC50 | = | 4.9 | Functional | ChEMBL | 375 | 3 | 0 | 5 | 4.1 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2c(nc3ccccc13)CCCC2 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL102494 | 4533 | 0 | None | - | 1 | Human | 4.9 | pIC50 | = | 4.9 | Functional | ChEMBL | 375 | 3 | 0 | 5 | 4.1 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2c(nc3ccccc13)CCCC2 | 10.1016/S0960-894X(96)00551-3 | ||
11432855 | 207831 | 0 | None | 28 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 552 | 8 | 3 | 7 | 3.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(C(=O)O)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96463 | 207831 | 0 | None | 28 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 552 | 8 | 3 | 7 | 3.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(C(=O)O)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11318559 | 207779 | 0 | None | 5 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 531 | 8 | 2 | 8 | 2.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCN3CCOCC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96193 | 207779 | 0 | None | 5 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 531 | 8 | 2 | 8 | 2.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCN3CCOCC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11238540 | 207502 | 0 | None | 11 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 576 | 8 | 2 | 5 | 5.9 | COc1cccc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL94602 | 207502 | 0 | None | 11 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 576 | 8 | 2 | 5 | 5.9 | COc1cccc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
10140418 | 106174 | 0 | None | 43 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 476 | 7 | 3 | 7 | 1.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CC(=O)O)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL313867 | 106174 | 0 | None | 43 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 476 | 7 | 3 | 7 | 1.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CC(=O)O)c3ccccc32)n1 | 10.1021/jm031115r | ||
11308052 | 112638 | 0 | None | 2 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 618 | 10 | 2 | 6 | 5.8 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL330354 | 112638 | 0 | None | 2 | 2 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | 618 | 10 | 2 | 6 | 5.8 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)c1 | 10.1021/jm031115r | ||
122194934 | 124067 | 0 | None | - | 1 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 561 | 10 | 2 | 8 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc(-c2ncccn2)cc1OCCO | 10.1021/acs.jmedchem.5b00258 | ||
CHEMBL3633039 | 124067 | 0 | None | - | 1 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 561 | 10 | 2 | 8 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc(-c2ncccn2)cc1OCCO | 10.1021/acs.jmedchem.5b00258 | ||
CHEMBL97470 | 215902 | 0 | None | -1 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL3143473 | 211311 | 0 | None | -1071 | 2 | Human | 5.9 | pIC50 | = | 5.9 | Functional | ChEMBL | None | None | None | CCCC[C@@H](NC(=O)[C@@H](Cc1cn(COC)c2ccccc12)NC(=O)[C@H](CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00084-7 | ||||
CHEMBL3305972 | 211311 | 0 | None | -1071 | 2 | Human | 5.9 | pIC50 | = | 5.9 | Functional | ChEMBL | None | None | None | CCCC[C@@H](NC(=O)[C@@H](Cc1cn(COC)c2ccccc12)NC(=O)[C@H](CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00084-7 | ||||
345351 | 9327 | 4 | None | 24 | 3 | Human | 5.9 | pIC50 | = | 5.9 | Functional | ChEMBL | 386 | 4 | 1 | 5 | 3.8 | O=C1OC(O)(c2ccccc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL11131 | 9327 | 4 | None | 24 | 3 | Human | 5.9 | pIC50 | = | 5.9 | Functional | ChEMBL | 386 | 4 | 1 | 5 | 3.8 | O=C1OC(O)(c2ccccc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
44332623 | 4734 | 1 | None | - | 1 | Human | 4.9 | pIC50 | = | 4.9 | Functional | ChEMBL | 320 | 3 | 1 | 4 | 2.9 | Cc1cc(C(C(N)=O)c2ccc3c(c2)OCO3)c2ccccc2n1 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103886 | 4734 | 1 | None | - | 1 | Human | 4.9 | pIC50 | = | 4.9 | Functional | ChEMBL | 320 | 3 | 1 | 4 | 2.9 | Cc1cc(C(C(N)=O)c2ccc3c(c2)OCO3)c2ccccc2n1 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL405599 | 212545 | 0 | None | 1 | 3 | Human | 7.9 | pIC50 | = | 7.9 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
11744509 | 5398 | 0 | None | 5 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 450 | 5 | 1 | 6 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10733 | 5398 | 0 | None | 5 | 2 | Human | 6.9 | pIC50 | = | 6.9 | Functional | ChEMBL | 450 | 5 | 1 | 6 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)cc2)cc1 | 10.1021/jm00008a002 | ||
11386977 | 207524 | 0 | None | 1 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | 528 | 8 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCC3CCCCC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94752 | 207524 | 0 | None | 1 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | 528 | 8 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCC3CCCCC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11226767 | 207503 | 0 | None | 6 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | 560 | 7 | 2 | 4 | 6.2 | Cc1ccc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL94606 | 207503 | 0 | None | 6 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | 560 | 7 | 2 | 4 | 6.2 | Cc1ccc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11452452 | 207179 | 0 | None | - | 1 | Human | 5.8 | pIC50 | = | 5.8 | Functional | ChEMBL | 404 | 5 | 2 | 6 | 1.8 | CN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2ncccn2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL92612 | 207179 | 0 | None | - | 1 | Human | 5.8 | pIC50 | = | 5.8 | Functional | ChEMBL | 404 | 5 | 2 | 6 | 1.8 | CN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2ncccn2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL284250 | 210837 | 0 | None | -19 | 4 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | None | None | None | CCCC[C@H](NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)[C@@H](NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1016/0960-894X(95)00237-N | ||||
11331242 | 107393 | 0 | None | 1 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 652 | 8 | 2 | 6 | 7.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3cccc(-c4ccccc4)c3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL318086 | 107393 | 0 | None | 1 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 652 | 8 | 2 | 6 | 7.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3cccc(-c4ccccc4)c3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL265116 | 210612 | 0 | None | -3 | 3 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
CHEMBL4533479 | 213963 | 1 | None | -1 | 2 | Human | 5.8 | pIC50 | = | 5.8 | Functional | ChEMBL | None | None | None | CCCOc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(CC)cccc2CC)cc1 | 10.6019/CHEMBL4507261 | ||||
10166981 | 207065 | 0 | None | 2 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(C(F)(F)F)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL91926 | 207065 | 0 | None | 2 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(C(F)(F)F)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11410074 | 207767 | 0 | None | 1 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 536 | 9 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCCc3ccccc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96114 | 207767 | 0 | None | 1 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 536 | 9 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCCc3ccccc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11365059 | 207772 | 0 | None | 1 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 564 | 7 | 2 | 6 | 5.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(C(C)(C)C)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96154 | 207772 | 0 | None | 1 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 564 | 7 | 2 | 6 | 5.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(C(C)(C)C)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
10347783 | 207811 | 0 | None | 32 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 560 | 7 | 2 | 4 | 5.6 | Cc1cc(C)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL96347 | 207811 | 0 | None | 32 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 560 | 7 | 2 | 4 | 5.6 | Cc1cc(C)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)c1 | 10.1021/jm031115r | ||
11753090 | 106176 | 0 | None | 7 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 542 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(Cl)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL313870 | 106176 | 0 | None | 7 | 2 | Human | 7.8 | pIC50 | = | 7.8 | Functional | ChEMBL | 542 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(Cl)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
10412464 | 9105 | 0 | None | 11 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | 470 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2=C(c3ccc(Cl)c(Cl)c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10996 | 9105 | 0 | None | 11 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Functional | ChEMBL | 470 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2=C(c3ccc(Cl)c(Cl)c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
44327656 | 141764 | 0 | None | -1 | 2 | Human | 5.8 | pIC50 | = | 5.8 | Functional | ChEMBL | 977 | 25 | 9 | 8 | 4.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(F)(F)F)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL386181 | 141764 | 0 | None | -1 | 2 | Human | 5.8 | pIC50 | = | 5.8 | Functional | ChEMBL | 977 | 25 | 9 | 8 | 4.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(F)(F)F)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
11330923 | 207799 | 0 | None | -1 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 606 | 10 | 2 | 6 | 6.3 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(C)cc(C)cc3C)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL96303 | 207799 | 0 | None | -1 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 606 | 10 | 2 | 6 | 6.3 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(C)cc(C)cc3C)c3ccccc32)c1 | 10.1021/jm031115r | ||
11226740 | 207879 | 0 | None | 9 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 558 | 7 | 2 | 4 | 6.0 | Cc1cc(C)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL96704 | 207879 | 0 | None | 9 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 558 | 7 | 2 | 4 | 6.0 | Cc1cc(C)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL408574 | 212699 | 0 | None | - | 1 | Pig | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
10410546 | 9380 | 0 | None | 37 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL11162 | 9380 | 0 | None | 37 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL319537 | 211196 | 0 | None | 2 | 2 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL409808 | 212763 | 0 | None | - | 1 | Pig | 8.7 | pIC50 | = | 8.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
10120430 | 207497 | 0 | None | 5 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)ccc(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94580 | 207497 | 0 | None | 5 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)ccc(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
9890440 | 8222 | 0 | None | 301 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(C)c2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10924 | 8222 | 0 | None | 301 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(C)c2)cc1 | 10.1021/jm00008a002 | ||
10166543 | 112335 | 0 | None | 33 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL329477 | 112335 | 0 | None | 33 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
10282008 | 207058 | 0 | None | 12 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 592 | 8 | 2 | 7 | 4.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(OC(F)(F)F)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL91873 | 207058 | 0 | None | 12 | 2 | Human | 8.6 | pIC50 | = | 8.6 | Functional | ChEMBL | 592 | 8 | 2 | 7 | 4.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(OC(F)(F)F)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11224973 | 107423 | 0 | None | 32 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 460 | 7 | 2 | 6 | 2.9 | CCc1cc(CC)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL318270 | 107423 | 0 | None | 32 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 460 | 7 | 2 | 6 | 2.9 | CCc1cc(CC)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1021/jm031115r | ||
11169125 | 207536 | 0 | None | 5 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 574 | 7 | 2 | 4 | 6.5 | Cc1cc(C)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL94802 | 207536 | 0 | None | 5 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 574 | 7 | 2 | 4 | 6.5 | Cc1cc(C)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL263295 | 210542 | 0 | None | -1 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
10024044 | 7807 | 0 | None | - | 1 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(CC2=C(c3ccccc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10897 | 7807 | 0 | None | - | 1 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(CC2=C(c3ccccc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
44332577 | 4674 | 0 | None | - | 1 | Human | 4.7 | pIC50 | = | 4.7 | Functional | ChEMBL | 341 | 3 | 0 | 4 | 4.4 | O=CC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103484 | 4674 | 0 | None | - | 1 | Human | 4.7 | pIC50 | = | 4.7 | Functional | ChEMBL | 341 | 3 | 0 | 4 | 4.4 | O=CC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL2373086 | 210349 | 0 | None | - | 1 | Pig | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)[C@@H](C)CC)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
3951 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1021/jm031115r | ||
4337 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1021/jm031115r | ||
6918493 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1021/jm031115r | ||
CHEMBL1111 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1021/jm031115r | ||
DB06403 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1021/jm031115r | ||
CHEMBL317099 | 211175 | 0 | None | -69 | 2 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL96822 | 215897 | 0 | None | -1 | 2 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NS(C)(=O)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
11786120 | 169144 | 0 | None | 17 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | 546 | 7 | 2 | 4 | 5.9 | O=C(O)[C@@H](Oc1ccccc1)[C@@]1(c2ccccc2)NCC(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL440507 | 169144 | 0 | None | 17 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | 546 | 7 | 2 | 4 | 5.9 | O=C(O)[C@@H](Oc1ccccc1)[C@@]1(c2ccccc2)NCC(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 | 10.1021/jm031115r | ||
70692693 | 76186 | 0 | None | -1 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 500 | 8 | 1 | 6 | 6.1 | CCCc1nc2ccccc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058369 | 76186 | 0 | None | -1 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | ChEMBL | 500 | 8 | 1 | 6 | 6.1 | CCCc1nc2ccccc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
10385531 | 112655 | 0 | None | - | 1 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 387 | 4 | 0 | 6 | 4.4 | COC(=O)C(Oc1c2ccccc2nc2ccccc12)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL330414 | 112655 | 0 | None | - | 1 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 387 | 4 | 0 | 6 | 4.4 | COC(=O)C(Oc1c2ccccc2nc2ccccc12)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00551-3 | ||
10024044 | 7807 | 0 | None | - | 1 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(CC2=C(c3ccccc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10897 | 7807 | 0 | None | - | 1 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(CC2=C(c3ccccc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
10070783 | 97027 | 0 | None | 3 | 3 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL267094 | 97027 | 0 | None | 3 | 3 | Human | 5.7 | pIC50 | = | 5.7 | Functional | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
11387315 | 207411 | 0 | None | -1 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | 552 | 8 | 2 | 7 | 4.3 | COc1ccc(CN2C(=O)CN[C@](c3ccc(C)cc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL94091 | 207411 | 0 | None | -1 | 2 | Human | 6.7 | pIC50 | = | 6.7 | Functional | ChEMBL | 552 | 8 | 2 | 7 | 4.3 | COc1ccc(CN2C(=O)CN[C@](c3ccc(C)cc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11408654 | 207913 | 0 | None | 19 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 464 | 7 | 2 | 8 | 1.8 | COc1cc(OC)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96906 | 207913 | 0 | None | 19 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 464 | 7 | 2 | 8 | 1.8 | COc1cc(OC)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1021/jm031115r | ||
11409474 | 207537 | 0 | None | 1 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 502 | 10 | 2 | 6 | 4.4 | CCCCCCN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2nc(C)cc(C)n2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL94810 | 207537 | 0 | None | 1 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 502 | 10 | 2 | 6 | 4.4 | CCCCCCN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2nc(C)cc(C)n2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
44327659 | 109795 | 0 | None | -1 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | 937 | 26 | 9 | 8 | 4.6 | CCC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)C(c1ccccc1)c1ccccc1 | 10.1021/jm00015a003 | ||
CHEMBL323331 | 109795 | 0 | None | -1 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | 937 | 26 | 9 | 8 | 4.6 | CCC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)C(c1ccccc1)c1ccccc1 | 10.1021/jm00015a003 | ||
CHEMBL263186 | 210539 | 0 | None | - | 1 | Pig | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
9896251 | 98745 | 0 | None | -1 | 3 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 682 | 12 | 1 | 9 | 7.1 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL278176 | 98745 | 0 | None | -1 | 3 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 682 | 12 | 1 | 9 | 7.1 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/j.bmc.2012.06.011 | ||
11467573 | 107213 | 0 | None | 9 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 606 | 8 | 2 | 7 | 5.0 | COc1ccc(CN2C(=O)CN[C@](c3cccc(C(F)(F)F)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL316851 | 107213 | 0 | None | 9 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 606 | 8 | 2 | 7 | 5.0 | COc1ccc(CN2C(=O)CN[C@](c3cccc(C(F)(F)F)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11238500 | 207801 | 0 | None | 3 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 572 | 8 | 2 | 7 | 4.7 | COc1ccc(CN2C(=O)CN[C@](c3cccc(Cl)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL96313 | 207801 | 0 | None | 3 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 572 | 8 | 2 | 7 | 4.7 | COc1ccc(CN2C(=O)CN[C@](c3cccc(Cl)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11753582 | 207565 | 0 | None | 4 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 586 | 7 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(Br)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94962 | 207565 | 0 | None | 4 | 2 | Human | 7.6 | pIC50 | = | 7.6 | Functional | ChEMBL | 586 | 7 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(Br)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11397857 | 207768 | 0 | None | 6 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | 496 | 7 | 2 | 6 | 3.7 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccc(Cl)cc32)c1 | 10.1021/jm031115r | ||
CHEMBL96125 | 207768 | 0 | None | 6 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | 496 | 7 | 2 | 6 | 3.7 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccc(Cl)cc32)c1 | 10.1021/jm031115r | ||
11489946 | 207324 | 0 | None | 2 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | 566 | 8 | 2 | 7 | 4.6 | COc1ccc(CN2C(=O)CN[C@](c3cc(C)cc(C)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL93612 | 207324 | 0 | None | 2 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | 566 | 8 | 2 | 7 | 4.6 | COc1ccc(CN2C(=O)CN[C@](c3cc(C)cc(C)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL433406 | 213617 | 0 | None | -9 | 2 | Human | 6.6 | pIC50 | = | 6.6 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)NC)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
44332803 | 4675 | 0 | None | - | 1 | Human | 5.6 | pIC50 | = | 5.6 | Functional | ChEMBL | 335 | 3 | 0 | 5 | 3.6 | COC(=O)C(c1ccc2c(c1)OCO2)c1cc(C)nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103497 | 4675 | 0 | None | - | 1 | Human | 5.6 | pIC50 | = | 5.6 | Functional | ChEMBL | 335 | 3 | 0 | 5 | 3.6 | COC(=O)C(c1ccc2c(c1)OCO2)c1cc(C)nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
9820754 | 108535 | 0 | None | - | 1 | Human | 5.6 | pIC50 | = | 5.6 | Functional | ChEMBL | 371 | 3 | 0 | 5 | 4.4 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL320236 | 108535 | 0 | None | - | 1 | Human | 5.6 | pIC50 | = | 5.6 | Functional | ChEMBL | 371 | 3 | 0 | 5 | 4.4 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
11410410 | 207527 | 0 | None | 25 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 560 | 7 | 2 | 4 | 6.2 | Cc1cccc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL94769 | 207527 | 0 | None | 25 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 560 | 7 | 2 | 4 | 6.2 | Cc1cccc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL319660 | 211197 | 0 | None | 2 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
CHEMBL410694 | 212811 | 0 | None | - | 1 | Pig | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL411965 | 212943 | 0 | None | - | 1 | Pig | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
11387934 | 107150 | 0 | None | 28 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 614 | 9 | 2 | 7 | 5.7 | COc1ccc(CN2C(=O)CN[C@](c3cccc(-c4ccccc4)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL316453 | 107150 | 0 | None | 28 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 614 | 9 | 2 | 7 | 5.7 | COc1ccc(CN2C(=O)CN[C@](c3cccc(-c4ccccc4)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11353580 | 207915 | 0 | None | 21 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 566 | 9 | 2 | 7 | 4.6 | CCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3ccc(OC)cc3)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL96932 | 207915 | 0 | None | 21 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 566 | 9 | 2 | 7 | 4.6 | CCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3ccc(OC)cc3)c3ccccc32)c1 | 10.1021/jm031115r | ||
10303258 | 161851 | 0 | None | 3 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 564 | 10 | 2 | 6 | 5.3 | CCCCc1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL415010 | 161851 | 0 | None | 3 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 564 | 10 | 2 | 6 | 5.3 | CCCCc1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11168474 | 207882 | 0 | None | 9 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 526 | 7 | 2 | 6 | 4.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96723 | 207882 | 0 | None | 9 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | ChEMBL | 526 | 7 | 2 | 6 | 4.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
11421392 | 207362 | 0 | None | 5 | 2 | Human | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL93820 | 207362 | 0 | None | 5 | 2 | Human | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
11489318 | 207776 | 0 | None | 5 | 2 | Human | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | 522 | 8 | 2 | 6 | 4.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCc3ccccc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96171 | 207776 | 0 | None | 5 | 2 | Human | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | 522 | 8 | 2 | 6 | 4.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCc3ccccc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94983 | 215893 | 0 | None | 7 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
11398818 | 167907 | 0 | None | 2 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 556 | 8 | 2 | 7 | 4.2 | COc1ccc(CN2C(=O)CN[C@](c3ccccc3F)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL431460 | 167907 | 0 | None | 2 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 556 | 8 | 2 | 7 | 4.2 | COc1ccc(CN2C(=O)CN[C@](c3ccccc3F)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11156692 | 167852 | 0 | None | 2 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 522 | 7 | 2 | 6 | 4.3 | Cc1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL431087 | 167852 | 0 | None | 2 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 522 | 7 | 2 | 6 | 4.3 | Cc1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
10412464 | 9105 | 0 | None | 11 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | 470 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2=C(c3ccc(Cl)c(Cl)c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10996 | 9105 | 0 | None | 11 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | 470 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2=C(c3ccc(Cl)c(Cl)c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
10410546 | 9380 | 0 | None | 37 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL11162 | 9380 | 0 | None | 37 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
15289330 | 99774 | 0 | None | 18 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 493 | 8 | 1 | 8 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL285368 | 99774 | 0 | None | 18 | 2 | Human | 7.5 | pIC50 | = | 7.5 | Functional | ChEMBL | 493 | 8 | 1 | 8 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL97431 | 215901 | 0 | None | 2 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
18995989 | 100527 | 0 | None | -2 | 2 | Human | 5.5 | pIC50 | = | 5.5 | Functional | ChEMBL | 583 | 9 | 1 | 9 | 6.6 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OCc1ccccc1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL29147 | 100527 | 0 | None | -2 | 2 | Human | 5.5 | pIC50 | = | 5.5 | Functional | ChEMBL | 583 | 9 | 1 | 9 | 6.6 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OCc1ccccc1 | 10.1016/0960-894X(96)00232-6 | ||
11307120 | 112377 | 0 | None | -4 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | 532 | 11 | 2 | 7 | 4.5 | CCCCC[C@]1([C@H](Oc2nc(C)cc(C)n2)C(=O)O)NCC(=O)N(Cc2ccc(OC)cc2)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL329744 | 112377 | 0 | None | -4 | 2 | Human | 6.5 | pIC50 | = | 6.5 | Functional | ChEMBL | 532 | 11 | 2 | 7 | 4.5 | CCCCC[C@]1([C@H](Oc2nc(C)cc(C)n2)C(=O)O)NCC(=O)N(Cc2ccc(OC)cc2)c2ccccc21 | 10.1021/jm031115r | ||
1009 | 194 | 25 | None | -1621 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.6019/CHEMBL4507261 | ||
5310991 | 194 | 25 | None | -1621 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.6019/CHEMBL4507261 | ||
CHEMBL332794 | 194 | 25 | None | -1621 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.6019/CHEMBL4507261 | ||
11362537 | 107494 | 0 | None | 24 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 434 | 6 | 2 | 7 | 1.8 | COc1cnc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)nc1 | 10.1021/jm031115r | ||
CHEMBL318683 | 107494 | 0 | None | 24 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 434 | 6 | 2 | 7 | 1.8 | COc1cnc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)nc1 | 10.1021/jm031115r | ||
11167889 | 207812 | 0 | None | 1 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 496 | 7 | 2 | 6 | 3.7 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3cc(Cl)ccc32)c1 | 10.1021/jm031115r | ||
CHEMBL96351 | 207812 | 0 | None | 1 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 496 | 7 | 2 | 6 | 3.7 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3cc(Cl)ccc32)c1 | 10.1021/jm031115r | ||
11752174 | 172701 | 0 | None | 4 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 489 | 8 | 2 | 7 | 2.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCN(C)C)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL450628 | 172701 | 0 | None | 4 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 489 | 8 | 2 | 7 | 2.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCN(C)C)c3ccccc32)n1 | 10.1021/jm031115r | ||
70686381 | 76185 | 0 | None | -1 | 2 | Human | 7.4 | pIC50 | = | 7.4 | Functional | ChEMBL | 486 | 7 | 1 | 6 | 5.7 | CCc1nc2ccccc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058368 | 76185 | 0 | None | -1 | 2 | Human | 7.4 | pIC50 | = | 7.4 | Functional | ChEMBL | 486 | 7 | 1 | 6 | 5.7 | CCc1nc2ccccc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
11785180 | 111481 | 0 | None | 1 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 492 | 8 | 2 | 7 | 3.1 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3cc(OC)ccc32)c1 | 10.1021/jm031115r | ||
CHEMBL327823 | 111481 | 0 | None | 1 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | 492 | 8 | 2 | 7 | 3.1 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3cc(OC)ccc32)c1 | 10.1021/jm031115r | ||
CHEMBL1790448 | 208865 | 0 | None | - | 1 | Pig | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)[C@H](C)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL293029 | 210865 | 0 | None | - | 1 | Pig | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL410869 | 212824 | 0 | None | - | 1 | Pig | 8.4 | pIC50 | = | 8.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
10230546 | 107220 | 0 | None | 4 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 538 | 8 | 2 | 7 | 4.0 | COc1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL316878 | 107220 | 0 | None | 4 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 538 | 8 | 2 | 7 | 4.0 | COc1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
9807691 | 100036 | 0 | None | 134 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 553 | 10 | 1 | 10 | 5.3 | COc1cc2c(Sc3cc(OC)c(OC)c(OC)c3)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL287169 | 100036 | 0 | None | 134 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 553 | 10 | 1 | 10 | 5.3 | COc1cc2c(Sc3cc(OC)c(OC)c(OC)c3)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
44304492 | 96531 | 0 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL262993 | 96531 | 0 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
10027018 | 98461 | 0 | None | - | 1 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 454 | 4 | 1 | 5 | 5.1 | O=C1OC(O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL275991 | 98461 | 0 | None | - | 1 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 454 | 4 | 1 | 5 | 5.1 | O=C1OC(O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL94907 | 215891 | 0 | None | 1 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
10070783 | 97027 | 0 | None | 3 | 3 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL267094 | 97027 | 0 | None | 3 | 3 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL2370255 | 209796 | 0 | None | -13 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL433349 | 213614 | 0 | None | -1 | 3 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL2370254 | 209795 | 0 | None | 2 | 2 | Human | 5.4 | pIC50 | = | 5.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
11168401 | 112277 | 0 | None | 18 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 522 | 9 | 2 | 8 | 3.1 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3cc(OC)c(OC)cc32)c1 | 10.1021/jm031115r | ||
CHEMBL329132 | 112277 | 0 | None | 18 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | 522 | 9 | 2 | 8 | 3.1 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3cc(OC)c(OC)cc32)c1 | 10.1021/jm031115r | ||
11156376 | 112639 | 0 | None | 5 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 504 | 9 | 3 | 7 | 2.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCCC(=O)O)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL330359 | 112639 | 0 | None | 5 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 504 | 9 | 3 | 7 | 2.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCCC(=O)O)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL318020 | 211186 | 0 | None | 8 | 2 | Human | 6.4 | pIC50 | = | 6.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
11330927 | 207484 | 0 | None | 8 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 606 | 9 | 2 | 6 | 5.9 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL94488 | 207484 | 0 | None | 8 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 606 | 9 | 2 | 6 | 5.9 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(Cl)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
10385531 | 112655 | 0 | None | - | 1 | Human | 5.3 | pIC50 | = | 5.3 | Functional | ChEMBL | 387 | 4 | 0 | 6 | 4.4 | COC(=O)C(Oc1c2ccccc2nc2ccccc12)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL330414 | 112655 | 0 | None | - | 1 | Human | 5.3 | pIC50 | = | 5.3 | Functional | ChEMBL | 387 | 4 | 0 | 6 | 4.4 | COC(=O)C(Oc1c2ccccc2nc2ccccc12)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00551-3 | ||
9865706 | 98106 | 0 | None | 1 | 2 | Human | 5.3 | pIC50 | = | 5.3 | Functional | ChEMBL | 400 | 4 | 1 | 5 | 4.1 | Cc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL273613 | 98106 | 0 | None | 1 | 2 | Human | 5.3 | pIC50 | = | 5.3 | Functional | ChEMBL | 400 | 4 | 1 | 5 | 4.1 | Cc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL264330 | 210589 | 0 | None | - | 1 | Pig | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(C)(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL386850 | 212374 | 0 | None | - | 1 | Pig | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(C)(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
11318409 | 207432 | 0 | None | 3 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 522 | 7 | 2 | 6 | 4.3 | Cc1cccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL94212 | 207432 | 0 | None | 3 | 2 | Human | 8.3 | pIC50 | = | 8.3 | Functional | ChEMBL | 522 | 7 | 2 | 6 | 4.3 | Cc1cccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)c1 | 10.1021/jm031115r | ||
10187261 | 111513 | 0 | None | 3 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 542 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(Cl)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL327976 | 111513 | 0 | None | 3 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 542 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(Cl)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11785813 | 106895 | 0 | None | 8 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 526 | 7 | 2 | 6 | 4.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL314755 | 106895 | 0 | None | 8 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 526 | 7 | 2 | 6 | 4.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)cc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL408616 | 212701 | 0 | None | - | 1 | Pig | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
9845562 | 4709 | 0 | None | 7 | 3 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(C)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10374 | 4709 | 0 | None | 7 | 3 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(C)cc2)cc1 | 10.1021/jm00008a002 | ||
11742628 | 98207 | 0 | None | 25 | 3 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL274383 | 98207 | 0 | None | 25 | 3 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
9845562 | 4709 | 0 | None | 7 | 3 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(C)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10374 | 4709 | 0 | None | 7 | 3 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(C)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL411797 | 212934 | 0 | None | 1 | 2 | Human | 6.3 | pIC50 | = | 6.3 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10226239 | 207865 | 0 | None | 4 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 456 | 5 | 2 | 8 | 2.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCc3nnc(C)n3-c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96614 | 207865 | 0 | None | 4 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | ChEMBL | 456 | 5 | 2 | 8 | 2.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCc3nnc(C)n3-c3ccccc32)n1 | 10.1021/jm031115r | ||
10027018 | 98461 | 0 | None | - | 1 | Human | 6.3 | pIC50 | = | 6.3 | Functional | ChEMBL | 454 | 4 | 1 | 5 | 5.1 | O=C1OC(O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL275991 | 98461 | 0 | None | - | 1 | Human | 6.3 | pIC50 | = | 6.3 | Functional | ChEMBL | 454 | 4 | 1 | 5 | 5.1 | O=C1OC(O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
44332578 | 4284 | 0 | None | - | 1 | Human | 5.3 | pIC50 | = | 5.3 | Functional | ChEMBL | 413 | 3 | 0 | 5 | 5.6 | CC(C)(C)OC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100874 | 4284 | 0 | None | - | 1 | Human | 5.3 | pIC50 | = | 5.3 | Functional | ChEMBL | 413 | 3 | 0 | 5 | 5.6 | CC(C)(C)OC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
122272 | 97068 | 31 | None | -4 | 4 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL267458 | 97068 | 31 | None | -4 | 4 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
10047521 | 8598 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 416 | 6 | 1 | 5 | 4.4 | COc1ccc(CC2=C(c3ccc(C)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10951 | 8598 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 416 | 6 | 1 | 5 | 4.4 | COc1ccc(CC2=C(c3ccc(C)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
11156301 | 78635 | 0 | None | 4 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 500 | 7 | 3 | 9 | 2.2 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCc3nnc(CC(=O)O)n3-c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL2112377 | 78635 | 0 | None | 4 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 500 | 7 | 3 | 9 | 2.2 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCc3nnc(CC(=O)O)n3-c3ccccc32)n1 | 10.1021/jm031115r | ||
9820754 | 108535 | 0 | None | - | 1 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 371 | 3 | 0 | 5 | 4.4 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL320236 | 108535 | 0 | None | - | 1 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 371 | 3 | 0 | 5 | 4.4 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
11203972 | 106850 | 0 | None | - | 1 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 576 | 8 | 2 | 5 | 5.9 | COc1ccccc1O[C@H](C(=O)O)[C@@]1(c2ccccc2)NCC(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL314511 | 106850 | 0 | None | - | 1 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 576 | 8 | 2 | 5 | 5.9 | COc1ccccc1O[C@H](C(=O)O)[C@@]1(c2ccccc2)NCC(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL2373085 | 210348 | 0 | None | - | 1 | Pig | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL433837 | 213622 | 0 | None | - | 1 | Pig | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL62641 | 215823 | 0 | None | - | 1 | Pig | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
10187313 | 107417 | 0 | None | 18 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL318247 | 107417 | 0 | None | 18 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
9890440 | 8222 | 0 | None | 301 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(C)c2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10924 | 8222 | 0 | None | 301 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(C)c2)cc1 | 10.1021/jm00008a002 | ||
11284285 | 107302 | 0 | None | 8 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 552 | 8 | 2 | 7 | 4.3 | COc1ccc(CN2C(=O)CN[C@](c3cccc(C)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL317510 | 107302 | 0 | None | 8 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 552 | 8 | 2 | 7 | 4.3 | COc1ccc(CN2C(=O)CN[C@](c3cccc(C)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11307805 | 107314 | 0 | None | 3 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 586 | 7 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(Br)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL317589 | 107314 | 0 | None | 3 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 586 | 7 | 2 | 6 | 4.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(Br)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11283571 | 207575 | 0 | None | 7 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 508 | 7 | 2 | 6 | 4.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL95013 | 207575 | 0 | None | 7 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 508 | 7 | 2 | 6 | 4.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11364770 | 163632 | 0 | None | 5 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)c(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL420435 | 163632 | 0 | None | 5 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)c(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
10209814 | 207248 | 0 | None | 7 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)c(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL93084 | 207248 | 0 | None | 7 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccc(F)c(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
10163956 | 207566 | 0 | None | 10 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 500 | 7 | 3 | 9 | 1.5 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3nn[nH]n3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94964 | 207566 | 0 | None | 10 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 500 | 7 | 3 | 9 | 1.5 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3nn[nH]n3)c3ccccc32)n1 | 10.1021/jm031115r | ||
10166139 | 163320 | 0 | None | 2 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 550 | 7 | 2 | 6 | 4.9 | Cc1cc(C)c(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)c(C)c1 | 10.1021/jm031115r | ||
CHEMBL419136 | 163320 | 0 | None | 2 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 550 | 7 | 2 | 6 | 4.9 | Cc1cc(C)c(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)c(C)c1 | 10.1021/jm031115r | ||
11191999 | 207476 | 0 | None | 4 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)ccc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL94438 | 207476 | 0 | None | 4 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)ccc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
11375934 | 207890 | 0 | None | 3 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 526 | 7 | 2 | 6 | 4.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96746 | 207890 | 0 | None | 3 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 526 | 7 | 2 | 6 | 4.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11478911 | 156286 | 0 | None | 4 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 598 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)c(F)c(F)c(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL406551 | 156286 | 0 | None | 4 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 598 | 7 | 2 | 6 | 4.7 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3c(F)c(F)c(F)c(F)c3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
10298354 | 111979 | 0 | None | 15 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 462 | 7 | 3 | 7 | 1.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCO)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL328878 | 111979 | 0 | None | 15 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Functional | ChEMBL | 462 | 7 | 3 | 7 | 1.8 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CCO)c3ccccc32)n1 | 10.1021/jm031115r | ||
345351 | 9327 | 4 | None | 24 | 3 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 386 | 4 | 1 | 5 | 3.8 | O=C1OC(O)(c2ccccc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL11131 | 9327 | 4 | None | 24 | 3 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 386 | 4 | 1 | 5 | 3.8 | O=C1OC(O)(c2ccccc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm00008a002 | ||
CHEMBL329609 | 211295 | 0 | None | 3 | 2 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(N)=O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
11202819 | 112537 | 0 | None | 1 | 2 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 499 | 6 | 3 | 8 | 3.2 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCc3c(C(=O)O)nc(C)n3-c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL330045 | 112537 | 0 | None | 1 | 2 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 499 | 6 | 3 | 8 | 3.2 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCc3c(C(=O)O)nc(C)n3-c3ccccc32)n1 | 10.1021/jm031115r | ||
11385689 | 112769 | 0 | None | 10 | 2 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 462 | 7 | 2 | 6 | 3.0 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL330629 | 112769 | 0 | None | 10 | 2 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 462 | 7 | 2 | 6 | 3.0 | COc1cc(OC)cc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)c1 | 10.1021/jm031115r | ||
44283270 | 167857 | 0 | None | -2691 | 4 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCC[C@H](NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL431124 | 167857 | 0 | None | -2691 | 4 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCC[C@H](NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
18995991 | 100272 | 0 | None | 9 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 537 | 8 | 1 | 10 | 5.0 | COc1cc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc(OC)c1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28920 | 100272 | 0 | None | 9 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 537 | 8 | 1 | 10 | 5.0 | COc1cc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc(OC)c1OC | 10.1016/0960-894X(96)00232-6 | ||
18995992 | 99810 | 0 | None | 3 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1ccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28563 | 99810 | 0 | None | 3 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1ccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc1OC | 10.1016/0960-894X(96)00232-6 | ||
11465096 | 96736 | 0 | None | - | 1 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 450 | 6 | 2 | 7 | 2.5 | CSc1cnc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)nc1 | 10.1021/jm031115r | ||
CHEMBL264625 | 96736 | 0 | None | - | 1 | Human | 5.2 | pIC50 | = | 5.2 | Functional | ChEMBL | 450 | 6 | 2 | 7 | 2.5 | CSc1cnc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)nc1 | 10.1021/jm031115r | ||
11235126 | 207904 | 0 | None | 52 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 405 | 5 | 2 | 6 | 2.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCCOc3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96831 | 207904 | 0 | None | 52 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | 405 | 5 | 2 | 6 | 2.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCCOc3ccccc32)n1 | 10.1021/jm031115r | ||
11478553 | 163426 | 0 | None | 10 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)c(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL419879 | 163426 | 0 | None | 10 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 562 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)c(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
11330570 | 207561 | 0 | None | 4 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 570 | 8 | 2 | 7 | 4.5 | COc1ccc(CN2C(=O)CN[C@](c3ccc(F)c(C)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL94934 | 207561 | 0 | None | 4 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 570 | 8 | 2 | 7 | 4.5 | COc1ccc(CN2C(=O)CN[C@](c3ccc(F)c(C)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11155687 | 207804 | 0 | None | 12 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 472 | 7 | 2 | 6 | 3.2 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CC3CC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96318 | 207804 | 0 | None | 12 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 472 | 7 | 2 | 6 | 3.2 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CC3CC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
10303311 | 107135 | 0 | None | 9 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 566 | 8 | 2 | 8 | 3.8 | COC(=O)c1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL316301 | 107135 | 0 | None | 9 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 566 | 8 | 2 | 8 | 3.8 | COC(=O)c1ccc(CN2C(=O)CN[C@](c3ccccc3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
11742628 | 98207 | 0 | None | 25 | 3 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL274383 | 98207 | 0 | None | 25 | 3 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm00008a002 | ||
11477664 | 168143 | 0 | None | 6 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 506 | 10 | 2 | 8 | 2.4 | COCCOCN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2nc(C)cc(C)n2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL433173 | 168143 | 0 | None | 6 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 506 | 10 | 2 | 8 | 2.4 | COCCOCN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2nc(C)cc(C)n2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
11204331 | 112552 | 0 | None | -1 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 616 | 10 | 2 | 6 | 6.1 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(F)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL330135 | 112552 | 0 | None | -1 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 616 | 10 | 2 | 6 | 6.1 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(F)cccc3Cl)c3ccccc32)c1 | 10.1021/jm031115r | ||
11377200 | 108271 | 0 | None | 11 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 638 | 8 | 2 | 6 | 6.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3cccc(-c4ccccc4)c3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL319754 | 108271 | 0 | None | 11 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 638 | 8 | 2 | 6 | 6.1 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3cccc(-c4ccccc4)c3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)n1 | 10.1021/jm031115r | ||
11444738 | 164855 | 0 | None | 4 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 594 | 11 | 2 | 7 | 5.4 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3ccc(OC)cc3)c3ccccc32)c1 | 10.1021/jm031115r | ||
CHEMBL422068 | 164855 | 0 | None | 4 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 594 | 11 | 2 | 7 | 5.4 | CCCCc1cccc([C@]2([C@H](Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3ccc(OC)cc3)c3ccccc32)c1 | 10.1021/jm031115r | ||
11398658 | 207576 | 0 | None | 1 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)cc(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL95017 | 207576 | 0 | None | 1 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 544 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cc(F)cc(F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL319719 | 211198 | 0 | None | -3 | 2 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL328942 | 211293 | 0 | None | 1 | 4 | Human | 7.2 | pIC50 | = | 7.2 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
9980487 | 5238 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 436 | 6 | 1 | 5 | 4.8 | COc1ccc(CC2=C(c3ccc(Cl)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10648 | 5238 | 0 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Functional | ChEMBL | 436 | 6 | 1 | 5 | 4.8 | COc1ccc(CC2=C(c3ccc(Cl)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
10452089 | 4533 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 375 | 3 | 0 | 5 | 4.1 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2c(nc3ccccc13)CCCC2 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL102494 | 4533 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 375 | 3 | 0 | 5 | 4.1 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2c(nc3ccccc13)CCCC2 | 10.1016/S0960-894X(96)00551-3 | ||
70694736 | 76184 | 0 | None | -1 | 2 | Human | 7.1 | pIC50 | = | 7.1 | Functional | ChEMBL | 472 | 6 | 1 | 6 | 5.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(Cn3c(C)nc4ccccc43)cc2)c1C | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058367 | 76184 | 0 | None | -1 | 2 | Human | 7.1 | pIC50 | = | 7.1 | Functional | ChEMBL | 472 | 6 | 1 | 6 | 5.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(Cn3c(C)nc4ccccc43)cc2)c1C | 10.1016/j.bmc.2012.06.011 | ||
134136255 | 142569 | 0 | None | - | 1 | Human | 7.1 | pIC50 | = | 7.1 | Functional | ChEMBL | 663 | 11 | 2 | 10 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.ejmech.2016.06.006 | ||
CHEMBL3891334 | 142569 | 0 | None | - | 1 | Human | 7.1 | pIC50 | = | 7.1 | Functional | ChEMBL | 663 | 11 | 2 | 10 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.ejmech.2016.06.006 | ||
10047521 | 8598 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Functional | ChEMBL | 416 | 6 | 1 | 5 | 4.4 | COc1ccc(CC2=C(c3ccc(C)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10951 | 8598 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Functional | ChEMBL | 416 | 6 | 1 | 5 | 4.4 | COc1ccc(CC2=C(c3ccc(C)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
44332807 | 107208 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 447 | 5 | 0 | 5 | 6.0 | O=C(OCc1ccccc1)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL316792 | 107208 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 447 | 5 | 0 | 5 | 6.0 | O=C(OCc1ccccc1)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
44332624 | 4150 | 0 | None | - | 1 | Human | 4.1 | pIC50 | = | 4.1 | Functional | ChEMBL | 356 | 3 | 1 | 4 | 3.7 | NC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100120 | 4150 | 0 | None | - | 1 | Human | 4.1 | pIC50 | = | 4.1 | Functional | ChEMBL | 356 | 3 | 1 | 4 | 3.7 | NC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
10336018 | 102081 | 0 | None | -10 | 2 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 318 | 3 | 2 | 5 | 3.0 | Cc1noc(NS(=O)(=O)c2cccc3c(O)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL30228 | 102081 | 0 | None | -10 | 2 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 318 | 3 | 2 | 5 | 3.0 | Cc1noc(NS(=O)(=O)c2cccc3c(O)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL265614 | 210633 | 19 | None | - | 1 | Pig | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL269189 | 210759 | 0 | None | - | 1 | Pig | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
104865 | 703 | 99 | None | -3 | 5 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2012.06.011 | ||
3494 | 703 | 99 | None | -3 | 5 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2012.06.011 | ||
392 | 703 | 99 | None | -3 | 5 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL957 | 703 | 99 | None | -3 | 5 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2012.06.011 | ||
DB00559 | 703 | 99 | None | -3 | 5 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2012.06.011 | ||
70694737 | 76189 | 0 | None | -1 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 544 | 10 | 1 | 7 | 6.5 | CCCCc1nc2ccc(OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058372 | 76189 | 0 | None | -1 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 544 | 10 | 1 | 7 | 6.5 | CCCCc1nc2ccc(OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
11432418 | 106921 | 0 | None | 6 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 522 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3C)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL314946 | 106921 | 0 | None | 6 | 2 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 522 | 7 | 2 | 6 | 4.3 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3C)c3ccccc32)n1 | 10.1021/jm031115r | ||
44332638 | 4344 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 477 | 6 | 0 | 6 | 6.0 | COc1ccc(COC(=O)C(c2ccc3c(c2)OCO3)c2c3ccccc3nc3ccccc23)cc1 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL101239 | 4344 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 477 | 6 | 0 | 6 | 6.0 | COc1ccc(COC(=O)C(c2ccc3c(c2)OCO3)c2c3ccccc3nc3ccccc23)cc1 | 10.1016/S0960-894X(96)00551-3 | ||
11489174 | 112521 | 0 | None | -1 | 2 | Human | 7.1 | pIC50 | = | 7.1 | Functional | ChEMBL | 514 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CC3CCCCC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL329943 | 112521 | 0 | None | -1 | 2 | Human | 7.1 | pIC50 | = | 7.1 | Functional | ChEMBL | 514 | 7 | 2 | 6 | 4.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(CC3CCCCC3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL216082 | 209294 | 0 | None | -20 | 2 | Human | 6.1 | pIC50 | = | 6.1 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
44332624 | 4150 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 356 | 3 | 1 | 4 | 3.7 | NC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100120 | 4150 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 356 | 3 | 1 | 4 | 3.7 | NC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
44332546 | 107186 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 491 | 5 | 0 | 7 | 5.7 | O=C(OCc1ccc2c(c1)OCO2)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL316648 | 107186 | 0 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Functional | ChEMBL | 491 | 5 | 0 | 7 | 5.7 | O=C(OCc1ccc2c(c1)OCO2)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
9955200 | 9300 | 0 | None | 53 | 3 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL11115 | 9300 | 0 | None | 53 | 3 | Human | 8.1 | pIC50 | = | 8.1 | Functional | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
11376627 | 107605 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(C(F)(F)F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL319007 | 107605 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 576 | 7 | 2 | 6 | 5.0 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3cccc(C(F)(F)F)c3)c3ccccc32)n1 | 10.1021/jm031115r | ||
11307457 | 207588 | 0 | None | 5 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 556 | 8 | 2 | 7 | 4.2 | COc1ccc(CN2C(=O)CN[C@](c3cccc(F)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
CHEMBL95095 | 207588 | 0 | None | 5 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 556 | 8 | 2 | 7 | 4.2 | COc1ccc(CN2C(=O)CN[C@](c3cccc(F)c3)([C@H](Oc3nc(C)cc(C)n3)C(=O)O)c3ccccc32)cc1 | 10.1021/jm031115r | ||
70684239 | 76188 | 0 | None | -1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 528 | 9 | 1 | 6 | 6.8 | CCCCc1nc2ccc(C)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058371 | 76188 | 0 | None | -1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 528 | 9 | 1 | 6 | 6.8 | CCCCc1nc2ccc(C)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
70694738 | 76190 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 548 | 9 | 1 | 6 | 7.2 | CCCCc1nc2ccc(Cl)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058373 | 76190 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 548 | 9 | 1 | 6 | 7.2 | CCCCc1nc2ccc(Cl)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
70686382 | 76187 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 514 | 9 | 1 | 6 | 6.5 | CCCCc1nc2ccccc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058370 | 76187 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 514 | 9 | 1 | 6 | 6.5 | CCCCc1nc2ccccc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
70696780 | 76191 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 592 | 9 | 1 | 6 | 7.3 | CCCCc1nc2ccc(Br)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058374 | 76191 | 0 | None | 1 | 2 | Human | 8.0 | pIC50 | = | 8.0 | Functional | ChEMBL | 592 | 9 | 1 | 6 | 7.3 | CCCCc1nc2ccc(Br)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/j.bmc.2012.06.011 | ||
44213651 | 4267 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Functional | ChEMBL | 343 | 3 | 1 | 4 | 4.2 | OCC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100795 | 4267 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Functional | ChEMBL | 343 | 3 | 1 | 4 | 4.2 | OCC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
11441050 | 207808 | 0 | None | 85 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 403 | 5 | 2 | 5 | 3.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCCCc3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96331 | 207808 | 0 | None | 85 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 403 | 5 | 2 | 5 | 3.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCCCc3ccccc32)n1 | 10.1021/jm031115r | ||
11488556 | 207846 | 0 | None | 10 | 2 | Human | 6.0 | pIC50 | = | 6.0 | Functional | ChEMBL | 482 | 5 | 2 | 6 | 2.6 | CN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2ncc(Br)cn2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
CHEMBL96520 | 207846 | 0 | None | 10 | 2 | Human | 6.0 | pIC50 | = | 6.0 | Functional | ChEMBL | 482 | 5 | 2 | 6 | 2.6 | CN1C(=O)CN[C@](c2ccccc2)([C@H](Oc2ncc(Br)cn2)C(=O)O)c2ccccc21 | 10.1021/jm031115r | ||
9980487 | 5238 | 0 | None | - | 1 | Human | 6.0 | pIC50 | = | 6.0 | Functional | ChEMBL | 436 | 6 | 1 | 5 | 4.8 | COc1ccc(CC2=C(c3ccc(Cl)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
CHEMBL10648 | 5238 | 0 | None | - | 1 | Human | 6.0 | pIC50 | = | 6.0 | Functional | ChEMBL | 436 | 6 | 1 | 5 | 4.8 | COc1ccc(CC2=C(c3ccc(Cl)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm00008a002 | ||
11456110 | 207816 | 0 | None | -1 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 592 | 8 | 2 | 7 | 4.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3OC(F)(F)F)c3ccccc32)n1 | 10.1021/jm031115r | ||
CHEMBL96387 | 207816 | 0 | None | -1 | 2 | Human | 7.0 | pIC50 | = | 7.0 | Functional | ChEMBL | 592 | 8 | 2 | 7 | 4.9 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(Cc3ccccc3OC(F)(F)F)c3ccccc32)n1 | 10.1021/jm031115r | ||
70686380 | 76183 | 0 | None | -1 | 2 | Human | 7.0 | pIC50 | = | 7 | Functional | ChEMBL | 458 | 6 | 1 | 6 | 5.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(Cn3cnc4ccccc43)cc2)c1C | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL2058366 | 76183 | 0 | None | -1 | 2 | Human | 7.0 | pIC50 | = | 7 | Functional | ChEMBL | 458 | 6 | 1 | 6 | 5.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(Cn3cnc4ccccc43)cc2)c1C | 10.1016/j.bmc.2012.06.011 | ||
44311232 | 204084 | 0 | None | - | 2 | Rat | 10.0 | pKd | = | 10 | Functional | ChEMBL | 658 | 13 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70293 | 204084 | 0 | None | - | 2 | Rat | 10.0 | pKd | = | 10 | Functional | ChEMBL | 658 | 13 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
9939238 | 204105 | 0 | None | - | 2 | Rat | 9.7 | pKd | = | 9.7 | Functional | ChEMBL | 637 | 12 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70385 | 204105 | 0 | None | - | 2 | Rat | 9.7 | pKd | = | 9.7 | Functional | ChEMBL | 637 | 12 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
9809919 | 204386 | 0 | None | - | 2 | Rat | 9.3 | pKd | = | 9.3 | Functional | ChEMBL | 665 | 13 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL72037 | 204386 | 0 | None | - | 2 | Rat | 9.3 | pKd | = | 9.3 | Functional | ChEMBL | 665 | 13 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44212539 | 204070 | 0 | None | - | 2 | Rat | 9.0 | pKd | = | 9 | Functional | ChEMBL | 671 | 12 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70203 | 204070 | 0 | None | - | 2 | Rat | 9.0 | pKd | = | 9 | Functional | ChEMBL | 671 | 12 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311233 | 204086 | 0 | None | - | 2 | Rat | 9.0 | pKd | = | 9 | Functional | ChEMBL | 630 | 12 | 2 | 13 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70303 | 204086 | 0 | None | - | 2 | Rat | 9.0 | pKd | = | 9 | Functional | ChEMBL | 630 | 12 | 2 | 13 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311516 | 204095 | 0 | None | - | 2 | Rat | 8.0 | pKd | = | 8 | Functional | ChEMBL | 678 | 12 | 2 | 12 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70339 | 204095 | 0 | None | - | 2 | Rat | 8.0 | pKd | = | 8 | Functional | ChEMBL | 678 | 12 | 2 | 12 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311527 | 204100 | 0 | None | - | 2 | Rat | 8.0 | pKd | = | 8 | Functional | ChEMBL | 675 | 12 | 2 | 11 | 7.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2cccs2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70365 | 204100 | 0 | None | - | 2 | Rat | 8.0 | pKd | = | 8 | Functional | ChEMBL | 675 | 12 | 2 | 11 | 7.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2cccs2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
18184234 | 62179 | 0 | None | - | 2 | Rat | 7.0 | pKd | = | 7.0 | Functional | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL177802 | 62179 | 0 | None | - | 2 | Rat | 7.0 | pKd | = | 7.0 | Functional | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9807456 | 60443 | 0 | None | - | 2 | Rat | 7.0 | pKd | = | 7.0 | Functional | ChEMBL | 545 | 9 | 1 | 9 | 4.8 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175435 | 60443 | 0 | None | - | 2 | Rat | 7.0 | pKd | = | 7.0 | Functional | ChEMBL | 545 | 9 | 1 | 9 | 4.8 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
44311285 | 102272 | 0 | None | - | 2 | Rat | 7.9 | pKd | = | 7.9 | Functional | ChEMBL | 635 | 13 | 2 | 10 | 6.4 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(Oc2ccccc2OC)c(OCCOC(=O)Nc2ccccn2)n1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL303428 | 102272 | 0 | None | - | 2 | Rat | 7.9 | pKd | = | 7.9 | Functional | ChEMBL | 635 | 13 | 2 | 10 | 6.4 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(Oc2ccccc2OC)c(OCCOC(=O)Nc2ccccn2)n1 | 10.1016/S0960-894X(97)00400-9 | ||
9917706 | 129713 | 0 | None | - | 2 | Rat | 6.9 | pKd | = | 6.9 | Functional | ChEMBL | 659 | 15 | 2 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367444 | 129713 | 0 | None | - | 2 | Rat | 6.9 | pKd | = | 6.9 | Functional | ChEMBL | 659 | 15 | 2 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
9869444 | 97217 | 0 | None | 120 | 2 | Human | 6.9 | pKd | = | 6.9 | Functional | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2c1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL268751 | 97217 | 0 | None | 120 | 2 | Human | 6.9 | pKd | = | 6.9 | Functional | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2c1 | 10.1016/0960-894X(96)00170-9 | ||
9848132 | 207554 | 0 | None | 120 | 2 | Rat | 5.9 | pKd | = | 5.9 | Functional | ChEMBL | 483 | 6 | 1 | 8 | 2.8 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94918 | 207554 | 0 | None | 120 | 2 | Rat | 5.9 | pKd | = | 5.9 | Functional | ChEMBL | 483 | 6 | 1 | 8 | 2.8 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
10281606 | 129646 | 0 | None | - | 2 | Rat | 6.8 | pKd | = | 6.8 | Functional | ChEMBL | 575 | 9 | 2 | 10 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367382 | 129646 | 0 | None | - | 2 | Rat | 6.8 | pKd | = | 6.8 | Functional | ChEMBL | 575 | 9 | 2 | 10 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
44311284 | 204222 | 0 | None | - | 2 | Rat | 7.8 | pKd | = | 7.8 | Functional | ChEMBL | 635 | 12 | 2 | 10 | 6.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL71070 | 204222 | 0 | None | - | 2 | Rat | 7.8 | pKd | = | 7.8 | Functional | ChEMBL | 635 | 12 | 2 | 10 | 6.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311346 | 103136 | 0 | None | - | 2 | Rat | 6.8 | pKd | = | 6.8 | Functional | ChEMBL | 681 | 13 | 2 | 13 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCSCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL308088 | 103136 | 0 | None | - | 2 | Rat | 6.8 | pKd | = | 6.8 | Functional | ChEMBL | 681 | 13 | 2 | 13 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCSCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL1790962 | 208887 | 0 | None | -2 | 2 | Pig | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
CHEMBL2373291 | 210351 | 0 | None | -1 | 2 | Pig | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
44311528 | 204119 | 0 | None | - | 2 | Rat | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | 633 | 12 | 2 | 10 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70487 | 204119 | 0 | None | - | 2 | Rat | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | 633 | 12 | 2 | 10 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
10122675 | 98444 | 0 | None | - | 2 | Rat | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | 682 | 12 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL275897 | 98444 | 0 | None | - | 2 | Rat | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | 682 | 12 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10146640 | 207531 | 0 | None | - | 2 | Rat | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | 689 | 12 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL94786 | 207531 | 0 | None | - | 2 | Rat | 7.7 | pKd | = | 7.7 | Functional | ChEMBL | 689 | 12 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10212088 | 96667 | 0 | None | - | 2 | Rat | 6.7 | pKd | = | 6.7 | Functional | ChEMBL | 688 | 12 | 2 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL264035 | 96667 | 0 | None | - | 2 | Rat | 6.7 | pKd | = | 6.7 | Functional | ChEMBL | 688 | 12 | 2 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
10211772 | 56493 | 0 | None | - | 2 | Rat | 6.6 | pKd | = | 6.6 | Functional | ChEMBL | 660 | 11 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL163638 | 56493 | 0 | None | - | 2 | Rat | 6.6 | pKd | = | 6.6 | Functional | ChEMBL | 660 | 11 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
9917072 | 62073 | 0 | None | - | 2 | Rat | 6.6 | pKd | = | 6.6 | Functional | ChEMBL | 619 | 16 | 2 | 10 | 4.6 | CCCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL177538 | 62073 | 0 | None | - | 2 | Rat | 6.6 | pKd | = | 6.6 | Functional | ChEMBL | 619 | 16 | 2 | 10 | 4.6 | CCCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9809270 | 131314 | 0 | None | - | 2 | Rat | 6.6 | pKd | = | 6.6 | Functional | ChEMBL | 622 | 14 | 2 | 12 | 2.3 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368738 | 131314 | 0 | None | - | 2 | Rat | 6.6 | pKd | = | 6.6 | Functional | ChEMBL | 622 | 14 | 2 | 12 | 2.3 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9870830 | 206691 | 38 | None | -1 | 5 | Human | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL8981 | 206691 | 38 | None | -1 | 5 | Human | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
44311283 | 102306 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 649 | 11 | 2 | 10 | 6.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL303649 | 102306 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 649 | 11 | 2 | 10 | 6.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
23670447 | 3007 | 2 | None | 1 | 4 | Human | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(97)10151-2 | ||
999 | 3007 | 2 | None | 1 | 4 | Human | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL1204799 | 3007 | 2 | None | 1 | 4 | Human | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL25438 | 3007 | 2 | None | 1 | 4 | Human | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(97)10151-2 | ||
44386169 | 131363 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 690 | 12 | 2 | 14 | 3.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368996 | 131363 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 690 | 12 | 2 | 14 | 3.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10190108 | 130672 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 681 | 12 | 2 | 12 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368386 | 130672 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 681 | 12 | 2 | 12 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10211781 | 129715 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367453 | 129715 | 0 | None | - | 2 | Rat | 7.6 | pKd | = | 7.6 | Functional | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
18184229 | 59578 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL171950 | 59578 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9894460 | 206686 | 9 | None | -158 | 4 | Rat | 8.5 | pKd | = | 8.5 | Functional | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL313871 | 206686 | 9 | None | -158 | 4 | Rat | 8.5 | pKd | = | 8.5 | Functional | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL8978 | 206686 | 9 | None | -158 | 4 | Rat | 8.5 | pKd | = | 8.5 | Functional | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00617-8 | ||
10311570 | 14598 | 0 | None | - | 2 | Human | 8.5 | pKd | = | 8.5 | Functional | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL1205068 | 14598 | 0 | None | - | 2 | Human | 8.5 | pKd | = | 8.5 | Functional | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL48907 | 14598 | 0 | None | - | 2 | Human | 8.5 | pKd | = | 8.5 | Functional | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
9830495 | 131123 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 618 | 14 | 2 | 9 | 5.0 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368617 | 131123 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 618 | 14 | 2 | 9 | 5.0 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9874557 | 129712 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 667 | 15 | 2 | 10 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367443 | 129712 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 667 | 15 | 2 | 10 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
9864880 | 102361 | 0 | None | - | 1 | Human | 7.5 | pKd | = | 7.5 | Functional | ChEMBL | 384 | 4 | 1 | 6 | 3.7 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc4nsnc4c3)cccc12 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL303902 | 102361 | 0 | None | - | 1 | Human | 7.5 | pKd | = | 7.5 | Functional | ChEMBL | 384 | 4 | 1 | 6 | 3.7 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc4nsnc4c3)cccc12 | 10.1016/s0960-894x(97)10151-2 | ||
9810571 | 61356 | 0 | None | - | 2 | Rat | 5.5 | pKd | = | 5.5 | Functional | ChEMBL | 731 | 18 | 2 | 13 | 5.0 | CCCS(=O)(=O)NCCOc1nc(-c2cc(OC)c(OC)c(OC)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL176997 | 61356 | 0 | None | - | 2 | Rat | 5.5 | pKd | = | 5.5 | Functional | ChEMBL | 731 | 18 | 2 | 13 | 5.0 | CCCS(=O)(=O)NCCOc1nc(-c2cc(OC)c(OC)c(OC)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9873255 | 59604 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 591 | 14 | 2 | 10 | 3.8 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172071 | 59604 | 0 | None | - | 2 | Rat | 6.5 | pKd | = | 6.5 | Functional | ChEMBL | 591 | 14 | 2 | 10 | 3.8 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL2373292 | 210352 | 0 | None | -2 | 2 | Pig | 7.4 | pKd | = | 7.4 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
44298982 | 195597 | 0 | None | - | 0 | Rat | 6.4 | pKd | = | 6.4 | Functional | ChEMBL | 445 | 7 | 1 | 6 | 5.2 | CCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc(OC)cc1 | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL55621 | 195597 | 0 | None | - | 0 | Rat | 6.4 | pKd | = | 6.4 | Functional | ChEMBL | 445 | 7 | 1 | 6 | 5.2 | CCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc(OC)cc1 | 10.1016/S0960-894X(97)00319-3 | ||
10122442 | 130671 | 0 | None | - | 2 | Rat | 6.4 | pKd | = | 6.4 | Functional | ChEMBL | 660 | 14 | 2 | 11 | 5.6 | CCCCNC(=O)OCC#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368383 | 130671 | 0 | None | - | 2 | Rat | 6.4 | pKd | = | 6.4 | Functional | ChEMBL | 660 | 14 | 2 | 11 | 5.6 | CCCCNC(=O)OCC#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
18184194 | 130536 | 0 | None | - | 2 | Rat | 5.3 | pKd | = | 5.3 | Functional | ChEMBL | 712 | 15 | 2 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368107 | 130536 | 0 | None | - | 2 | Rat | 5.3 | pKd | = | 5.3 | Functional | ChEMBL | 712 | 15 | 2 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
44311345 | 204194 | 0 | None | - | 2 | Rat | 8.3 | pKd | = | 8.3 | Functional | ChEMBL | 663 | 13 | 3 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CCNCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70895 | 204194 | 0 | None | - | 2 | Rat | 8.3 | pKd | = | 8.3 | Functional | ChEMBL | 663 | 13 | 3 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CCNCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
104865 | 703 | 99 | None | 1 | 5 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
3494 | 703 | 99 | None | 1 | 5 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
392 | 703 | 99 | None | 1 | 5 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL957 | 703 | 99 | None | 1 | 5 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
DB00559 | 703 | 99 | None | 1 | 5 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
10005597 | 119792 | 0 | None | 1 | 2 | Rat | 6.3 | pKd | = | 6.3 | Functional | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cc(OC)ccc3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL348407 | 119792 | 0 | None | 1 | 2 | Rat | 6.3 | pKd | = | 6.3 | Functional | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cc(OC)ccc3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
10168597 | 61307 | 0 | None | - | 2 | Rat | 6.3 | pKd | = | 6.3 | Functional | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cccnc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176741 | 61307 | 0 | None | - | 2 | Rat | 6.3 | pKd | = | 6.3 | Functional | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cccnc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL411171 | 212844 | 0 | None | -19 | 2 | Pig | 5.3 | pKd | = | 5.3 | Functional | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00077a013 | ||||
10233400 | 128659 | 0 | None | - | 2 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccncc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL366885 | 128659 | 0 | None | - | 2 | Rat | 7.3 | pKd | = | 7.3 | Functional | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccncc1 | 10.1016/s0960-894x(02)01084-3 | ||
10305334 | 129021 | 0 | None | - | 2 | Rat | 6.3 | pKd | = | 6.3 | Functional | ChEMBL | 680 | 12 | 2 | 11 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367036 | 129021 | 0 | None | - | 2 | Rat | 6.3 | pKd | = | 6.3 | Functional | ChEMBL | 680 | 12 | 2 | 11 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
192311 | 107247 | 4 | None | - | 1 | Pig | 7.2 | pKd | = | 7.2 | Functional | ChEMBL | 513 | 11 | 5 | 4 | 2.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31702 | 107247 | 4 | None | - | 1 | Pig | 7.2 | pKd | = | 7.2 | Functional | ChEMBL | 513 | 11 | 5 | 4 | 2.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10457385 | 112661 | 0 | None | 85 | 2 | Rat | 6.2 | pKd | = | 6.2 | Functional | ChEMBL | 469 | 6 | 1 | 8 | 2.5 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL330424 | 112661 | 0 | None | 85 | 2 | Rat | 6.2 | pKd | = | 6.2 | Functional | ChEMBL | 469 | 6 | 1 | 8 | 2.5 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
11755275 | 199986 | 0 | None | -1 | 2 | Rat | 5.2 | pKd | = | 5.2 | Functional | ChEMBL | 489 | 9 | 1 | 7 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)c(=O)n2Cc1cc(OC)ccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL59537 | 199986 | 0 | None | -1 | 2 | Rat | 5.2 | pKd | = | 5.2 | Functional | ChEMBL | 489 | 9 | 1 | 7 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)c(=O)n2Cc1cc(OC)ccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
9831249 | 59667 | 0 | None | - | 2 | Rat | 6.2 | pKd | = | 6.2 | Functional | ChEMBL | 672 | 14 | 2 | 10 | 6.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172297 | 59667 | 0 | None | - | 2 | Rat | 6.2 | pKd | = | 6.2 | Functional | ChEMBL | 672 | 14 | 2 | 10 | 6.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
10146377 | 60384 | 0 | None | - | 2 | Rat | 8.1 | pKd | = | 8.1 | Functional | ChEMBL | 662 | 11 | 2 | 14 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175058 | 60384 | 0 | None | - | 2 | Rat | 8.1 | pKd | = | 8.1 | Functional | ChEMBL | 662 | 11 | 2 | 14 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
44384715 | 60332 | 0 | None | - | 2 | Rat | 7.2 | pKd | = | 7.2 | Functional | ChEMBL | 559 | 9 | 1 | 9 | 5.2 | CC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL174607 | 60332 | 0 | None | - | 2 | Rat | 7.2 | pKd | = | 7.2 | Functional | ChEMBL | 559 | 9 | 1 | 9 | 5.2 | CC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
104865 | 703 | 99 | None | 1 | 5 | Rat | 7.1 | pKd | = | 7.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
3494 | 703 | 99 | None | 1 | 5 | Rat | 7.1 | pKd | = | 7.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
392 | 703 | 99 | None | 1 | 5 | Rat | 7.1 | pKd | = | 7.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL957 | 703 | 99 | None | 1 | 5 | Rat | 7.1 | pKd | = | 7.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
DB00559 | 703 | 99 | None | 1 | 5 | Rat | 7.1 | pKd | = | 7.1 | Functional | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
9853077 | 59597 | 0 | None | - | 2 | Rat | 6.1 | pKd | = | 6.1 | Functional | ChEMBL | 696 | 13 | 2 | 12 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172030 | 59597 | 0 | None | - | 2 | Rat | 6.1 | pKd | = | 6.1 | Functional | ChEMBL | 696 | 13 | 2 | 12 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
9961131 | 132131 | 0 | None | - | 2 | Rat | 6.1 | pKd | = | 6.1 | Functional | ChEMBL | 650 | 15 | 2 | 12 | 3.1 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL369676 | 132131 | 0 | None | - | 2 | Rat | 6.1 | pKd | = | 6.1 | Functional | ChEMBL | 650 | 15 | 2 | 12 | 3.1 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9830773 | 130200 | 0 | None | - | 2 | Rat | 7.0 | pKd | = | 7.0 | Functional | ChEMBL | 636 | 14 | 2 | 12 | 2.8 | CCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367958 | 130200 | 0 | None | - | 2 | Rat | 7.0 | pKd | = | 7.0 | Functional | ChEMBL | 636 | 14 | 2 | 12 | 2.8 | CCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
10096179 | 176996 | 0 | None | - | 0 | Human | 8.7 | pKi | = | 8.7 | Functional | ChEMBL | 468 | 9 | 1 | 5 | 5.7 | CCOc1ccc(-c2cc(C)nc(OC(C(=O)O)C(C)(c3ccccc3)c3ccccc3)n2)cc1 | 10.1016/s0960-894x(03)00236-1 | ||
CHEMBL46311 | 176996 | 0 | None | - | 0 | Human | 8.7 | pKi | = | 8.7 | Functional | ChEMBL | 468 | 9 | 1 | 5 | 5.7 | CCOc1ccc(-c2cc(C)nc(OC(C(=O)O)C(C)(c3ccccc3)c3ccccc3)n2)cc1 | 10.1016/s0960-894x(03)00236-1 | ||
10070 | 448 | 47 | None | 109 | 2 | Human | 6.7 | pA2 | = | 6.7 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
25099191 | 448 | 47 | None | 109 | 2 | Human | 6.7 | pA2 | = | 6.7 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
CHEMBL2165326 | 448 | 47 | None | 109 | 2 | Human | 6.7 | pA2 | = | 6.7 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
DB15059 | 448 | 47 | None | 109 | 2 | Human | 6.7 | pA2 | = | 6.7 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
3951 | 390 | 86 | None | 47 | 2 | Human | 7.1 | pA2 | = | 7.1 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
4337 | 390 | 86 | None | 47 | 2 | Human | 7.1 | pA2 | = | 7.1 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
6918493 | 390 | 86 | None | 47 | 2 | Human | 7.1 | pA2 | = | 7.1 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
CHEMBL1111 | 390 | 86 | None | 47 | 2 | Human | 7.1 | pA2 | = | 7.1 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
DB06403 | 390 | 86 | None | 47 | 2 | Human | 7.1 | pA2 | = | 7.1 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
443289 | 708 | 47 | None | 1 | 4 | Human | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
997 | 708 | 47 | None | 1 | 4 | Human | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
CHEMBL314691 | 708 | 47 | None | 1 | 4 | Human | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
DB12054 | 708 | 47 | None | 1 | 4 | Human | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
104865 | 703 | 99 | None | 1 | 5 | Rat | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 8035319 | ||
3494 | 703 | 99 | None | 1 | 5 | Rat | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 8035319 | ||
392 | 703 | 99 | None | 1 | 5 | Rat | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 8035319 | ||
CHEMBL957 | 703 | 99 | None | 1 | 5 | Rat | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 8035319 | ||
DB00559 | 703 | 99 | None | 1 | 5 | Rat | 7.2 | pA2 | = | 7.2 | Functional | Guide to Pharmacology | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 8035319 | ||
11477084 | 3583 | 53 | None | 58 | 2 | Human | 8.0 | pA2 | = | 8 | Functional | Guide to Pharmacology | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 9171878 | ||
216235 | 3583 | 53 | None | 58 | 2 | Human | 8.0 | pA2 | = | 8 | Functional | Guide to Pharmacology | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 9171878 | ||
3548 | 3583 | 53 | None | 58 | 2 | Human | 8.0 | pA2 | = | 8 | Functional | Guide to Pharmacology | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 9171878 | ||
3950 | 3583 | 53 | None | 58 | 2 | Human | 8.0 | pA2 | = | 8 | Functional | Guide to Pharmacology | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 9171878 | ||
CHEMBL282724 | 3583 | 53 | None | 58 | 2 | Human | 8.0 | pA2 | = | 8 | Functional | Guide to Pharmacology | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 9171878 | ||
DB06268 | 3583 | 53 | None | 58 | 2 | Human | 8.0 | pA2 | = | 8 | Functional | Guide to Pharmacology | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 9171878 | ||
3913 | 3710 | 0 | None | -1 | 2 | Rat | 8.4 | pA2 | = | 8.4 | Functional | Guide to Pharmacology | None | None | None | None | 7780649 | ||||
5311469 | 3710 | 0 | None | -1 | 2 | Rat | 8.4 | pA2 | = | 8.4 | Functional | Guide to Pharmacology | None | None | None | None | 7780649 | ||||
23670447 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10066864 | ||
23670447 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
999 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10066864 | ||
999 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
CHEMBL1204799 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10066864 | ||
CHEMBL1204799 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
CHEMBL25438 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10066864 | ||
CHEMBL25438 | 3007 | 2 | None | 1 | 4 | Human | 8.7 | pA2 | = | 8.7 | Functional | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
159594 | 520 | 45 | None | 2 | 4 | Human | 9.2 | pA2 | = | 9.2 | Functional | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
3487 | 520 | 45 | None | 2 | 4 | Human | 9.2 | pA2 | = | 9.2 | Functional | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
CHEMBL9194 | 520 | 45 | None | 2 | 4 | Human | 9.2 | pA2 | = | 9.2 | Functional | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
DB06199 | 520 | 45 | None | 2 | 4 | Human | 9.2 | pA2 | = | 9.2 | Functional | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
12286 | 945 | 36 | None | 234 | 2 | Human | 9.5 | pA2 | = | 9.5 | Functional | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9399983 | ||
6433095 | 945 | 36 | None | 234 | 2 | Human | 9.5 | pA2 | = | 9.5 | Functional | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9399983 | ||
CHEMBL109648 | 945 | 36 | None | 234 | 2 | Human | 9.5 | pA2 | = | 9.5 | Functional | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9399983 | ||
DB06677 | 945 | 36 | None | 234 | 2 | Human | 9.5 | pA2 | = | 9.5 | Functional | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9399983 | ||
5340 | 168706 | 106 | None | 1 | 3 | Human | 8.4 | pIC50 | = | 8.4 | Functional | Drug Central | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | None | ||
CHEMBL437 | 168706 | 106 | None | 1 | 3 | Human | 8.4 | pIC50 | = | 8.4 | Functional | Drug Central | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | None | ||
5344 | 173449 | 101 | None | -100 | 6 | Human | 8.2 | pIC50 | = | 8.2 | Functional | Drug Central | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | None | ||
CHEMBL453 | 173449 | 101 | None | -100 | 6 | Human | 8.2 | pIC50 | = | 8.2 | Functional | Drug Central | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | None | ||
6662 | 217711 | 0 | None | -1 | 3 | Human | 8.2 | pIC50 | = | 8.2 | Functional | Drug Central | 309 | 3 | 1 | 6 | 1.6 | CC(=O)N(C1=C(C)C(C)=NO1)S(=O)(=O)C1=CC=C(N)C=C1 | None | ||
8260 | 529 | 54 | None | 141 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | Guide to Pharmacology | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | None | ||
9912992 | 529 | 54 | None | 141 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | Guide to Pharmacology | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | None | ||
CHEMBL3989834 | 529 | 54 | None | 141 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Functional | Guide to Pharmacology | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | None | ||
107810 | 1671 | 30 | None | - | 1 | Human | 7.6 | pIC50 | = | 7.6 | Functional | Guide to Pharmacology | 604 | 12 | 4 | 6 | 3.4 | CC(C[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccn1)Cc1cn(c2c1cccc2)C)NC(=O)N1CCCCCC1)C | 7647976 | ||
998 | 1671 | 30 | None | - | 1 | Human | 7.6 | pIC50 | = | 7.6 | Functional | Guide to Pharmacology | 604 | 12 | 4 | 6 | 3.4 | CC(C[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccn1)Cc1cn(c2c1cccc2)C)NC(=O)N1CCCCCC1)C | 7647976 | ||
CHEMBL352396 | 1671 | 30 | None | - | 1 | Human | 7.6 | pIC50 | = | 7.6 | Functional | Guide to Pharmacology | 604 | 12 | 4 | 6 | 3.4 | CC(C[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccn1)Cc1cn(c2c1cccc2)C)NC(=O)N1CCCCCC1)C | 7647976 | ||
3951 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
4337 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
6918493 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
CHEMBL1111 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
DB06403 | 390 | 86 | None | 47 | 2 | Human | 7.7 | pIC50 | = | 7.7 | Functional | Guide to Pharmacology | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 15139756 | ||
3539 | 4110 | 83 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Functional | Guide to Pharmacology | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 15956965 | ||
9910224 | 4110 | 83 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Functional | Guide to Pharmacology | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 15956965 | ||
CHEMBL1628688 | 4110 | 83 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Functional | Guide to Pharmacology | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 15956965 | ||
DB06629 | 4110 | 83 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Functional | Guide to Pharmacology | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 15956965 | ||
10070 | 448 | 47 | None | 109 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
25099191 | 448 | 47 | None | 109 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
CHEMBL2165326 | 448 | 47 | None | 109 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
DB15059 | 448 | 47 | None | 109 | 2 | Human | 8.5 | pIC50 | = | 8.5 | Functional | Guide to Pharmacology | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 18780830 | ||
1000 | 3477 | 0 | None | - | 1 | Human | 8.9 | pIC50 | = | 8.9 | Functional | Guide to Pharmacology | 614 | 14 | 2 | 9 | 6.1 | CCCCn1ncc(c1c1ccc(cc1OCc1ccccc1C(=O)O)OC)/C=C(/C(=O)O)\Cc1cc2OCOc2cc1OC | 9694916 | ||
5311425 | 3477 | 0 | None | - | 1 | Human | 8.9 | pIC50 | = | 8.9 | Functional | Guide to Pharmacology | 614 | 14 | 2 | 9 | 6.1 | CCCCn1ncc(c1c1ccc(cc1OCc1ccccc1C(=O)O)OC)/C=C(/C(=O)O)\Cc1cc2OCOc2cc1OC | 9694916 | ||
CHEMBL1628624 | 3477 | 0 | None | - | 1 | Human | 8.9 | pIC50 | = | 8.9 | Functional | Guide to Pharmacology | 614 | 14 | 2 | 9 | 6.1 | CCCCn1ncc(c1c1ccc(cc1OCc1ccccc1C(=O)O)OC)/C=C(/C(=O)O)\Cc1cc2OCOc2cc1OC | 9694916 | ||
16004692 | 2438 | 91 | None | 107 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Functional | Guide to Pharmacology | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 22862294 | ||
4809 | 2438 | 91 | None | 107 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Functional | Guide to Pharmacology | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 22862294 | ||
7352 | 2438 | 91 | None | 107 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Functional | Guide to Pharmacology | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 22862294 | ||
CHEMBL2103873 | 2438 | 91 | None | 107 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Functional | Guide to Pharmacology | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 22862294 | ||
DB08932 | 2438 | 91 | None | 107 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Functional | Guide to Pharmacology | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 22862294 | ||
131845706 | 3446 | 6 | None | - | 1 | Human | 7.8 | pIC50 | None | 7.8 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
71308726 | 3446 | 6 | None | - | 1 | Human | 7.8 | pIC50 | None | 7.8 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
995 | 3446 | 6 | None | - | 1 | Human | 7.8 | pIC50 | None | 7.8 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
CHEMBL1222310 | 3446 | 6 | None | - | 1 | Human | 7.8 | pIC50 | None | 7.8 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
CHEMBL4524099 | 3446 | 6 | None | - | 1 | Human | 7.8 | pIC50 | None | 7.8 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
101598716 | 1549 | 30 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
16133807 | 1549 | 30 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
16212950 | 1549 | 30 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
989 | 1549 | 30 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
CHEMBL3775234 | 1549 | 30 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
16133808 | 1551 | 0 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
16219332 | 1551 | 0 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
56947103 | 1551 | 0 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
990 | 1551 | 0 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
CHEMBL3774897 | 1551 | 0 | None | - | 1 | Human | 8.2 | pIC50 | None | 8.2 | Functional | Guide to Pharmacology | None | None | None | None | 7647976 | ||||
108002 | 3468 | 23 | None | -1 | 2 | Rat | 9.4 | pKB | = | 9.4 | Functional | Guide to Pharmacology | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 8201588 | ||
3528 | 3468 | 23 | None | -1 | 2 | Rat | 9.4 | pKB | = | 9.4 | Functional | Guide to Pharmacology | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 8201588 | ||
CHEMBL8823 | 3468 | 23 | None | -1 | 2 | Rat | 9.4 | pKB | = | 9.4 | Functional | Guide to Pharmacology | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 8201588 |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
28230148 | 205708 | 97 | None | - | 0 | Human | 5.0 | pAC50 | = | 5.0 | Binding | ChEMBL | 320 | 3 | 2 | 6 | 0.7 | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)nc21 | 10.1038/s41467-023-40064-9 | ||
3229 | 205708 | 97 | None | - | 0 | Human | 5.0 | pAC50 | = | 5.0 | Binding | ChEMBL | 320 | 3 | 2 | 6 | 0.7 | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)nc21 | 10.1038/s41467-023-40064-9 | ||
CHEMBL826 | 205708 | 97 | None | - | 0 | Human | 5.0 | pAC50 | = | 5.0 | Binding | ChEMBL | 320 | 3 | 2 | 6 | 0.7 | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)nc21 | 10.1038/s41467-023-40064-9 | ||
41684 | 31191 | 105 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | ChEMBL | 307 | 4 | 1 | 7 | 2.2 | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1401 | 31191 | 105 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | ChEMBL | 307 | 4 | 1 | 7 | 2.2 | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 | 10.1038/s41467-023-40064-9 | ||
54677470 | 200528 | 115 | None | - | 30 | Human | 4.9 | pAC50 | = | 4.9 | Binding | ChEMBL | 351 | 2 | 2 | 6 | 2.0 | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1256873 | 200528 | 115 | None | - | 30 | Human | 4.9 | pAC50 | = | 4.9 | Binding | ChEMBL | 351 | 2 | 2 | 6 | 2.0 | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL599 | 200528 | 115 | None | - | 30 | Human | 4.9 | pAC50 | = | 4.9 | Binding | ChEMBL | 351 | 2 | 2 | 6 | 2.0 | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1 | 10.1038/s41467-023-40064-9 | ||
4829 | 199933 | 108 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | ChEMBL | 356 | 7 | 1 | 5 | 3.2 | CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL595 | 199933 | 108 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | ChEMBL | 356 | 7 | 1 | 5 | 3.2 | CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 | 10.1038/s41467-023-40064-9 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.5 | pAC50 | = | 7.5 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1038/s41467-023-40064-9 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.5 | pAC50 | = | 7.5 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1038/s41467-023-40064-9 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.5 | pAC50 | = | 7.5 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.5 | pAC50 | = | 7.5 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1038/s41467-023-40064-9 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.5 | pAC50 | = | 7.5 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1038/s41467-023-40064-9 | ||
1209 | 1645 | 75 | None | - | 32 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 309 | 6 | 1 | 2 | 4.4 | CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F | 10.1038/s41467-023-40064-9 | ||
203 | 1645 | 75 | None | - | 32 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 309 | 6 | 1 | 2 | 4.4 | CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F | 10.1038/s41467-023-40064-9 | ||
3386 | 1645 | 75 | None | - | 32 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 309 | 6 | 1 | 2 | 4.4 | CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F | 10.1038/s41467-023-40064-9 | ||
CHEMBL41 | 1645 | 75 | None | - | 32 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 309 | 6 | 1 | 2 | 4.4 | CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F | 10.1038/s41467-023-40064-9 | ||
DB00472 | 1645 | 75 | None | - | 32 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 309 | 6 | 1 | 2 | 4.4 | CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F | 10.1038/s41467-023-40064-9 | ||
5329102 | 194703 | 86 | None | - | 0 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 398 | 7 | 3 | 3 | 3.3 | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c1C | 10.1038/s41467-023-40064-9 | ||
CHEMBL535 | 194703 | 86 | None | - | 0 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 398 | 7 | 3 | 3 | 3.3 | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c1C | 10.1038/s41467-023-40064-9 | ||
135398513 | 66089 | 133 | None | - | 0 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 225 | 4 | 3 | 8 | -0.9 | Nc1nc(O)c2ncn(COCCO)c2n1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL184 | 66089 | 133 | None | - | 0 | Human | 5.1 | pAC50 | = | 5.1 | Binding | ChEMBL | 225 | 4 | 3 | 8 | -0.9 | Nc1nc(O)c2ncn(COCCO)c2n1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL2370066 | 209754 | 0 | None | - | 0 | Human | 7.9 | pEC50 | = | 7.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL315841 | 211170 | 0 | None | - | 0 | Human | 7.8 | pEC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00070a001 | ||||
CHEMBL2370067 | 209755 | 0 | None | - | 0 | Human | 5.7 | pEC50 | = | 5.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](N)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@H](C=O)Cc1c[nH]c2ccccc12)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL407269 | 212628 | 0 | None | - | 0 | Human | 7.6 | pEC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL313344 | 211089 | 0 | None | - | 0 | Human | 5.6 | pEC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL387200 | 212385 | 0 | None | - | 0 | Human | 6.2 | pEC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL86703 | 215866 | 0 | None | - | 0 | Human | 5.2 | pEC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(C)C | 10.1021/jm00070a001 | ||||
44284437 | 99956 | 0 | None | - | 0 | Human | 11.0 | pIC50 | = | 11.0 | Binding | ChEMBL | 520 | 9 | 4 | 8 | 3.5 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(O)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL286621 | 99956 | 0 | None | - | 0 | Human | 11.0 | pIC50 | = | 11.0 | Binding | ChEMBL | 520 | 9 | 4 | 8 | 3.5 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(O)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44284405 | 100328 | 0 | None | - | 0 | Human | 11.0 | pIC50 | = | 11.0 | Binding | ChEMBL | 532 | 10 | 2 | 7 | 5.4 | COCC(C)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL289634 | 100328 | 0 | None | - | 0 | Human | 11.0 | pIC50 | = | 11.0 | Binding | ChEMBL | 532 | 10 | 2 | 7 | 5.4 | COCC(C)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
44284287 | 161223 | 0 | None | - | 0 | Human | 11.0 | pIC50 | = | 11.0 | Binding | ChEMBL | 532 | 10 | 3 | 7 | 5.2 | CCC(CO)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL411925 | 161223 | 0 | None | - | 0 | Human | 11.0 | pIC50 | = | 11.0 | Binding | ChEMBL | 532 | 10 | 3 | 7 | 5.2 | CCC(CO)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
11017304 | 114113 | 0 | None | - | 0 | Pig | 10.9 | pIC50 | = | 10.9 | Binding | ChEMBL | 579 | 11 | 1 | 9 | 5.8 | CCc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(SC)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL332922 | 114113 | 0 | None | - | 0 | Pig | 10.9 | pIC50 | = | 10.9 | Binding | ChEMBL | 579 | 11 | 1 | 9 | 5.8 | CCc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(SC)cn2)cc1 | 10.1021/jm0102304 | ||
44284288 | 100107 | 0 | None | - | 0 | Human | 10.9 | pIC50 | = | 10.9 | Binding | ChEMBL | 559 | 9 | 2 | 7 | 4.9 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)C(=O)N(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL287683 | 100107 | 0 | None | - | 0 | Human | 10.9 | pIC50 | = | 10.9 | Binding | ChEMBL | 559 | 9 | 2 | 7 | 4.9 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)C(=O)N(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44284292 | 168088 | 0 | None | - | 0 | Human | 10.9 | pIC50 | = | 10.9 | Binding | ChEMBL | 518 | 8 | 3 | 7 | 4.9 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)(C)O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL432856 | 168088 | 0 | None | - | 0 | Human | 10.9 | pIC50 | = | 10.9 | Binding | ChEMBL | 518 | 8 | 3 | 7 | 4.9 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)(C)O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
9852318 | 9582 | 8 | None | - | 2 | Rat | 10.8 | pIC50 | = | 10.8 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL112624 | 9582 | 8 | None | - | 2 | Rat | 10.8 | pIC50 | = | 10.8 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL1627022 | 9582 | 8 | None | - | 2 | Rat | 10.8 | pIC50 | = | 10.8 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
11082446 | 9879 | 0 | None | - | 0 | Pig | 10.8 | pIC50 | = | 10.8 | Binding | ChEMBL | 581 | 12 | 1 | 11 | 4.6 | COc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2Oc2cccc(OC)c2)nc1 | 10.1021/jm0102304 | ||
CHEMBL114380 | 9879 | 0 | None | - | 0 | Pig | 10.8 | pIC50 | = | 10.8 | Binding | ChEMBL | 581 | 12 | 1 | 11 | 4.6 | COc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2Oc2cccc(OC)c2)nc1 | 10.1021/jm0102304 | ||
10897569 | 10108 | 0 | None | - | 0 | Pig | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 645 | 11 | 1 | 10 | 5.7 | COc1ccccc1Sc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCOc1ncc(Br)cn1 | 10.1021/jm0102304 | ||
CHEMBL115724 | 10108 | 0 | None | - | 0 | Pig | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 645 | 11 | 1 | 10 | 5.7 | COc1ccccc1Sc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCOc1ncc(Br)cn1 | 10.1021/jm0102304 | ||
10227760 | 100960 | 0 | None | - | 0 | Human | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 481 | 6 | 2 | 7 | 4.9 | CC(=O)c1c(C)c(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL294291 | 100960 | 0 | None | - | 0 | Human | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 481 | 6 | 2 | 7 | 4.9 | CC(=O)c1c(C)c(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
10163017 | 200758 | 0 | None | - | 0 | Human | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 482 | 6 | 3 | 8 | 4.6 | C/C(=N\O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL60058 | 200758 | 0 | None | - | 0 | Human | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 482 | 6 | 3 | 8 | 4.6 | C/C(=N\O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
44284236 | 122297 | 0 | None | - | 0 | Human | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 504 | 9 | 3 | 7 | 4.5 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CCCO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL35984 | 122297 | 0 | None | - | 0 | Human | 10.7 | pIC50 | = | 10.7 | Binding | ChEMBL | 504 | 9 | 3 | 7 | 4.5 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CCCO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
72548703 | 161543 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 583 | 8 | 3 | 6 | 5.8 | CC(C)(C)NS(=O)(=O)c1ccc(-c2sc(C(=O)N[C@H]3C[C@H](C(=O)O)C3)nc2CC2CCCCC2)c2ccccc12 | 10.1016/j.bmcl.2018.03.093 | ||
CHEMBL4128926 | 161543 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 583 | 8 | 3 | 6 | 5.8 | CC(C)(C)NS(=O)(=O)c1ccc(-c2sc(C(=O)N[C@H]3C[C@H](C(=O)O)C3)nc2CC2CCCCC2)c2ccccc12 | 10.1016/j.bmcl.2018.03.093 | ||
101598716 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.03.006 | ||||
16133807 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.03.006 | ||||
16212950 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.03.006 | ||||
989 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.03.006 | ||||
CHEMBL3775234 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.03.006 | ||||
101598716 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
16133807 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
16212950 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
989 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
CHEMBL3775234 | 1549 | 30 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
44284288 | 100107 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 559 | 9 | 2 | 7 | 4.9 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)C(=O)N(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL287683 | 100107 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 559 | 9 | 2 | 7 | 4.9 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)C(=O)N(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44284405 | 100328 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 532 | 10 | 2 | 7 | 5.4 | COCC(C)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL289634 | 100328 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 532 | 10 | 2 | 7 | 5.4 | COCC(C)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
9873636 | 173800 | 0 | None | - | 0 | Rat | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 607 | 10 | 1 | 10 | 6.4 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2cc3ccccc3s2)nc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4538570 | 173800 | 0 | None | - | 0 | Rat | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 607 | 10 | 1 | 10 | 6.4 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2cc3ccccc3s2)nc1 | 10.1016/j.bmcl.2016.06.014 | ||
44381151 | 59359 | 0 | None | - | 0 | Pig | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 671 | 13 | 1 | 10 | 6.3 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(Oc2ccccc2OC)c(OCCOc2ncc(Br)cn2)n1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL170908 | 59359 | 0 | None | - | 0 | Pig | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 671 | 13 | 1 | 10 | 6.3 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(Oc2ccccc2OC)c(OCCOc2ncc(Br)cn2)n1 | 10.1016/s0960-894x(01)00682-5 | ||
44284266 | 136907 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 531 | 8 | 2 | 7 | 4.6 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CN(C)C(C)=O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL37427 | 136907 | 0 | None | - | 0 | Human | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 531 | 8 | 2 | 7 | 4.6 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CN(C)C(C)=O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
11039156 | 10038 | 0 | None | - | 0 | Pig | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 581 | 11 | 1 | 10 | 5.2 | COc1cccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(SC)cn2)c1 | 10.1021/jm0102304 | ||
CHEMBL115333 | 10038 | 0 | None | - | 0 | Pig | 10.6 | pIC50 | = | 10.6 | Binding | ChEMBL | 581 | 11 | 1 | 10 | 5.2 | COc1cccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(SC)cn2)c1 | 10.1021/jm0102304 | ||
10206855 | 100875 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 493 | 7 | 2 | 7 | 5.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)C2CC2)c1 | 10.1021/jm030528p | ||
CHEMBL293830 | 100875 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 493 | 7 | 2 | 7 | 5.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)C2CC2)c1 | 10.1021/jm030528p | ||
10185556 | 102629 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 503 | 6 | 2 | 8 | 3.8 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(S(C)(=O)=O)c1 | 10.1021/jm030528p | ||
CHEMBL304460 | 102629 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 503 | 6 | 2 | 8 | 3.8 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(S(C)(=O)=O)c1 | 10.1021/jm030528p | ||
10228523 | 201207 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 495 | 7 | 2 | 7 | 5.3 | CCC(=O)c1c(C)c(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL60367 | 201207 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 495 | 7 | 2 | 7 | 5.3 | CCC(=O)c1c(C)c(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
44284238 | 100099 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 490 | 8 | 3 | 7 | 4.2 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CCO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL287622 | 100099 | 0 | None | - | 0 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 490 | 8 | 3 | 7 | 4.2 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CCO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
10152810 | 14754 | 2 | None | - | 0 | Rat | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1F | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206706 | 14754 | 2 | None | - | 0 | Rat | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1F | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL298725 | 14754 | 2 | None | - | 0 | Rat | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1F | 10.1016/s0960-894x(98)00301-1 | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm970101g | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm970101g | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm970101g | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm970101g | ||
10962637 | 10047 | 0 | None | - | 0 | Rat | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 549 | 10 | 2 | 9 | 4.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(CO)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL115372 | 10047 | 0 | None | - | 0 | Rat | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 549 | 10 | 2 | 9 | 4.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(CO)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL1627023 | 10047 | 0 | None | - | 0 | Rat | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 549 | 10 | 2 | 9 | 4.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(CO)cn2)cc1 | 10.1021/jm000538f | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990171i | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990171i | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990171i | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pIC50 | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990171i | ||
11767155 | 11709 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 596 | 10 | 1 | 9 | 5.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3ccccn3)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL1181545 | 11709 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 596 | 10 | 1 | 9 | 5.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3ccccn3)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL177173 | 11709 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 596 | 10 | 1 | 9 | 5.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3ccccn3)cn2)cc1 | 10.1021/jm0102304 | ||
44284041 | 100275 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 520 | 9 | 3 | 8 | 4.4 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL289216 | 100275 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 520 | 9 | 3 | 8 | 4.4 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
9938571 | 9565 | 0 | None | - | 1 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 597 | 9 | 1 | 8 | 5.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL112531 | 9565 | 0 | None | - | 1 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 597 | 9 | 1 | 8 | 5.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL369489 | 9565 | 0 | None | - | 1 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 597 | 9 | 1 | 8 | 5.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
9938571 | 9565 | 0 | None | - | 1 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 597 | 9 | 1 | 8 | 5.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL112531 | 9565 | 0 | None | - | 1 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 597 | 9 | 1 | 8 | 5.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL369489 | 9565 | 0 | None | - | 1 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 597 | 9 | 1 | 8 | 5.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
10187997 | 109945 | 0 | None | - | 0 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm031041j | ||
CHEMBL323464 | 109945 | 0 | None | - | 0 | Rat | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm031041j | ||
11828009 | 9859 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 581 | 11 | 2 | 10 | 4.7 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(CO)cc2)nc1 | 10.1021/jm000538f | ||
CHEMBL114298 | 9859 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 581 | 11 | 2 | 10 | 4.7 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(CO)cc2)nc1 | 10.1021/jm000538f | ||
11966523 | 110343 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 613 | 10 | 2 | 9 | 4.7 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ncnc(OCCOc3ncc(Br)cn3)c2-c2ccc(CO)cc2)cc1 | 10.1021/jm000538f | ||
CHEMBL324184 | 110343 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 613 | 10 | 2 | 9 | 4.7 | CC(C)(C)c1ccc(S(=O)(=O)Nc2ncnc(OCCOc3ncc(Br)cn3)c2-c2ccc(CO)cc2)cc1 | 10.1021/jm000538f | ||
9934302 | 72615 | 1 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 467 | 6 | 2 | 7 | 4.6 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL19950 | 72615 | 1 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 467 | 6 | 2 | 7 | 4.6 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
11752337 | 162204 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 496 | 7 | 2 | 8 | 4.7 | CO/N=C(\C)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL416324 | 162204 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 496 | 7 | 2 | 8 | 4.7 | CO/N=C(\C)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
23445355 | 200879 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 469 | 6 | 2 | 8 | 3.8 | COC(=O)c1cc(C)ccc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL60149 | 200879 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 469 | 6 | 2 | 8 | 3.8 | COC(=O)c1cc(C)ccc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
9934302 | 72615 | 1 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 467 | 6 | 2 | 7 | 4.6 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm000349x | ||
CHEMBL19950 | 72615 | 1 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 467 | 6 | 2 | 7 | 4.6 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm000349x | ||
44284115 | 100167 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 518 | 9 | 3 | 7 | 4.8 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL288247 | 100167 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 518 | 9 | 3 | 7 | 4.8 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44381125 | 59259 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 674 | 10 | 1 | 9 | 6.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(-c3ccccn3)nc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL170493 | 59259 | 0 | None | - | 0 | Pig | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 674 | 10 | 1 | 9 | 6.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(-c3ccccn3)nc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/s0960-894x(01)00682-5 | ||
10187997 | 109945 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL323464 | 109945 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
44284287 | 161223 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 532 | 10 | 3 | 7 | 5.2 | CCC(CO)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL411925 | 161223 | 0 | None | - | 0 | Human | 10.4 | pIC50 | = | 10.4 | Binding | ChEMBL | 532 | 10 | 3 | 7 | 5.2 | CCC(CO)Cc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/np900287e | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/np900287e | ||||
44284328 | 127515 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 476 | 7 | 2 | 7 | 4.6 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL36627 | 127515 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 476 | 7 | 2 | 7 | 4.6 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44284437 | 99956 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 520 | 9 | 4 | 8 | 3.5 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(O)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL286621 | 99956 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 520 | 9 | 4 | 8 | 3.5 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(O)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44386450 | 62368 | 0 | None | - | 0 | Rat | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 606 | 15 | 1 | 10 | 5.1 | COC(=O)CCCCOc1cc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3c(c2)OCO3)cc(OC)c1OC | 10.1021/jm031041j | ||
CHEMBL177973 | 62368 | 0 | None | - | 0 | Rat | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 606 | 15 | 1 | 10 | 5.1 | COC(=O)CCCCOc1cc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3c(c2)OCO3)cc(OC)c1OC | 10.1021/jm031041j | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.ejmech.2013.01.044 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.ejmech.2013.01.044 | ||||
10143256 | 100546 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 531 | 7 | 2 | 8 | 4.6 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(S(=O)(=O)C(C)C)c1 | 10.1021/jm030528p | ||
CHEMBL291592 | 100546 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 531 | 7 | 2 | 8 | 4.6 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(S(=O)(=O)C(C)C)c1 | 10.1021/jm030528p | ||
10183338 | 202763 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 464 | 5 | 2 | 7 | 4.5 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C#N)c1C | 10.1021/jm030528p | ||
CHEMBL62159 | 202763 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 464 | 5 | 2 | 7 | 4.5 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C#N)c1C | 10.1021/jm030528p | ||
10722385 | 100471 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 606 | 13 | 1 | 11 | 4.6 | COC(=O)CCCCOc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OC)c1OC | 10.1021/jm980504w | ||
CHEMBL291058 | 100471 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 606 | 13 | 1 | 11 | 4.6 | COC(=O)CCCCOc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OC)c1OC | 10.1021/jm980504w | ||
11006709 | 9925 | 0 | None | - | 0 | Pig | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 629 | 11 | 1 | 10 | 5.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL114700 | 9925 | 0 | None | - | 0 | Pig | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 629 | 11 | 1 | 10 | 5.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1016/s0960-894x(01)00682-5 | ||
11006709 | 9925 | 0 | None | - | 0 | Pig | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 629 | 11 | 1 | 10 | 5.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1021/jm0102304 | ||
CHEMBL114700 | 9925 | 0 | None | - | 0 | Pig | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 629 | 11 | 1 | 10 | 5.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1021/jm0102304 | ||
10651488 | 163355 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
CHEMBL419367 | 163355 | 0 | None | - | 0 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.3 | pIC50 | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
44284041 | 100275 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 520 | 9 | 3 | 8 | 4.4 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL289216 | 100275 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 520 | 9 | 3 | 8 | 4.4 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
11734600 | 9978 | 0 | None | - | 0 | Pig | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 585 | 11 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Cl)cn2)c1 | 10.1021/jm0102304 | ||
CHEMBL114964 | 9978 | 0 | None | - | 0 | Pig | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 585 | 11 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Cl)cn2)c1 | 10.1021/jm0102304 | ||
44284115 | 100167 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 518 | 9 | 3 | 7 | 4.8 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL288247 | 100167 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 518 | 9 | 3 | 7 | 4.8 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CC(C)CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
10119327 | 202733 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 531 | 8 | 2 | 8 | 4.6 | CCCS(=O)(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL62019 | 202733 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 531 | 8 | 2 | 8 | 4.6 | CCCS(=O)(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
10206155 | 202753 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 481 | 7 | 2 | 7 | 5.0 | CCC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL62112 | 202753 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 481 | 7 | 2 | 7 | 5.0 | CCC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
10344914 | 100109 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 476 | 7 | 3 | 7 | 4.1 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL287711 | 100109 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 476 | 7 | 3 | 7 | 4.1 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CO)c1 | 10.1016/j.bmcl.2004.01.008 | ||
44284391 | 139276 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 532 | 9 | 3 | 7 | 5.3 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CCC(C)(C)O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL37920 | 139276 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 532 | 9 | 3 | 7 | 5.3 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(CCC(C)(C)O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
10119177 | 117439 | 0 | None | - | 0 | Rat | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 528 | 12 | 1 | 6 | 4.8 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL339904 | 117439 | 0 | None | - | 0 | Rat | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 528 | 12 | 1 | 6 | 4.8 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm010237l | ||
10603409 | 110577 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
CHEMBL325581 | 110577 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
10228588 | 101831 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 496 | 6 | 2 | 7 | 4.1 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)N(C)C)c1 | 10.1021/jm030528p | ||
CHEMBL300577 | 101831 | 0 | None | - | 0 | Human | 10.2 | pIC50 | = | 10.2 | Binding | ChEMBL | 496 | 6 | 2 | 7 | 4.1 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)N(C)C)c1 | 10.1021/jm030528p | ||
10210629 | 8732 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL109644 | 8732 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
9916235 | 9321 | 1 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL111277 | 9321 | 1 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990170q | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990170q | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990170q | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm990170q | ||
9916235 | 9321 | 1 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm990170q | ||
CHEMBL111277 | 9321 | 1 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm990170q | ||
10278217 | 101743 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 492 | 6 | 2 | 8 | 5.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(-c2ncco2)c1 | 10.1021/jm030528p | ||
CHEMBL299921 | 101743 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 492 | 6 | 2 | 8 | 5.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(-c2ncco2)c1 | 10.1021/jm030528p | ||
9911482 | 168049 | 20 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 447 | 6 | 2 | 7 | 4.2 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm030528p | ||
CHEMBL432521 | 168049 | 20 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 447 | 6 | 2 | 7 | 4.2 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm030528p | ||
10114414 | 198799 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 444 | 5 | 2 | 7 | 4.2 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C#N)c1C | 10.1021/jm030528p | ||
CHEMBL58359 | 198799 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 444 | 5 | 2 | 7 | 4.2 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C#N)c1C | 10.1021/jm030528p | ||
11766844 | 109754 | 0 | None | - | 0 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 553 | 9 | 1 | 8 | 5.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Cl)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL176272 | 109754 | 0 | None | - | 0 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 553 | 9 | 1 | 8 | 5.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Cl)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL323243 | 109754 | 0 | None | - | 0 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 553 | 9 | 1 | 8 | 5.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Cl)cn2)cc1 | 10.1021/jm0102304 | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
10115469 | 100811 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 459 | 5 | 2 | 6 | 5.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(Cl)c1 | 10.1021/jm030528p | ||
CHEMBL293398 | 100811 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 459 | 5 | 2 | 6 | 5.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(Cl)c1 | 10.1021/jm030528p | ||
10627272 | 204033 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 592 | 12 | 1 | 11 | 4.2 | COC(=O)CCCOc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OC)c1OC | 10.1021/jm980504w | ||
CHEMBL69986 | 204033 | 0 | None | - | 0 | Human | 10.1 | pIC50 | = | 10.1 | Binding | ChEMBL | 592 | 12 | 1 | 11 | 4.2 | COC(=O)CCCOc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OC)c1OC | 10.1021/jm980504w | ||
10603409 | 110577 | 0 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
CHEMBL325581 | 110577 | 0 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
10187997 | 109945 | 0 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL323464 | 109945 | 0 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
21041278 | 171753 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 554 | 12 | 2 | 9 | 3.5 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4467748 | 171753 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 554 | 12 | 2 | 9 | 3.5 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
10165963 | 102822 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 545 | 8 | 2 | 9 | 3.6 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)CS(C)(=O)=O)c1 | 10.1021/jm030528p | ||
CHEMBL305602 | 102822 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 545 | 8 | 2 | 9 | 3.6 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)CS(C)(=O)=O)c1 | 10.1021/jm030528p | ||
10366278 | 172440 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 446 | 6 | 2 | 6 | 4.6 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL448165 | 172440 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 446 | 6 | 2 | 6 | 4.6 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
10624511 | 71709 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 478 | 6 | 2 | 7 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2noc(C)c2Cl)c(C)c1CC#N | 10.1021/jm000349x | ||
CHEMBL19661 | 71709 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10 | Binding | ChEMBL | 478 | 6 | 2 | 7 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2noc(C)c2Cl)c(C)c1CC#N | 10.1021/jm000349x | ||
10210629 | 8732 | 0 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL109644 | 8732 | 0 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
11827657 | 19349 | 1 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 540 | 13 | 1 | 7 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(OC)c1 | 10.1021/jm010237l | ||
CHEMBL129220 | 19349 | 1 | None | - | 0 | Rat | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 540 | 13 | 1 | 7 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(OC)c1 | 10.1021/jm010237l | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.bmc.2013.03.016 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.bmc.2013.03.016 | ||||
44302615 | 200401 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 497 | 7 | 2 | 8 | 4.6 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)OC(C)C)c1 | 10.1021/jm030528p | ||
CHEMBL59819 | 200401 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 497 | 7 | 2 | 8 | 4.6 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)OC(C)C)c1 | 10.1021/jm030528p | ||
25211074 | 18453 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 543 | 10 | 2 | 7 | 5.1 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1272244 | 18453 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 543 | 10 | 2 | 7 | 5.1 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
11016761 | 108996 | 0 | None | - | 0 | Pig | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 519 | 9 | 1 | 8 | 4.8 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncccn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL321242 | 108996 | 0 | None | - | 0 | Pig | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 519 | 9 | 1 | 8 | 4.8 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncccn2)cc1 | 10.1021/jm0102304 | ||
44284329 | 100384 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 504 | 8 | 2 | 7 | 5.4 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL290181 | 100384 | 0 | None | - | 0 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 504 | 8 | 2 | 7 | 5.4 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OC(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
9914310 | 206620 | 8 | None | 1995 | 2 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL8923 | 206620 | 8 | None | 1995 | 2 | Human | 10.0 | pIC50 | = | 10.0 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10768977 | 61818 | 0 | None | - | 0 | Rat | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 548 | 13 | 1 | 8 | 5.6 | CCOc1cc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3c(c2)OCO3)cc(OCC)c1OCC | 10.1021/jm031041j | ||
CHEMBL177378 | 61818 | 0 | None | - | 0 | Rat | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 548 | 13 | 1 | 8 | 5.6 | CCOc1cc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3c(c2)OCO3)cc(OCC)c1OCC | 10.1021/jm031041j | ||
44352079 | 116515 | 0 | None | - | 0 | Rat | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 494 | 11 | 1 | 5 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)cc1 | 10.1021/jm010237l | ||
CHEMBL336272 | 116515 | 0 | None | - | 0 | Rat | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 494 | 11 | 1 | 5 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)cc1 | 10.1021/jm010237l | ||
10674176 | 162676 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 548 | 11 | 1 | 9 | 5.0 | CCOc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OCC)c1OCC | 10.1021/jm9606507 | ||
CHEMBL417067 | 162676 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 548 | 11 | 1 | 9 | 5.0 | CCOc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OCC)c1OCC | 10.1021/jm9606507 | ||
44334146 | 167976 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 446 | 7 | 2 | 6 | 4.6 | CCCNc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL432012 | 167976 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 446 | 7 | 2 | 6 | 4.6 | CCCNc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
10163744 | 98686 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 495 | 7 | 2 | 7 | 5.2 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)C(C)C)c1 | 10.1021/jm000349x | ||
CHEMBL277706 | 98686 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 495 | 7 | 2 | 7 | 5.2 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)C(C)C)c1 | 10.1021/jm000349x | ||
9916235 | 9321 | 1 | None | - | 0 | Rat | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL111277 | 9321 | 1 | None | - | 0 | Rat | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
11465535 | 201048 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 468 | 6 | 3 | 7 | 3.5 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(N)=O)c1 | 10.1021/jm030528p | ||
CHEMBL60276 | 201048 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 468 | 6 | 3 | 7 | 3.5 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(N)=O)c1 | 10.1021/jm030528p | ||
10277399 | 66836 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 478 | 6 | 2 | 7 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1CC#N | 10.1021/jm000349x | ||
CHEMBL18626 | 66836 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 478 | 6 | 2 | 7 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1CC#N | 10.1021/jm000349x | ||
10139080 | 72538 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 454 | 6 | 2 | 7 | 4.6 | Cc1cc(C)c(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1O | 10.1021/jm000349x | ||
CHEMBL19921 | 72538 | 0 | None | - | 0 | Human | 9.9 | pIC50 | = | 9.9 | Binding | ChEMBL | 454 | 6 | 2 | 7 | 4.6 | Cc1cc(C)c(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1O | 10.1021/jm000349x | ||
10717923 | 98665 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 439 | 5 | 2 | 6 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm030528p | ||
CHEMBL277595 | 98665 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 439 | 5 | 2 | 6 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm030528p | ||
9810351 | 58051 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 705 | 14 | 2 | 12 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(SCCO)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL167314 | 58051 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 705 | 14 | 2 | 12 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(SCCO)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
44284481 | 213702 | 0 | None | -3 | 5 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00077a013 | ||||
CHEMBL437472 | 213702 | 0 | None | -3 | 5 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00077a013 | ||||
9936145 | 18995 | 2 | None | - | 1 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 510 | 11 | 1 | 4 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL128818 | 18995 | 2 | None | - | 1 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 510 | 11 | 1 | 4 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)c(F)c1 | 10.1021/jm010237l | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm8007618 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm8007618 | ||||
11731472 | 9480 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 571 | 10 | 1 | 10 | 5.6 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)s2)nc1 | 10.1021/jm0102304 | ||
CHEMBL112141 | 9480 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 571 | 10 | 1 | 10 | 5.6 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)s2)nc1 | 10.1021/jm0102304 | ||
11050163 | 11712 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 583 | 10 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL1181553 | 11712 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 583 | 10 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL177924 | 11712 | 0 | None | - | 0 | Pig | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 583 | 10 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
44351968 | 118054 | 0 | None | - | 0 | Rat | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 5.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)cc1 | 10.1021/jm010237l | ||
CHEMBL340575 | 118054 | 0 | None | - | 0 | Rat | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 5.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)cc1 | 10.1021/jm010237l | ||
10717923 | 98665 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 439 | 5 | 2 | 6 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm000349x | ||
CHEMBL277595 | 98665 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 439 | 5 | 2 | 6 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm000349x | ||
10623757 | 98903 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 458 | 6 | 2 | 7 | 4.4 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1CC#N | 10.1021/jm000349x | ||
CHEMBL279471 | 98903 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 458 | 6 | 2 | 7 | 4.4 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1CC#N | 10.1021/jm000349x | ||
9806559 | 9118 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 515 | 13 | 1 | 6 | 3.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCCC1=O | 10.1021/jm980217s | ||
CHEMBL110053 | 9118 | 0 | None | - | 0 | Human | 9.8 | pIC50 | = | 9.8 | Binding | ChEMBL | 515 | 13 | 1 | 6 | 3.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCCC1=O | 10.1021/jm980217s | ||
9936145 | 18995 | 2 | None | - | 1 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 510 | 11 | 1 | 4 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL128818 | 18995 | 2 | None | - | 1 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 510 | 11 | 1 | 4 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL1790959 | 208885 | 0 | None | - | 0 | Pig | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
9825494 | 202587 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL61211 | 202587 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
9825494 | 202587 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL61211 | 202587 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
9825494 | 202587 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL61211 | 202587 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/acs.jmedchem.5b01781 | ||
9868637 | 99060 | 1 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 455 | 5 | 3 | 7 | 4.4 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1O | 10.1021/jm000349x | ||
CHEMBL280659 | 99060 | 1 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 455 | 5 | 3 | 7 | 4.4 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1O | 10.1021/jm000349x | ||
CHEMBL1790963 | 208888 | 0 | None | - | 0 | Pig | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)[C@@H](C)CC)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
11757759 | 174422 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 570 | 13 | 2 | 10 | 2.8 | COCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4553625 | 174422 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 570 | 13 | 2 | 10 | 2.8 | COCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
18931096 | 58717 | 0 | None | - | 0 | Pig | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 689 | 14 | 2 | 12 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(OCCO)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL168604 | 58717 | 0 | None | - | 0 | Pig | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 689 | 14 | 2 | 12 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(OCCO)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
10722371 | 102201 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 605 | 11 | 1 | 11 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL302974 | 102201 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 605 | 11 | 1 | 11 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
10578853 | 103565 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 564 | 10 | 1 | 11 | 3.4 | COC(=O)COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OC)c1OC | 10.1021/jm980504w | ||
CHEMBL308646 | 103565 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 564 | 10 | 1 | 11 | 3.4 | COC(=O)COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc(OC)c1OC | 10.1021/jm980504w | ||
44334128 | 4374 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 443 | 7 | 1 | 5 | 4.9 | C=CCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL101424 | 4374 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 443 | 7 | 1 | 5 | 4.9 | C=CCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
9939238 | 204105 | 0 | None | - | 1 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 637 | 12 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70385 | 204105 | 0 | None | - | 1 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 637 | 12 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(97)00400-9 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(97)00400-9 | ||||
CHEMBL1790960 | 208886 | 0 | None | - | 0 | Pig | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | None | None | None | CCC[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00077a013 | ||||
10120499 | 109729 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 564 | 12 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CC(C)C | 10.1021/jm970101g | ||
CHEMBL323055 | 109729 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 564 | 12 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CC(C)C | 10.1021/jm970101g | ||
11113541 | 203245 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 476 | 7 | 1 | 7 | 5.2 | COc1ccc(OC2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64632 | 203245 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 476 | 7 | 1 | 7 | 5.2 | COc1ccc(OC2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
10299555 | 101006 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 481 | 6 | 2 | 7 | 4.9 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sc(C)cc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL294563 | 101006 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 481 | 6 | 2 | 7 | 4.9 | CC(=O)c1cc(C)cc(C)c1NC(=O)c1sc(C)cc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
10321290 | 4604 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 445 | 7 | 1 | 5 | 5.1 | CCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL102969 | 4604 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 445 | 7 | 1 | 5 | 5.1 | CCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
10651488 | 163355 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
CHEMBL419367 | 163355 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
44284381 | 128483 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 462 | 6 | 3 | 7 | 4.3 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL36671 | 128483 | 0 | None | - | 0 | Human | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 462 | 6 | 3 | 7 | 4.3 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(O)c1 | 10.1016/j.bmcl.2004.01.008 | ||
10648937 | 207283 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9334 | 207283 | 0 | None | - | 0 | Rat | 9.7 | pIC50 | = | 9.7 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.bmcl.2013.01.025 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.bmcl.2013.01.025 | ||||
123883 | 14612 | 1 | None | - | 0 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 927 | 12 | 9 | 11 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](c2cccs2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N2CCN(c3ccccc3)CC2)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm970101g | ||
CHEMBL1205177 | 14612 | 1 | None | - | 0 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 927 | 12 | 9 | 11 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](c2cccs2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N2CCN(c3ccccc3)CC2)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm970101g | ||
CHEMBL61425 | 14612 | 1 | None | - | 0 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 927 | 12 | 9 | 11 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](c2cccs2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N2CCN(c3ccccc3)CC2)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm970101g | ||
123883 | 14612 | 1 | None | - | 0 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 927 | 12 | 9 | 11 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](c2cccs2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N2CCN(c3ccccc3)CC2)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm030528p | ||
CHEMBL1205177 | 14612 | 1 | None | - | 0 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 927 | 12 | 9 | 11 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](c2cccs2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N2CCN(c3ccccc3)CC2)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm030528p | ||
CHEMBL61425 | 14612 | 1 | None | - | 0 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 927 | 12 | 9 | 11 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](c2cccs2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)N2CCN(c3ccccc3)CC2)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm030528p | ||
11006532 | 12211 | 0 | None | - | 0 | Rat | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 601 | 10 | 1 | 9 | 6.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3cccs3)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL1184515 | 12211 | 0 | None | - | 0 | Rat | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 601 | 10 | 1 | 9 | 6.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3cccs3)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL367445 | 12211 | 0 | None | - | 0 | Rat | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 601 | 10 | 1 | 9 | 6.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3cccs3)cn2)cc1 | 10.1021/jm0102304 | ||
9894460 | 206686 | 9 | None | 24 | 3 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm970101g | ||
CHEMBL313871 | 206686 | 9 | None | 24 | 3 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm970101g | ||
CHEMBL8978 | 206686 | 9 | None | 24 | 3 | Human | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm970101g | ||
22004774 | 100782 | 0 | None | - | 0 | Rat | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 442 | 8 | 1 | 6 | 5.7 | CCCCSC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL293192 | 100782 | 0 | None | - | 0 | Rat | 9.6 | pIC50 | = | 9.6 | Binding | ChEMBL | 442 | 8 | 1 | 6 | 5.7 | CCCCSC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL2304284 | 209465 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/np900287e | ||||
44387242 | 120377 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 502 | 15 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCCC(C)C | 10.1021/jm031041j | ||
CHEMBL353560 | 120377 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 502 | 15 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCCC(C)C | 10.1021/jm031041j | ||
11093237 | 10375 | 0 | None | - | 0 | Pig | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 601 | 10 | 1 | 9 | 6.4 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc3ccccc3c2)nc1 | 10.1021/jm0102304 | ||
CHEMBL116281 | 10375 | 0 | None | - | 0 | Pig | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 601 | 10 | 1 | 9 | 6.4 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc3ccccc3c2)nc1 | 10.1021/jm0102304 | ||
10769526 | 102673 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 578 | 12 | 2 | 10 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCC(=O)O)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL304762 | 102673 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 578 | 12 | 2 | 10 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCC(=O)O)c2)cc1 | 10.1021/jm980504w | ||
9870959 | 8885 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 509 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccccn1 | 10.1021/jm980217s | ||
CHEMBL109778 | 8885 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 509 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccccn1 | 10.1021/jm980217s | ||
44339655 | 9074 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 530 | 14 | 1 | 6 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2cc(OC)c3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL109926 | 9074 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 530 | 14 | 1 | 6 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2cc(OC)c3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
10278777 | 168108 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 502 | 14 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL432974 | 168108 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 502 | 14 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
9870830 | 206691 | 38 | None | 66 | 2 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL8981 | 206691 | 38 | None | 66 | 2 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
9939238 | 204105 | 0 | None | - | 1 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 637 | 12 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL70385 | 204105 | 0 | None | - | 1 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 637 | 12 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
21041284 | 170913 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 568 | 13 | 2 | 9 | 3.9 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4455360 | 170913 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 568 | 13 | 2 | 9 | 3.9 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
58688006 | 171092 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 524 | 13 | 2 | 9 | 3.8 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4458005 | 171092 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 524 | 13 | 2 | 9 | 3.8 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
9870830 | 206691 | 38 | None | - | 2 | Mouse | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL8981 | 206691 | 38 | None | - | 2 | Mouse | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
21041264 | 81982 | 1 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 600 | 12 | 2 | 8 | 4.0 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165339 | 81982 | 1 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 600 | 12 | 2 | 8 | 4.0 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
10311570 | 14598 | 0 | None | - | 1 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205068 | 14598 | 0 | None | - | 1 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL48907 | 14598 | 0 | None | - | 1 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
10555424 | 204013 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 592 | 13 | 2 | 10 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCCC(=O)O)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL69832 | 204013 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 592 | 13 | 2 | 10 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCCC(=O)O)c2)cc1 | 10.1021/jm980504w | ||
9870830 | 206691 | 38 | None | 66 | 2 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL8981 | 206691 | 38 | None | 66 | 2 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm980504w | ||
9871348 | 204004 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 520 | 8 | 1 | 10 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4nsnc4c3)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL69741 | 204004 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 520 | 8 | 1 | 10 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4nsnc4c3)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
9809919 | 204386 | 0 | None | - | 2 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 665 | 13 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL72037 | 204386 | 0 | None | - | 2 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 665 | 13 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(97)00400-9 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(97)00400-9 | ||||
159594 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm031041j | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm031041j | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm031041j | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm031041j | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
11144344 | 202989 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 424 | 8 | 1 | 5 | 5.8 | CCCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL63267 | 202989 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 424 | 8 | 1 | 5 | 5.8 | CCCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
44334150 | 4502 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 445 | 6 | 1 | 5 | 5.0 | COc1ccc([C@@H]2c3nc(CC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL102314 | 4502 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 445 | 6 | 1 | 5 | 5.0 | COc1ccc([C@@H]2c3nc(CC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
9852318 | 9582 | 8 | None | - | 2 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL112624 | 9582 | 8 | None | - | 2 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL1627022 | 9582 | 8 | None | - | 2 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
11102201 | 203200 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 438 | 9 | 1 | 6 | 5.1 | C=CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL64447 | 203200 | 0 | None | - | 0 | Rat | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 438 | 9 | 1 | 6 | 5.1 | C=CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
44266903 | 14554 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 536 | 11 | 1 | 9 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL10862 | 14554 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 536 | 11 | 1 | 9 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL1204672 | 14554 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 536 | 11 | 1 | 9 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
9960931 | 107994 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 635 | 12 | 1 | 12 | 4.1 | CCOC(=O)CNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL319452 | 107994 | 0 | None | - | 0 | Human | 9.5 | pIC50 | = | 9.5 | Binding | ChEMBL | 635 | 12 | 1 | 12 | 4.1 | CCOC(=O)CNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
9914310 | 206620 | 8 | None | - | 2 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL8923 | 206620 | 8 | None | - | 2 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
9870830 | 206691 | 38 | None | 66 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL8981 | 206691 | 38 | None | 66 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
11017436 | 9918 | 0 | None | - | 0 | Pig | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 597 | 12 | 1 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCOc1ncc(SC)cn1 | 10.1021/jm0102304 | ||
CHEMBL114660 | 9918 | 0 | None | - | 0 | Pig | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 597 | 12 | 1 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCOc1ncc(SC)cn1 | 10.1021/jm0102304 | ||
44333913 | 5069 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 431 | 6 | 1 | 5 | 4.8 | CCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL105591 | 5069 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 431 | 6 | 1 | 5 | 4.8 | CCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
9870959 | 8885 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 509 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccccn1 | 10.1021/jm980217s | ||
CHEMBL109778 | 8885 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 509 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccccn1 | 10.1021/jm980217s | ||
9809526 | 14827 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 614 | 12 | 2 | 11 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCS(=O)(=O)O)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL1207463 | 14827 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 614 | 12 | 2 | 11 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCS(=O)(=O)O)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL408055 | 14827 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 614 | 12 | 2 | 11 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCS(=O)(=O)O)c2)cc1 | 10.1021/jm980504w | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm701575k | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm701575k | ||||
10208674 | 101826 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 529 | 7 | 2 | 7 | 5.6 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)c2ccccc2)c1 | 10.1021/jm030528p | ||
CHEMBL300547 | 101826 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 529 | 7 | 2 | 7 | 5.6 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)c2ccccc2)c1 | 10.1021/jm030528p | ||
10603409 | 110577 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
CHEMBL325581 | 110577 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 584 | 13 | 1 | 7 | 4.1 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
9852318 | 9582 | 8 | None | 2691 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL112624 | 9582 | 8 | None | 2691 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL1627022 | 9582 | 8 | None | 2691 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/acs.jmedchem.5b01781 | ||
44332735 | 172678 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 649 | 13 | 1 | 12 | 4.5 | CCOC(=O)CCNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL450337 | 172678 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 649 | 13 | 1 | 12 | 4.5 | CCOC(=O)CCNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm960077r | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm960077r | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm960077r | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm960077r | ||
9852318 | 9582 | 8 | None | 2691 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
CHEMBL112624 | 9582 | 8 | None | 2691 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
CHEMBL1627022 | 9582 | 8 | None | 2691 | 2 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
71462245 | 81637 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 588 | 13 | 2 | 10 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1Oc1cc(OC)ccc1Cl | 10.1021/jm3009103 | ||
CHEMBL2163692 | 81637 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 588 | 13 | 2 | 10 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1Oc1cc(OC)ccc1Cl | 10.1021/jm3009103 | ||
44386169 | 131363 | 0 | None | - | 1 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 690 | 12 | 2 | 14 | 3.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368996 | 131363 | 0 | None | - | 1 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 690 | 12 | 2 | 14 | 3.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
11122784 | 162898 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 426 | 8 | 1 | 6 | 4.9 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL417413 | 162898 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 426 | 8 | 1 | 6 | 4.9 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
44339655 | 9074 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 530 | 14 | 1 | 6 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2cc(OC)c3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL109926 | 9074 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 530 | 14 | 1 | 6 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2cc(OC)c3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
44284196 | 100495 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 504 | 9 | 2 | 7 | 5.4 | CCCOc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL291247 | 100495 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 504 | 9 | 2 | 7 | 5.4 | CCCOc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
10364227 | 202776 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm031041j | ||
CHEMBL62264 | 202776 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm031041j | ||
10364227 | 202776 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL62264 | 202776 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
9806559 | 9118 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 515 | 13 | 1 | 6 | 3.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCCC1=O | 10.1021/jm980217s | ||
CHEMBL110053 | 9118 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 515 | 13 | 1 | 6 | 3.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCCC1=O | 10.1021/jm980217s | ||
11827880 | 10194 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 565 | 10 | 1 | 9 | 5.5 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)cc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL116046 | 10194 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 565 | 10 | 1 | 9 | 5.5 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)cc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL177979 | 10194 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 565 | 10 | 1 | 9 | 5.5 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)cc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL1790962 | 208887 | 0 | None | - | 1 | Pig | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
10303555 | 163357 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 574 | 15 | 1 | 7 | 4.9 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
CHEMBL419383 | 163357 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 574 | 15 | 1 | 7 | 4.9 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
10578320 | 97281 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 538 | 12 | 1 | 6 | 5.2 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(CCC(C)C)CCC(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL269141 | 97281 | 0 | None | - | 0 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 538 | 12 | 1 | 6 | 5.2 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(CCC(C)C)CCC(C)C)cc1 | 10.1021/jm9505369 | ||
10182624 | 99525 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 453 | 6 | 2 | 6 | 4.9 | CCc1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm000349x | ||
CHEMBL283582 | 99525 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 453 | 6 | 2 | 6 | 4.9 | CCc1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm000349x | ||
9870830 | 206691 | 38 | None | - | 2 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL8981 | 206691 | 38 | None | - | 2 | Rat | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
9825494 | 202587 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL61211 | 202587 | 0 | None | - | 0 | Human | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
44380648 | 120487 | 0 | None | - | 0 | Pig | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 727 | 12 | 1 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCN(C)CC2)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL354528 | 120487 | 0 | None | - | 0 | Pig | 9.4 | pIC50 | = | 9.4 | Binding | ChEMBL | 727 | 12 | 1 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCN(C)CC2)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
10210629 | 8732 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL109644 | 8732 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
10167052 | 109612 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 578 | 13 | 1 | 7 | 4.5 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCC(C)C | 10.1021/jm970101g | ||
CHEMBL322297 | 109612 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 578 | 13 | 1 | 7 | 4.5 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCC(C)C | 10.1021/jm970101g | ||
44265870 | 207548 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 524 | 12 | 1 | 6 | 5.1 | CCCCN(CCCC)C(=O)C(C)N1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9488 | 207548 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 524 | 12 | 1 | 6 | 5.1 | CCCCN(CCCC)C(=O)C(C)N1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10391487 | 9629 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3occc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
CHEMBL112832 | 9629 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3occc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
10983045 | 202883 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 440 | 9 | 1 | 6 | 5.3 | CCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL62762 | 202883 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 440 | 9 | 1 | 6 | 5.3 | CCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
11050177 | 10227 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 585 | 10 | 1 | 9 | 6.1 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3ccco3)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL116108 | 10227 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 585 | 10 | 1 | 9 | 6.1 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3ccco3)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL175501 | 10227 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 585 | 10 | 1 | 9 | 6.1 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(-c3ccco3)cn2)cc1 | 10.1021/jm0102304 | ||
9915028 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm010237l | ||
CHEMBL111612 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm010237l | ||
CHEMBL4761843 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm010237l | ||
10391487 | 9629 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3occc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
CHEMBL112832 | 9629 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3occc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
10840068 | 60327 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 536 | 11 | 1 | 9 | 4.4 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL174573 | 60327 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 536 | 11 | 1 | 9 | 4.4 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
44387124 | 130865 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 524 | 13 | 1 | 6 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](CC(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
CHEMBL368558 | 130865 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 524 | 13 | 1 | 6 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](CC(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
10530409 | 5674 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 536 | 9 | 1 | 10 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10781 | 5674 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 536 | 9 | 1 | 10 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
10815823 | 9765 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 520 | 8 | 1 | 9 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1C | 10.1021/jm9606507 | ||
CHEMBL11369 | 9765 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 520 | 8 | 1 | 9 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1C | 10.1021/jm9606507 | ||
15411009 | 107163 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 691 | 14 | 1 | 12 | 5.6 | CCOC(=O)C(CC(C)C)NC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL316523 | 107163 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 691 | 14 | 1 | 12 | 5.6 | CCOC(=O)C(CC(C)C)NC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
10391487 | 9629 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3occc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL112832 | 9629 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3occc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
16004692 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
4809 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
7352 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2103873 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
DB08932 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
157574 | 78361 | 11 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 517 | 4 | 1 | 5 | 5.0 | CCc1cc(C2=C(C(=O)O)N(c3ccccc3C(F)(F)F)S(=O)(=O)c3ccccc32)cc2c1OCO2 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2110610 | 78361 | 11 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 517 | 4 | 1 | 5 | 5.0 | CCc1cc(C2=C(C(=O)O)N(c3ccccc3C(F)(F)F)S(=O)(=O)c3ccccc32)cc2c1OCO2 | 10.1016/j.bmcl.2016.06.014 | ||
21041283 | 173123 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 552 | 13 | 2 | 9 | 3.2 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(OC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4521348 | 173123 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 552 | 13 | 2 | 9 | 3.2 | CCCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(OC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
155544917 | 173390 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 540 | 13 | 2 | 10 | 3.4 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2cc(OC)ccc2Cl)c1-c1ncc(SC)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4528516 | 173390 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 540 | 13 | 2 | 10 | 3.4 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2cc(OC)ccc2Cl)c1-c1ncc(SC)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
16004692 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1021/jm3009103 | ||
4809 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1021/jm3009103 | ||
7352 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1021/jm3009103 | ||
CHEMBL2103873 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1021/jm3009103 | ||
DB08932 | 2438 | 91 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1021/jm3009103 | ||
44279554 | 99298 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 512 | 11 | 2 | 7 | 3.8 | COCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(C)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL282187 | 99298 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 512 | 11 | 2 | 7 | 3.8 | COCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(C)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
11754394 | 108601 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 468 | 8 | 2 | 6 | 3.8 | CNC(=O)c1cccc(S(=O)(=O)Nc2ncc(C)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL32066 | 108601 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 468 | 8 | 2 | 6 | 3.8 | CNC(=O)c1cccc(S(=O)(=O)Nc2ncc(C)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
9933950 | 202803 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL62395 | 202803 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
10553384 | 109641 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 498 | 13 | 1 | 7 | 3.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1cccn1 | 10.1021/jm980217s | ||
CHEMBL322537 | 109641 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 498 | 13 | 1 | 7 | 3.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1cccn1 | 10.1021/jm980217s | ||
44333721 | 167769 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.3 | CCOCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL430506 | 167769 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.3 | CCOCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
9916235 | 9321 | 1 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL111277 | 9321 | 1 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 578 | 14 | 1 | 7 | 4.6 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
10994374 | 203393 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 474 | 7 | 1 | 6 | 5.4 | COc1ccc(CC2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL65619 | 203393 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 474 | 7 | 1 | 6 | 5.4 | COc1ccc(CC2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
10651146 | 108837 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 596 | 12 | 1 | 8 | 4.4 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccc(OC)cc1 | 10.1021/jm970101g | ||
CHEMBL321035 | 108837 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 596 | 12 | 1 | 8 | 4.4 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccc(OC)cc1 | 10.1021/jm970101g | ||
10982740 | 203360 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 422 | 5 | 1 | 5 | 5.4 | CC(C)Oc1ccc2c(c1)C(C1CCCC1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL65353 | 203360 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 422 | 5 | 1 | 5 | 5.4 | CC(C)Oc1ccc2c(c1)C(C1CCCC1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10187997 | 109945 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL323464 | 109945 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 564 | 13 | 1 | 7 | 4.2 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1 | 10.1021/jm970101g | ||
10651488 | 163355 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
CHEMBL419367 | 163355 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 618 | 13 | 1 | 7 | 4.8 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)CCCC(F)(F)F | 10.1021/jm970101g | ||
9915510 | 85126 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 8 | 2 | 8 | 3.4 | CCOc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL22513 | 85126 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 8 | 2 | 8 | 3.4 | CCOc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
9915510 | 85126 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 8 | 2 | 8 | 3.4 | CCOc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL22513 | 85126 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 8 | 2 | 8 | 3.4 | CCOc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1007/s00044-004-0021-y | ||
44334097 | 110042 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 447 | 7 | 2 | 6 | 3.7 | COc1ccc([C@@H]2c3nc(CCCO)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL323561 | 110042 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 447 | 7 | 2 | 6 | 3.7 | COc1ccc([C@@H]2c3nc(CCCO)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
10719598 | 206967 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9139 | 206967 | 0 | None | - | 0 | Human | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
9915028 | 9379 | 18 | None | - | 2 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL111612 | 9379 | 18 | None | - | 2 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL4761843 | 9379 | 18 | None | - | 2 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
10886132 | 9777 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 10 | 1 | 9 | 4.8 | COc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)cc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL113757 | 9777 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 10 | 1 | 9 | 4.8 | COc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)cc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL368796 | 9777 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 549 | 10 | 1 | 9 | 4.8 | COc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C)cc2)nc1 | 10.1021/jm0102304 | ||
10744973 | 207253 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 538 | 14 | 1 | 6 | 5.5 | CCCCCN(CCCCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9313 | 207253 | 0 | None | - | 0 | Rat | 9.3 | pIC50 | = | 9.3 | Binding | ChEMBL | 538 | 14 | 1 | 6 | 5.5 | CCCCCN(CCCCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10209779 | 163407 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 560 | 14 | 1 | 7 | 4.5 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
CHEMBL419749 | 163407 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 560 | 14 | 1 | 7 | 4.5 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
11015826 | 203508 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 450 | 6 | 1 | 5 | 6.1 | CC(C)Oc1ccc2c(c1)C(CC1CCCCC1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL66426 | 203508 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 450 | 6 | 1 | 5 | 6.1 | CC(C)Oc1ccc2c(c1)C(CC1CCCCC1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
9915028 | 9379 | 18 | None | 28183 | 2 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210121 | ||
CHEMBL111612 | 9379 | 18 | None | 28183 | 2 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210121 | ||
CHEMBL4761843 | 9379 | 18 | None | 28183 | 2 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210121 | ||
10346184 | 9164 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
CHEMBL110366 | 9164 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
15411005 | 4728 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 677 | 13 | 1 | 12 | 5.2 | CCOC(=O)C(NC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1)C(C)C | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL103846 | 4728 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 677 | 13 | 1 | 12 | 5.2 | CCOC(=O)C(NC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1)C(C)C | 10.1016/S0960-894X(97)00002-4 | ||
10346184 | 9164 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL110366 | 9164 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL2373291 | 210351 | 0 | None | - | 1 | Pig | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
10579303 | 9399 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 590 | 16 | 1 | 8 | 4.5 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCOC)cc1 | 10.1021/jm970101g | ||
CHEMBL111712 | 9399 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 590 | 16 | 1 | 8 | 4.5 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCOC)cc1 | 10.1021/jm970101g | ||
11015645 | 203164 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 438 | 9 | 1 | 5 | 6.1 | CCCCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL64282 | 203164 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 438 | 9 | 1 | 5 | 6.1 | CCCCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10938122 | 162982 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 396 | 5 | 1 | 5 | 4.8 | CC(C)Oc1ccc2c(c1)C(C(C)C)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL417555 | 162982 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 396 | 5 | 1 | 5 | 4.8 | CC(C)Oc1ccc2c(c1)C(C(C)C)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10503921 | 101449 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1noc(C)c1Cl)OCO2 | 10.1021/jm9700068 | ||
CHEMBL297783 | 101449 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1noc(C)c1Cl)OCO2 | 10.1021/jm9700068 | ||
44279141 | 106996 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 498 | 10 | 3 | 7 | 3.2 | COc1nc(C)cnc1NS(=O)(=O)c1cccc(C(=O)NCCO)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL31544 | 106996 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 498 | 10 | 3 | 7 | 3.2 | COc1nc(C)cnc1NS(=O)(=O)c1cccc(C(=O)NCCO)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
10552883 | 109977 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 484 | 13 | 1 | 5 | 4.8 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC=C1CC1 | 10.1021/jm980217s | ||
CHEMBL323485 | 109977 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 484 | 13 | 1 | 5 | 4.8 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC=C1CC1 | 10.1021/jm980217s | ||
10974047 | 9485 | 0 | None | - | 0 | Pig | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 601 | 11 | 1 | 10 | 4.3 | COc1ccc(S(=O)(=O)Nc2ncnc(OCCOc3ncc(Br)cn3)c2-c2ccc(C)cc2)cc1OC | 10.1021/jm0102304 | ||
CHEMBL112162 | 9485 | 0 | None | - | 0 | Pig | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 601 | 11 | 1 | 10 | 4.3 | COc1ccc(S(=O)(=O)Nc2ncnc(OCCOc3ncc(Br)cn3)c2-c2ccc(C)cc2)cc1OC | 10.1021/jm0102304 | ||
10745942 | 9279 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 588 | 13 | 1 | 8 | 4.3 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc2c(c1)OCCO2 | 10.1021/jm970101g | ||
CHEMBL111010 | 9279 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 588 | 13 | 1 | 8 | 4.3 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc2c(c1)OCCO2 | 10.1021/jm970101g | ||
11080933 | 203389 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 454 | 10 | 1 | 6 | 5.7 | CCCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL65599 | 203389 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 454 | 10 | 1 | 6 | 5.7 | CCCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10166223 | 202688 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 552 | 7 | 2 | 7 | 5.5 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)N(C)CC(C)(C)C)c1 | 10.1021/jm030528p | ||
CHEMBL61711 | 202688 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 552 | 7 | 2 | 7 | 5.5 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)N(C)CC(C)(C)C)c1 | 10.1021/jm030528p | ||
10076527 | 14583 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 485 | 7 | 2 | 6 | 4.3 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3ccccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1204990 | 14583 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 485 | 7 | 2 | 6 | 4.3 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3ccccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
10720982 | 127791 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 4.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)C)cc1 | 10.1021/jm031041j | ||
CHEMBL121647 | 127791 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 4.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)C)cc1 | 10.1021/jm031041j | ||
CHEMBL366441 | 127791 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 4.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)C)cc1 | 10.1021/jm031041j | ||
71462320 | 81975 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 570 | 11 | 2 | 8 | 3.9 | Cc1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2165332 | 81975 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 570 | 11 | 2 | 8 | 3.9 | Cc1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
10720982 | 127791 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 4.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL121647 | 127791 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 4.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL366441 | 127791 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 4.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)C)cc1 | 10.1021/jm990171i | ||
10649266 | 9600 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3ccoc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL112685 | 9600 | 0 | None | - | 0 | Rat | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3ccoc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
11505449 | 171460 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 616 | 12 | 3 | 9 | 2.6 | O=C(O)CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4463633 | 171460 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 616 | 12 | 3 | 9 | 2.6 | O=C(O)CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
58688005 | 174936 | 1 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 540 | 11 | 2 | 9 | 3.1 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4565926 | 174936 | 1 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 540 | 11 | 2 | 9 | 3.1 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
71462320 | 81975 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 570 | 11 | 2 | 8 | 3.9 | Cc1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165332 | 81975 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 570 | 11 | 2 | 8 | 3.9 | Cc1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
10746431 | 102279 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 619 | 12 | 1 | 11 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL303484 | 102279 | 0 | None | - | 0 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 619 | 12 | 1 | 11 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
9809919 | 204386 | 0 | None | - | 2 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 665 | 13 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL72037 | 204386 | 0 | None | - | 2 | Human | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | 665 | 13 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL2373292 | 210352 | 0 | None | - | 1 | Pig | 9.2 | pIC50 | = | 9.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)[C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
9870959 | 8885 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 509 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccccn1 | 10.1021/jm980217s | ||
CHEMBL109778 | 8885 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 509 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccccn1 | 10.1021/jm980217s | ||
10916597 | 203292 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL64832 | 203292 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
44284184 | 139975 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 490 | 8 | 2 | 7 | 5.0 | CCOc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL38000 | 139975 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 490 | 8 | 2 | 7 | 5.0 | CCOc1cc(OC)ccc1[C@@H]1c2nc(NC(C)C)ccc2[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL427748 | 213349 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00077a013 | ||||
11827489 | 116960 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 524 | 12 | 1 | 4 | 5.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL338754 | 116960 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 524 | 12 | 1 | 4 | 5.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)c(F)c1 | 10.1021/jm010237l | ||
10984671 | 9441 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 571 | 10 | 1 | 9 | 4.3 | COc1ccc(S(=O)(=O)Nc2ncnc(OCCOc3ncc(Br)cn3)c2-c2ccc(C)cc2)cc1 | 10.1021/jm0102304 | ||
CHEMBL111934 | 9441 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 571 | 10 | 1 | 9 | 4.3 | COc1ccc(S(=O)(=O)Nc2ncnc(OCCOc3ncc(Br)cn3)c2-c2ccc(C)cc2)cc1 | 10.1021/jm0102304 | ||
10648006 | 161642 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 468 | 6 | 1 | 6 | 4.7 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1021/jm9700068 | ||
CHEMBL413093 | 161642 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 468 | 6 | 1 | 6 | 4.7 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1021/jm9700068 | ||
10648135 | 9310 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 472 | 13 | 1 | 5 | 4.7 | C/C=C/CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm031041j | ||
CHEMBL111218 | 9310 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 472 | 13 | 1 | 5 | 4.7 | C/C=C/CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm031041j | ||
10209320 | 9253 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 546 | 12 | 1 | 7 | 4.0 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CC(C)C | 10.1021/jm970101g | ||
CHEMBL110899 | 9253 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 546 | 12 | 1 | 7 | 4.0 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CC(C)C | 10.1021/jm970101g | ||
11038320 | 18841 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 492 | 11 | 1 | 4 | 5.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)cc1 | 10.1021/jm010237l | ||
CHEMBL128240 | 18841 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 492 | 11 | 1 | 4 | 5.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)cc1 | 10.1021/jm010237l | ||
44340049 | 110304 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 500 | 13 | 1 | 5 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL323951 | 110304 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 500 | 13 | 1 | 5 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
10552413 | 110641 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 472 | 13 | 1 | 5 | 4.7 | C/C=C\CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL325935 | 110641 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 472 | 13 | 1 | 5 | 4.7 | C/C=C\CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
44266851 | 14553 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 550 | 11 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1C | 10.1021/jm9606507 | ||
CHEMBL10847 | 14553 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 550 | 11 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1C | 10.1021/jm9606507 | ||
CHEMBL1204671 | 14553 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 550 | 11 | 1 | 9 | 4.7 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1C | 10.1021/jm9606507 | ||
44279316 | 107319 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 518 | 8 | 2 | 6 | 4.0 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc(C(N)=O)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL31763 | 107319 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 518 | 8 | 2 | 6 | 4.0 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc(C(N)=O)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
137649592 | 157386 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 567 | 10 | 2 | 9 | 4.6 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4078537 | 157386 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 567 | 10 | 2 | 9 | 4.6 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
15411003 | 108693 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 589 | 11 | 1 | 10 | 4.8 | C=CCNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL320839 | 108693 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 589 | 11 | 1 | 10 | 4.8 | C=CCNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
10673644 | 9750 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 524 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL113611 | 9750 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 524 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
177236 | 1313 | 45 | None | 2 | 3 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/s0960-894x(01)00660-6 | ||
3508 | 1313 | 45 | None | 2 | 3 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL23261 | 1313 | 45 | None | 2 | 3 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/s0960-894x(01)00660-6 | ||
DB04883 | 1313 | 45 | None | 2 | 3 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/s0960-894x(01)00660-6 | ||
71462322 | 81981 | 11 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 572 | 10 | 2 | 8 | 3.2 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165338 | 81981 | 11 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 572 | 10 | 2 | 8 | 3.2 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
44284199 | 100082 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 552 | 9 | 2 | 7 | 6.2 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OCc2ccccc2)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL287517 | 100082 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 552 | 9 | 2 | 7 | 6.2 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OCc2ccccc2)c1 | 10.1016/j.bmcl.2004.01.008 | ||
10993320 | 202957 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 412 | 6 | 1 | 6 | 4.6 | CC(C)OC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL63067 | 202957 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 412 | 6 | 1 | 6 | 4.6 | CC(C)OC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10097589 | 206258 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 502 | 7 | 2 | 7 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccs2)nn1CC1CCC(C(=O)O)CC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL86965 | 206258 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 502 | 7 | 2 | 7 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccs2)nn1CC1CCC(C(=O)O)CC1 | 10.1016/s0960-894x(00)00513-8 | ||
10792319 | 207211 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 530 | 10 | 1 | 6 | 5.1 | CCCCN(C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm9505369 | ||
CHEMBL9283 | 207211 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 530 | 10 | 1 | 6 | 5.1 | CCCCN(C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm9505369 | ||
10648937 | 207283 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9334 | 207283 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10673644 | 9750 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 524 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
CHEMBL113611 | 9750 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 524 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
10814655 | 207577 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCCN(CC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9502 | 207577 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCCN(CC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44339714 | 111281 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 500 | 14 | 1 | 5 | 5.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC/C=C(/C)CC | 10.1021/jm980217s | ||
CHEMBL326685 | 111281 | 0 | None | - | 0 | Rat | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 500 | 14 | 1 | 5 | 5.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC/C=C(/C)CC | 10.1021/jm980217s | ||
10984617 | 9976 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 565 | 11 | 1 | 10 | 4.9 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(C)cn2)c1 | 10.1021/jm0102304 | ||
CHEMBL114933 | 9976 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 565 | 11 | 1 | 10 | 4.9 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(C)cn2)c1 | 10.1021/jm0102304 | ||
44284183 | 139550 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 518 | 9 | 2 | 7 | 5.7 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OCC(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
CHEMBL37973 | 139550 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 518 | 9 | 2 | 7 | 5.7 | COc1ccc([C@@H]2c3nc(NC(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)c(OCC(C)C)c1 | 10.1016/j.bmcl.2004.01.008 | ||
11027946 | 18881 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 540 | 12 | 1 | 5 | 5.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL128479 | 18881 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 540 | 12 | 1 | 5 | 5.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)c(F)c1 | 10.1021/jm010237l | ||
11006213 | 169245 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 557 | 10 | 1 | 10 | 5.3 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2cccs2)nc1 | 10.1021/jm0102304 | ||
CHEMBL441277 | 169245 | 0 | None | - | 0 | Pig | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 557 | 10 | 1 | 10 | 5.3 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2cccs2)nc1 | 10.1021/jm0102304 | ||
10602743 | 7125 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 550 | 9 | 1 | 10 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1C | 10.1021/jm9606507 | ||
CHEMBL10854 | 7125 | 0 | None | - | 0 | Human | 9.1 | pIC50 | = | 9.1 | Binding | ChEMBL | 550 | 9 | 1 | 10 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1C | 10.1021/jm9606507 | ||
10983992 | 19429 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 12 | 1 | 4 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)cc1 | 10.1021/jm010237l | ||
CHEMBL129740 | 19429 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 12 | 1 | 4 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)cc1 | 10.1021/jm010237l | ||
44333598 | 109163 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.6 | CCCOc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL321520 | 109163 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.6 | CCCOc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
11037806 | 202801 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 456 | 10 | 2 | 7 | 4.3 | CC(C)Oc1ccc2c(c1)C(OCCCCCO)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL62376 | 202801 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 456 | 10 | 2 | 7 | 4.3 | CC(C)Oc1ccc2c(c1)C(OCCCCCO)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10788494 | 170599 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 424 | 6 | 1 | 6 | 4.5 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm9700068 | ||
CHEMBL445101 | 170599 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 424 | 6 | 1 | 6 | 4.5 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm9700068 | ||
10768294 | 14556 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 520 | 10 | 1 | 8 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1C | 10.1021/jm9606507 | ||
CHEMBL10922 | 14556 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 520 | 10 | 1 | 8 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1C | 10.1021/jm9606507 | ||
CHEMBL1204674 | 14556 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 520 | 10 | 1 | 8 | 4.7 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1C | 10.1021/jm9606507 | ||
10625694 | 11414 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 516 | 9 | 2 | 6 | 4.5 | CCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL1180344 | 11414 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 516 | 9 | 2 | 6 | 4.5 | CCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL123107 | 11414 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 516 | 9 | 2 | 6 | 4.5 | CCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
9868379 | 100756 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 450 | 5 | 1 | 6 | 5.6 | Cc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)s1 | 10.1021/jm010382z | ||
CHEMBL293012 | 100756 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 450 | 5 | 1 | 6 | 5.6 | Cc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)s1 | 10.1021/jm010382z | ||
44332842 | 109694 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 703 | 11 | 1 | 10 | 7.5 | COc1ccc(C2(OC(=O)N[C@@H](C)c3cccc4ccccc34)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL322920 | 109694 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 703 | 11 | 1 | 10 | 7.5 | COc1ccc(C2(OC(=O)N[C@@H](C)c3cccc4ccccc34)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
44314904 | 103120 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 585 | 12 | 5 | 5 | 3.6 | CSCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL307936 | 103120 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 585 | 12 | 5 | 5 | 3.6 | CSCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
10649321 | 110919 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL326191 | 110919 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
3951 | 390 | 86 | None | -1 | 2 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
4337 | 390 | 86 | None | -1 | 2 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
6918493 | 390 | 86 | None | -1 | 2 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL1111 | 390 | 86 | None | -1 | 2 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
DB06403 | 390 | 86 | None | -1 | 2 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
9868379 | 100756 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 450 | 5 | 1 | 6 | 5.6 | Cc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)s1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL293012 | 100756 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 450 | 5 | 1 | 6 | 5.6 | Cc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)s1 | 10.1016/j.bmcl.2016.06.014 | ||
155519384 | 170394 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 674 | 12 | 1 | 13 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)c1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4448273 | 170394 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 674 | 12 | 1 | 13 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)c1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
155551580 | 173969 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 526 | 12 | 2 | 10 | 3.0 | CCNS(=O)(=O)Nc1ncnc(OCCOc2cc(OC)ccc2Cl)c1-c1ncc(SC)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4542394 | 173969 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 526 | 12 | 2 | 10 | 3.0 | CCNS(=O)(=O)Nc1ncnc(OCCOc2cc(OC)ccc2Cl)c1-c1ncc(SC)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
10146305 | 174247 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 656 | 14 | 2 | 13 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2cccs2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4549357 | 174247 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 656 | 14 | 2 | 13 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2cccs2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
44439102 | 90270 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 508 | 8 | 1 | 7 | 5.2 | CN(Cc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1ccno1)C(=O)CC(C)(C)C | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL238539 | 90270 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 508 | 8 | 1 | 7 | 5.2 | CN(Cc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1ccno1)C(=O)CC(C)(C)C | 10.1016/j.bmcl.2006.10.009 | ||
71460621 | 81972 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 602 | 13 | 2 | 10 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1021/jm3009103 | ||
CHEMBL2165329 | 81972 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 602 | 13 | 2 | 10 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1021/jm3009103 | ||
44295173 | 14601 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 554 | 10 | 1 | 9 | 5.3 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1Cl | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205090 | 14601 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 554 | 10 | 1 | 9 | 5.3 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1Cl | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL51234 | 14601 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 554 | 10 | 1 | 9 | 5.3 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1Cl | 10.1016/s0960-894x(98)00301-1 | ||
44279398 | 99861 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 454 | 8 | 2 | 6 | 3.6 | COc1nc(C)cnc1NS(=O)(=O)c1cccc(C(N)=O)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL285976 | 99861 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 454 | 8 | 2 | 6 | 3.6 | COc1nc(C)cnc1NS(=O)(=O)c1cccc(C(N)=O)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
44279294 | 99868 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 546 | 8 | 1 | 6 | 4.6 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc(C(=O)N(C)C)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL286014 | 99868 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 546 | 8 | 1 | 6 | 4.6 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc(C(=O)N(C)C)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
10897248 | 9477 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 591 | 9 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc4ccccc4c3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL112134 | 9477 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 591 | 9 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc4ccccc4c3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
11136124 | 10338 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 667 | 9 | 1 | 8 | 4.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(I)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL116220 | 10338 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 667 | 9 | 1 | 8 | 4.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(I)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
10211781 | 129715 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367453 | 129715 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10146640 | 207531 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 689 | 12 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL94786 | 207531 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 689 | 12 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10555191 | 203769 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 577 | 12 | 1 | 10 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL68269 | 203769 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 577 | 12 | 1 | 10 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL1790519 | 208870 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N(C)[C@@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1021/jm970161m | ||||
44311346 | 103136 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 681 | 13 | 2 | 13 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCSCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL308088 | 103136 | 0 | None | - | 1 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 681 | 13 | 2 | 13 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCSCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44340049 | 110304 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 500 | 13 | 1 | 5 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL323951 | 110304 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9 | Binding | ChEMBL | 500 | 13 | 1 | 5 | 5.3 | C/C=C\C(C)(C)C[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
44339662 | 9820 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 527 | 13 | 1 | 7 | 4.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1nc(C)c(C)o1 | 10.1021/jm980217s | ||
CHEMBL114074 | 9820 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 527 | 13 | 1 | 7 | 4.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1nc(C)c(C)o1 | 10.1021/jm980217s | ||
44351961 | 18804 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 522 | 13 | 1 | 5 | 5.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CCC)cc1 | 10.1021/jm010237l | ||
CHEMBL128061 | 18804 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 522 | 13 | 1 | 5 | 5.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CCC)cc1 | 10.1021/jm010237l | ||
10553384 | 109641 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 498 | 13 | 1 | 7 | 3.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1cccn1 | 10.1021/jm980217s | ||
CHEMBL322537 | 109641 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 498 | 13 | 1 | 7 | 3.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1cccn1 | 10.1021/jm980217s | ||
9909467 | 205488 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 409 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80782 | 205488 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 409 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1Br | 10.1016/0960-894X(96)00441-6 | ||
9827093 | 173400 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 494 | 9 | 2 | 7 | 5.1 | CCCc1nc(SC2CCC(CC(=O)O)CC2)c(C(=O)O)n1Cc1cc2c(cc1Cl)OCO2 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4528664 | 173400 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 494 | 9 | 2 | 7 | 5.1 | CCCc1nc(SC2CCC(CC(=O)O)CC2)c(C(=O)O)n1Cc1cc2c(cc1Cl)OCO2 | 10.1016/j.bmcl.2016.06.014 | ||
10347080 | 85198 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 535 | 7 | 2 | 8 | 3.0 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL22562 | 85198 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 535 | 7 | 2 | 8 | 3.0 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
10347080 | 85198 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 535 | 7 | 2 | 8 | 3.0 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL22562 | 85198 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 535 | 7 | 2 | 8 | 3.0 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1007/s00044-004-0021-y | ||
71449713 | 81639 | 27 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 585 | 11 | 1 | 8 | 4.5 | CCCCS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2163694 | 81639 | 27 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 585 | 11 | 1 | 8 | 4.5 | CCCCS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
71458719 | 81649 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 647 | 15 | 1 | 13 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(SC)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163704 | 81649 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 647 | 15 | 1 | 13 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(SC)cn1 | 10.1021/jm3009103 | ||
17885918 | 105946 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 458 | 6 | 1 | 6 | 5.9 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccsc2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL313044 | 105946 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 458 | 6 | 1 | 6 | 5.9 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccsc2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
9846994 | 105962 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 458 | 6 | 1 | 6 | 5.9 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccs2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL313153 | 105962 | 0 | None | - | 0 | Rat | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 458 | 6 | 1 | 6 | 5.9 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccs2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
44380976 | 165602 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 639 | 10 | 1 | 8 | 6.7 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(C(C)C)nc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL424358 | 165602 | 0 | None | - | 0 | Pig | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 639 | 10 | 1 | 8 | 6.7 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(C(C)C)nc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/s0960-894x(01)00682-5 | ||
10505755 | 14552 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 10 | 1 | 8 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL10832 | 14552 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 10 | 1 | 8 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL1204670 | 14552 | 0 | None | - | 0 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 10 | 1 | 8 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(OC)c2OC)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
9870830 | 206691 | 38 | None | 66 | 2 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL8981 | 206691 | 38 | None | 66 | 2 | Human | 9.0 | pIC50 | = | 9.0 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
10142669 | 9412 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 518 | 11 | 1 | 7 | 3.3 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CC | 10.1021/jm970101g | ||
CHEMBL111769 | 9412 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 518 | 11 | 1 | 7 | 3.3 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CC | 10.1021/jm970101g | ||
137637038 | 155917 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 581 | 11 | 2 | 9 | 5.0 | CCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4061110 | 155917 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 581 | 11 | 2 | 9 | 5.0 | CCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10649321 | 110919 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
CHEMBL326191 | 110919 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 508 | 12 | 1 | 5 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
10576427 | 5338 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 473 | 6 | 2 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(NC(C)=O)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10697 | 5338 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 473 | 6 | 2 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(NC(C)=O)cc2)cc1 | 10.1021/jm9606507 | ||
21041324 | 81635 | 5 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 542 | 11 | 2 | 8 | 3.5 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 | 10.1021/jm3009103 | ||
CHEMBL2163690 | 81635 | 5 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 542 | 11 | 2 | 8 | 3.5 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 | 10.1021/jm3009103 | ||
11093167 | 10021 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 593 | 11 | 1 | 9 | 6.3 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C(C)C)cc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL115230 | 10021 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 593 | 11 | 1 | 9 | 6.3 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccc(C(C)C)cc2)nc1 | 10.1021/jm0102304 | ||
11813644 | 110350 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccncn2)c1 | 10.1021/jm0102304 | ||
CHEMBL324246 | 110350 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccncn2)c1 | 10.1021/jm0102304 | ||
CHEMBL414165 | 213092 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](c2cccs2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10719598 | 206967 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9139 | 206967 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCN(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44279296 | 110603 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 532 | 8 | 2 | 6 | 4.3 | CNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL32572 | 110603 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 532 | 8 | 2 | 6 | 4.3 | CNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
10206812 | 199612 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 492 | 6 | 2 | 8 | 5.0 | Cc1cc(-c2ncco2)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL59288 | 199612 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 492 | 6 | 2 | 8 | 5.0 | Cc1cc(-c2ncco2)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
11102609 | 168546 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 462 | 6 | 1 | 6 | 5.2 | COc1ccc([C@@H]2c3cc(OC(C)C)ccc3O[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1021/jm031041j | ||
CHEMBL435773 | 168546 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 462 | 6 | 1 | 6 | 5.2 | COc1ccc([C@@H]2c3cc(OC(C)C)ccc3O[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1021/jm031041j | ||
10603546 | 110420 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCC)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL324639 | 110420 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 592 | 15 | 1 | 7 | 5.0 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCC)c(F)c1 | 10.1021/jm970101g | ||
11102609 | 168546 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 462 | 6 | 1 | 6 | 5.2 | COc1ccc([C@@H]2c3cc(OC(C)C)ccc3O[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1021/jm010382z | ||
CHEMBL435773 | 168546 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 462 | 6 | 1 | 6 | 5.2 | COc1ccc([C@@H]2c3cc(OC(C)C)ccc3O[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1021/jm010382z | ||
10576910 | 108512 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 486 | 13 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC=C(C)C | 10.1021/jm980217s | ||
CHEMBL320124 | 108512 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 486 | 13 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC=C(C)C | 10.1021/jm980217s | ||
10278777 | 168108 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 502 | 14 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL432974 | 168108 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 502 | 14 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
10767586 | 9737 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 496 | 13 | 1 | 5 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(OC)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL113529 | 9737 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 496 | 13 | 1 | 5 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(OC)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
58688008 | 175278 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 496 | 11 | 2 | 9 | 3.0 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4573273 | 175278 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 496 | 11 | 2 | 9 | 3.0 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
23670447 | 3007 | 2 | None | - | 2 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(98)00301-1 | ||
999 | 3007 | 2 | None | - | 2 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1204799 | 3007 | 2 | None | - | 2 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL25438 | 3007 | 2 | None | - | 2 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1016/s0960-894x(98)00301-1 | ||
44320480 | 105931 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 442 | 6 | 1 | 6 | 5.4 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccco2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL312979 | 105931 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 442 | 6 | 1 | 6 | 5.4 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccco2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
17885920 | 206418 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 502 | 7 | 2 | 7 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccs2)nn1CC1CCCC(C(=O)O)C1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL88011 | 206418 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 502 | 7 | 2 | 7 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccs2)nn1CC1CCCC(C(=O)O)C1 | 10.1016/s0960-894x(00)00513-8 | ||
44291775 | 101140 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 506 | 6 | 1 | 10 | 4.1 | CC#N.Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2cc3c(cc2C#N)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL295557 | 101140 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 506 | 6 | 1 | 10 | 4.1 | CC#N.Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2cc3c(cc2C#N)OCO3)c1Cl | 10.1021/jm9700068 | ||
10280278 | 100816 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 535 | 7 | 2 | 7 | 6.1 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)C2CCCCC2)c1 | 10.1021/jm030528p | ||
CHEMBL293421 | 100816 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 535 | 7 | 2 | 7 | 6.1 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)C2CCCCC2)c1 | 10.1021/jm030528p | ||
11071347 | 117780 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 516 | 11 | 1 | 5 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(F)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL340190 | 117780 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 516 | 11 | 1 | 5 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(F)c(F)c1 | 10.1021/jm010237l | ||
10745564 | 6193 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 566 | 11 | 1 | 7 | 4.4 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccccc1 | 10.1021/jm970101g | ||
CHEMBL108142 | 6193 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 566 | 11 | 1 | 7 | 4.4 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccccc1 | 10.1021/jm970101g | ||
11125029 | 10007 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 627 | 11 | 2 | 9 | 4.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C(=O)O)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL115147 | 10007 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 627 | 11 | 2 | 9 | 4.6 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C(=O)O)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
15453177 | 205498 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80857 | 205498 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10790757 | 97184 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL268480 | 97184 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
10554273 | 9378 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 532 | 13 | 1 | 7 | 4.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C1OCCO1 | 10.1021/jm980217s | ||
CHEMBL111611 | 9378 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 532 | 13 | 1 | 7 | 4.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C1OCCO1 | 10.1021/jm980217s | ||
8260 | 529 | 54 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | 10.1016/j.bmcl.2016.06.014 | ||
9912992 | 529 | 54 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL3989834 | 529 | 54 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | 10.1016/j.bmcl.2016.06.014 | ||
18630945 | 170968 | 1 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 507 | 9 | 1 | 9 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4456288 | 170968 | 1 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 507 | 9 | 1 | 9 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OC | 10.1016/j.bmcl.2016.06.014 | ||
155542285 | 173053 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 522 | 14 | 2 | 11 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1Oc1cccc(OC)c1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4519822 | 173053 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 522 | 14 | 2 | 11 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1Oc1cccc(OC)c1 | 10.1016/j.bmcl.2016.06.014 | ||
11477084 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
216235 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
3548 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
3950 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
CHEMBL282724 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
DB06268 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
22467234 | 85324 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 534 | 7 | 1 | 8 | 4.1 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(C)=O)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261599 | 85324 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 534 | 7 | 1 | 8 | 4.1 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(C)=O)ccc12 | 10.1007/s00044-004-0021-y | ||
21041372 | 81671 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 687 | 14 | 2 | 12 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(N2CCOCC2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163725 | 81671 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 687 | 14 | 2 | 12 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(N2CCOCC2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
21041370 | 81973 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 636 | 13 | 2 | 10 | 4.4 | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1021/jm3009103 | ||
CHEMBL2165330 | 81973 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 636 | 13 | 2 | 10 | 4.4 | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)c1 | 10.1021/jm3009103 | ||
21979593 | 81976 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 590 | 11 | 2 | 8 | 4.3 | O=S(=O)(NCc1ccccc1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165333 | 81976 | 0 | None | - | 0 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 590 | 11 | 2 | 8 | 4.3 | O=S(=O)(NCc1ccccc1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 | 10.1021/jm3009103 | ||
44295177 | 14749 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 534 | 10 | 1 | 9 | 5.0 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1C | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206680 | 14749 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 534 | 10 | 1 | 9 | 5.0 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1C | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL295483 | 14749 | 0 | None | - | 0 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 534 | 10 | 1 | 9 | 5.0 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1C | 10.1016/s0960-894x(98)00301-1 | ||
104865 | 703 | 99 | None | -1 | 4 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
3494 | 703 | 99 | None | -1 | 4 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
392 | 703 | 99 | None | -1 | 4 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
CHEMBL957 | 703 | 99 | None | -1 | 4 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
DB00559 | 703 | 99 | None | -1 | 4 | Rat | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
10952199 | 9991 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 609 | 9 | 1 | 8 | 5.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL115017 | 9991 | 0 | None | - | 0 | Pig | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 609 | 9 | 1 | 8 | 5.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
11477084 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
216235 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
3548 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
3950 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
CHEMBL282724 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
DB06268 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
11477084 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
216235 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
3548 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
3950 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
CHEMBL282724 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
DB06268 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
11477084 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm000349x | ||
216235 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm000349x | ||
3548 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm000349x | ||
3950 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm000349x | ||
CHEMBL282724 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm000349x | ||
DB06268 | 3583 | 53 | None | 1 | 2 | Human | 8.9 | pIC50 | = | 8.9 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm000349x | ||
42630655 | 18375 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 557 | 11 | 2 | 7 | 5.5 | CCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271586 | 18375 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 557 | 11 | 2 | 7 | 5.5 | CCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
11409462 | 198665 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 501 | 6 | 2 | 6 | 6.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(-c2ccccc2)c1 | 10.1021/jm030528p | ||
CHEMBL58058 | 198665 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 501 | 6 | 2 | 6 | 6.0 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(-c2ccccc2)c1 | 10.1021/jm030528p | ||
10505771 | 163332 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 506 | 12 | 1 | 4 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
CHEMBL419211 | 163332 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 506 | 12 | 1 | 4 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm010237l | ||
11026025 | 202862 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 412 | 7 | 1 | 6 | 4.6 | CCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL62669 | 202862 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 412 | 7 | 1 | 6 | 4.6 | CCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10649122 | 9707 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 502 | 12 | 1 | 4 | 5.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(F)c(F)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL113400 | 9707 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 502 | 12 | 1 | 4 | 5.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(F)c(F)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10505771 | 163332 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 506 | 12 | 1 | 4 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL419211 | 163332 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 506 | 12 | 1 | 4 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
21041297 | 169583 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 510 | 12 | 2 | 9 | 3.4 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4436531 | 169583 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 510 | 12 | 2 | 9 | 3.4 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
71453357 | 81653 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 707 | 12 | 1 | 12 | 5.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163708 | 81653 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 707 | 12 | 1 | 12 | 5.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1016/s0960-894x(98)00301-1 | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1016/s0960-894x(98)00301-1 | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1016/s0960-894x(98)00301-1 | ||
44279303 | 107069 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 576 | 11 | 2 | 7 | 4.3 | COCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL31592 | 107069 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 576 | 11 | 2 | 7 | 4.3 | COCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
10302092 | 111310 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 532 | 12 | 1 | 7 | 3.7 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCC | 10.1021/jm970101g | ||
CHEMBL326861 | 111310 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 532 | 12 | 1 | 7 | 3.7 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCC | 10.1021/jm970101g | ||
10768903 | 12102 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 544 | 11 | 2 | 6 | 5.3 | CCCCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL1184133 | 12102 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 544 | 11 | 2 | 6 | 5.3 | CCCCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL334076 | 12102 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 544 | 11 | 2 | 6 | 5.3 | CCCCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
11733231 | 202821 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1cccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)c1 | 10.1021/jm010382z | ||
CHEMBL62465 | 202821 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1cccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)c1 | 10.1021/jm010382z | ||
9872534 | 175999 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 521 | 11 | 2 | 10 | 3.5 | COc1ccccc1Oc1c(NS(=O)(=O)/C=C/c2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4590018 | 175999 | 0 | None | - | 0 | Rat | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 521 | 11 | 2 | 10 | 3.5 | COc1ccccc1Oc1c(NS(=O)(=O)/C=C/c2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
44439103 | 91922 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 859 | 27 | 2 | 14 | 5.3 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCC(=O)N(C)Cc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2ccno2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL241460 | 91922 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 859 | 27 | 2 | 14 | 5.3 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCC(=O)N(C)Cc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2ccno2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
67952994 | 81977 | 14 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 634 | 11 | 2 | 8 | 4.4 | O=S(=O)(NCc1ccccc1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165334 | 81977 | 14 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 634 | 11 | 2 | 8 | 4.4 | O=S(=O)(NCc1ccccc1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
19689505 | 58884 | 0 | None | - | 0 | Pig | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 639 | 11 | 1 | 8 | 6.5 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(-c2ccc(C)cc2)c(OCCOc2ncc(Br)cn2)n1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL168904 | 58884 | 0 | None | - | 0 | Pig | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 639 | 11 | 1 | 8 | 6.5 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(-c2ccc(C)cc2)c(OCCOc2ncc(Br)cn2)n1 | 10.1016/s0960-894x(01)00682-5 | ||
44334065 | 167798 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 429 | 5 | 1 | 5 | 4.7 | COc1ccc([C@@H]2c3nc(C4CC4)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL430695 | 167798 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 429 | 5 | 1 | 5 | 4.7 | COc1ccc([C@@H]2c3nc(C4CC4)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
10719367 | 98202 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)cc(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL274359 | 98202 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)cc(OC)c2)cc1 | 10.1021/jm9606507 | ||
12286 | 945 | 36 | None | 1348 | 2 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
6433095 | 945 | 36 | None | 1348 | 2 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL109648 | 945 | 36 | None | 1348 | 2 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
DB06677 | 945 | 36 | None | 1348 | 2 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
22467237 | 85314 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 549 | 8 | 3 | 8 | 2.3 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccc(CC(=O)O)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261357 | 85314 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 549 | 8 | 3 | 8 | 2.3 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccc(CC(=O)O)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1007/s00044-004-0021-y | ||
71455063 | 81666 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 646 | 15 | 2 | 12 | 3.8 | CCCCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163720 | 81666 | 0 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 646 | 15 | 2 | 12 | 3.8 | CCCCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
21041267 | 81980 | 13 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 558 | 9 | 2 | 8 | 2.8 | CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165337 | 81980 | 13 | None | - | 0 | Human | 8.8 | pIC50 | = | 8.8 | Binding | ChEMBL | 558 | 9 | 2 | 8 | 2.8 | CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
10813261 | 60397 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL175129 | 60397 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
9955200 | 9300 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL11115 | 9300 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
10601668 | 98418 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)cc2OC)cc1 | 10.1021/jm9606507 | ||
CHEMBL275701 | 98418 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)cc2OC)cc1 | 10.1021/jm9606507 | ||
10973523 | 202838 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 537 | 7 | 1 | 8 | 4.2 | COc1ccc(C2=C(C(=O)NS(C)(=O)=O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL62578 | 202838 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 537 | 7 | 1 | 8 | 4.2 | COc1ccc(C2=C(C(=O)NS(C)(=O)=O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
11122785 | 202952 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 426 | 8 | 1 | 6 | 4.6 | COCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL63057 | 202952 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 426 | 8 | 1 | 6 | 4.6 | COCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10649546 | 108587 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 516 | 13 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1CCCCO1 | 10.1021/jm980217s | ||
CHEMBL320569 | 108587 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 516 | 13 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1CCCCO1 | 10.1021/jm980217s | ||
CHEMBL2304015 | 209448 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | None | None | None | Cc1[nH]c2ccccc2c1C[C@@H]1NC(=O)[C@@H](C2CC2)NC(=O)[C@H](C2CCCC2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC1=O | 10.1021/jm9600914 | ||||
10029171 | 98737 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 505 | 6 | 2 | 7 | 3.0 | Cc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL278109 | 98737 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 505 | 6 | 2 | 7 | 3.0 | Cc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
11800804 | 161812 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 550 | 10 | 4 | 5 | 4.7 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N(C)C2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL414605 | 161812 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 550 | 10 | 4 | 5 | 4.7 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N(C)C2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
42630655 | 18375 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 557 | 11 | 2 | 7 | 5.5 | CCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1271586 | 18375 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 557 | 11 | 2 | 7 | 5.5 | CCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10504475 | 206929 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 468 | 8 | 1 | 6 | 3.4 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)CC(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL9119 | 206929 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 468 | 8 | 1 | 6 | 3.4 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)CC(C)C)cc1 | 10.1021/jm9505369 | ||
71456863 | 81661 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 680 | 14 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2163716 | 81661 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 680 | 14 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
10971938 | 202953 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 424 | 7 | 1 | 5 | 5.6 | CC(C)CCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL63058 | 202953 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 424 | 7 | 1 | 5 | 5.6 | CC(C)CCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
44315008 | 102804 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 665 | 13 | 5 | 5 | 4.7 | CCSCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL305524 | 102804 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 665 | 13 | 5 | 5 | 4.7 | CCSCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
71453356 | 81636 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 554 | 13 | 2 | 10 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1Oc1cccc(OC)c1 | 10.1021/jm3009103 | ||
CHEMBL2163691 | 81636 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 554 | 13 | 2 | 10 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1Oc1cccc(OC)c1 | 10.1021/jm3009103 | ||
71456863 | 81661 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 680 | 14 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163716 | 81661 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 680 | 14 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
11827768 | 9843 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncccn2)c1 | 10.1021/jm0102304 | ||
CHEMBL114201 | 9843 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncccn2)c1 | 10.1021/jm0102304 | ||
44387543 | 60532 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 759 | 9 | 1 | 9 | 8.1 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(Cl)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1.O=C1C2=C(CCCC2)c2ccccc21 | 10.1021/jm0102304 | ||
CHEMBL175931 | 60532 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 759 | 9 | 1 | 9 | 8.1 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(Cl)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1.O=C1C2=C(CCCC2)c2ccccc21 | 10.1021/jm0102304 | ||
44334129 | 108527 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 459 | 8 | 1 | 5 | 5.5 | CCCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL320208 | 108527 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 459 | 8 | 1 | 5 | 5.5 | CCCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
10507467 | 8468 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 580 | 12 | 1 | 7 | 4.5 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)Cc1ccccc1 | 10.1021/jm970101g | ||
CHEMBL109408 | 8468 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 580 | 12 | 1 | 7 | 4.5 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)Cc1ccccc1 | 10.1021/jm970101g | ||
10118046 | 9404 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 504 | 10 | 1 | 7 | 2.9 | CCCS(=O)(=O)N(C)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
CHEMBL111728 | 9404 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 504 | 10 | 1 | 7 | 2.9 | CCCS(=O)(=O)N(C)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
10597575 | 6864 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 408 | 5 | 1 | 6 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2CC2CCCC2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10843 | 6864 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 408 | 5 | 1 | 6 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2CC2CCCC2)cc1 | 10.1021/jm9606507 | ||
10671928 | 7244 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 467 | 5 | 1 | 7 | 4.4 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2nccc3ccccc23)cc1 | 10.1021/jm9606507 | ||
CHEMBL10860 | 7244 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 467 | 5 | 1 | 7 | 4.4 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2nccc3ccccc23)cc1 | 10.1021/jm9606507 | ||
10791988 | 8551 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 516 | 13 | 1 | 6 | 4.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1CCOCC1 | 10.1021/jm980217s | ||
CHEMBL109474 | 8551 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 516 | 13 | 1 | 6 | 4.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1CCOCC1 | 10.1021/jm980217s | ||
10792934 | 163889 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 558 | 10 | 2 | 6 | 5.6 | CCc1cc(CC)c(NC(=O)CN2C[C@H](c3ccc4c(c3)OCO4)[C@@H](C(=O)O)[C@@H]2c2ccc(OC)cc2)c(CC)c1 | 10.1021/jm990170q | ||
CHEMBL420729 | 163889 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 558 | 10 | 2 | 6 | 5.6 | CCc1cc(CC)c(NC(=O)CN2C[C@H](c3ccc4c(c3)OCO4)[C@@H](C(=O)O)[C@@H]2c2ccc(OC)cc2)c(CC)c1 | 10.1021/jm990170q | ||
9939960 | 175551 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 704 | 13 | 2 | 11 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)cc(C(=O)N2CCN(C)CC2)cc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4579445 | 175551 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 704 | 13 | 2 | 11 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)cc(C(=O)N2CCN(C)CC2)cc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
127035070 | 136447 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 647 | 11 | 2 | 7 | 7.3 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735931 | 136447 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 647 | 11 | 2 | 7 | 7.3 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
127036865 | 137399 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 584 | 10 | 3 | 7 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3753406 | 137399 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 584 | 10 | 3 | 7 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
9875246 | 120283 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 733 | 15 | 2 | 12 | 6.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(SCCC(=O)O)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL352775 | 120283 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 733 | 15 | 2 | 12 | 6.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(SCCC(=O)O)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
10696210 | 99520 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 483 | 6 | 2 | 9 | 3.7 | CC(=O)c1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
CHEMBL283535 | 99520 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 483 | 6 | 2 | 9 | 3.7 | CC(=O)c1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
44291884 | 172874 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 483 | 6 | 2 | 9 | 3.7 | CC(=O)c1c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)ccc2c1OCO2 | 10.1021/jm9700068 | ||
CHEMBL45160 | 172874 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 483 | 6 | 2 | 9 | 3.7 | CC(=O)c1c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)ccc2c1OCO2 | 10.1021/jm9700068 | ||
10671037 | 131418 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL273660 | 131418 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL369085 | 131418 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
10673756 | 203439 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 529 | 9 | 1 | 8 | 4.3 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCN3CCCC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL65939 | 203439 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 529 | 9 | 1 | 8 | 4.3 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCN3CCCC3)c2)cc1 | 10.1021/jm980504w | ||
10475644 | 203109 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 392 | 5 | 1 | 6 | 3.2 | COc1nc(Cl)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6412 | 203109 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 392 | 5 | 1 | 6 | 3.2 | COc1nc(Cl)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
10696210 | 99520 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 483 | 6 | 2 | 9 | 3.7 | CC(=O)c1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm000349x | ||
CHEMBL283535 | 99520 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 483 | 6 | 2 | 9 | 3.7 | CC(=O)c1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm000349x | ||
71456862 | 81654 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 651 | 12 | 1 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163709 | 81654 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 651 | 12 | 1 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
44291583 | 101363 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 500 | 8 | 3 | 9 | 2.9 | COc1cc(OC)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(N)=O)c1 | 10.1021/jm9608366 | ||
CHEMBL297215 | 101363 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 500 | 8 | 3 | 9 | 2.9 | COc1cc(OC)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(N)=O)c1 | 10.1021/jm9608366 | ||
44278215 | 99530 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 491 | 5 | 1 | 9 | 4.7 | O=C(O)c1c(Sc2ccc3c(c2)OCO3)c2cc3c(cc2n1Cc1ccc2c(c1)OCO2)OCO3 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL283598 | 99530 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 491 | 5 | 1 | 9 | 4.7 | O=C(O)c1c(Sc2ccc3c(c2)OCO3)c2cc3c(cc2n1Cc1ccc2c(c1)OCO2)OCO3 | 10.1016/0960-894X(96)00232-6 | ||
10841576 | 11411 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 620 | 11 | 2 | 6 | 6.3 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1CC | 10.1021/jm990171i | ||
CHEMBL1180336 | 11411 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 620 | 11 | 2 | 6 | 6.3 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1CC | 10.1021/jm990171i | ||
CHEMBL122673 | 11411 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 620 | 11 | 2 | 6 | 6.3 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1CC | 10.1021/jm990171i | ||
CHEMBL94907 | 215891 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
CHEMBL2304010 | 209443 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | None | None | None | CSC(C)(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Cl)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
10792316 | 168458 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 530 | 8 | 2 | 6 | 5.3 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(C)cccc2C(C)C)cc1 | 10.1021/jm990170q | ||
CHEMBL435185 | 168458 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 530 | 8 | 2 | 6 | 5.3 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(C)cccc2C(C)C)cc1 | 10.1021/jm990170q | ||
18738890 | 99119 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 548 | 7 | 1 | 8 | 4.5 | COC(=O)c1ccc2c(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)cn(C)c2c1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL281121 | 99119 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 548 | 7 | 1 | 8 | 4.5 | COC(=O)c1ccc2c(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)cn(C)c2c1 | 10.1016/s0960-894x(01)00660-6 | ||
23445498 | 206677 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 426 | 4 | 1 | 5 | 4.9 | Cc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL89688 | 206677 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7 | Binding | ChEMBL | 426 | 4 | 1 | 5 | 4.9 | Cc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(96)00496-9 | ||
10265127 | 96807 | 2 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(F)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL26522 | 96807 | 2 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(F)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL315047 | 211163 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
44327659 | 109795 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 937 | 26 | 9 | 8 | 4.6 | CCC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)C(c1ccccc1)c1ccccc1 | 10.1021/jm00015a003 | ||
CHEMBL323331 | 109795 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 937 | 26 | 9 | 8 | 4.6 | CCC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)C(c1ccccc1)c1ccccc1 | 10.1021/jm00015a003 | ||
CHEMBL318020 | 211186 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
44316685 | 205025 | 1 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 266 | 3 | 1 | 4 | 2.4 | Cc1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL77090 | 205025 | 1 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 266 | 3 | 1 | 4 | 2.4 | Cc1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
10022291 | 112001 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 374 | 9 | 1 | 3 | 5.1 | O=C(O)CCC(C(=O)c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL328964 | 112001 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 374 | 9 | 1 | 3 | 5.1 | O=C(O)CCC(C(=O)c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
12060119 | 110364 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 441 | 7 | 2 | 6 | 3.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL324304 | 110364 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 441 | 7 | 2 | 6 | 3.9 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
4568158 | 111380 | 1 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 400 | 8 | 2 | 4 | 4.9 | O=C(O)c1cc(-c2ccc(OCc3ccccc3)cc2OCc2ccccc2)[nH]n1 | 10.1021/jm9707131 | ||
CHEMBL327247 | 111380 | 1 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 400 | 8 | 2 | 4 | 4.9 | O=C(O)c1cc(-c2ccc(OCc3ccccc3)cc2OCc2ccccc2)[nH]n1 | 10.1021/jm9707131 | ||
CHEMBL315047 | 211163 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
10568280 | 203080 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 328 | 4 | 1 | 5 | 2.5 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnccn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6399 | 203080 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 328 | 4 | 1 | 5 | 2.5 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnccn3)cccc12 | 10.1021/jm9604585 | ||
10553319 | 61038 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 496 | 11 | 5 | 4 | 3.8 | CCN(CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C)[nH]1 | 10.1021/jm950592+ | ||
CHEMBL176430 | 61038 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 496 | 11 | 5 | 4 | 3.8 | CCN(CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C)[nH]1 | 10.1021/jm950592+ | ||
10006086 | 121036 | 0 | None | - | 0 | Pig | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 498 | 9 | 2 | 5 | 4.6 | COc1ccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2c[nH]c3ccccc23)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL356916 | 121036 | 0 | None | - | 0 | Pig | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 498 | 9 | 2 | 5 | 4.6 | COc1ccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2c[nH]c3ccccc23)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
10381122 | 99169 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N)cc3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL281427 | 99169 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N)cc3c2)c1C | 10.1021/jm00008a013 | ||
44327466 | 96422 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 966 | 25 | 9 | 8 | 5.2 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(C)(C)C)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL262229 | 96422 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 966 | 25 | 9 | 8 | 5.2 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(C)(C)C)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
18617385 | 205189 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 286 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78601 | 205189 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 286 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
127029201 | 137233 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 644 | 12 | 3 | 9 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3751994 | 137233 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 644 | 12 | 3 | 9 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
3080568 | 178821 | 33 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 348 | 5 | 3 | 7 | 2.7 | COC(=O)c1cc(O)cc(OC)c1Oc1cc(C)cc(O)c1C(=O)O | 10.1021/np0102758 | ||
CHEMBL469424 | 178821 | 33 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 348 | 5 | 3 | 7 | 2.7 | COC(=O)c1cc(O)cc(OC)c1Oc1cc(C)cc(O)c1C(=O)O | 10.1021/np0102758 | ||
9846065 | 170895 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 439 | 7 | 2 | 6 | 3.6 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4455096 | 170895 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 439 | 7 | 2 | 6 | 3.6 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
44276947 | 106824 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 430 | 5 | 1 | 3 | 5.2 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc(Cl)c(Cl)c3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144803 | 106824 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 430 | 5 | 1 | 3 | 5.2 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc(Cl)c(Cl)c3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44276907 | 106828 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 376 | 4 | 1 | 4 | 3.6 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1ccccc1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144845 | 106828 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 376 | 4 | 1 | 4 | 3.6 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1ccccc1 | 10.1016/s0960-894x(00)00232-8 | ||
10381122 | 99169 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N)cc3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL281427 | 99169 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N)cc3c2)c1C | 10.1021/jm00004a012 | ||
3765218 | 203398 | 1 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 419 | 4 | 1 | 4 | 4.2 | Cc1nc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)ccc1Br | 10.1021/jm9604585 | ||
CHEMBL6566 | 203398 | 1 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 419 | 4 | 1 | 4 | 4.2 | Cc1nc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)ccc1Br | 10.1021/jm9604585 | ||
44266649 | 98082 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 391 | 3 | 1 | 4 | 5.4 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1-c1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL273488 | 98082 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 391 | 3 | 1 | 4 | 5.4 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc(Cl)ccc2n1-c1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
23445421 | 59900 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.0 | Cc1ccc(CCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL173189 | 59900 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.0 | Cc1ccc(CCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
10832763 | 168415 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 366 | 4 | 2 | 6 | 2.3 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)O)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL434983 | 168415 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 366 | 4 | 2 | 6 | 2.3 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)O)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
137649809 | 157363 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 583 | 10 | 2 | 7 | 5.9 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CCCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4078297 | 157363 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 583 | 10 | 2 | 7 | 5.9 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CCCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10527774 | 183664 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 455 | 5 | 2 | 6 | 4.2 | Cc1cccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
CHEMBL48031 | 183664 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 455 | 5 | 2 | 6 | 4.2 | Cc1cccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
22998456 | 59764 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 514 | 8 | 1 | 8 | 4.9 | CCCc1cc2c(cc1OCc1sccc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL172666 | 59764 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 514 | 8 | 1 | 8 | 4.9 | CCCc1cc2c(cc1OCc1sccc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00132-7 | ||
9874379 | 60416 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 653 | 14 | 2 | 10 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL175268 | 60416 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 653 | 14 | 2 | 10 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
10718385 | 206788 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 450 | 7 | 1 | 6 | 2.4 | C#CCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9040 | 206788 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 450 | 7 | 1 | 6 | 2.4 | C#CCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
23445593 | 60205 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 440 | 6 | 1 | 5 | 4.7 | Cc1ccc(CCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL174086 | 60205 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 440 | 6 | 1 | 5 | 4.7 | Cc1ccc(CCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
10805820 | 203694 | 60 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 322 | 4 | 2 | 6 | 2.2 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)O)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL67664 | 203694 | 60 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 322 | 4 | 2 | 6 | 2.2 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)O)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
10812400 | 98351 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 427 | 9 | 1 | 6 | 3.7 | CCCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL275306 | 98351 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 427 | 9 | 1 | 6 | 3.7 | CCCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44265853 | 206379 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 454 | 4 | 1 | 6 | 2.7 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)N2CCOCC2)cc1 | 10.1021/jm9505369 | ||
CHEMBL8776 | 206379 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 454 | 4 | 1 | 6 | 2.7 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)N2CCOCC2)cc1 | 10.1021/jm9505369 | ||
10854399 | 202977 | 41 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 336 | 4 | 1 | 7 | 2.3 | COC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL63169 | 202977 | 41 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 336 | 4 | 1 | 7 | 2.3 | COC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
10647020 | 61265 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1OC | 10.1021/jm031041j | ||
CHEMBL176696 | 61265 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1OC | 10.1021/jm031041j | ||
10647021 | 6942 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1OC | 10.1021/jm9606507 | ||
CHEMBL10846 | 6942 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1OC | 10.1021/jm9606507 | ||
10552548 | 98494 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OC)c2OC)cc1 | 10.1021/jm9606507 | ||
CHEMBL276252 | 98494 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OC)c2OC)cc1 | 10.1021/jm9606507 | ||
9934580 | 162906 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 474 | 6 | 1 | 8 | 3.6 | COC(=O)c1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL417428 | 162906 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 474 | 6 | 1 | 8 | 3.6 | COC(=O)c1ccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
127035757 | 136480 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 591 | 10 | 1 | 8 | 6.2 | CCCCc1nn(-c2ccccc2Cl)c(=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3736242 | 136480 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 591 | 10 | 1 | 8 | 6.2 | CCCCc1nn(-c2ccccc2Cl)c(=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
76308472 | 85325 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 517 | 6 | 1 | 8 | 3.7 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C#N)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261600 | 85325 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 517 | 6 | 1 | 8 | 3.7 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C#N)ccc12 | 10.1007/s00044-004-0021-y | ||
44320338 | 106947 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 490 | 7 | 2 | 6 | 5.0 | O=C(O)c1ccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)cc1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315087 | 106947 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 490 | 7 | 2 | 6 | 5.0 | O=C(O)c1ccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)cc1 | 10.1016/s0960-894x(00)00513-8 | ||
44385162 | 61351 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 533 | 10 | 2 | 10 | 3.3 | C#CCOc1nc(-c2ccnc(CO)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176963 | 61351 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 533 | 10 | 2 | 10 | 3.3 | C#CCOc1nc(-c2ccnc(CO)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10697633 | 60304 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 536 | 10 | 5 | 5 | 4.4 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL174448 | 60304 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 536 | 10 | 5 | 5 | 4.4 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
10697633 | 60304 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 536 | 10 | 5 | 5 | 4.4 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL174448 | 60304 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 536 | 10 | 5 | 5 | 4.4 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
10551548 | 127792 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 450 | 7 | 1 | 5 | 5.0 | COc1ccc(C(=O)/C(Cc2ccc(Cl)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL366442 | 127792 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 450 | 7 | 1 | 5 | 5.0 | COc1ccc(C(=O)/C(Cc2ccc(Cl)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
11732966 | 203148 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 444 | 5 | 1 | 5 | 5.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(C(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL64244 | 203148 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 444 | 5 | 1 | 5 | 5.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(C(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL302776 | 210892 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00089a028 | ||||
22616262 | 205516 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 366 | 3 | 1 | 4 | 3.7 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80980 | 205516 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 366 | 3 | 1 | 4 | 3.7 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1Br | 10.1016/0960-894X(96)00441-6 | ||
18617351 | 104082 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL309397 | 104082 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10433234 | 205424 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 436 | 5 | 1 | 4 | 4.3 | CCCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80342 | 205424 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 436 | 5 | 1 | 4 | 4.3 | CCCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
11744509 | 5398 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 450 | 5 | 1 | 6 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10733 | 5398 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 450 | 5 | 1 | 6 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)cc2)cc1 | 10.1021/jm9606507 | ||
11732966 | 203148 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 444 | 5 | 1 | 5 | 5.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(C(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64244 | 203148 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 444 | 5 | 1 | 5 | 5.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(C(C)C)cc32)cc1 | 10.1021/jm010382z | ||
54587165 | 60279 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 675 | 15 | 5 | 4 | 5.9 | CCCCCC[C@@H](NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL1744023 | 60279 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 675 | 15 | 5 | 4 | 5.9 | CCCCCC[C@@H](NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
44293932 | 163122 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@H](c1cccc(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL417903 | 163122 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@H](c1cccc(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
15304942 | 164406 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 394 | 9 | 1 | 4 | 5.5 | Cc1ccccc1C(CCC(=O)O)C(=O)c1cccc(OCc2ccsc2)c1 | 10.1021/jm9707131 | ||
CHEMBL421365 | 164406 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 394 | 9 | 1 | 4 | 5.5 | Cc1ccccc1C(CCC(=O)O)C(=O)c1cccc(OCc2ccsc2)c1 | 10.1021/jm9707131 | ||
44213279 | 106821 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 456 | 6 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(C(F)(F)C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144737 | 106821 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 456 | 6 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(C(F)(F)C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10554748 | 60044 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 552 | 10 | 6 | 6 | 3.3 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(O)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL173826 | 60044 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 552 | 10 | 6 | 6 | 3.3 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(O)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL335143 | 211523 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44382975 | 120307 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 596 | 11 | 4 | 7 | 3.7 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCc1nc(C(=O)O)cs1 | 10.1016/0960-894X(95)00144-I | ||
CHEMBL352929 | 120307 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 596 | 11 | 4 | 7 | 3.7 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCc1nc(C(=O)O)cs1 | 10.1016/0960-894X(95)00144-I | ||
10440821 | 207515 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 918 | 24 | 9 | 8 | 4.1 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c(C)c(C)c(C)c(C)c1C)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL94689 | 207515 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 918 | 24 | 9 | 8 | 4.1 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c(C)c(C)c(C)c(C)c1C)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
10620470 | 111492 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 391 | 7 | 1 | 5 | 4.8 | COc1cccc(/C(=C\c2cc(OCc3ccsc3)ccc2C#N)C(=O)O)c1 | 10.1021/jm970847e | ||
CHEMBL327861 | 111492 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 391 | 7 | 1 | 5 | 4.8 | COc1cccc(/C(=C\c2cc(OCc3ccsc3)ccc2C#N)C(=O)O)c1 | 10.1021/jm970847e | ||
44293915 | 192522 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 507 | 9 | 1 | 8 | 4.4 | CCOc1ccc2c(c1)[C@H](c1cc(OC)c(OC)c(OC)c1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL52110 | 192522 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 507 | 9 | 1 | 8 | 4.4 | CCOc1ccc2c(c1)[C@H](c1cc(OC)c(OC)c(OC)c1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
44291495 | 11201 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 455 | 6 | 2 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2/C(Cc2ccc3c(c2)OCO3)=N\O)c1Cl | 10.1021/jm9700068 | ||
CHEMBL1178832 | 11201 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 455 | 6 | 2 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2/C(Cc2ccc3c(c2)OCO3)=N\O)c1Cl | 10.1021/jm9700068 | ||
CHEMBL45351 | 11201 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 455 | 6 | 2 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2/C(Cc2ccc3c(c2)OCO3)=N\O)c1Cl | 10.1021/jm9700068 | ||
44266565 | 98206 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 417 | 5 | 1 | 6 | 4.7 | COc1ccc(-c2c(C(=O)O)n(-c3ccc4c(c3)OCO4)c3ccc(OC)cc23)cc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL274370 | 98206 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 417 | 5 | 1 | 6 | 4.7 | COc1ccc(-c2c(C(=O)O)n(-c3ccc4c(c3)OCO4)c3ccc(OC)cc23)cc1 | 10.1016/0960-894X(96)00170-9 | ||
44311225 | 204684 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 581 | 11 | 1 | 10 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)c1ccoc1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL74118 | 204684 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 581 | 11 | 1 | 10 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)c1ccoc1 | 10.1016/S0960-894X(97)00400-9 | ||
13044638 | 85809 | 22 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 206 | 2 | 1 | 3 | 2.4 | COc1cccc2oc(C(=O)O)c(C)c12 | 10.1007/s00044-013-0542-3 | ||
CHEMBL2296888 | 85809 | 22 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 206 | 2 | 1 | 3 | 2.4 | COc1cccc2oc(C(=O)O)c(C)c12 | 10.1007/s00044-013-0542-3 | ||
CHEMBL269428 | 210764 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10769177 | 112885 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.2 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CCOC)cc1 | 10.1021/jm990170q | ||
CHEMBL331066 | 112885 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.2 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CCOC)cc1 | 10.1021/jm990170q | ||
127026338 | 137379 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 616 | 11 | 3 | 7 | 5.9 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3F)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3753277 | 137379 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 616 | 11 | 3 | 7 | 5.9 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3F)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
120533 | 101603 | 9 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 379 | 3 | 2 | 5 | 2.0 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1I | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL298976 | 101603 | 9 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 379 | 3 | 2 | 5 | 2.0 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1I | 10.1016/s0960-894x(00)00366-8 | ||
10674532 | 168564 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 567 | 10 | 4 | 5 | 5.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C(C)C)s1 | 10.1021/jm950591h | ||
CHEMBL435894 | 168564 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 567 | 10 | 4 | 5 | 5.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C(C)C)s1 | 10.1021/jm950591h | ||
10452089 | 4533 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 375 | 3 | 0 | 5 | 4.1 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2c(nc3ccccc13)CCCC2 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL102494 | 4533 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 375 | 3 | 0 | 5 | 4.1 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2c(nc3ccccc13)CCCC2 | 10.1016/S0960-894X(96)00551-3 | ||
10095637 | 49937 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 457 | 9 | 1 | 5 | 5.8 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)O)c1ccccc1 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL15689 | 49937 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 457 | 9 | 1 | 5 | 5.8 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)O)c1ccccc1 | 10.1016/0960-894X(95)00186-W | ||
19385674 | 98561 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 715 | 13 | 1 | 7 | 8.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)O)c1cc(Br)c(OC)c(OC)c1Br | 10.1016/0960-894X(95)00186-W | ||
CHEMBL276819 | 98561 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 715 | 13 | 1 | 7 | 8.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)O)c1cc(Br)c(OC)c(OC)c1Br | 10.1016/0960-894X(95)00186-W | ||
19385674 | 98561 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 715 | 13 | 1 | 7 | 8.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)O)c1cc(Br)c(OC)c(OC)c1Br | 10.1021/jm058225d | ||
CHEMBL276819 | 98561 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 715 | 13 | 1 | 7 | 8.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)O)c1cc(Br)c(OC)c(OC)c1Br | 10.1021/jm058225d | ||
44266538 | 5433 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 371 | 4 | 1 | 4 | 4.8 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10750 | 5433 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 371 | 4 | 1 | 4 | 4.8 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
11798999 | 207562 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 482 | 7 | 1 | 6 | 3.8 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)CC(C)(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL9495 | 207562 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 482 | 7 | 1 | 6 | 3.8 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)CC(C)(C)C)cc1 | 10.1021/jm9505369 | ||
71460536 | 81657 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 589 | 11 | 1 | 12 | 3.1 | COc1ccccc1Oc1c(NS(C)(=O)=O)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163712 | 81657 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 589 | 11 | 1 | 12 | 3.1 | COc1ccccc1Oc1c(NS(C)(=O)=O)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
10669120 | 207422 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1[C@H](CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL94141 | 207422 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1[C@H](CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL444274 | 213908 | 0 | None | - | 0 | Mouse | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/S0960-894X(01)81219-1 | ||||
23445366 | 106156 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 482 | 7 | 1 | 5 | 6.2 | Cc1cc(CCC(C)C)ccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL313801 | 106156 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 482 | 7 | 1 | 5 | 6.2 | Cc1cc(CCC(C)C)ccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
52949197 | 18392 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 555 | 10 | 2 | 7 | 5.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CC4)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271746 | 18392 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 555 | 10 | 2 | 7 | 5.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CC4)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
10694591 | 9194 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 444 | 6 | 1 | 6 | 4.6 | CC(C)Oc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL11064 | 9194 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 444 | 6 | 1 | 6 | 4.6 | CC(C)Oc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
18184194 | 130536 | 0 | None | - | 2 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 712 | 15 | 2 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368107 | 130536 | 0 | None | - | 2 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 712 | 15 | 2 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
9998577 | 98074 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.6 | CCc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27344 | 98074 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.6 | CCc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL327350 | 211267 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
18184228 | 61323 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 604 | 13 | 2 | 9 | 4.6 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL176749 | 61323 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 604 | 13 | 2 | 9 | 4.6 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
10342643 | 5125 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm9606507 | ||
CHEMBL10588 | 5125 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm9606507 | ||
10791694 | 98172 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(OC)c2OC)cc1 | 10.1021/jm9606507 | ||
CHEMBL274175 | 98172 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(OC)c2OC)cc1 | 10.1021/jm9606507 | ||
11058202 | 202800 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 388 | 4 | 1 | 5 | 4.4 | CC(C)Oc1ccc2c(c1)C(Cl)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL62374 | 202800 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 388 | 4 | 1 | 5 | 4.4 | CC(C)Oc1ccc2c(c1)C(Cl)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
11799636 | 109237 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 502 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1CCCO1 | 10.1021/jm980217s | ||
CHEMBL321831 | 109237 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 502 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1CCCO1 | 10.1021/jm980217s | ||
10626646 | 16414 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCc1cccc(CCC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL123305 | 16414 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCc1cccc(CCC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
10224745 | 112663 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 432 | 5 | 2 | 6 | 2.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL330425 | 112663 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 432 | 5 | 2 | 6 | 2.4 | Cc1cc(C)nc(O[C@H](C(=O)O)[C@@]2(c3ccccc3)NCC(=O)N(C)c3ccccc32)n1 | 10.1016/j.bmcl.2016.06.014 | ||
44459272 | 91211 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 491 | 6 | 2 | 7 | 2.6 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccccc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL24015 | 91211 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 491 | 6 | 2 | 7 | 2.6 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccccc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
22010352 | 117600 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 404 | 10 | 1 | 4 | 5.5 | CC(=O)c1ccc(OCc2ccccc2)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
CHEMBL3400984 | 117600 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 404 | 10 | 1 | 4 | 5.5 | CC(=O)c1ccc(OCc2ccccc2)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
10693270 | 60039 | 1 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL172144 | 60039 | 1 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173792 | 60039 | 1 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
44295257 | 14596 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1cc(F)ccc1C(=O)/C(Cc1cc(OC)c(OC)c(OC)c1)=C(\C(=O)O)c1ccc2nsnc2c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205063 | 14596 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1cc(F)ccc1C(=O)/C(Cc1cc(OC)c(OC)c(OC)c1)=C(\C(=O)O)c1ccc2nsnc2c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL48458 | 14596 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1cc(F)ccc1C(=O)/C(Cc1cc(OC)c(OC)c(OC)c1)=C(\C(=O)O)c1ccc2nsnc2c1 | 10.1016/s0960-894x(98)00301-1 | ||
9915095 | 101503 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 535 | 8 | 2 | 8 | 3.4 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(C(=O)C(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL298212 | 101503 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 535 | 8 | 2 | 8 | 3.4 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(C(=O)C(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10864618 | 113295 | 0 | None | - | 0 | Pig | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 556 | 11 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2nccs2)c1 | 10.1021/jm0102304 | ||
CHEMBL331580 | 113295 | 0 | None | - | 0 | Pig | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 556 | 11 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2nccs2)c1 | 10.1021/jm0102304 | ||
10599879 | 101249 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 455 | 5 | 2 | 6 | 4.2 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
CHEMBL296326 | 101249 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 455 | 5 | 2 | 6 | 4.2 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
10233400 | 128659 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccncc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL366885 | 128659 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccncc1 | 10.1016/s0960-894x(02)01084-3 | ||
10304227 | 129982 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 603 | 10 | 2 | 13 | 4.2 | C#CCOc1nc(-c2ccnc(-c3noc(S)n3)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367686 | 129982 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 603 | 10 | 2 | 13 | 4.2 | C#CCOc1nc(-c2ccnc(-c3noc(S)n3)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10745668 | 204354 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 572 | 10 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCCN3CCN(C)CC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL71787 | 204354 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 572 | 10 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCCN3CCN(C)CC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL148751 | 208761 | 0 | None | - | 0 | Mouse | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CN(Cc1ccccc1)C(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
CHEMBL137659 | 208723 | 0 | None | - | 0 | Pig | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
44302513 | 102691 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 553 | 9 | 3 | 9 | 5.1 | CCCc1c(O)c(C(C)=O)cc(C(C)=O)c1NC(=O)c1sc(C)cc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
CHEMBL304860 | 102691 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 553 | 9 | 3 | 9 | 5.1 | CCCc1c(O)c(C(C)=O)cc(C(C)=O)c1NC(=O)c1sc(C)cc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm030528p | ||
10623465 | 203724 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 450 | 6 | 1 | 6 | 3.7 | CCN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3OC)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6785 | 203724 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 450 | 6 | 1 | 6 | 3.7 | CCN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3OC)cccc12 | 10.1021/jm9604585 | ||
18617303 | 105768 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1cccc(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL312685 | 105768 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1cccc(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
15453179 | 205458 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80538 | 205458 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44293866 | 101595 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 461 | 8 | 1 | 6 | 4.8 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL298922 | 101595 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 461 | 8 | 1 | 6 | 4.8 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL292901 | 210864 | 0 | None | - | 0 | Pig | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
10627333 | 60353 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 595 | 11 | 4 | 8 | 4.2 | COC(=O)C1(NC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc2cn(C)c3ccccc23)c2nc(C(=O)O)c(C)o2)CCCCC1 | 10.1021/jm950592+ | ||
CHEMBL174818 | 60353 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 595 | 11 | 4 | 8 | 4.2 | COC(=O)C1(NC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc2cn(C)c3ccccc23)c2nc(C(=O)O)c(C)o2)CCCCC1 | 10.1021/jm950592+ | ||
CHEMBL335416 | 211524 | 0 | None | - | 0 | Pig | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
10961510 | 202812 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 458 | 7 | 1 | 4 | 6.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc(C(C)C)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL62425 | 202812 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 458 | 7 | 1 | 4 | 6.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc(C(C)C)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
44371449 | 49348 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)c(OC)c1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL156404 | 49348 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)c(OC)c1 | 10.1016/s0960-894x(99)00040-2 | ||
44371460 | 49500 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 469 | 5 | 1 | 7 | 4.9 | COc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc3c(c2)OCO3)c2oc3ccccc3c21 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL156539 | 49500 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 469 | 5 | 1 | 7 | 4.9 | COc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc3c(c2)OCO3)c2oc3ccccc3c21 | 10.1016/s0960-894x(99)00040-2 | ||
10961510 | 202812 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 458 | 7 | 1 | 4 | 6.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc(C(C)C)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL62425 | 202812 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 458 | 7 | 1 | 4 | 6.6 | COc1ccc(C2=C(C(=O)O)C(c3ccc(C(C)C)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
11733232 | 202841 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1cccc2c1C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL62586 | 202841 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1cccc2c1C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL412460 | 212968 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
23445317 | 100518 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 456 | 5 | 1 | 7 | 4.1 | Cc1cccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL291404 | 100518 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 456 | 5 | 1 | 7 | 4.1 | Cc1cccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/S0960-894X(97)00367-3 | ||
23445507 | 59730 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 442 | 6 | 1 | 6 | 4.5 | Cc1ccc(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL172538 | 59730 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 442 | 6 | 1 | 6 | 4.5 | Cc1ccc(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00132-7 | ||
44298956 | 195657 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 489 | 9 | 1 | 7 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1OC)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL55666 | 195657 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 489 | 9 | 1 | 7 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1OC)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
10041979 | 99344 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 325 | 6 | 3 | 6 | 1.6 | Cc1noc(NS(=O)(=O)c2ccc(NCC(=O)O)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL282557 | 99344 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 325 | 6 | 3 | 6 | 1.6 | Cc1noc(NS(=O)(=O)c2ccc(NCC(=O)O)cc2)c1C | 10.1021/jm00008a013 | ||
44266654 | 98044 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 387 | 4 | 1 | 5 | 4.7 | COc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2-c1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL273258 | 98044 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 387 | 4 | 1 | 5 | 4.7 | COc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2-c1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
44385576 | 131351 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 539 | 10 | 1 | 10 | 3.4 | C#CCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368929 | 131351 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 539 | 10 | 1 | 10 | 3.4 | C#CCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
11799440 | 206953 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCN(CCC)C(=O)CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9132 | 206953 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCN(CCC)C(=O)CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
52949197 | 18392 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 555 | 10 | 2 | 7 | 5.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1271746 | 18392 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 555 | 10 | 2 | 7 | 5.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10531506 | 12084 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 592 | 9 | 2 | 6 | 5.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2cc(C)ccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL1184076 | 12084 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 592 | 9 | 2 | 6 | 5.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2cc(C)ccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL331548 | 12084 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 592 | 9 | 2 | 6 | 5.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2cc(C)ccc2C)cc1 | 10.1021/jm990171i | ||
10650546 | 12088 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 562 | 7 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC2c3ccccc3-c3ccccc32)cc1 | 10.1021/jm990171i | ||
CHEMBL1184091 | 12088 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 562 | 7 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC2c3ccccc3-c3ccccc32)cc1 | 10.1021/jm990171i | ||
CHEMBL332144 | 12088 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 562 | 7 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC2c3ccccc3-c3ccccc32)cc1 | 10.1021/jm990171i | ||
10814743 | 179347 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 484 | 6 | 1 | 9 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C2(Cc3ccc4c(c3)OCO4)OCCO2)c1Cl | 10.1021/jm9700068 | ||
CHEMBL47383 | 179347 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 484 | 6 | 1 | 9 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C2(Cc3ccc4c(c3)OCO4)OCCO2)c1Cl | 10.1021/jm9700068 | ||
10623888 | 163134 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 461 | 8 | 1 | 6 | 3.4 | CCCCS(=O)(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL417971 | 163134 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 461 | 8 | 1 | 6 | 3.4 | CCCCS(=O)(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10281573 | 59945 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 574 | 9 | 2 | 9 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccncc2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL173358 | 59945 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 574 | 9 | 2 | 9 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccncc2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
44385586 | 61632 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 531 | 10 | 1 | 9 | 4.7 | C#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL177143 | 61632 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 531 | 10 | 1 | 9 | 4.7 | C#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10645066 | 97165 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnc(Br)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL268339 | 97165 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnc(Br)cn3)cccc12 | 10.1021/jm9604585 | ||
11792960 | 161891 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 361 | 4 | 1 | 4 | 3.8 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)nc3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL415292 | 161891 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 361 | 4 | 1 | 4 | 3.8 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)nc3)cccc12 | 10.1021/jm9604585 | ||
10593411 | 203424 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 342 | 4 | 1 | 5 | 2.8 | Cc1cnc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)cn1 | 10.1021/jm9604585 | ||
CHEMBL6583 | 203424 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 342 | 4 | 1 | 5 | 2.8 | Cc1cnc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)cn1 | 10.1021/jm9604585 | ||
127029202 | 137303 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 598 | 11 | 3 | 7 | 5.8 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3752680 | 137303 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 598 | 11 | 3 | 7 | 5.8 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
10122495 | 30840 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 665 | 12 | 1 | 10 | 6.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOCc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL139734 | 30840 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 665 | 12 | 1 | 10 | 6.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOCc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
44384177 | 120267 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 506 | 6 | 1 | 8 | 4.6 | Cc1noc(NS(=O)(=O)c2ccsc2COc2cc3c(cc2Cl)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL352657 | 120267 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 506 | 6 | 1 | 8 | 4.6 | Cc1noc(NS(=O)(=O)c2ccsc2COc2cc3c(cc2Cl)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
10550033 | 101340 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 419 | 5 | 2 | 9 | 2.9 | Cc1nnc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)s1 | 10.1021/jm9608366 | ||
CHEMBL297048 | 101340 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 419 | 5 | 2 | 9 | 2.9 | Cc1nnc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)s1 | 10.1021/jm9608366 | ||
10626521 | 60045 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 551 | 11 | 4 | 6 | 5.1 | CCn1cc(C[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)c2nc(C(=O)O)c(C)o2)c2ccccc21 | 10.1021/jm950592+ | ||
CHEMBL173833 | 60045 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 551 | 11 | 4 | 6 | 5.1 | CCn1cc(C[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)c2nc(C(=O)O)c(C)o2)c2ccccc21 | 10.1021/jm950592+ | ||
CHEMBL94983 | 215893 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10671036 | 6625 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)c(OC)c1 | 10.1021/jm9606507 | ||
CHEMBL10834 | 6625 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)c(OC)c1 | 10.1021/jm9606507 | ||
9932004 | 98149 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 422 | 5 | 1 | 6 | 4.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2CC2CCCCC2)cc1 | 10.1021/jm9606507 | ||
CHEMBL273948 | 98149 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 422 | 5 | 1 | 6 | 4.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2CC2CCCCC2)cc1 | 10.1021/jm9606507 | ||
10816110 | 108539 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 532 | 13 | 1 | 7 | 4.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1OC(C)C(C)O1 | 10.1021/jm980217s | ||
CHEMBL320254 | 108539 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 532 | 13 | 1 | 7 | 4.2 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1OC(C)C(C)O1 | 10.1021/jm980217s | ||
44314619 | 204663 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 631 | 12 | 5 | 4 | 4.5 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL73925 | 204663 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 631 | 12 | 5 | 4 | 4.5 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
10209324 | 14458 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 546 | 8 | 1 | 7 | 6.2 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(C)c1)C(=O)CCCC2 | 10.1039/C4MD00499J | ||
CHEMBL12013 | 14458 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 546 | 8 | 1 | 7 | 6.2 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(C)c1)C(=O)CCCC2 | 10.1039/C4MD00499J | ||
10740439 | 172724 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 412 | 5 | 2 | 7 | 3.5 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)nc1 | 10.1021/jm9608366 | ||
CHEMBL45087 | 172724 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 412 | 5 | 2 | 7 | 3.5 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)nc1 | 10.1021/jm9608366 | ||
135415889 | 59239 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 587 | 10 | 2 | 13 | 3.6 | C#CCOc1nc(-c2ccnc(-c3noc(O)n3)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL170401 | 59239 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 587 | 10 | 2 | 13 | 3.6 | C#CCOc1nc(-c2ccnc(-c3noc(O)n3)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10281943 | 60034 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 589 | 10 | 1 | 10 | 4.9 | COCC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL173743 | 60034 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 589 | 10 | 1 | 10 | 4.9 | COCC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10212088 | 96667 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 688 | 12 | 2 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL264035 | 96667 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 688 | 12 | 2 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL2370830 | 209906 | 0 | None | - | 0 | Pig | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
42630531 | 18456 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 543 | 9 | 2 | 7 | 5.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1272299 | 18456 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 543 | 9 | 2 | 7 | 5.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
10768904 | 12098 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(CC(C)C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL1184117 | 12098 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(CC(C)C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL333034 | 12098 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(CC(C)C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
10385400 | 96178 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 385 | 4 | 1 | 5 | 3.4 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCC4=O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL26079 | 96178 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 385 | 4 | 1 | 5 | 3.4 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCC4=O)cccc23)c1C | 10.1021/jm00008a013 | ||
10426828 | 98117 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 331 | 4 | 2 | 5 | 3.3 | CNc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL27370 | 98117 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 331 | 4 | 2 | 5 | 3.3 | CNc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
10361993 | 99538 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 373 | 5 | 1 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL283652 | 99538 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 373 | 5 | 1 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
11103224 | 202630 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 510 | 14 | 1 | 6 | 7.3 | CCCCCCCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL61406 | 202630 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 510 | 14 | 1 | 6 | 7.3 | CCCCCCCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
11826847 | 202896 | 1 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccccc1OC)O2 | 10.1021/jm010382z | ||
CHEMBL62814 | 202896 | 1 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccccc1OC)O2 | 10.1021/jm010382z | ||
10837347 | 8837 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 452 | 8 | 1 | 5 | 3.3 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL109736 | 8837 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 452 | 8 | 1 | 5 | 3.3 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10298764 | 9822 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 468 | 8 | 1 | 6 | 3.2 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL114084 | 9822 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 468 | 8 | 1 | 6 | 3.2 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL317064 | 211174 | 15 | None | - | 1 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
44266552 | 4481 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10218 | 4481 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL337567 | 211575 | 0 | None | - | 0 | Pig | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CSCC[C@H]1NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C(C)C)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL150719 | 208768 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
44371421 | 51405 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 459 | 5 | 1 | 5 | 5.8 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3Cl)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL158204 | 51405 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 459 | 5 | 1 | 5 | 5.8 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3Cl)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
10067008 | 97772 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc2c1 | 10.1021/jm00008a013 | ||
CHEMBL27187 | 97772 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc2c1 | 10.1021/jm00008a013 | ||
10423091 | 99943 | 3 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2cccc(N)c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL286521 | 99943 | 3 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2cccc(N)c2)c1C | 10.1021/jm00008a013 | ||
10552007 | 6291 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 462 | 8 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c(OC)c(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10819 | 6291 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 462 | 8 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c(OC)c(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10961720 | 203461 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 472 | 6 | 1 | 5 | 6.3 | CC(C)Oc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(C(C)C)cc1)O2 | 10.1021/jm010382z | ||
CHEMBL66094 | 203461 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 472 | 6 | 1 | 5 | 6.3 | CC(C)Oc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(C(C)C)cc1)O2 | 10.1021/jm010382z | ||
10577405 | 9620 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 502 | 14 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1C(C)(C)CCCC | 10.1021/jm980217s | ||
CHEMBL112777 | 9620 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 502 | 14 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1C(C)(C)CCCC | 10.1021/jm980217s | ||
10573912 | 111595 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 415 | 7 | 1 | 5 | 5.5 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1ccccc1Cl | 10.1021/jm970847e | ||
CHEMBL328444 | 111595 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 415 | 7 | 1 | 5 | 5.5 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1ccccc1Cl | 10.1021/jm970847e | ||
10524954 | 207037 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 399 | 6 | 1 | 5 | 4.5 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1/C=C(/C(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL91741 | 207037 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 399 | 6 | 1 | 5 | 4.5 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1/C=C(/C(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
44298343 | 101766 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 485 | 9 | 1 | 7 | 5.8 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC#N)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL300066 | 101766 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 485 | 9 | 1 | 7 | 5.8 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC#N)c1 | 10.1016/s0960-894x(00)00366-8 | ||
44298279 | 194928 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 502 | 10 | 1 | 7 | 5.8 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC(C)=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL54274 | 194928 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 502 | 10 | 1 | 7 | 5.8 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC(C)=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
155560344 | 176479 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 641 | 12 | 4 | 7 | 4.8 | CCCC[C@H](NC(=O)[C@@H](Cc1cn(C(=O)OC)c2ccccc12)NC(=O)[C@@H](CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL4568795 | 176479 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 641 | 12 | 4 | 7 | 4.8 | CCCC[C@H](NC(=O)[C@@H](Cc1cn(C(=O)OC)c2ccccc12)NC(=O)[C@@H](CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL4596821 | 176479 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 641 | 12 | 4 | 7 | 4.8 | CCCC[C@H](NC(=O)[C@@H](Cc1cn(C(=O)OC)c2ccccc12)NC(=O)[C@@H](CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/acs.jmedchem.5b01781 | ||
155535325 | 171985 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc(-c2ncccn2)cc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4471434 | 171985 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc(-c2ncccn2)cc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
44276946 | 106819 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 440 | 5 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3cc(Cl)c4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144735 | 106819 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 440 | 5 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3cc(Cl)c4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44309897 | 204608 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 469 | 5 | 1 | 7 | 4.9 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccc4c(c3)OCO4)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL73506 | 204608 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 469 | 5 | 1 | 7 | 4.9 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccc4c(c3)OCO4)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
44298988 | 100691 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 459 | 8 | 1 | 6 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL292580 | 100691 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 459 | 8 | 1 | 6 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
10067008 | 97772 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc2c1 | 10.1021/jm00004a012 | ||
CHEMBL27187 | 97772 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc2c1 | 10.1021/jm00004a012 | ||
10423091 | 99943 | 3 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2cccc(N)c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL286521 | 99943 | 3 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2cccc(N)c2)c1C | 10.1021/jm00004a012 | ||
44266595 | 4361 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 507 | 6 | 1 | 7 | 6.0 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc(OCc3ccccc3)ccc2n1-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10136 | 4361 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 507 | 6 | 1 | 7 | 6.0 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc(OCc3ccccc3)ccc2n1-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
10337668 | 102110 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 346 | 4 | 2 | 5 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc3c(C(=O)O)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL30246 | 102110 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 346 | 4 | 2 | 5 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc3c(C(=O)O)cccc23)c1C | 10.1021/jm00029a001 | ||
10337668 | 102110 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 346 | 4 | 2 | 5 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc3c(C(=O)O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL30246 | 102110 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 346 | 4 | 2 | 5 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc3c(C(=O)O)cccc23)c1C | 10.1021/jm00008a013 | ||
160743 | 204467 | 23 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 309 | 4 | 2 | 5 | 2.1 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00008a013 | ||
CHEMBL725 | 204467 | 23 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 309 | 4 | 2 | 5 | 2.1 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00008a013 | ||
18617314 | 205209 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 334 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccc(F)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78734 | 205209 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 334 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccc(F)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL38071 | 212249 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
44213959 | 170344 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 592 | 11 | 3 | 9 | 5.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(=O)Nc2ccccc2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4447655 | 170344 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 592 | 11 | 3 | 9 | 5.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(=O)Nc2ccccc2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
127026027 | 137248 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 628 | 12 | 3 | 8 | 5.8 | CCCc1nc2c(C)cc(C(=O)NCCc3ccc(OC)cc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3752145 | 137248 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 628 | 12 | 3 | 8 | 5.8 | CCCc1nc2c(C)cc(C(=O)NCCc3ccc(OC)cc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL1791280 | 208897 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00152-J | ||||
10816667 | 11412 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 558 | 9 | 2 | 6 | 5.6 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(CC(C)(C)C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL1180341 | 11412 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 558 | 9 | 2 | 6 | 5.6 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(CC(C)(C)C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL122933 | 11412 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 558 | 9 | 2 | 6 | 5.6 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(CC(C)(C)C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
9853680 | 98620 | 0 | None | - | 1 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 771 | 17 | 2 | 14 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2cc(OC)c(OC)c(OC)c2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL277275 | 98620 | 0 | None | - | 1 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 771 | 17 | 2 | 14 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2cc(OC)c(OC)c(OC)c2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
10576378 | 101096 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1ccccc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1021/jm9608366 | ||
CHEMBL295207 | 101096 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1ccccc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1021/jm9608366 | ||
CHEMBL170229 | 208819 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)[C@@H](Cc1cn(C)c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)N1CCCCCC1)C(=O)O | 10.1016/0960-894X(95)00144-I | ||||
23445219 | 112448 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 428 | 5 | 1 | 6 | 4.3 | COc1cccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL329861 | 112448 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 428 | 5 | 1 | 6 | 4.3 | COc1cccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/S0960-894X(96)00496-9 | ||
44386163 | 60350 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 577 | 14 | 2 | 10 | 3.4 | CCCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL174781 | 60350 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 577 | 14 | 2 | 10 | 3.4 | CCCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
23445537 | 61115 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 514 | 8 | 1 | 8 | 4.9 | CCCc1cc2c(cc1OCc1ccsc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL176538 | 61115 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 514 | 8 | 1 | 8 | 4.9 | CCCc1cc2c(cc1OCc1ccsc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00132-7 | ||
10766067 | 9706 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 452 | 8 | 1 | 5 | 3.3 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)OCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL113379 | 9706 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 452 | 8 | 1 | 5 | 3.3 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)OCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
127035069 | 136374 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 663 | 11 | 2 | 8 | 7.7 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735300 | 136374 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 663 | 11 | 2 | 8 | 7.7 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
10792785 | 166699 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 551 | 10 | 3 | 6 | 5.0 | CCOC(=O)c1nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)oc1C | 10.1021/jm950592+ | ||
CHEMBL428298 | 166699 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 551 | 10 | 3 | 6 | 5.0 | CCOC(=O)c1nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)oc1C | 10.1021/jm950592+ | ||
9831527 | 129456 | 0 | None | - | 1 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 698 | 14 | 2 | 12 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367274 | 129456 | 0 | None | - | 1 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 698 | 14 | 2 | 12 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
10189776 | 60027 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 651 | 11 | 1 | 10 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL173689 | 60027 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 651 | 11 | 1 | 10 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
10743478 | 109241 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 484 | 12 | 1 | 4 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(F)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
CHEMBL321852 | 109241 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 484 | 12 | 1 | 4 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(F)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
10504389 | 130648 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 466 | 7 | 1 | 5 | 5.5 | COc1ccc(C(=O)/C(Cc2cccc3ccccc23)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL368270 | 130648 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 466 | 7 | 1 | 5 | 5.5 | COc1ccc(C(=O)/C(Cc2cccc3ccccc23)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
10505209 | 9285 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 490 | 6 | 1 | 9 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL11106 | 9285 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 490 | 6 | 1 | 9 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
10742841 | 97320 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 466 | 5 | 1 | 6 | 5.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc3ccccc3c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL269453 | 97320 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 466 | 5 | 1 | 6 | 5.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc3ccccc3c2)cc1 | 10.1021/jm9606507 | ||
44314645 | 172648 | 0 | None | - | 0 | Pig | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 601 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CC1CC1)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL449962 | 172648 | 0 | None | - | 0 | Pig | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 601 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CC1CC1)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
10743478 | 109241 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 484 | 12 | 1 | 4 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(F)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL321852 | 109241 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 484 | 12 | 1 | 4 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(F)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10166561 | 10032 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 562 | 9 | 2 | 8 | 5.4 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CO)c1)C(=O)CCCC2 | 10.1039/C4MD00499J | ||
CHEMBL11528 | 10032 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 562 | 9 | 2 | 8 | 5.4 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CO)c1)C(=O)CCCC2 | 10.1039/C4MD00499J | ||
44214320 | 85321 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 510 | 6 | 1 | 7 | 4.0 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(F)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261364 | 85321 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 510 | 6 | 1 | 7 | 4.0 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(F)ccc12 | 10.1007/s00044-004-0021-y | ||
10240093 | 81658 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 603 | 12 | 1 | 12 | 3.5 | CCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163713 | 81658 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 603 | 12 | 1 | 12 | 3.5 | CCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
71458721 | 81672 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 642 | 14 | 2 | 10 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(C2CC2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163726 | 81672 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 642 | 14 | 2 | 10 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(C2CC2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
10812894 | 120250 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 437 | 7 | 1 | 6 | 4.7 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
CHEMBL352536 | 120250 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 437 | 7 | 1 | 6 | 4.7 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
17869371 | 14757 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 478 | 8 | 1 | 7 | 4.8 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(F)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206716 | 14757 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 478 | 8 | 1 | 7 | 4.8 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(F)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL299521 | 14757 | 0 | None | - | 0 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 478 | 8 | 1 | 7 | 4.8 | COc1ccc(C(=O)/C(Cc2ccc(OC)c(F)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
44293417 | 187312 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 563 | 11 | 2 | 8 | 4.9 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1OCC(C)(C)C(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL49312 | 187312 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 563 | 11 | 2 | 8 | 4.9 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1OCC(C)(C)C(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
443289 | 708 | 47 | None | -2 | 3 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | None | 10.1021/jm9707131 | ||||
997 | 708 | 47 | None | -2 | 3 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | None | 10.1021/jm9707131 | ||||
CHEMBL314691 | 708 | 47 | None | -2 | 3 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | None | 10.1021/jm9707131 | ||||
DB12054 | 708 | 47 | None | -2 | 3 | Rat | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | None | 10.1021/jm9707131 | ||||
10814746 | 181570 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 484 | 6 | 1 | 8 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL47706 | 181570 | 0 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 484 | 6 | 1 | 8 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
10122675 | 98444 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 682 | 12 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL275897 | 98444 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 682 | 12 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL1791271 | 208893 | 2 | None | - | 0 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@H](C)CC)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00152-J | ||||
9831249 | 59667 | 0 | None | - | 2 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 672 | 14 | 2 | 10 | 6.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172297 | 59667 | 0 | None | - | 2 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 672 | 14 | 2 | 10 | 6.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
44311283 | 102306 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 649 | 11 | 2 | 10 | 6.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL303649 | 102306 | 0 | None | - | 1 | Human | 7.9 | pIC50 | = | 7.9 | Binding | ChEMBL | 649 | 11 | 2 | 10 | 6.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44320590 | 106534 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 556 | 10 | 2 | 9 | 4.8 | COc1ccc(Cn2nc(-c3cccs3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c(OCC(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL314206 | 106534 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 556 | 10 | 2 | 9 | 4.8 | COc1ccc(Cn2nc(-c3cccs3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c(OCC(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL1788127 | 211093 | 8 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL313760 | 211093 | 8 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
44382933 | 165075 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 541 | 12 | 4 | 5 | 3.2 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCCCC(=O)O | 10.1016/0960-894X(95)00144-I | ||
CHEMBL422720 | 165075 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 541 | 12 | 4 | 5 | 3.2 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCCCC(=O)O | 10.1016/0960-894X(95)00144-I | ||
CHEMBL330144 | 211304 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(C)C | 10.1021/jm00015a003 | ||||
22616257 | 204991 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 272 | 3 | 1 | 4 | 2.4 | Cc1noc(NS(=O)(=O)c2ccccc2)c1Cl | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76860 | 204991 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 272 | 3 | 1 | 4 | 2.4 | Cc1noc(NS(=O)(=O)c2ccccc2)c1Cl | 10.1016/0960-894X(96)00441-6 | ||
44317109 | 104865 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 472 | 3 | 1 | 4 | 4.1 | Cc1noc(NS(=O)(=O)c2cc(Br)ccc2Br)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311216 | 104865 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 472 | 3 | 1 | 4 | 4.1 | Cc1noc(NS(=O)(=O)c2cc(Br)ccc2Br)c1Br | 10.1016/0960-894X(96)00441-6 | ||
18617327 | 205233 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1ccccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78929 | 205233 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1ccccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44276969 | 106812 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 506 | 7 | 1 | 5 | 4.8 | COc1cccc(Cn2[nH]c(C(F)(F)C(F)(F)C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144607 | 106812 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 506 | 7 | 1 | 5 | 4.8 | COc1cccc(Cn2[nH]c(C(F)(F)C(F)(F)C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
9961131 | 132131 | 0 | None | - | 2 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 650 | 15 | 2 | 12 | 3.1 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL369676 | 132131 | 0 | None | - | 2 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 650 | 15 | 2 | 12 | 3.1 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL342617 | 211653 | 0 | None | - | 0 | Pig | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL407639 | 212649 | 0 | None | - | 0 | Pig | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CS(=O)(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10381121 | 96204 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N)cc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL26090 | 96204 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N)cc23)c1C | 10.1021/jm00008a013 | ||
9974856 | 99325 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N(C)C)cc3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL282401 | 99325 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N(C)C)cc3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL1790499 | 208869 | 0 | None | - | 0 | Pig | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@@H]1NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC1=O | 10.1021/jm00089a028 | ||||
CHEMBL327350 | 211267 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
18617355 | 204931 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1ccc(S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76438 | 204931 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1ccc(S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL432683 | 213611 | 0 | None | - | 0 | Pig | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00087a001 | ||||
10618969 | 207319 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 367 | 7 | 1 | 5 | 4.8 | O=[N+]([O-])c1ccc(OCc2ccsc2)cc1/C=C(/CO)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL93596 | 207319 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 367 | 7 | 1 | 5 | 4.8 | O=[N+]([O-])c1ccc(OCc2ccsc2)cc1/C=C(/CO)c1ccccc1 | 10.1021/jm970847e | ||
127034901 | 136453 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 670 | 12 | 2 | 9 | 5.5 | CCCc1nc2c(C)cc(C(=O)NCCN3CCOCC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3736037 | 136453 | 0 | None | - | 0 | Human | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 670 | 12 | 2 | 9 | 5.5 | CCCc1nc2c(C)cc(C(=O)NCCN3CCOCC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44298382 | 195089 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 502 | 11 | 1 | 7 | 5.8 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCCC=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL54998 | 195089 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 502 | 11 | 1 | 7 | 5.8 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCCC=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
9974856 | 99325 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N(C)C)cc3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL282401 | 99325 | 0 | None | - | 0 | Rat | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3ccc(N(C)C)cc3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL343379 | 211676 | 0 | None | - | 0 | Pig | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL343379 | 211676 | 0 | None | - | 0 | Pig | 5.9 | pIC50 | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL315780 | 211169 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@H](C(=O)O)c1csc2ccccc12)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
10334781 | 95981 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL25970 | 95981 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
18617299 | 205251 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2Cl)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL79054 | 205251 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2Cl)c1C | 10.1016/0960-894X(96)00441-6 | ||
127028930 | 137279 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 570 | 9 | 3 | 7 | 6.0 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3752444 | 137279 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 570 | 9 | 3 | 7 | 6.0 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
10769025 | 60240 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.6 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(C)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL174171 | 60240 | 0 | None | - | 0 | Rat | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.6 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(C)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
44384656 | 130069 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 468 | 5 | 1 | 7 | 4.5 | Cc1noc(NS(=O)(=O)c2ccsc2/C=C/c2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL367763 | 130069 | 0 | None | - | 0 | Human | 6.9 | pIC50 | = | 6.9 | Binding | ChEMBL | 468 | 5 | 1 | 7 | 4.5 | Cc1noc(NS(=O)(=O)c2ccsc2/C=C/c2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
10577111 | 206874 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 493 | 7 | 1 | 6 | 4.0 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)COc2ccc(F)cc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL9084 | 206874 | 0 | None | - | 0 | Rat | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 493 | 7 | 1 | 6 | 4.0 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)COc2ccc(F)cc2)cc1 | 10.1021/jm9505369 | ||
10723203 | 11418 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 678 | 14 | 2 | 7 | 6.8 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL1180350 | 11418 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 678 | 14 | 2 | 7 | 6.8 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL123206 | 11418 | 0 | None | - | 0 | Human | 4.9 | pIC50 | = | 4.9 | Binding | ChEMBL | 678 | 14 | 2 | 7 | 6.8 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
44291584 | 101207 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 501 | 8 | 3 | 9 | 3.5 | COc1cc(OC)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)O)c1 | 10.1021/jm9608366 | ||
CHEMBL296074 | 101207 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 501 | 8 | 3 | 9 | 3.5 | COc1cc(OC)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)O)c1 | 10.1021/jm9608366 | ||
10625875 | 129622 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 523 | 9 | 4 | 5 | 4.6 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL367313 | 129622 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 523 | 9 | 4 | 5 | 4.6 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
10625875 | 129622 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 523 | 9 | 4 | 5 | 4.6 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL367313 | 129622 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 523 | 9 | 4 | 5 | 4.6 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
22998447 | 206652 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 414 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2sccc2Oc2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL89457 | 206652 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 414 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2sccc2Oc2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
10381121 | 96204 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N)cc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL26090 | 96204 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N)cc23)c1C | 10.1021/jm00004a012 | ||
10718688 | 183602 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 457 | 5 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cccc(O)c2)c1Br | 10.1021/jm9608366 | ||
CHEMBL48024 | 183602 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 457 | 5 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cccc(O)c2)c1Br | 10.1021/jm9608366 | ||
23445325 | 203364 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 397 | 5 | 2 | 6 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL65407 | 203364 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 397 | 5 | 2 | 6 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
10961546 | 96730 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL264543 | 96730 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
122272 | 97068 | 31 | None | -1 | 2 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL267458 | 97068 | 31 | None | -1 | 2 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
10961546 | 96730 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL264543 | 96730 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccc(C2=C(C(=O)O)[C@H](c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
44314751 | 161331 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 603 | 13 | 5 | 4 | 5.0 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL412602 | 161331 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 603 | 13 | 5 | 4 | 5.0 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
10602620 | 16559 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.4 | CCCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL123997 | 16559 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.4 | CCCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
10529868 | 164167 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 516 | 8 | 2 | 6 | 4.8 | CCc1cccc(C)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL421073 | 164167 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 516 | 8 | 2 | 6 | 4.8 | CCc1cccc(C)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
127035410 | 136360 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 557 | 8 | 1 | 8 | 5.7 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(C#N)c1)C(=O)CCCC2 | 10.1039/C4MD00499J | ||
CHEMBL3735155 | 136360 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 557 | 8 | 1 | 8 | 5.7 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(C#N)c1)C(=O)CCCC2 | 10.1039/C4MD00499J | ||
44320474 | 107041 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 440 | 8 | 1 | 5 | 5.7 | CCC(CC)Cn1nc(-c2ccccc2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315752 | 107041 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 440 | 8 | 1 | 5 | 5.7 | CCC(CC)Cn1nc(-c2ccccc2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
10575845 | 11197 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 457 | 7 | 2 | 8 | 3.8 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(OC)c1 | 10.1021/jm9608366 | ||
CHEMBL1178807 | 11197 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 457 | 7 | 2 | 8 | 3.8 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(OC)c1 | 10.1021/jm9608366 | ||
CHEMBL43788 | 11197 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 457 | 7 | 2 | 8 | 3.8 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(OC)c1 | 10.1021/jm9608366 | ||
10811595 | 98739 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 411 | 5 | 2 | 6 | 4.1 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9608366 | ||
10811595 | 98739 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 411 | 5 | 2 | 6 | 4.1 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9700068 | ||
CHEMBL278114 | 98739 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 411 | 5 | 2 | 6 | 4.1 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9608366 | ||
CHEMBL278114 | 98739 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 411 | 5 | 2 | 6 | 4.1 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9700068 | ||
CHEMBL328942 | 211293 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
CHEMBL150719 | 208768 | 0 | None | - | 0 | Mouse | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
10360201 | 95657 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1onc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL25816 | 95657 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1onc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
122272 | 97068 | 31 | None | -1 | 2 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL267458 | 97068 | 31 | None | -1 | 2 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
44283349 | 100298 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 603 | 13 | 5 | 4 | 5.0 | CCCC[C@H](NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL289410 | 100298 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 603 | 13 | 5 | 4 | 5.0 | CCCC[C@H](NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
44334053 | 4519 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 465 | 5 | 1 | 5 | 5.5 | COc1ccc([C@@H]2c3nc(-c4ccccc4)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL102411 | 4519 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 465 | 5 | 1 | 5 | 5.5 | COc1ccc([C@@H]2c3nc(-c4ccccc4)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
10811595 | 98739 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 411 | 5 | 2 | 6 | 4.1 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm000349x | ||
CHEMBL278114 | 98739 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 411 | 5 | 2 | 6 | 4.1 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm000349x | ||
CHEMBL336563 | 211561 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL347948 | 211691 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H](NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H]1CCCN1C(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
11072080 | 12072 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 600 | 11 | 1 | 9 | 6.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccc3ccccc3n2)c1 | 10.1021/jm0102304 | ||
CHEMBL1183970 | 12072 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 600 | 11 | 1 | 9 | 6.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccc3ccccc3n2)c1 | 10.1021/jm0102304 | ||
CHEMBL326160 | 12072 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 600 | 11 | 1 | 9 | 6.4 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccc3ccccc3n2)c1 | 10.1021/jm0102304 | ||
155562688 | 175156 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 554 | 13 | 2 | 10 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4570529 | 175156 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 554 | 13 | 2 | 10 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
22616258 | 105379 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 372 | 5 | 1 | 4 | 3.8 | CCCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311781 | 105379 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 372 | 5 | 1 | 4 | 3.8 | CCCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
10740943 | 203383 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 422 | 5 | 2 | 6 | 3.2 | CNc1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3OC)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6555 | 203383 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 422 | 5 | 2 | 6 | 3.2 | CNc1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3OC)cccc12 | 10.1021/jm9604585 | ||
CHEMBL67074 | 203591 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 646 | 8 | 2 | 13 | 5.8 | COC(=O)C1=C(C)N=C(C)/C(=C(/O)OC(=O)C2=C(C)N=C(C)/C(=C(/O)OC)[C@@H]2c2cccc([N+](=O)[O-])c2)[C@@H]1c1cccc([N+](=O)[O-])c1 | 10.1016/S0960-894X(01)81025-8 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
10095393 | 97530 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 452 | 5 | 3 | 5 | 5.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N/C(S)=N/c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27063 | 97530 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 452 | 5 | 3 | 5 | 5.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N/C(S)=N/c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
10576863 | 8256 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 484 | 5 | 1 | 6 | 5.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)c(Cl)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10926 | 8256 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 484 | 5 | 1 | 6 | 5.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(Cl)c(Cl)c2)cc1 | 10.1021/jm9606507 | ||
44279338 | 106667 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 487 | 11 | 6 | 4 | 2.3 | CC(C)C[C@H](NC(=O)NC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31436 | 106667 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 487 | 11 | 6 | 4 | 2.3 | CC(C)C[C@H](NC(=O)NC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44279309 | 161793 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 412 | 3 | 2 | 3 | 4.5 | Cc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL414408 | 161793 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 412 | 3 | 2 | 3 | 4.5 | Cc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 | 10.1016/0960-894X(95)00230-Q | ||
10641986 | 207212 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 356 | 6 | 1 | 4 | 4.2 | N#Cc1ccc(OCc2cccnc2)cc1/C=C(/C(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL92842 | 207212 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 356 | 6 | 1 | 4 | 4.2 | N#Cc1ccc(OCc2cccnc2)cc1/C=C(/C(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
44266646 | 98537 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 475 | 6 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL276638 | 98537 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 475 | 6 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/s0960-894x(97)10151-2 | ||
10087191 | 101810 | 1 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL30039 | 101810 | 1 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL424227 | 213299 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
44334084 | 109626 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 461 | 7 | 2 | 6 | 3.8 | COc1ccc([C@@H]2c3nc(CCC(=O)O)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL322434 | 109626 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 461 | 7 | 2 | 6 | 3.8 | COc1ccc([C@@H]2c3nc(CCC(=O)O)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm030480f | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm030480f | ||
44266646 | 98537 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 475 | 6 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1021/jm0300429 | ||
CHEMBL276638 | 98537 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 475 | 6 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1021/jm0300429 | ||
CHEMBL137671 | 208724 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL335128 | 211522 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44371429 | 48870 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 455 | 6 | 1 | 6 | 5.2 | COc1cccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)c1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL155973 | 48870 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 455 | 6 | 1 | 6 | 5.2 | COc1cccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)c1 | 10.1016/s0960-894x(99)00040-2 | ||
44316993 | 204916 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 286 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76360 | 204916 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 286 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
10983585 | 173250 | 0 | None | - | 1 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1021/acs.jmedchem.0c01093 | ||
CHEMBL4525321 | 173250 | 0 | None | - | 1 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1021/acs.jmedchem.0c01093 | ||
10650477 | 114222 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 558 | 10 | 2 | 6 | 5.8 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC(C)C)cc1 | 10.1021/jm990170q | ||
CHEMBL333009 | 114222 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 558 | 10 | 2 | 6 | 5.8 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC(C)C)cc1 | 10.1021/jm990170q | ||
44298356 | 194962 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 503 | 10 | 2 | 8 | 5.7 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCC/C=N/O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL54703 | 194962 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 503 | 10 | 2 | 8 | 5.7 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCC/C=N/O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
10983585 | 173250 | 0 | None | - | 1 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4525321 | 173250 | 0 | None | - | 1 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
66875612 | 175248 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 495 | 10 | 2 | 10 | 2.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4572634 | 175248 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 495 | 10 | 2 | 10 | 2.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
10693981 | 59520 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 431 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL171702 | 59520 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 431 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
15340612 | 106805 | 1 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 406 | 5 | 1 | 5 | 3.6 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144599 | 106805 | 1 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 406 | 5 | 1 | 5 | 3.6 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10744921 | 60023 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 536 | 10 | 5 | 4 | 4.6 | CCc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL173666 | 60023 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 536 | 10 | 5 | 4 | 4.6 | CCc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
44299023 | 196475 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 457 | 6 | 1 | 6 | 4.7 | CCc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL56343 | 196475 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 457 | 6 | 1 | 6 | 4.7 | CCc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
44332577 | 4674 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 341 | 3 | 0 | 4 | 4.4 | O=CC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103484 | 4674 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 341 | 3 | 0 | 4 | 4.4 | O=CC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
44266540 | 4873 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 447 | 6 | 1 | 7 | 4.8 | COc1ccc2c(c1)c(-c1ccc(OC)c(OC)c1)c(C(=O)O)n2-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10457 | 4873 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 447 | 6 | 1 | 7 | 4.8 | COc1ccc2c(c1)c(-c1ccc(OC)c(OC)c1)c(C(=O)O)n2-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
44266549 | 162343 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 415 | 4 | 1 | 6 | 4.5 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL416518 | 162343 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 415 | 4 | 1 | 6 | 4.5 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
19432649 | 204465 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 487 | 9 | 2 | 8 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCO | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL72473 | 204465 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 487 | 9 | 2 | 8 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCO | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL342215 | 211640 | 0 | None | - | 0 | Pig | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2cn(C(=O)OC(C)(C)C)c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44279349 | 168123 | 0 | None | - | 0 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 448 | 3 | 2 | 3 | 5.3 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3cccc4ccccc34)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL433039 | 168123 | 0 | None | - | 0 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 448 | 3 | 2 | 3 | 5.3 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3cccc4ccccc34)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL336087 | 211554 | 0 | None | - | 0 | Pig | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O | 10.1021/jm00021a021 | ||||
44386537 | 127784 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 532 | 10 | 4 | 7 | 4.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2cccnc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL366391 | 127784 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 532 | 10 | 4 | 7 | 4.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2cccnc2)nc1C(=O)O | 10.1021/jm950592+ | ||
10188517 | 61736 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 582 | 9 | 2 | 10 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL177203 | 61736 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 582 | 9 | 2 | 10 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
10122442 | 130671 | 0 | None | - | 1 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 660 | 14 | 2 | 11 | 5.6 | CCCCNC(=O)OCC#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368383 | 130671 | 0 | None | - | 1 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 660 | 14 | 2 | 11 | 5.6 | CCCCNC(=O)OCC#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10832511 | 203381 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 362 | 4 | 1 | 5 | 3.2 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnc(Cl)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6553 | 203381 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 362 | 4 | 1 | 5 | 3.2 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnc(Cl)cn3)cccc12 | 10.1021/jm9604585 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.8b00435 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.8b00435 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.8b00435 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.8b00435 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.8b00435 | ||
10569313 | 97174 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 342 | 4 | 1 | 5 | 2.8 | Cc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1 | 10.1021/jm9604585 | ||
CHEMBL268387 | 97174 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 342 | 4 | 1 | 5 | 2.8 | Cc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1 | 10.1021/jm9604585 | ||
5018984 | 203107 | 2 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 405 | 4 | 1 | 4 | 3.9 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6411 | 203107 | 2 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 405 | 4 | 1 | 4 | 3.9 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)cn3)cccc12 | 10.1021/jm9604585 | ||
10690058 | 203174 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 362 | 4 | 1 | 5 | 3.2 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Cl)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6433 | 203174 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 362 | 4 | 1 | 5 | 3.2 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Cl)cn3)cccc12 | 10.1021/jm9604585 | ||
5017966 | 203243 | 2 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 341 | 4 | 1 | 4 | 3.4 | Cc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nc1 | 10.1021/jm9604585 | ||
CHEMBL6463 | 203243 | 2 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 341 | 4 | 1 | 4 | 3.4 | Cc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nc1 | 10.1021/jm9604585 | ||
23445285 | 112350 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 454 | 7 | 1 | 5 | 5.6 | CCCCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL329560 | 112350 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 454 | 7 | 1 | 5 | 5.6 | CCCCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
10250826 | 99077 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 407 | 5 | 1 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1-c1ccccc1 | 10.1021/jm00008a013 | ||
CHEMBL280823 | 99077 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 407 | 5 | 1 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1-c1ccccc1 | 10.1021/jm00008a013 | ||
9980084 | 102106 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 429 | 10 | 1 | 5 | 5.7 | CCCCN(CCCC)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL30245 | 102106 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 429 | 10 | 1 | 5 | 5.7 | CCCCN(CCCC)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
9852624 | 128655 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 656 | 14 | 2 | 11 | 4.5 | CCS(=O)(=O)NCCCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL366872 | 128655 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 656 | 14 | 2 | 11 | 4.5 | CCS(=O)(=O)NCCCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
10744040 | 113542 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cccc(C)c2C)cc1 | 10.1021/jm031041j | ||
CHEMBL332231 | 113542 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cccc(C)c2C)cc1 | 10.1021/jm031041j | ||
10815726 | 11416 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 516 | 8 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL1180348 | 11416 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 516 | 8 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL123146 | 11416 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 516 | 8 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
10671649 | 98538 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 460 | 5 | 1 | 8 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL276639 | 98538 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 460 | 5 | 1 | 8 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
10299975 | 110227 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 488 | 14 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC(C)CC | 10.1021/jm980217s | ||
CHEMBL323791 | 110227 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 488 | 14 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC(C)CC | 10.1021/jm980217s | ||
10816152 | 16301 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 534 | 9 | 2 | 8 | 3.9 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(OC)cccc2OC)cc1 | 10.1021/jm990170q | ||
CHEMBL122832 | 16301 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 534 | 9 | 2 | 8 | 3.9 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(OC)cccc2OC)cc1 | 10.1021/jm990170q | ||
10744040 | 113542 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cccc(C)c2C)cc1 | 10.1021/jm990170q | ||
CHEMBL332231 | 113542 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cccc(C)c2C)cc1 | 10.1021/jm990170q | ||
10552344 | 59185 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 471 | 7 | 1 | 6 | 5.1 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1OC(C(=O)O)c1ccccc1C(F)(F)F | 10.1021/jm990378b | ||
CHEMBL170202 | 59185 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 471 | 7 | 1 | 6 | 5.1 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1OC(C(=O)O)c1ccccc1C(F)(F)F | 10.1021/jm990378b | ||
44295156 | 14595 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccccc1C(=O)/C(Cc1cc(OC)c(OC)c(OC)c1)=C(\C(=O)O)c1ccc2nsnc2c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205062 | 14595 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccccc1C(=O)/C(Cc1cc(OC)c(OC)c(OC)c1)=C(\C(=O)O)c1ccc2nsnc2c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL48411 | 14595 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1ccccc1C(=O)/C(Cc1cc(OC)c(OC)c(OC)c1)=C(\C(=O)O)c1ccc2nsnc2c1 | 10.1016/s0960-894x(98)00301-1 | ||
10231591 | 131334 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 569 | 10 | 2 | 11 | 2.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368828 | 131334 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 569 | 10 | 2 | 11 | 2.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
10338502 | 119449 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3noc(C)c3C)cccc12 | 10.1021/jm00004a012 | ||
CHEMBL345247 | 119449 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3noc(C)c3C)cccc12 | 10.1021/jm00004a012 | ||
44386370 | 60385 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 531 | 10 | 4 | 6 | 4.8 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL175066 | 60385 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 531 | 10 | 4 | 6 | 4.8 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
15453177 | 205498 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL80857 | 205498 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
10601795 | 96943 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 510 | 10 | 1 | 6 | 4.4 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(CC(C)C)CC(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL266354 | 96943 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 510 | 10 | 1 | 6 | 4.4 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(CC(C)C)CC(C)C)cc1 | 10.1021/jm9505369 | ||
44265869 | 97233 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 466 | 7 | 2 | 6 | 3.3 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC2CCCC2)cc1 | 10.1021/jm9505369 | ||
CHEMBL268864 | 97233 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 466 | 7 | 2 | 6 | 3.3 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC2CCCC2)cc1 | 10.1021/jm9505369 | ||
44278003 | 99240 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 449 | 8 | 1 | 6 | 5.6 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccccc3)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28188 | 99240 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 449 | 8 | 1 | 6 | 5.6 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccccc3)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
18617302 | 104389 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 334 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccccc2F)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL310361 | 104389 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 334 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccccc2F)c1Br | 10.1016/0960-894X(96)00441-6 | ||
15453180 | 105198 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 348 | 4 | 1 | 4 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1Cl | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311510 | 105198 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 348 | 4 | 1 | 4 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1Cl | 10.1016/0960-894X(96)00441-6 | ||
10951244 | 202930 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1cc(OC)ccc1OC)O2 | 10.1021/jm010382z | ||
CHEMBL62962 | 202930 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1cc(OC)ccc1OC)O2 | 10.1021/jm010382z | ||
11100307 | 203178 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 354 | 5 | 1 | 5 | 3.8 | CCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL64340 | 203178 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 354 | 5 | 1 | 5 | 3.8 | CCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
44314461 | 204756 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 605 | 13 | 5 | 4 | 3.9 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL74837 | 204756 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 605 | 13 | 5 | 4 | 3.9 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCC1)C(=O)O | 10.1021/jm9600914 | ||
10767778 | 16370 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cc(C)cc(C)c2)cc1 | 10.1021/jm990170q | ||
CHEMBL123077 | 16370 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cc(C)cc(C)c2)cc1 | 10.1021/jm990170q | ||
44295114 | 14848 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 556 | 11 | 1 | 9 | 5.3 | COc1cc(C/C(C(=O)c2ccc(OC(F)F)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1207717 | 14848 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 556 | 11 | 1 | 9 | 5.3 | COc1cc(C/C(C(=O)c2ccc(OC(F)F)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL433090 | 14848 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 556 | 11 | 1 | 9 | 5.3 | COc1cc(C/C(C(=O)c2ccc(OC(F)F)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
122044 | 10141 | 51 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1 | 10.1021/jm0102304 | ||
CHEMBL115951 | 10141 | 51 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1 | 10.1021/jm0102304 | ||
44309814 | 102979 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 487 | 8 | 1 | 7 | 6.2 | CCCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)n2Cc1cc2nsnc2cc1C | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL306863 | 102979 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 487 | 8 | 1 | 7 | 6.2 | CCCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)n2Cc1cc2nsnc2cc1C | 10.1016/s0960-894x(97)10151-2 | ||
44327380 | 111577 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 457 | 6 | 1 | 9 | 1.4 | COc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc(C)ccc2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL328311 | 111577 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 457 | 6 | 1 | 9 | 1.4 | COc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc(C)ccc2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL136634 | 208717 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C(C)C)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL337031 | 211567 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL342840 | 211671 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CCC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10926281 | 102731 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm031041j | ||
CHEMBL305117 | 102731 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm031041j | ||
10926281 | 102731 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL305117 | 102731 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
11026419 | 203159 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3c(OC)cccc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64266 | 203159 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3c(OC)cccc32)cc1 | 10.1021/jm010382z | ||
44368819 | 168868 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1637 | 31 | 19 | 20 | 1.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
77282140 | 168868 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1637 | 31 | 19 | 20 | 1.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL438380 | 168868 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1637 | 31 | 19 | 20 | 1.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
44270524 | 98179 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 682 | 13 | 1 | 9 | 6.9 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1ccccc1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL274243 | 98179 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 682 | 13 | 1 | 9 | 6.9 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1ccccc1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
44267002 | 98531 | 0 | None | - | 0 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 546 | 5 | 1 | 7 | 5.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc3c2CCc2ccccc2C3=O)cc1 | 10.1021/jm9606507 | ||
CHEMBL276601 | 98531 | 0 | None | - | 0 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 546 | 5 | 1 | 7 | 5.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc3c2CCc2ccccc2C3=O)cc1 | 10.1021/jm9606507 | ||
10627398 | 130661 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 599 | 11 | 4 | 5 | 5.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(Cc2ccccc2)o1 | 10.1021/jm950591h | ||
CHEMBL368339 | 130661 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 599 | 11 | 4 | 5 | 5.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(Cc2ccccc2)o1 | 10.1021/jm950591h | ||
10841170 | 12087 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 592 | 9 | 2 | 6 | 5.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL1184090 | 12087 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 592 | 9 | 2 | 6 | 5.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL332109 | 12087 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 592 | 9 | 2 | 6 | 5.8 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
10579647 | 168454 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 612 | 11 | 4 | 5 | 5.8 | Cc1c(C(=O)O)nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)n1Cc1ccccc1 | 10.1021/jm950592+ | ||
CHEMBL435156 | 168454 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 612 | 11 | 4 | 5 | 5.8 | Cc1c(C(=O)O)nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)n1Cc1ccccc1 | 10.1021/jm950592+ | ||
10575061 | 206870 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 439 | 9 | 1 | 6 | 4.0 | CCCCC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9082 | 206870 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 439 | 9 | 1 | 6 | 4.0 | CCCCC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10646637 | 207025 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 437 | 8 | 1 | 5 | 4.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C/C=C/CC(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL9168 | 207025 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 437 | 8 | 1 | 5 | 4.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C/C=C/CC(C)C)cc1 | 10.1021/jm9505369 | ||
44368416 | 44662 | 0 | None | - | 0 | Pig | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 540 | 8 | 2 | 6 | 5.6 | O=C(O)C(Cc1c[nH]c2ccccc12)N(Cc1cc2c(cc1Cl)OCO2)Cc1cc2c(cc1Cl)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152098 | 44662 | 0 | None | - | 0 | Pig | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 540 | 8 | 2 | 6 | 5.6 | O=C(O)C(Cc1c[nH]c2ccccc12)N(Cc1cc2c(cc1Cl)OCO2)Cc1cc2c(cc1Cl)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
10478562 | 131772 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 442 | 6 | 1 | 6 | 4.5 | Cc1ccc(OCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL369359 | 131772 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 442 | 6 | 1 | 6 | 4.5 | Cc1ccc(OCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00132-7 | ||
127026043 | 137328 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 607 | 11 | 3 | 9 | 3.8 | CCCc1nc2c(C)cc(C(=O)NCCN3CCOCC3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3752947 | 137328 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 607 | 11 | 3 | 9 | 3.8 | CCCc1nc2c(C)cc(C(=O)NCCN3CCOCC3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
44386162 | 60379 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 575 | 11 | 1 | 9 | 6.2 | CC/C=C/COc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175005 | 60379 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 575 | 11 | 1 | 9 | 6.2 | CC/C=C/COc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10503334 | 173320 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 441 | 5 | 2 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL45269 | 173320 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 441 | 5 | 2 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
10503334 | 173320 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 441 | 5 | 2 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL45269 | 173320 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 441 | 5 | 2 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1Br | 10.1021/jm9608366 | ||
10140871 | 59221 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 484 | 9 | 2 | 9 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)ncnc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL170342 | 59221 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 484 | 9 | 2 | 9 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)ncnc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
44383754 | 59853 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 452 | 5 | 1 | 5 | 5.4 | Cc1ccc(/C=C/c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL172987 | 59853 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 452 | 5 | 1 | 5 | 5.4 | Cc1ccc(/C=C/c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL319660 | 211197 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
11005243 | 203358 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL65337 | 203358 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
9801093 | 59206 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.1 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
CHEMBL170296 | 59206 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.1 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
44295089 | 14600 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 8 | 1 | 7 | 5.4 | COc1ccc(C(=O)/C(Cc2ccc(SC)cc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205088 | 14600 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 8 | 1 | 7 | 5.4 | COc1ccc(C(=O)/C(Cc2ccc(SC)cc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL51030 | 14600 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 8 | 1 | 7 | 5.4 | COc1ccc(C(=O)/C(Cc2ccc(SC)cc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
44320192 | 107029 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 480 | 6 | 1 | 5 | 5.9 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1Cc1cccc(Cl)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315622 | 107029 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 480 | 6 | 1 | 5 | 5.9 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1Cc1cccc(Cl)c1 | 10.1016/s0960-894x(00)00513-8 | ||
10504542 | 179539 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 469 | 6 | 2 | 6 | 4.4 | CCc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
CHEMBL47418 | 179539 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 469 | 6 | 2 | 6 | 4.4 | CCc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
44386536 | 130687 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccc2F)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368461 | 130687 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccc2F)nc1C(=O)O | 10.1021/jm950592+ | ||
10626245 | 131136 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 539 | 10 | 2 | 8 | 5.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)OC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL368629 | 131136 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 539 | 10 | 2 | 8 | 5.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)OC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
44311516 | 204095 | 0 | None | - | 1 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 678 | 12 | 2 | 12 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70339 | 204095 | 0 | None | - | 1 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 678 | 12 | 2 | 12 | 5.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
137633242 | 156456 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 569 | 10 | 2 | 10 | 3.8 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCOC)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4067475 | 156456 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 569 | 10 | 2 | 10 | 3.8 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCOC)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10599230 | 206972 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 440 | 8 | 2 | 6 | 2.8 | CCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9141 | 206972 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 440 | 8 | 2 | 6 | 2.8 | CCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
71458718 | 81645 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 615 | 14 | 1 | 12 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(C)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163700 | 81645 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 615 | 14 | 1 | 12 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(C)cn1 | 10.1021/jm3009103 | ||
44320783 | 106666 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 453 | 6 | 1 | 6 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccnc2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL314357 | 106666 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 453 | 6 | 1 | 6 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2cccnc2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
18995986 | 99553 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 537 | 8 | 1 | 10 | 5.0 | COc1ccc(Sc2c(C(=O)O)n(Cc3cc(OC)c4c(c3)OCO4)c3cc4c(cc23)OCO4)cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL283858 | 99553 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 537 | 8 | 1 | 10 | 5.0 | COc1ccc(Sc2c(C(=O)O)n(Cc3cc(OC)c4c(c3)OCO4)c3cc4c(cc23)OCO4)cc1OC | 10.1016/0960-894X(96)00232-6 | ||
18617379 | 205201 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 364 | 3 | 1 | 4 | 3.5 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78669 | 205201 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 364 | 3 | 1 | 4 | 3.5 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10622616 | 8026 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | CSc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10911 | 8026 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | CSc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10412464 | 9105 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 470 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2=C(c3ccc(Cl)c(Cl)c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10996 | 9105 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 470 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2=C(c3ccc(Cl)c(Cl)c3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
11826883 | 200128 | 1 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 476 | 8 | 1 | 6 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)c(OC)c3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL59635 | 200128 | 1 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 476 | 8 | 1 | 6 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)c(OC)c3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
11017198 | 108986 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 563 | 12 | 1 | 8 | 6.0 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOCc2ccccc2)c1 | 10.1021/jm0102304 | ||
CHEMBL321226 | 108986 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 563 | 12 | 1 | 8 | 6.0 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOCc2ccccc2)c1 | 10.1021/jm0102304 | ||
10765567 | 111327 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 440 | 9 | 1 | 5 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2cccc(OC)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL326951 | 111327 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 440 | 9 | 1 | 5 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2cccc(OC)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
9870117 | 194863 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 488 | 10 | 1 | 7 | 5.5 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC=O)c1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL54057 | 194863 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 488 | 10 | 1 | 7 | 5.5 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC=O)c1 | 10.1016/j.bmcl.2016.06.014 | ||
9870117 | 194863 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 488 | 10 | 1 | 7 | 5.5 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL54057 | 194863 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 488 | 10 | 1 | 7 | 5.5 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
44277367 | 106811 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 392 | 4 | 2 | 5 | 3.3 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1cccc(O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144606 | 106811 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 392 | 4 | 2 | 5 | 3.3 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1cccc(O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44387128 | 168565 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 558 | 12 | 2 | 10 | 3.8 | CNCC(=O)OCCOc1nc(C)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL435895 | 168565 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 558 | 12 | 2 | 10 | 3.8 | CNCC(=O)OCCOc1nc(C)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL422464 | 213264 | 0 | None | - | 0 | Pig | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CCO)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
5310990 | 166806 | 11 | None | - | 1 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL428504 | 166806 | 11 | None | - | 1 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
23445506 | 112531 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 428 | 5 | 1 | 6 | 4.3 | COc1ccccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL330003 | 112531 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 428 | 5 | 1 | 6 | 4.3 | COc1ccccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
10452145 | 98176 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 376 | 5 | 1 | 7 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1[N+](=O)[O-] | 10.1021/jm00008a013 | ||
CHEMBL27420 | 98176 | 0 | None | - | 0 | Rat | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 376 | 5 | 1 | 7 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1[N+](=O)[O-] | 10.1021/jm00008a013 | ||
10813007 | 113293 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 440 | 9 | 1 | 5 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccc(OC)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL331577 | 113293 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 440 | 9 | 1 | 5 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccc(OC)cc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
44384852 | 60210 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 544 | 9 | 1 | 8 | 5.5 | C#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL174094 | 60210 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 544 | 9 | 1 | 8 | 5.5 | C#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10362674 | 97754 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 385 | 4 | 1 | 5 | 4.2 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCCC4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27178 | 97754 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 385 | 4 | 1 | 5 | 4.2 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCCC4)cccc23)c1C | 10.1021/jm00008a013 | ||
10742446 | 206989 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 456 | 9 | 2 | 7 | 2.0 | COCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9147 | 206989 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 456 | 9 | 2 | 7 | 2.0 | COCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10650638 | 9152 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 566 | 13 | 1 | 6 | 4.8 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(F)c(F)c1 | 10.1021/jm970101g | ||
CHEMBL110305 | 9152 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 566 | 13 | 1 | 6 | 4.8 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(F)c(F)c1 | 10.1021/jm970101g | ||
10647898 | 97317 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 466 | 5 | 1 | 6 | 5.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc3ccccc23)cc1 | 10.1021/jm9606507 | ||
CHEMBL269409 | 97317 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 466 | 5 | 1 | 6 | 5.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc3ccccc23)cc1 | 10.1021/jm9606507 | ||
10993781 | 201326 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 434 | 7 | 1 | 7 | 5.0 | CCCCC1=C(c2nnn[nH]2)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL60440 | 201326 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 434 | 7 | 1 | 7 | 5.0 | CCCCC1=C(c2nnn[nH]2)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10896412 | 202781 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)cc1OC)O2 | 10.1021/jm010382z | ||
CHEMBL62277 | 202781 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)cc1OC)O2 | 10.1021/jm010382z | ||
15410997 | 4676 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 563 | 8 | 1 | 7 | 6.3 | COc1ccc(C2(OC(=O)N[C@@H](C)c3ccccc3)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL103501 | 4676 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 563 | 8 | 1 | 7 | 6.3 | COc1ccc(C2(OC(=O)N[C@@H](C)c3ccccc3)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL2370534 | 209846 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CCCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1CCCCNC(=O)CC[C@@H](NC(=O)[C@H](CCCC)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@H](N)Cc2ccccc2)C(C)C)C(=O)N[C@H](CCCN=C(N)N)C(=O)N[C@@H](C)C(=O)N1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(N)=O)[C@@H](C)CC)[C@@H](C)CC | 10.1021/jm990170q | ||||
151174 | 202697 | 45 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 605 | 12 | 3 | 13 | 3.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL61780 | 202697 | 45 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 605 | 12 | 3 | 13 | 3.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
76319370 | 85327 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 564 | 8 | 1 | 9 | 4.0 | CCOC(=O)c1ccc2c(C(C(=O)NS(=O)(=O)c3ccc(C)cc3OC)c3ccc4c(c3)OCO4)cn(C)c2c1 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261602 | 85327 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 564 | 8 | 1 | 9 | 4.0 | CCOC(=O)c1ccc2c(C(C(=O)NS(=O)(=O)c3ccc(C)cc3OC)c3ccc4c(c3)OCO4)cn(C)c2c1 | 10.1007/s00044-004-0021-y | ||
10050696 | 96749 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 7 | 1 | 6 | 5.3 | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL26474 | 96749 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 7 | 1 | 6 | 5.3 | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
10050696 | 96749 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 7 | 1 | 6 | 5.3 | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL26474 | 96749 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 476 | 7 | 1 | 6 | 5.3 | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10138169 | 99333 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 440 | 6 | 1 | 8 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL282470 | 99333 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 440 | 6 | 1 | 8 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
10211772 | 56493 | 0 | None | - | 1 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 660 | 11 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL163638 | 56493 | 0 | None | - | 1 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 660 | 11 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
10165809 | 131773 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 541 | 9 | 2 | 11 | 2.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL369362 | 131773 | 0 | None | - | 0 | Human | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 541 | 9 | 2 | 11 | 2.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL61900 | 215818 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
44327412 | 207558 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 497 | 5 | 1 | 8 | 3.0 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94929 | 207558 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 497 | 5 | 1 | 8 | 3.0 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44385621 | 128170 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.6 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2C)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL366544 | 128170 | 0 | None | - | 0 | Rat | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.6 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2C)nc1C(=O)O | 10.1021/jm950592+ | ||
44356917 | 119215 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 638 | 8 | 5 | 8 | 0.3 | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2cn(C=O)c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||
CHEMBL343516 | 119215 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | 638 | 8 | 5 | 8 | 0.3 | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2cn(C=O)c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||
CHEMBL2370825 | 209905 | 0 | None | - | 0 | Pig | 7.8 | pIC50 | = | 7.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2C[C@@H](O)CN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
11091217 | 101040 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 426 | 9 | 1 | 6 | 5.0 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2cc(OCCC)ccc21 | 10.1021/jm010382z | ||
CHEMBL294787 | 101040 | 0 | None | - | 0 | Rat | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 426 | 9 | 1 | 6 | 5.0 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2cc(OCCC)ccc21 | 10.1021/jm010382z | ||
44314722 | 155727 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 597 | 14 | 5 | 4 | 4.9 | CCCCC(NC(=O)[C@@H](Cc1c(CC)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL405724 | 155727 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 597 | 14 | 5 | 4 | 4.9 | CCCCC(NC(=O)[C@@H](Cc1c(CC)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL293216 | 210866 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
44283421 | 100129 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 597 | 14 | 5 | 4 | 4.9 | CCCC[C@H](NC(=O)[C@@H](Cc1c(CC)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL287888 | 100129 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 597 | 14 | 5 | 4 | 4.9 | CCCC[C@H](NC(=O)[C@@H](Cc1c(CC)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
44383742 | 168481 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 452 | 5 | 1 | 5 | 5.4 | Cc1ccc(/C=C/c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL435346 | 168481 | 0 | None | - | 0 | Human | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | 452 | 5 | 1 | 5 | 5.4 | Cc1ccc(/C=C/c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL137361 | 208721 | 0 | None | - | 0 | Pig | 6.8 | pIC50 | = | 6.8 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL313382 | 211090 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL86814 | 215869 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
44368819 | 168868 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1637 | 31 | 19 | 20 | 1.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
77282140 | 168868 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1637 | 31 | 19 | 20 | 1.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL438380 | 168868 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1637 | 31 | 19 | 20 | 1.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
44316973 | 205582 | 2 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc(Br)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL81593 | 205582 | 2 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2cccc(Br)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
127035067 | 136367 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 683 | 12 | 2 | 9 | 5.4 | CCCc1nc2c(C)cc(C(=O)NCCN3CCN(C)CC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735236 | 136367 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 683 | 12 | 2 | 9 | 5.4 | CCCc1nc2c(C)cc(C(=O)NCCN3CCN(C)CC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44368824 | 96798 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1595 | 31 | 19 | 20 | 0.6 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
77282142 | 96798 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1595 | 31 | 19 | 20 | 0.6 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL265164 | 96798 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 1595 | 31 | 19 | 20 | 0.6 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL436899 | 213671 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
44277034 | 106816 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 406 | 5 | 1 | 5 | 3.6 | COc1ccccc1Cn1[nH]c(C(F)(F)F)c(Cc2ccc3c(c2)OCO3)c1=O | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144729 | 106816 | 0 | None | - | 0 | Rat | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | 406 | 5 | 1 | 5 | 3.6 | COc1ccccc1Cn1[nH]c(C(F)(F)F)c(Cc2ccc3c(c2)OCO3)c1=O | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL1791279 | 208896 | 0 | None | - | 0 | Human | 5.8 | pIC50 | = | 5.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)[C@H](C)CC)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00152-J | ||||
CHEMBL5272983 | 193719 | 0 | None | - | 0 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 439 | 7 | 2 | 6 | 3.3 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccccc1)c1ccc(C(F)(F)F)cc1 | 10.1021/acs.jmedchem.0c01093 | ||
19735343 | 176027 | 0 | None | - | 1 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 473 | 7 | 2 | 6 | 4.0 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4590568 | 176027 | 0 | None | - | 1 | Human | 4.8 | pIC50 | = | 4.8 | Binding | ChEMBL | 473 | 7 | 2 | 6 | 4.0 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
23445516 | 106601 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 468 | 7 | 1 | 5 | 5.9 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccc(CCC(C)C)cc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL314307 | 106601 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 468 | 7 | 1 | 5 | 5.9 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccc(CCC(C)C)cc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
23445354 | 206612 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 426 | 5 | 1 | 5 | 4.8 | CCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL89203 | 206612 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 426 | 5 | 1 | 5 | 4.8 | CCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL273391 | 210786 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL273391 | 210786 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
18184206 | 60302 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 600 | 13 | 2 | 11 | 3.2 | CCS(=O)(=O)NCCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL174413 | 60302 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 600 | 13 | 2 | 11 | 3.2 | CCS(=O)(=O)NCCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
44385792 | 60321 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 617 | 13 | 2 | 11 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(C2CC2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL174547 | 60321 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 617 | 13 | 2 | 11 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(C2CC2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
44384966 | 59967 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 545 | 9 | 1 | 9 | 4.8 | C#CCOc1nc(-c2cnccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL173465 | 59967 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 545 | 9 | 1 | 9 | 4.8 | C#CCOc1nc(-c2cnccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
71460537 | 81668 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 660 | 12 | 1 | 13 | 2.7 | COc1ccccc1Oc1c(NS(=O)(=O)N2CCOCC2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163722 | 81668 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 660 | 12 | 1 | 13 | 2.7 | COc1ccccc1Oc1c(NS(=O)(=O)N2CCOCC2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
10765057 | 163136 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 430 | 4 | 1 | 7 | 3.5 | O=C1OC(O)(c2ccc3c(c2)OCO3)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL417978 | 163136 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 430 | 4 | 1 | 7 | 3.5 | O=C1OC(O)(c2ccc3c(c2)OCO3)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL2304012 | 209445 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)[C@H]1NC(=O)[C@H](C2CCCC2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Br)[nH]c3ccccc23)NC1=O | 10.1021/jm9600914 | ||||
44458399 | 98964 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 520 | 7 | 2 | 7 | 4.2 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(CO)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL279947 | 98964 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 520 | 7 | 2 | 7 | 4.2 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(CO)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
73669992 | 117605 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 387 | 9 | 1 | 4 | 5.4 | N#CCCC(Oc1cc(OCc2ccccc2)ccc1C(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
CHEMBL3400998 | 117605 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 387 | 9 | 1 | 4 | 5.4 | N#CCCC(Oc1cc(OCc2ccccc2)ccc1C(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
10814776 | 99445 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 5 | 2 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9608366 | ||
10814776 | 99445 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 5 | 2 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL283136 | 99445 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 5 | 2 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9608366 | ||
CHEMBL283136 | 99445 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 5 | 2 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
44387111 | 166158 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 548 | 10 | 5 | 5 | 4.2 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL426413 | 166158 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 548 | 10 | 5 | 5 | 4.2 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
9830773 | 130200 | 0 | None | - | 2 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 636 | 14 | 2 | 12 | 2.8 | CCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367958 | 130200 | 0 | None | - | 2 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 636 | 14 | 2 | 12 | 2.8 | CCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
10814776 | 99445 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 5 | 2 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm000349x | ||
CHEMBL283136 | 99445 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 5 | 2 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm000349x | ||
CHEMBL341994 | 211638 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C2=CCC=CC2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10410546 | 9380 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL11162 | 9380 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(CC2=C(c3ccc(OC)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
44279481 | 112356 | 0 | None | - | 0 | Pig | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 555 | 11 | 5 | 4 | 4.0 | CC(C)C[C@H](NC(=O)N1C(C)(C)CCCC1(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL32959 | 112356 | 0 | None | - | 0 | Pig | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 555 | 11 | 5 | 4 | 4.0 | CC(C)C[C@H](NC(=O)N1C(C)(C)CCCC1(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10674095 | 113486 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 544 | 9 | 1 | 6 | 5.1 | CCc1cccc(CC)c1N(C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL332093 | 113486 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 544 | 9 | 1 | 6 | 5.1 | CCc1cccc(CC)c1N(C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL135906 | 208711 | 0 | None | - | 0 | Pig | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44316983 | 104769 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 312 | 5 | 1 | 6 | 2.1 | COc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1OC | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL310944 | 104769 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 312 | 5 | 1 | 6 | 2.1 | COc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1OC | 10.1016/0960-894X(96)00441-6 | ||
44371670 | 141638 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 1082 | 23 | 11 | 10 | 3.7 | CC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C1c2ccccc2CCc2ccccc21 | 10.1016/0960-894X(95)00084-7 | ||
CHEMBL385405 | 141638 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 1082 | 23 | 11 | 10 | 3.7 | CC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C1c2ccccc2CCc2ccccc21 | 10.1016/0960-894X(95)00084-7 | ||
44277035 | 106825 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 410 | 4 | 1 | 4 | 4.2 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1cccc(Cl)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144806 | 106825 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 410 | 4 | 1 | 4 | 4.2 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1cccc(Cl)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10554385 | 60185 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 537 | 10 | 4 | 5 | 4.8 | CCc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL174000 | 60185 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 537 | 10 | 4 | 5 | 4.8 | CCc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
10721963 | 60529 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 580 | 11 | 5 | 6 | 3.7 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)NCC(=O)O | 10.1021/jm950592+ | ||
CHEMBL175924 | 60529 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 580 | 11 | 5 | 6 | 3.7 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)NCC(=O)O | 10.1021/jm950592+ | ||
44386620 | 170581 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccc(F)cc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL445076 | 170581 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccc(F)cc2)nc1C(=O)O | 10.1021/jm950592+ | ||
44311218 | 103100 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 607 | 11 | 2 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)Nc1ccncc1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL307803 | 103100 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 607 | 11 | 2 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)Nc1ccncc1 | 10.1016/S0960-894X(97)00400-9 | ||
18617344 | 205255 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 361 | 4 | 1 | 6 | 2.5 | Cc1noc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL79080 | 205255 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 361 | 4 | 1 | 6 | 2.5 | Cc1noc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
15342056 | 206990 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 322 | 3 | 1 | 5 | 2.6 | Cc1noc(NS(=O)(=O)c2cccs2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL91470 | 206990 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 322 | 3 | 1 | 5 | 2.6 | Cc1noc(NS(=O)(=O)c2cccs2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
10503976 | 11206 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 455 | 5 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)N(C)c2ccccc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL1178874 | 11206 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 455 | 5 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)N(C)c2ccccc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL47536 | 11206 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 455 | 5 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)N(C)c2ccccc2)c1Br | 10.1021/jm9608366 | ||
10211543 | 131359 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 640 | 13 | 2 | 12 | 3.5 | CCCCNC(=O)OCC#CCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368989 | 131359 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 640 | 13 | 2 | 12 | 3.5 | CCCCNC(=O)OCC#CCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10341117 | 163173 | 1 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 403 | 8 | 3 | 6 | 3.5 | Cc1noc(NS(=O)(=O)c2cccc3c(NCCCC(=O)O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL418202 | 163173 | 1 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 403 | 8 | 3 | 6 | 3.5 | Cc1noc(NS(=O)(=O)c2cccc3c(NCCCC(=O)O)cccc23)c1C | 10.1021/jm00008a013 | ||
10554085 | 101260 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 524 | 6 | 1 | 9 | 3.2 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1Cl | 10.1021/jm9700068 | ||
CHEMBL296427 | 101260 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 524 | 6 | 1 | 9 | 3.2 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1Cl | 10.1021/jm9700068 | ||
10817024 | 12096 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NCC(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL1184112 | 12096 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NCC(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL332808 | 12096 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NCC(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
44279140 | 110605 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 588 | 12 | 2 | 6 | 5.8 | CCCCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL32574 | 110605 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 588 | 12 | 2 | 6 | 5.8 | CCCCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
11793037 | 203684 | 3 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 362 | 4 | 1 | 5 | 3.2 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)nn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6761 | 203684 | 3 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 362 | 4 | 1 | 5 | 3.2 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)nn3)cccc12 | 10.1021/jm9604585 | ||
9885296 | 96940 | 1 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 361 | 4 | 1 | 4 | 3.8 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL266315 | 96940 | 1 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 361 | 4 | 1 | 4 | 3.8 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)cn3)cccc12 | 10.1021/jm9604585 | ||
10786783 | 203412 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 393 | 4 | 1 | 5 | 3.2 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc2ccccc12 | 10.1021/jm9604585 | ||
CHEMBL6576 | 203412 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 393 | 4 | 1 | 5 | 3.2 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc2ccccc12 | 10.1021/jm9604585 | ||
10740137 | 203490 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Br)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6630 | 203490 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Br)cn3)cccc12 | 10.1021/jm9604585 | ||
10230836 | 8877 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 546 | 13 | 1 | 7 | 4.1 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
CHEMBL109765 | 8877 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 546 | 13 | 1 | 7 | 4.1 | CCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
10209319 | 9338 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 546 | 13 | 1 | 7 | 4.1 | CCCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCC | 10.1021/jm970101g | ||
CHEMBL111355 | 9338 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 546 | 13 | 1 | 7 | 4.1 | CCCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCC | 10.1021/jm970101g | ||
10507211 | 110344 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 566 | 13 | 1 | 7 | 3.9 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
CHEMBL324214 | 110344 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 566 | 13 | 1 | 7 | 3.9 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCCCl | 10.1021/jm970101g | ||
9807691 | 100036 | 0 | None | - | 1 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 553 | 10 | 1 | 10 | 5.3 | COc1cc2c(Sc3cc(OC)c(OC)c(OC)c3)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL287169 | 100036 | 0 | None | - | 1 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 553 | 10 | 1 | 10 | 5.3 | COc1cc2c(Sc3cc(OC)c(OC)c(OC)c3)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
11732669 | 203094 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 426 | 9 | 1 | 6 | 5.0 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OCCC)cc21 | 10.1021/jm010382z | ||
CHEMBL64039 | 203094 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 426 | 9 | 1 | 6 | 5.0 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OCCC)cc21 | 10.1021/jm010382z | ||
10602267 | 8555 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 529 | 13 | 1 | 6 | 3.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCCCC1=O | 10.1021/jm980217s | ||
CHEMBL109478 | 8555 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 529 | 13 | 1 | 6 | 3.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCCCC1=O | 10.1021/jm980217s | ||
44332842 | 109694 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 703 | 11 | 1 | 10 | 7.5 | COc1ccc(C2(OC(=O)N[C@@H](C)c3cccc4ccccc34)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL322920 | 109694 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 703 | 11 | 1 | 10 | 7.5 | COc1ccc(C2(OC(=O)N[C@@H](C)c3cccc4ccccc34)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
44315009 | 103179 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 665 | 13 | 5 | 5 | 4.7 | CSCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL308403 | 103179 | 0 | None | - | 0 | Pig | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 665 | 13 | 5 | 5 | 4.7 | CSCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
10791702 | 195793 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cccc3occc23)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL558148 | 195793 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 506 | 12 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cccc3occc23)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
9895957 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1039/C4MD00499J | ||
CHEMBL11706 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1039/C4MD00499J | ||
21041288 | 173902 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 526 | 10 | 2 | 9 | 2.8 | CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4540866 | 173902 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 526 | 10 | 2 | 9 | 2.8 | CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
155563100 | 175252 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 619 | 13 | 2 | 10 | 4.6 | COc1cnc(OCCOc2nc(-c3ccncc3)nc(NS(=O)(=O)NCc3ccccc3)c2-c2ccc(Cl)cc2)nc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4572734 | 175252 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 619 | 13 | 2 | 10 | 4.6 | COc1cnc(OCCOc2nc(-c3ccncc3)nc(NS(=O)(=O)NCc3ccccc3)c2-c2ccc(Cl)cc2)nc1 | 10.1016/j.bmcl.2016.06.014 | ||
9829478 | 175301 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 567 | 10 | 1 | 8 | 4.9 | Cc1ccc(-c2c(NS(=O)(=O)/C=C/c3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4573806 | 175301 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 567 | 10 | 1 | 8 | 4.9 | Cc1ccc(-c2c(NS(=O)(=O)/C=C/c3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
10146377 | 60384 | 0 | None | - | 1 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 662 | 11 | 2 | 14 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175058 | 60384 | 0 | None | - | 1 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 662 | 11 | 2 | 14 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
10816682 | 102114 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 559 | 10 | 1 | 9 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL302493 | 102114 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 559 | 10 | 1 | 9 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
10579885 | 102680 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 632 | 12 | 1 | 11 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCN3CCN(C)CC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL304802 | 102680 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 632 | 12 | 1 | 11 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCCN3CCN(C)CC3)c2)cc1 | 10.1021/jm980504w | ||
10814440 | 98119 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)ccc2OC)cc1 | 10.1021/jm9606507 | ||
CHEMBL273723 | 98119 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)ccc2OC)cc1 | 10.1021/jm9606507 | ||
71462247 | 81669 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 680 | 14 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2cnccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163723 | 81669 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 680 | 14 | 2 | 12 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2cnccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
23548253 | 81647 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 679 | 14 | 1 | 12 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2163702 | 81647 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 679 | 14 | 1 | 12 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
11014820 | 202889 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 398 | 6 | 1 | 6 | 4.2 | CCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL62780 | 202889 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 398 | 6 | 1 | 6 | 4.2 | CCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10602183 | 9207 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 525 | 13 | 1 | 7 | 3.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1ccccc1=O | 10.1021/jm980217s | ||
CHEMBL110695 | 9207 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 525 | 13 | 1 | 7 | 3.6 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCn1ccccc1=O | 10.1021/jm980217s | ||
10625152 | 110432 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 498 | 13 | 1 | 6 | 4.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccoc1 | 10.1021/jm980217s | ||
CHEMBL324685 | 110432 | 0 | None | - | 0 | Rat | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 498 | 13 | 1 | 6 | 4.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccoc1 | 10.1021/jm980217s | ||
90766557 | 170504 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 528 | 10 | 2 | 8 | 3.1 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4449731 | 170504 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 528 | 10 | 2 | 8 | 3.1 | CCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
76312118 | 85318 | 0 | None | 691 | 2 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 522 | 7 | 2 | 8 | 3.4 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(CO)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261361 | 85318 | 0 | None | 691 | 2 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 522 | 7 | 2 | 8 | 3.4 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(CO)ccc12 | 10.1007/s00044-004-0021-y | ||
9916121 | 81638 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 571 | 10 | 1 | 8 | 4.1 | CCCS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2163693 | 81638 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 571 | 10 | 1 | 8 | 4.1 | CCCS(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
23548253 | 81647 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 679 | 14 | 1 | 12 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163702 | 81647 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 679 | 14 | 1 | 12 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
44334130 | 4477 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 458 | 5 | 1 | 6 | 4.4 | COc1ccc([C@@H]2c3nc(N4CCCC4)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL102173 | 4477 | 0 | None | - | 0 | Human | 8.7 | pIC50 | = | 8.7 | Binding | ChEMBL | 458 | 5 | 1 | 6 | 4.4 | COc1ccc([C@@H]2c3nc(N4CCCC4)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
9808602 | 109182 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 590 | 15 | 1 | 8 | 4.5 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(OC)c1 | 10.1021/jm970101g | ||
CHEMBL321673 | 109182 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 590 | 15 | 1 | 8 | 4.5 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(OC)c1 | 10.1021/jm970101g | ||
11826062 | 202966 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 426 | 8 | 2 | 6 | 4.3 | CC(C)Oc1ccc2c(c1)C(CCCCO)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL63113 | 202966 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 426 | 8 | 2 | 6 | 4.3 | CC(C)Oc1ccc2c(c1)C(CCCCO)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10696876 | 110309 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 504 | 13 | 1 | 7 | 3.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1OCCO1 | 10.1021/jm980217s | ||
CHEMBL323989 | 110309 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 504 | 13 | 1 | 7 | 3.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1OCCO1 | 10.1021/jm980217s | ||
22467235 | 96496 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 533 | 7 | 2 | 7 | 3.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL262784 | 96496 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 533 | 7 | 2 | 7 | 3.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
22467235 | 96496 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 533 | 7 | 2 | 7 | 3.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1007/s00044-004-0021-y | ||
CHEMBL262784 | 96496 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 533 | 7 | 2 | 7 | 3.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1007/s00044-004-0021-y | ||
71462321 | 81978 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 584 | 12 | 2 | 8 | 4.2 | CCc1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165335 | 81978 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 584 | 12 | 2 | 8 | 4.2 | CCc1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
9890440 | 8222 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(C)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10924 | 8222 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(OC)c(C)c2)cc1 | 10.1021/jm9606507 | ||
10577306 | 109661 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 499 | 13 | 1 | 7 | 3.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ncco1 | 10.1021/jm980217s | ||
CHEMBL322732 | 109661 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 499 | 13 | 1 | 7 | 3.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ncco1 | 10.1021/jm980217s | ||
44315007 | 204525 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 679 | 14 | 5 | 5 | 5.1 | CCCSCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL72891 | 204525 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 679 | 14 | 5 | 5 | 5.1 | CCCSCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
21041273 | 173724 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 538 | 12 | 2 | 9 | 2.8 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(OC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4536769 | 173724 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 538 | 12 | 2 | 9 | 2.8 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(OC)cn2)c1-c1ccc(Br)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
9821701 | 4580 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 389 | 4 | 1 | 5 | 3.8 | COc1ccc([C@@H]2c3ncccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL102825 | 4580 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 389 | 4 | 1 | 5 | 3.8 | COc1ccc([C@@H]2c3ncccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
10698065 | 12081 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.6 | CCC(CC)C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL1184065 | 12081 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.6 | CCC(CC)C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL330895 | 12081 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.6 | CCC(CC)C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL171198 | 208823 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)N[C@H](Cc1ccccc1)C(=O)O | 10.1016/0960-894X(95)00144-I | ||||
10529742 | 8160 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 511 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1cccn1C | 10.1021/jm980217s | ||
CHEMBL109206 | 8160 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 511 | 13 | 1 | 6 | 4.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1cccn1C | 10.1021/jm980217s | ||
10116355 | 8234 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 474 | 14 | 1 | 5 | 4.9 | CCCCC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL109248 | 8234 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 474 | 14 | 1 | 5 | 4.9 | CCCCC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
10648715 | 109642 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 488 | 14 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCC(C)C | 10.1021/jm980217s | ||
CHEMBL322547 | 109642 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 488 | 14 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCC(C)C | 10.1021/jm980217s | ||
44320291 | 105911 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 548 | 7 | 2 | 8 | 4.8 | O=C(O)c1cc2c(c(Cn3nc(-c4ccccc4)c(Cc4cc5c(cc4Cl)OCO5)c3C(=O)O)c1)OCOC2 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL312854 | 105911 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 548 | 7 | 2 | 8 | 4.8 | O=C(O)c1cc2c(c(Cn3nc(-c4ccccc4)c(Cc4cc5c(cc4Cl)OCO5)c3C(=O)O)c1)OCOC2 | 10.1016/s0960-894x(00)00513-8 | ||
17885912 | 107072 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 496 | 7 | 2 | 6 | 5.1 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1CCCC(C(=O)O)C1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315936 | 107072 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 496 | 7 | 2 | 6 | 5.1 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1CCCC(C(=O)O)C1 | 10.1016/s0960-894x(00)00513-8 | ||
44279295 | 105975 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 482 | 8 | 1 | 6 | 4.2 | COc1nc(C)cnc1NS(=O)(=O)c1cccc(C(=O)N(C)C)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL31324 | 105975 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 482 | 8 | 1 | 6 | 4.2 | COc1nc(C)cnc1NS(=O)(=O)c1cccc(C(=O)N(C)C)c1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
10670600 | 96547 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 436 | 6 | 2 | 6 | 3.6 | CCNc1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3OC)cccc12 | 10.1021/jm9604585 | ||
CHEMBL263079 | 96547 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 436 | 6 | 2 | 6 | 3.6 | CCNc1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3OC)cccc12 | 10.1021/jm9604585 | ||
10646831 | 183896 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 441 | 6 | 2 | 7 | 4.1 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm9608366 | ||
10646831 | 183896 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 441 | 6 | 2 | 7 | 4.1 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm9700068 | ||
CHEMBL48134 | 183896 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 441 | 6 | 2 | 7 | 4.1 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm9608366 | ||
CHEMBL48134 | 183896 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 441 | 6 | 2 | 7 | 4.1 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1021/jm9700068 | ||
11751754 | 102334 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 469 | 6 | 3 | 7 | 4.1 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)O)c1 | 10.1021/jm030528p | ||
CHEMBL303806 | 102334 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 469 | 6 | 3 | 7 | 4.1 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C(=O)O)c1 | 10.1021/jm030528p | ||
10555516 | 9209 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 598 | 12 | 1 | 7 | 4.6 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)Cc1ccccc1 | 10.1021/jm970101g | ||
CHEMBL110700 | 9209 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 598 | 12 | 1 | 7 | 4.6 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)c(F)c1)S(=O)(=O)Cc1ccccc1 | 10.1021/jm970101g | ||
11799503 | 9721 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 498 | 13 | 1 | 6 | 4.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccco1 | 10.1021/jm980217s | ||
CHEMBL113472 | 9721 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 498 | 13 | 1 | 6 | 4.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCc1ccco1 | 10.1021/jm980217s | ||
10289311 | 110408 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 514 | 13 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C=C(C)C | 10.1021/jm980217s | ||
CHEMBL324586 | 110408 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 514 | 13 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)C=C(C)C | 10.1021/jm980217s | ||
CHEMBL2304007 | 209440 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | None | None | None | Cc1[nH]c2ccccc2c1C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C2CCCC2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC1=O | 10.1021/jm9600914 | ||||
44380954 | 57647 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 643 | 11 | 1 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL166875 | 57647 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 643 | 11 | 1 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOc1ncc(Br)cn1 | 10.1016/s0960-894x(01)00682-5 | ||
10525281 | 182826 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 404 | 6 | 1 | 6 | 4.2 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1021/jm9700068 | ||
CHEMBL47915 | 182826 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 404 | 6 | 1 | 6 | 4.2 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1021/jm9700068 | ||
9888574 | 104149 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 422 | 4 | 1 | 4 | 3.9 | CCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL309692 | 104149 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 422 | 4 | 1 | 4 | 3.9 | CCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
11102844 | 203218 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 476 | 7 | 2 | 7 | 4.2 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)CO)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64536 | 203218 | 0 | None | - | 0 | Rat | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 476 | 7 | 2 | 7 | 4.2 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)CO)cc32)cc1 | 10.1021/jm010382z | ||
44314906 | 103551 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 607 | 12 | 6 | 5 | 3.4 | Cc1[nH]c2ccccc2c1C[C@@H](NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)NC(Cc1c[nH]cn1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL308621 | 103551 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 607 | 12 | 6 | 5 | 3.4 | Cc1[nH]c2ccccc2c1C[C@@H](NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)NC(Cc1c[nH]cn1)C(=O)O | 10.1021/jm9600914 | ||
44458670 | 99024 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 521 | 7 | 2 | 8 | 2.7 | COc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL280379 | 99024 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 521 | 7 | 2 | 8 | 2.7 | COc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(N)=O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
71455060 | 81634 | 1 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 614 | 9 | 1 | 9 | 2.9 | O=S(=O)(Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1)N1CCOCC1 | 10.1021/jm3009103 | ||
CHEMBL2163689 | 81634 | 1 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 614 | 9 | 1 | 9 | 2.9 | O=S(=O)(Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1)N1CCOCC1 | 10.1021/jm3009103 | ||
71451526 | 81646 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 635 | 14 | 1 | 12 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Cl)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163701 | 81646 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 635 | 14 | 1 | 12 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Cl)cn1 | 10.1021/jm3009103 | ||
10875868 | 114935 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 619 | 9 | 1 | 8 | 5.0 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(Br)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL334263 | 114935 | 0 | None | - | 0 | Pig | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 619 | 9 | 1 | 8 | 5.0 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(Br)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
9810190 | 103039 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 563 | 11 | 1 | 10 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL307330 | 103039 | 0 | None | - | 0 | Human | 8.6 | pIC50 | = | 8.6 | Binding | ChEMBL | 563 | 11 | 1 | 10 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL2304015 | 209448 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | None | None | None | Cc1[nH]c2ccccc2c1C[C@@H]1NC(=O)[C@@H](C2CC2)NC(=O)[C@H](C2CCCC2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC1=O | 10.1021/jm9600914 | ||||
10875239 | 9555 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 541 | 10 | 1 | 10 | 4.8 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccco2)nc1 | 10.1021/jm0102304 | ||
CHEMBL112502 | 9555 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 541 | 10 | 1 | 10 | 4.8 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccco2)nc1 | 10.1021/jm0102304 | ||
10791823 | 9417 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)C(=O)CCC | 10.1021/jm970101g | ||
CHEMBL111783 | 9417 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)C(=O)CCC | 10.1021/jm970101g | ||
15289330 | 99774 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 493 | 8 | 1 | 8 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL285368 | 99774 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 493 | 8 | 1 | 8 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
10361107 | 162024 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 359 | 5 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL416026 | 162024 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 359 | 5 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
44314658 | 205145 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 589 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CCC)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL78230 | 205145 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 589 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CCC)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
9951753 | 166313 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 379 | 7 | 1 | 5 | 4.7 | Cc1ccccc1C(Oc1cc(OCc2ccsc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL427294 | 166313 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 379 | 7 | 1 | 5 | 4.7 | Cc1ccccc1C(Oc1cc(OCc2ccsc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
11797717 | 207038 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 448 | 10 | 2 | 5 | 6.0 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1cc[nH]n1 | 10.1021/jm9707131 | ||
CHEMBL91753 | 207038 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 448 | 10 | 2 | 5 | 6.0 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1cc[nH]n1 | 10.1021/jm9707131 | ||
10668808 | 207138 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 402 | 9 | 1 | 5 | 4.8 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccncc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL92353 | 207138 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 402 | 9 | 1 | 5 | 4.8 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccncc2)ccc1C#N | 10.1021/jm9707131 | ||
10694804 | 207797 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 449 | 10 | 1 | 6 | 6.3 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1ncco1 | 10.1021/jm9707131 | ||
CHEMBL96301 | 207797 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 449 | 10 | 1 | 6 | 6.3 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1ncco1 | 10.1021/jm9707131 | ||
10695071 | 101131 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 454 | 6 | 1 | 6 | 4.3 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9700068 | ||
CHEMBL295477 | 101131 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 454 | 6 | 1 | 6 | 4.3 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9700068 | ||
10672494 | 179529 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 483 | 6 | 2 | 6 | 5.0 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(C(C)C)cc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL47417 | 179529 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 483 | 6 | 2 | 6 | 5.0 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(C(C)C)cc2)c1Br | 10.1021/jm9608366 | ||
44327412 | 207558 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 497 | 5 | 1 | 8 | 3.0 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94929 | 207558 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 497 | 5 | 1 | 8 | 3.0 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL343062 | 211673 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CSCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
443289 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm3009103 | ||||
997 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm3009103 | ||||
CHEMBL314691 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm3009103 | ||||
DB12054 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm3009103 | ||||
44320431 | 106929 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 526 | 9 | 2 | 7 | 4.9 | O=C(O)COC1CCCCC1Cn1nc(-c2ccccc2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL314973 | 106929 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 526 | 9 | 2 | 7 | 4.9 | O=C(O)COC1CCCCC1Cn1nc(-c2ccccc2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
10767442 | 131197 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 492 | 8 | 1 | 5 | 6.1 | COc1ccc(C(=O)/C(Cc2ccc(-c3ccccc3)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL368668 | 131197 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 492 | 8 | 1 | 5 | 6.1 | COc1ccc(C(=O)/C(Cc2ccc(-c3ccccc3)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL313984 | 211100 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL265116 | 210612 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
10815005 | 9716 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 492 | 6 | 1 | 6 | 5.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(-c3ccccc3)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL11345 | 9716 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 492 | 6 | 1 | 6 | 5.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(-c3ccccc3)cc2)cc1 | 10.1021/jm9606507 | ||
10506430 | 113763 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 532 | 9 | 2 | 7 | 4.5 | CCc1cccc(OC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL332387 | 113763 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 532 | 9 | 2 | 7 | 4.5 | CCc1cccc(OC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
10669001 | 112595 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 405 | 6 | 1 | 6 | 4.6 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm970847e | ||
CHEMBL330255 | 112595 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 405 | 6 | 1 | 6 | 4.6 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm970847e | ||
10692108 | 168146 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 395 | 6 | 1 | 4 | 5.5 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(=O)O)c1ccccc1Cl | 10.1021/jm970847e | ||
CHEMBL433201 | 168146 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 395 | 6 | 1 | 4 | 5.5 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(=O)O)c1ccccc1Cl | 10.1021/jm970847e | ||
CHEMBL313984 | 211100 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
10577255 | 175395 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 497 | 8 | 2 | 6 | 5.2 | CCCCc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
CHEMBL45760 | 175395 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 497 | 8 | 2 | 6 | 5.2 | CCCCc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
CHEMBL1793926 | 208907 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||||
10769045 | 131191 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2(C)CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368641 | 131191 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2(C)CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL134562 | 208707 | 0 | None | - | 0 | Pig | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL436899 | 213671 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
CHEMBL407933 | 212671 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)NC1CCCCC1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
18617284 | 205185 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 350 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78552 | 205185 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 350 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44314579 | 102890 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL306123 | 102890 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
10549516 | 110363 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 410 | 8 | 1 | 4 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccccc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL324301 | 110363 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 410 | 8 | 1 | 4 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccccc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
22010208 | 207072 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 362 | 9 | 1 | 3 | 5.3 | O=C(O)CCC(Oc1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL91965 | 207072 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 362 | 9 | 1 | 3 | 5.3 | O=C(O)CCC(Oc1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
10717670 | 207172 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 433 | 7 | 1 | 5 | 5.7 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1c(F)cccc1Cl | 10.1021/jm970847e | ||
CHEMBL92570 | 207172 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 433 | 7 | 1 | 5 | 5.7 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1c(F)cccc1Cl | 10.1021/jm970847e | ||
19735404 | 175797 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 471 | 9 | 2 | 7 | 3.5 | COc1ccccc1Cc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4584753 | 175797 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 471 | 9 | 2 | 7 | 3.5 | COc1ccccc1Cc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
10528383 | 11203 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 470 | 5 | 1 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)c2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL1178854 | 11203 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 470 | 5 | 1 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)c2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL46357 | 11203 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 470 | 5 | 1 | 8 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)c2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
10604797 | 102317 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 704 | 14 | 1 | 13 | 3.3 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OCCN3CCOCC3)c(OC)c(OCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL303712 | 102317 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 704 | 14 | 1 | 13 | 3.3 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OCCN3CCOCC3)c(OC)c(OCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
10238141 | 195828 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 429 | 5 | 1 | 6 | 4.2 | COc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc3c(c2)OCO3)c2ccccc21 | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL55853 | 195828 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 429 | 5 | 1 | 6 | 4.2 | COc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc3c(c2)OCO3)c2ccccc21 | 10.1016/S0960-894X(97)00319-3 | ||
44283270 | 167857 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCC[C@H](NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL431124 | 167857 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCC[C@H](NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
10357554 | 97536 | 1 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL27065 | 97536 | 1 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1021/jm00029a001 | ||
44278161 | 99776 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 569 | 10 | 1 | 8 | 6.9 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OCc4ccccc4)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL285380 | 99776 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 569 | 10 | 1 | 8 | 6.9 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OCc4ccccc4)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
10357554 | 97536 | 1 | None | - | 0 | Rat | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27065 | 97536 | 1 | None | - | 0 | Rat | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1021/jm00008a013 | ||
10495634 | 207905 | 0 | None | - | 0 | Rat | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 316 | 6 | 1 | 2 | 4.8 | OC/C(=C/c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL96836 | 207905 | 0 | None | - | 0 | Rat | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 316 | 6 | 1 | 2 | 4.8 | OC/C(=C/c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
44276966 | 106829 | 0 | None | - | 0 | Rat | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 352 | 5 | 1 | 5 | 2.9 | COc1cccc(Cn2[nH]c(C)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144846 | 106829 | 0 | None | - | 0 | Rat | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 352 | 5 | 1 | 5 | 2.9 | COc1cccc(Cn2[nH]c(C)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44386894 | 62451 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 412 | 7 | 2 | 6 | 2.1 | COc1ccc([C@@H]2[C@@H](CC(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(N)=O)cc1 | 10.1021/jm031041j | ||
CHEMBL177999 | 62451 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 412 | 7 | 2 | 6 | 2.1 | COc1ccc([C@@H]2[C@@H](CC(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(N)=O)cc1 | 10.1021/jm031041j | ||
11795139 | 166513 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 398 | 6 | 2 | 6 | 1.8 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(N)=O)cc1 | 10.1021/jm9505369 | ||
CHEMBL427935 | 166513 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 398 | 6 | 2 | 6 | 1.8 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(N)=O)cc1 | 10.1021/jm9505369 | ||
10212163 | 130070 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 696 | 11 | 2 | 13 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367767 | 130070 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 696 | 11 | 2 | 13 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOC(=O)Nc1cnccn1 | 10.1016/s0960-894x(02)01084-3 | ||
23445256 | 60159 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 470 | 6 | 1 | 7 | 4.1 | Cc1noc(NS(=O)(=O)c2ccsc2CCc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL173982 | 60159 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 470 | 6 | 1 | 7 | 4.1 | Cc1noc(NS(=O)(=O)c2ccsc2CCc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
10604119 | 11425 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 636 | 12 | 2 | 7 | 5.8 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL1180361 | 11425 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 636 | 12 | 2 | 7 | 5.8 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL123654 | 11425 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 636 | 12 | 2 | 7 | 5.8 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
44325305 | 207444 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 426 | 10 | 2 | 5 | 5.3 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C(=O)O | 10.1021/jm9707131 | ||
CHEMBL94279 | 207444 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 426 | 10 | 2 | 5 | 5.3 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C(=O)O | 10.1021/jm9707131 | ||
10005597 | 119792 | 0 | None | - | 1 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cc(OC)ccc3OC)c3c2oc2ccccc23)cc1 | 10.1021/jm031041j | ||
CHEMBL348407 | 119792 | 0 | None | - | 1 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cc(OC)ccc3OC)c3c2oc2ccccc23)cc1 | 10.1021/jm031041j | ||
10005597 | 119792 | 0 | None | - | 1 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cc(OC)ccc3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL348407 | 119792 | 0 | None | - | 1 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cc(OC)ccc3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL433349 | 213614 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
44314890 | 105049 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 647 | 12 | 5 | 4 | 5.0 | CC(C)CC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL311384 | 105049 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 647 | 12 | 5 | 4 | 5.0 | CC(C)CC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
3539 | 4110 | 83 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 10.1016/j.bmcl.2016.06.014 | ||
9910224 | 4110 | 83 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL1628688 | 4110 | 83 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 10.1016/j.bmcl.2016.06.014 | ||
DB06629 | 4110 | 83 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 424 | 6 | 1 | 9 | 2.7 | COc1nc(C)cnc1NS(=O)(=O)c1cccnc1c1ccc(cc1)c1nnco1 | 10.1016/j.bmcl.2016.06.014 | ||
10168597 | 61307 | 0 | None | - | 1 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cccnc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176741 | 61307 | 0 | None | - | 1 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 661 | 11 | 2 | 13 | 3.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)Nc1cccnc1 | 10.1016/s0960-894x(02)01084-3 | ||
10673969 | 62075 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 538 | 10 | 3 | 7 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL177546 | 62075 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 538 | 10 | 3 | 7 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
10138169 | 99333 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 440 | 6 | 1 | 8 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm000349x | ||
CHEMBL282470 | 99333 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 440 | 6 | 1 | 8 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm000349x | ||
CHEMBL342615 | 211652 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CS(=O)(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL342615 | 211652 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CS(=O)(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10527706 | 96972 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 454 | 8 | 1 | 6 | 3.1 | CCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL266594 | 96972 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 454 | 8 | 1 | 6 | 3.1 | CCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44439114 | 161606 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 993 | 32 | 2 | 15 | 7.3 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOc2ccc(CCC(=O)N(C)Cc3cc(-c4ncco4)ccc3-c3ccccc3S(=O)(=O)Nc3ccno3)cc2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL413001 | 161606 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 993 | 32 | 2 | 15 | 7.3 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOc2ccc(CCC(=O)N(C)Cc3cc(-c4ncco4)ccc3-c3ccccc3S(=O)(=O)Nc3ccno3)cc2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
18738889 | 87937 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 562 | 8 | 1 | 8 | 4.9 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)OC)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL23418 | 87937 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 562 | 8 | 1 | 8 | 4.9 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)OC)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
10310877 | 203866 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 473 | 8 | 1 | 7 | 5.9 | CCCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)n2Cc1ccc2nsnc2c1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL68896 | 203866 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 473 | 8 | 1 | 7 | 5.9 | CCCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)n2Cc1ccc2nsnc2c1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL136210 | 208714 | 0 | None | - | 0 | Pig | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
21462927 | 120216 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 500 | 7 | 1 | 8 | 5.1 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2cc([N+](=O)[O-])ccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL352241 | 120216 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 500 | 7 | 1 | 8 | 5.1 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2cc([N+](=O)[O-])ccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
10086660 | 99132 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 309 | 6 | 2 | 5 | 2.9 | CCCNc1cccc(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1021/jm00008a013 | ||
CHEMBL281199 | 99132 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 309 | 6 | 2 | 5 | 2.9 | CCCNc1cccc(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1021/jm00008a013 | ||
44279308 | 100105 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 521 | 12 | 6 | 4 | 3.3 | Cc1cccc(NC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCC(=O)O)c1 | 10.1016/0960-894X(95)00221-E | ||
CHEMBL287676 | 100105 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 521 | 12 | 6 | 4 | 3.3 | Cc1cccc(NC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCC(=O)O)c1 | 10.1016/0960-894X(95)00221-E | ||
44279307 | 107987 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 541 | 12 | 6 | 4 | 3.7 | CC(C)C[C@H](NC(=O)Nc1cccc(Cl)c1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31944 | 107987 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 541 | 12 | 6 | 4 | 3.7 | CC(C)C[C@H](NC(=O)Nc1cccc(Cl)c1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL319537 | 211196 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10621049 | 207220 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 400 | 6 | 1 | 3 | 5.6 | OC/C(=C/c1cc(OCc2ccsc2)ccc1Br)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL92876 | 207220 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 400 | 6 | 1 | 3 | 5.6 | OC/C(=C/c1cc(OCc2ccsc2)ccc1Br)c1ccccc1 | 10.1021/jm970847e | ||
44213278 | 106822 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 406 | 5 | 1 | 5 | 3.6 | COc1ccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)cc1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144799 | 106822 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 406 | 5 | 1 | 5 | 3.6 | COc1ccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)cc1 | 10.1016/s0960-894x(00)00232-8 | ||
10719007 | 11209 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 465 | 6 | 1 | 9 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)C(C#N)c2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL1178895 | 11209 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 465 | 6 | 1 | 9 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)C(C#N)c2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL48448 | 11209 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 465 | 6 | 1 | 9 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)C(C#N)c2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
10626054 | 131322 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 530 | 11 | 6 | 4 | 4.2 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NCc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368788 | 131322 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 530 | 11 | 6 | 4 | 4.2 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NCc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL1206645 | 208585 | 0 | None | - | 0 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H](NC(=O)N1CCCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O | 10.1021/jm00087a001 | ||||
CHEMBL290454 | 208585 | 0 | None | - | 0 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H](NC(=O)N1CCCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O | 10.1021/jm00087a001 | ||||
10742968 | 12329 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 469 | 7 | 1 | 8 | 4.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(Cc2ccc3c(c2)OCO3)N(C)C)c1Cl | 10.1021/jm9700068 | ||
CHEMBL1185472 | 12329 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 469 | 7 | 1 | 8 | 4.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(Cc2ccc3c(c2)OCO3)N(C)C)c1Cl | 10.1021/jm9700068 | ||
CHEMBL416453 | 12329 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 469 | 7 | 1 | 8 | 4.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(Cc2ccc3c(c2)OCO3)N(C)C)c1Cl | 10.1021/jm9700068 | ||
44368481 | 121494 | 0 | None | - | 0 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 435 | 9 | 2 | 7 | 2.8 | CCOC(=O)CN(Cc1cc2c(cc1Cl)OCO2)C(Cc1ccc(O)cc1)C(=O)O | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL358444 | 121494 | 0 | None | - | 0 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 435 | 9 | 2 | 7 | 2.8 | CCOC(=O)CN(Cc1cc2c(cc1Cl)OCO2)C(Cc1ccc(O)cc1)C(=O)O | 10.1016/s0960-894x(01)00009-9 | ||
10576888 | 170821 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 485 | 6 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2C(=O)O)c1Br | 10.1021/jm9608366 | ||
CHEMBL44539 | 170821 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 485 | 6 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2C(=O)O)c1Br | 10.1021/jm9608366 | ||
23445284 | 112775 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 440 | 5 | 1 | 5 | 5.4 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccc(C(C)C)cc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL330674 | 112775 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 440 | 5 | 1 | 5 | 5.4 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccc(C(C)C)cc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
23445458 | 60270 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 468 | 5 | 1 | 7 | 4.5 | Cc1noc(NS(=O)(=O)c2sccc2/C=C/c2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL174363 | 60270 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 468 | 5 | 1 | 7 | 4.5 | Cc1noc(NS(=O)(=O)c2sccc2/C=C/c2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
5344 | 173449 | 101 | None | - | 1 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | nan | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | nan | ||
44385412 | 131352 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 711 | 14 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(Cc2ccc3c(c2)OCO3)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368945 | 131352 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 711 | 14 | 2 | 13 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(Cc2ccc3c(c2)OCO3)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
18184249 | 128446 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 662 | 13 | 2 | 11 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL366628 | 128446 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 662 | 13 | 2 | 11 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL303185 | 210894 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00089a028 | ||||
10696818 | 9618 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 502 | 15 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC(CC)CC | 10.1021/jm980217s | ||
CHEMBL112770 | 9618 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 502 | 15 | 1 | 5 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC(CC)CC | 10.1021/jm980217s | ||
CHEMBL303185 | 210894 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm9600914 | ||||
10792711 | 114765 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 548 | 9 | 2 | 6 | 5.2 | CCc1cc(F)cc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL333972 | 114765 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 548 | 9 | 2 | 6 | 5.2 | CCc1cc(F)cc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
9917706 | 129713 | 0 | None | - | 2 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 659 | 15 | 2 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL367444 | 129713 | 0 | None | - | 2 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 659 | 15 | 2 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/j.bmcl.2016.06.014 | ||
18738881 | 79554 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 534 | 7 | 2 | 7 | 4.4 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(=O)O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL2114305 | 79554 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 534 | 7 | 2 | 7 | 4.4 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C(=O)O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
443289 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm030528p | ||||
997 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm030528p | ||||
CHEMBL314691 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm030528p | ||||
DB12054 | 708 | 47 | None | 2 | 3 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm030528p | ||||
9886303 | 59507 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 383 | 7 | 1 | 5 | 4.5 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1F | 10.1021/jm990378b | ||
CHEMBL171638 | 59507 | 0 | None | - | 0 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 383 | 7 | 1 | 5 | 4.5 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1F | 10.1021/jm990378b | ||
44293761 | 169190 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 549 | 12 | 2 | 8 | 4.6 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCCCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL440853 | 169190 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 549 | 12 | 2 | 8 | 4.6 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCCCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10908075 | 11711 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 591 | 9 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3cccc4ccccc34)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL1181549 | 11711 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 591 | 9 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3cccc4ccccc34)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL177373 | 11711 | 0 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 591 | 9 | 1 | 8 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3cccc4ccccc34)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
10302118 | 60394 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 533 | 9 | 2 | 10 | 3.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175111 | 60394 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 533 | 9 | 2 | 10 | 3.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
135512539 | 128448 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 615 | 11 | 2 | 13 | 4.4 | C#CCOc1nc(-c2ccnc(-c3noc(O)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL366652 | 128448 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 615 | 11 | 2 | 13 | 4.4 | C#CCOc1nc(-c2ccnc(-c3noc(O)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
9864880 | 102361 | 0 | None | - | 1 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 384 | 4 | 1 | 6 | 3.7 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc4nsnc4c3)cccc12 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL303902 | 102361 | 0 | None | - | 1 | Rat | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 384 | 4 | 1 | 6 | 3.7 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc4nsnc4c3)cccc12 | 10.1016/s0960-894x(97)10151-2 | ||
443289 | 708 | 47 | None | - | 3 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00237-N | ||||
997 | 708 | 47 | None | - | 3 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00237-N | ||||
CHEMBL314691 | 708 | 47 | None | - | 3 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00237-N | ||||
DB12054 | 708 | 47 | None | - | 3 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00237-N | ||||
10578601 | 129019 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 550 | 10 | 4 | 5 | 4.7 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)N(C)C(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL367033 | 129019 | 0 | None | - | 0 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 550 | 10 | 4 | 5 | 4.7 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)N(C)C(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
9917706 | 129713 | 0 | None | - | 2 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 659 | 15 | 2 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367444 | 129713 | 0 | None | - | 2 | Human | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | 659 | 15 | 2 | 11 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL336033 | 211551 | 1 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL336033 | 211551 | 1 | None | - | 0 | Pig | 7.7 | pIC50 | = | 7.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL170121 | 208818 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCC(=O)O | 10.1016/0960-894X(95)00144-I | ||||
11070564 | 203377 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)cc1)O2 | 10.1021/jm010382z | ||
CHEMBL65494 | 203377 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)cc1)O2 | 10.1021/jm010382z | ||
122044 | 10141 | 51 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL115951 | 10141 | 51 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1 | 10.1016/j.bmcl.2016.06.014 | ||
10571812 | 128622 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 380 | 7 | 1 | 6 | 4.1 | Cc1ccccc1C(Oc1cc(OCc2ccsn2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL366788 | 128622 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 380 | 7 | 1 | 6 | 4.1 | Cc1ccccc1C(Oc1cc(OCc2ccsn2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
2802888 | 60527 | 10 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 414 | 9 | 4 | 5 | 2.5 | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O | 10.1021/jm031041j | ||
CHEMBL175916 | 60527 | 10 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 414 | 9 | 4 | 5 | 2.5 | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O | 10.1021/jm031041j | ||
10789279 | 206542 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 441 | 10 | 1 | 6 | 4.1 | CCCCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL8878 | 206542 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 441 | 10 | 1 | 6 | 4.1 | CCCCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10554384 | 169221 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL441112 | 169221 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
10554384 | 169221 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL441112 | 169221 | 0 | None | - | 0 | Human | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL2370254 | 209795 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10024044 | 7807 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(CC2=C(c3ccccc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10897 | 7807 | 0 | None | - | 0 | Human | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(CC2=C(c3ccccc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
11732155 | 202643 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1ccccc1C1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL61460 | 202643 | 0 | None | - | 0 | Rat | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1ccccc1C1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL2304014 | 209447 | 0 | None | - | 0 | Pig | 5.7 | pIC50 | = | 5.7 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(C#N)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
443289 | 708 | 47 | None | - | 3 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
997 | 708 | 47 | None | - | 3 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
CHEMBL314691 | 708 | 47 | None | - | 3 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
DB12054 | 708 | 47 | None | - | 3 | Pig | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
10647488 | 176898 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 456 | 6 | 2 | 8 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(C)(O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL46195 | 176898 | 0 | None | - | 0 | Human | 4.7 | pIC50 | = | 4.7 | Binding | ChEMBL | 456 | 6 | 2 | 8 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(C)(O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
44320488 | 106958 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 438 | 5 | 1 | 5 | 5.7 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1C1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315175 | 106958 | 0 | None | - | 0 | Rat | 6.7 | pIC50 | = | 6.7 | Binding | ChEMBL | 438 | 5 | 1 | 5 | 5.7 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1C1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
10766198 | 162861 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 455 | 6 | 2 | 6 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)NCc2ccccc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL417358 | 162861 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 455 | 6 | 2 | 6 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)NCc2ccccc2)c1Br | 10.1021/jm9608366 | ||
76324075 | 85811 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 340 | 4 | 1 | 6 | 4.0 | Cc1c(C(=O)O)oc2cccc(OCc3ccc4nsnc4c3)c12 | 10.1007/s00044-013-0542-3 | ||
CHEMBL2296899 | 85811 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 340 | 4 | 1 | 6 | 4.0 | Cc1c(C(=O)O)oc2cccc(OCc3ccc4nsnc4c3)c12 | 10.1007/s00044-013-0542-3 | ||
151174 | 202697 | 45 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 605 | 12 | 3 | 13 | 3.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCO | 10.1021/jm030528p | ||
CHEMBL61780 | 202697 | 45 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 605 | 12 | 3 | 13 | 3.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCO | 10.1021/jm030528p | ||
10810505 | 59481 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 392 | 7 | 1 | 5 | 4.2 | Cc1ccccc1C(Oc1cc(OCc2ccnc(F)c2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL171513 | 59481 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 392 | 7 | 1 | 5 | 4.2 | Cc1ccccc1C(Oc1cc(OCc2ccnc(F)c2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10282163 | 60383 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 599 | 11 | 2 | 12 | 3.9 | C#CCOc1nc(-c2ccnc(-c3nn[nH]n3)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175057 | 60383 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 599 | 11 | 2 | 12 | 3.9 | C#CCOc1nc(-c2ccnc(-c3nn[nH]n3)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10838921 | 206323 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 494 | 7 | 1 | 6 | 4.1 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)C2CCCCC2)cc1 | 10.1021/jm9505369 | ||
CHEMBL8736 | 206323 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 494 | 7 | 1 | 6 | 4.1 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)C2CCCCC2)cc1 | 10.1021/jm9505369 | ||
44279338 | 106667 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 487 | 11 | 6 | 4 | 2.3 | CC(C)C[C@H](NC(=O)NC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31436 | 106667 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 487 | 11 | 6 | 4 | 2.3 | CC(C)C[C@H](NC(=O)NC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL97431 | 215901 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
18617403 | 205250 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 394 | 3 | 1 | 4 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc(Br)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL79031 | 205250 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 394 | 3 | 1 | 4 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc(Br)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
18617374 | 205493 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 350 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80808 | 205493 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 350 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL262782 | 210527 | 0 | None | - | 0 | Mouse | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCCNC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(00)80326-1 | ||||
122044 | 10141 | 51 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1 | 10.1021/jm0102304 | ||
CHEMBL115951 | 10141 | 51 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1 | 10.1021/jm0102304 | ||
44327728 | 207872 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 505 | 5 | 1 | 8 | 2.1 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(Br)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL96662 | 207872 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 505 | 5 | 1 | 8 | 2.1 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(Br)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44327354 | 208033 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 427 | 5 | 1 | 8 | 1.4 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccccc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL97595 | 208033 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 427 | 5 | 1 | 8 | 1.4 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccccc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
10579210 | 168567 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 585 | 10 | 4 | 6 | 5.4 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL435901 | 168567 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 585 | 10 | 4 | 6 | 5.4 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL1791007 | 208890 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL423941 | 213298 | 0 | None | - | 0 | Mouse | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
21462925 | 119913 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 470 | 6 | 2 | 7 | 4.8 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2cc(N)ccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL349556 | 119913 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 470 | 6 | 2 | 7 | 4.8 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2cc(N)ccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
10766396 | 110552 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 460 | 8 | 1 | 4 | 4.6 | CCCN(C)C(=O)CN1C[C@H](c2ccc3ccccc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL325418 | 110552 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 460 | 8 | 1 | 4 | 4.6 | CCCN(C)C(=O)CN1C[C@H](c2ccc3ccccc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10837666 | 169864 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 460 | 8 | 1 | 4 | 4.6 | CCCN(C)C(=O)CN1C[C@H](c2cccc3ccccc23)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL444061 | 169864 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 460 | 8 | 1 | 4 | 4.6 | CCCN(C)C(=O)CN1C[C@H](c2cccc3ccccc23)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
44284290 | 12915 | 0 | None | - | 0 | Pig | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 589 | 13 | 4 | 5 | 3.9 | CC(C)C[C@@H](NC(=O)C1CCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)O | 10.1021/jm00087a001 | ||
CHEMBL1189291 | 12915 | 0 | None | - | 0 | Pig | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 589 | 13 | 4 | 5 | 3.9 | CC(C)C[C@@H](NC(=O)C1CCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)O | 10.1021/jm00087a001 | ||
CHEMBL538475 | 12915 | 0 | None | - | 0 | Pig | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 589 | 13 | 4 | 5 | 3.9 | CC(C)C[C@@H](NC(=O)C1CCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)O | 10.1021/jm00087a001 | ||
44320782 | 107045 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 482 | 7 | 1 | 6 | 5.8 | COc1ccc(-c2nn(CC3CCCCC3)c(C(=O)O)c2Cc2cc3c(cc2Cl)OCO3)cc1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315788 | 107045 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 482 | 7 | 1 | 6 | 5.8 | COc1ccc(-c2nn(CC3CCCCC3)c(C(=O)O)c2Cc2cc3c(cc2Cl)OCO3)cc1 | 10.1016/s0960-894x(00)00513-8 | ||
44266629 | 4387 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 387 | 4 | 1 | 5 | 4.7 | COc1ccc(-n2c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3ccccc32)cc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10151 | 4387 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 387 | 4 | 1 | 5 | 4.7 | COc1ccc(-n2c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3ccccc32)cc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL2304017 | 209450 | 0 | None | - | 0 | Pig | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | None | None | None | CSC(C)(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(C#N)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
44278270 | 162019 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 300 | 4 | 1 | 4 | 4.3 | COc1cccc(Sc2c(C(=O)O)oc3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL416019 | 162019 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 300 | 4 | 1 | 4 | 4.3 | COc1cccc(Sc2c(C(=O)O)oc3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
23445430 | 61036 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 438 | 5 | 1 | 5 | 5.1 | Cc1ccc(/C=C/c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL176422 | 61036 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 438 | 5 | 1 | 5 | 5.1 | Cc1ccc(/C=C/c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
10530424 | 62060 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 536 | 9 | 4 | 5 | 4.3 | Cc1c(C(=O)O)nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)n1C | 10.1021/jm950592+ | ||
CHEMBL177502 | 62060 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 536 | 9 | 4 | 5 | 4.3 | Cc1c(C(=O)O)nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)n1C | 10.1021/jm950592+ | ||
23445438 | 61469 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 470 | 6 | 1 | 7 | 4.1 | Cc1noc(NS(=O)(=O)c2sccc2CCc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL177070 | 61469 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 470 | 6 | 1 | 7 | 4.1 | Cc1noc(NS(=O)(=O)c2sccc2CCc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
44384826 | 59946 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 561 | 10 | 1 | 9 | 5.8 | C/C=C/COc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL173366 | 59946 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 561 | 10 | 1 | 9 | 5.8 | C/C=C/COc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
9896251 | 98745 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 682 | 12 | 1 | 9 | 7.1 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm020138n | ||
CHEMBL278176 | 98745 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 682 | 12 | 1 | 9 | 7.1 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm020138n | ||
127034758 | 136345 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 681 | 12 | 1 | 8 | 7.7 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)cc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1039/C4MD00499J | ||
CHEMBL3734968 | 136345 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 681 | 12 | 1 | 8 | 7.7 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)cc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1039/C4MD00499J | ||
10576379 | 101244 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
CHEMBL296291 | 101244 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
10281192 | 61047 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 561 | 11 | 2 | 10 | 4.2 | C#CCOc1nc(-c2ccnc(CO)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176482 | 61047 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 561 | 11 | 2 | 10 | 4.2 | C#CCOc1nc(-c2ccnc(CO)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
9896251 | 98745 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 682 | 12 | 1 | 9 | 7.1 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL278176 | 98745 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 682 | 12 | 1 | 9 | 7.1 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
44404967 | 135393 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 680 | 12 | 1 | 8 | 7.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCC2 | 10.1021/jm058225d | ||
CHEMBL372814 | 135393 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 680 | 12 | 1 | 8 | 7.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCC2 | 10.1021/jm058225d | ||
CHEMBL343582 | 211678 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](c2ccccc2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
42630654 | 18372 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 545 | 10 | 2 | 8 | 4.3 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCOC)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1271531 | 18372 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 545 | 10 | 2 | 8 | 4.3 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCOC)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
42630654 | 18372 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 545 | 10 | 2 | 8 | 4.3 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCOC)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271531 | 18372 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 545 | 10 | 2 | 8 | 4.3 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCOC)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
11763363 | 110480 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2cnccn2)c1 | 10.1021/jm0102304 | ||
CHEMBL324943 | 110480 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2cnccn2)c1 | 10.1021/jm0102304 | ||
443289 | 708 | 47 | None | 2 | 3 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmcl.2010.08.074 | ||||
997 | 708 | 47 | None | 2 | 3 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmcl.2010.08.074 | ||||
CHEMBL314691 | 708 | 47 | None | 2 | 3 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmcl.2010.08.074 | ||||
DB12054 | 708 | 47 | None | 2 | 3 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1016/j.bmcl.2010.08.074 | ||||
10915215 | 100776 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm031041j | ||
CHEMBL293161 | 100776 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm031041j | ||
18617389 | 163454 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 408 | 3 | 1 | 4 | 3.6 | Cc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL420029 | 163454 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 408 | 3 | 1 | 4 | 3.6 | Cc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10646375 | 97028 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)ccc3OC)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL267096 | 97028 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)ccc3OC)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10915215 | 100776 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL293161 | 100776 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)[C@@H](c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
44327727 | 168173 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 503 | 6 | 1 | 8 | 3.0 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL433373 | 168173 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 503 | 6 | 1 | 8 | 3.0 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44266640 | 98089 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 459 | 4 | 1 | 8 | 4.2 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc3c(cc2n1Cc1ccc2c(c1)OCO2)OCO3 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL273529 | 98089 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 459 | 4 | 1 | 8 | 4.2 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc3c(cc2n1Cc1ccc2c(c1)OCO2)OCO3 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL335780 | 211539 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](Cc2c[nH]cn2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL343768 | 211679 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CS)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10448516 | 99184 | 1 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3cc(N)ccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL281511 | 99184 | 1 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3cc(N)ccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL413880 | 213071 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | NC(=O)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00084-7 | ||||
44314579 | 102890 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL306123 | 102890 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 580 | 12 | 5 | 5 | 3.8 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
10618166 | 59821 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 355 | 7 | 1 | 6 | 4.0 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccco1 | 10.1021/jm990378b | ||
CHEMBL172880 | 59821 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 355 | 7 | 1 | 6 | 4.0 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccco1 | 10.1021/jm990378b | ||
10151203 | 100773 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 429 | 5 | 1 | 6 | 4.2 | COc1ccc(Cn2c(=O)c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3ccccc32)cc1 | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL293151 | 100773 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 429 | 5 | 1 | 6 | 4.2 | COc1ccc(Cn2c(=O)c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3ccccc32)cc1 | 10.1016/S0960-894X(97)00319-3 | ||
10448516 | 99184 | 1 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3cc(N)ccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL281511 | 99184 | 1 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3cc(N)ccc23)c1C | 10.1021/jm00004a012 | ||
44266568 | 98069 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 493 | 7 | 1 | 6 | 6.3 | COc1ccc(-c2c(C(=O)O)n(-c3ccc4c(c3)OCO4)c3ccc(OCc4ccccc4)cc23)cc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL273410 | 98069 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 493 | 7 | 1 | 6 | 6.3 | COc1ccc(-c2c(C(=O)O)n(-c3ccc4c(c3)OCO4)c3ccc(OCc4ccccc4)cc23)cc1 | 10.1016/0960-894X(96)00170-9 | ||
10313743 | 95517 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3c(N)cccc3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL25756 | 95517 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3c(N)cccc3c2)c1C | 10.1021/jm00008a013 | ||
10314989 | 99833 | 1 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 336 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2cccc3c(Cl)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL285814 | 99833 | 1 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 336 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2cccc3c(Cl)cccc23)c1C | 10.1021/jm00008a013 | ||
127035379 | 136482 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 691 | 13 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3cccc(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3736248 | 136482 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 691 | 13 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3cccc(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
10507191 | 128766 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 565 | 10 | 4 | 5 | 5.6 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C2CC2)s1 | 10.1021/jm950591h | ||
CHEMBL366911 | 128766 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 565 | 10 | 4 | 5 | 5.6 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C2CC2)s1 | 10.1021/jm950591h | ||
CHEMBL2369710 | 209630 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00152-J | ||||
10313743 | 95517 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3c(N)cccc3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL25756 | 95517 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3c(N)cccc3c2)c1C | 10.1021/jm00004a012 | ||
10813822 | 96941 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 460 | 5 | 2 | 5 | 4.5 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)Nc2ccccc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL266336 | 96941 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 460 | 5 | 2 | 5 | 4.5 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)Nc2ccccc2)cc1 | 10.1021/jm9505369 | ||
9915028 | 9379 | 18 | None | 28183 | 2 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL111612 | 9379 | 18 | None | 28183 | 2 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL4761843 | 9379 | 18 | None | 28183 | 2 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
10218058 | 81640 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 523 | 12 | 2 | 10 | 3.1 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2163695 | 81640 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 523 | 12 | 2 | 10 | 3.1 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL97470 | 215902 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10600668 | 5126 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1cc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc(OC)c1OC | 10.1021/jm9606507 | ||
CHEMBL10589 | 5126 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 3.8 | COc1cc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc(OC)c1OC | 10.1021/jm9606507 | ||
10625269 | 14424 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2ccc(C)cc2C)cc1 | 10.1021/jm990170q | ||
CHEMBL120106 | 14424 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2ccc(C)cc2C)cc1 | 10.1021/jm990170q | ||
10792783 | 60346 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 551 | 10 | 3 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N(C)C2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL174699 | 60346 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 551 | 10 | 3 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N(C)C2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
10218058 | 81640 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 523 | 12 | 2 | 10 | 3.1 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1021/jm3009103 | ||
CHEMBL2163695 | 81640 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 523 | 12 | 2 | 10 | 3.1 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCO | 10.1021/jm3009103 | ||
10951918 | 110846 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 567 | 11 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2SCCOc2ncccn2)c1 | 10.1021/jm0102304 | ||
CHEMBL326105 | 110846 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 567 | 11 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2SCCOc2ncccn2)c1 | 10.1021/jm0102304 | ||
44327656 | 141764 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 977 | 25 | 9 | 8 | 4.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(F)(F)F)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL386181 | 141764 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 977 | 25 | 9 | 8 | 4.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(F)(F)F)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL21253 | 209252 | 0 | None | - | 0 | Mouse | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](N)CCCNC(=O)[C@H](Cc1ccccc1)NC(C)=O)[C@@H](C)CC)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/S0960-894X(00)80326-1 | ||||
10862228 | 202938 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 398 | 7 | 1 | 6 | 4.2 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC)cc21 | 10.1021/jm010382z | ||
CHEMBL63000 | 202938 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 398 | 7 | 1 | 6 | 4.2 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC)cc21 | 10.1021/jm010382z | ||
CHEMBL405677 | 212551 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC(=O)[C@@H](Cc1c[nH]c2ccccc12)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00084-7 | ||||
44266552 | 4481 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL10218 | 4481 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/s0960-894x(97)10151-2 | ||
56671734 | 63299 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@H](C(=O)NCC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@@H](C)CC | 10.1021/jm970161m | ||
CHEMBL1793932 | 63299 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@H](C(=O)NCC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@@H](C)CC | 10.1021/jm970161m | ||
44266552 | 4481 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1021/jm0300429 | ||
CHEMBL10218 | 4481 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1021/jm0300429 | ||
CHEMBL341443 | 211617 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44368824 | 96798 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1595 | 31 | 19 | 20 | 0.6 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
77282142 | 96798 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1595 | 31 | 19 | 20 | 0.6 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL265164 | 96798 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1595 | 31 | 19 | 20 | 0.6 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL412460 | 212968 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
18617363 | 164536 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2Cl)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL421523 | 164536 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2ccc(Cl)cc2Cl)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL37860 | 212239 | 0 | None | - | 0 | Pig | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N(C)[C@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccccn1)C(=O)O | 10.1021/jm00087a001 | ||||
44368905 | 161798 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1623 | 31 | 19 | 20 | 1.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
77282145 | 161798 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1623 | 31 | 19 | 20 | 1.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
CHEMBL414448 | 161798 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1623 | 31 | 19 | 20 | 1.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)NCCCCCCC(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||
10792784 | 59565 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 551 | 10 | 4 | 5 | 5.4 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C(C)C)o1 | 10.1021/jm950591h | ||
CHEMBL171910 | 59565 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 551 | 10 | 4 | 5 | 5.4 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C(C)C)o1 | 10.1021/jm950591h | ||
44309488 | 203986 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 471 | 7 | 1 | 8 | 5.1 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nonc2c1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL69664 | 203986 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 471 | 7 | 1 | 8 | 5.1 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nonc2c1 | 10.1016/s0960-894x(97)10151-2 | ||
44327726 | 207869 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 495 | 6 | 1 | 8 | 2.7 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc3c(cc2=O)CCC3)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL96644 | 207869 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 495 | 6 | 1 | 8 | 2.7 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc3c(cc2=O)CCC3)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
44309488 | 203986 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 471 | 7 | 1 | 8 | 5.1 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nonc2c1 | 10.1021/jm0300429 | ||
CHEMBL69664 | 203986 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 471 | 7 | 1 | 8 | 5.1 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nonc2c1 | 10.1021/jm0300429 | ||
10038537 | 59943 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 266 | 3 | 2 | 5 | 0.8 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)CC1 | 10.1016/s0960-894x(00)00136-0 | ||
CHEMBL173336 | 59943 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 266 | 3 | 2 | 5 | 0.8 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)CC1 | 10.1016/s0960-894x(00)00136-0 | ||
44279479 | 99259 | 1 | None | - | 0 | Pig | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 516 | 14 | 6 | 5 | 1.8 | CC(C)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](CC(=O)O)C(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL281963 | 99259 | 1 | None | - | 0 | Pig | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 516 | 14 | 6 | 5 | 1.8 | CC(C)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](CC(=O)O)C(=O)O | 10.1016/0960-894X(95)00221-E | ||
44279439 | 107351 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 534 | 3 | 2 | 3 | 6.2 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL31781 | 107351 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 534 | 3 | 2 | 3 | 6.2 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL137569 | 208722 | 0 | None | - | 0 | Pig | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CCCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10787482 | 96932 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 405 | 4 | 1 | 4 | 3.9 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)nc3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL266277 | 96932 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 405 | 4 | 1 | 4 | 3.9 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)nc3)cccc12 | 10.1021/jm9604585 | ||
10740139 | 202932 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)nn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6297 | 202932 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)nn3)cccc12 | 10.1021/jm9604585 | ||
18617288 | 205123 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 316 | 3 | 1 | 4 | 2.5 | Cc1noc(NS(=O)(=O)c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL78080 | 205123 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 316 | 3 | 1 | 4 | 2.5 | Cc1noc(NS(=O)(=O)c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
10646522 | 203369 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 434 | 5 | 1 | 5 | 3.8 | CCc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6543 | 203369 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 434 | 5 | 1 | 5 | 3.8 | CCc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
22998439 | 203073 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 392 | 5 | 1 | 7 | 3.7 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL63938 | 203073 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 392 | 5 | 1 | 7 | 3.7 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/S0960-894X(97)00367-3 | ||
10650368 | 60337 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 553 | 10 | 5 | 7 | 3.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(O)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL174635 | 60337 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 553 | 10 | 5 | 7 | 3.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(O)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
10789715 | 113071 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 450 | 8 | 1 | 5 | 4.2 | CCCN(C)C(=O)CN1C[C@H](c2cccc3occc23)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL331375 | 113071 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 450 | 8 | 1 | 5 | 4.2 | CCCN(C)C(=O)CN1C[C@H](c2cccc3occc23)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10575552 | 111282 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 450 | 8 | 1 | 5 | 4.2 | CCCN(C)C(=O)CN1C[C@H](c2ccc3ccoc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL326690 | 111282 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 450 | 8 | 1 | 5 | 4.2 | CCCN(C)C(=O)CN1C[C@H](c2ccc3ccoc3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
9871561 | 174776 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 527 | 10 | 2 | 8 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cc2)nc(C(F)(F)F)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4562189 | 174776 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 527 | 10 | 2 | 8 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cc2)nc(C(F)(F)F)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
44314657 | 103176 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 619 | 13 | 5 | 4 | 4.3 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL308383 | 103176 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 619 | 13 | 5 | 4 | 4.3 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCC1)C(=O)O | 10.1021/jm9600914 | ||
10288020 | 14597 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 430 | 7 | 1 | 6 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205067 | 14597 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 430 | 7 | 1 | 6 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL48881 | 14597 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 430 | 7 | 1 | 6 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
11796594 | 207355 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 424 | 10 | 1 | 5 | 5.8 | CC(=O)c1ccc(OCc2ccsc2)cc1OC(CCC(=O)O)c1ccccc1C | 10.1021/jm9707131 | ||
CHEMBL93776 | 207355 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 424 | 10 | 1 | 5 | 5.8 | CC(=O)c1ccc(OCc2ccsc2)cc1OC(CCC(=O)O)c1ccccc1C | 10.1021/jm9707131 | ||
10144334 | 130638 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 561 | 10 | 2 | 10 | 4.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368211 | 130638 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 561 | 10 | 2 | 10 | 4.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL147510 | 208755 | 0 | None | - | 0 | Mouse | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
44385941 | 130650 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.6 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC(C)C2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368286 | 130650 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.6 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC(C)C2)nc1C(=O)O | 10.1021/jm950592+ | ||
31771 | 96937 | 37 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL26630 | 96937 | 37 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00008a013 | ||
11755275 | 199986 | 0 | None | - | 1 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 489 | 9 | 1 | 7 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)c(=O)n2Cc1cc(OC)ccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL59537 | 199986 | 0 | None | - | 1 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 489 | 9 | 1 | 7 | 4.8 | CCOc1ccc2c(c1)c(-c1ccc(OC)cc1)c(C(=O)O)c(=O)n2Cc1cc(OC)ccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
31771 | 96937 | 37 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00004a012 | ||
CHEMBL26630 | 96937 | 37 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00004a012 | ||
56657875 | 63295 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@@H](C)CC | 10.1021/jm970161m | ||
CHEMBL1793925 | 63295 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@@H](C)CC | 10.1021/jm970161m | ||
56681798 | 63298 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@@H](C)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)CNC(=O)[C@H](NC(=O)[C@H](N)Cc1c[nH]c2ccccc12)[C@H](C)CC | 10.1021/jm970161m | ||
CHEMBL1793929 | 63298 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@@H](C)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)CNC(=O)[C@H](NC(=O)[C@H](N)Cc1c[nH]c2ccccc12)[C@H](C)CC | 10.1021/jm970161m | ||
44327252 | 207510 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 495 | 7 | 1 | 8 | 3.1 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc(C3CC3)ccc2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94654 | 207510 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 495 | 7 | 1 | 8 | 3.1 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc(C3CC3)ccc2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
44266592 | 5343 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 431 | 4 | 1 | 7 | 4.5 | COc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10699 | 5343 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 431 | 4 | 1 | 7 | 4.5 | COc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL137754 | 208726 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
CHEMBL436884 | 213667 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
44328019 | 155680 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1000 | 26 | 9 | 8 | 5.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL405178 | 155680 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1000 | 26 | 9 | 8 | 5.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
44327348 | 161883 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1076 | 28 | 9 | 8 | 7.0 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL415238 | 161883 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 1076 | 28 | 9 | 8 | 7.0 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
10216862 | 196389 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 443 | 4 | 1 | 7 | 3.9 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n(Cc2ccc3c(c2)OCO3)c1=O | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL56286 | 196389 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 443 | 4 | 1 | 7 | 3.9 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n(Cc2ccc3c(c2)OCO3)c1=O | 10.1016/S0960-894X(97)00319-3 | ||
44327412 | 207558 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 497 | 5 | 1 | 8 | 3.0 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94929 | 207558 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 497 | 5 | 1 | 8 | 3.0 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44327114 | 207785 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 533 | 7 | 1 | 7 | 4.1 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)N2N=C(c3ccccc3)CCC2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL96234 | 207785 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 533 | 7 | 1 | 7 | 4.1 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)N2N=C(c3ccccc3)CCC2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
10244529 | 59252 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 264 | 3 | 1 | 5 | 1.0 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(=O)[C@]2(O)CC1 | 10.1016/s0960-894x(00)00136-0 | ||
CHEMBL170450 | 59252 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 264 | 3 | 1 | 5 | 1.0 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(=O)[C@]2(O)CC1 | 10.1016/s0960-894x(00)00136-0 | ||
44279371 | 99896 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 466 | 3 | 2 | 3 | 5.5 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3cc(Cl)cc(Cl)c3)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL286214 | 99896 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 466 | 3 | 2 | 3 | 5.5 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3cc(Cl)cc(Cl)c3)cc21 | 10.1016/0960-894X(95)00230-Q | ||
6426756 | 150685 | 40 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 537 | 9 | 3 | 10 | 3.9 | CC(C)(C)c1ccc(S(=O)(=O)Nc2nc(-c3ncccn3)nc(OCCO)c2Oc2ccccc2O)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL3956076 | 150685 | 40 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 537 | 9 | 3 | 10 | 3.9 | CC(C)(C)c1ccc(S(=O)(=O)Nc2nc(-c3ncccn3)nc(OCCO)c2Oc2ccccc2O)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
23445254 | 207132 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 412 | 5 | 1 | 5 | 4.2 | Cc1noc(NS(=O)(=O)c2sccc2Cc2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL92318 | 207132 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 412 | 5 | 1 | 5 | 4.2 | Cc1noc(NS(=O)(=O)c2sccc2Cc2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
9810571 | 61356 | 0 | None | - | 2 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 731 | 18 | 2 | 13 | 5.0 | CCCS(=O)(=O)NCCOc1nc(-c2cc(OC)c(OC)c(OC)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL176997 | 61356 | 0 | None | - | 2 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 731 | 18 | 2 | 13 | 5.0 | CCCS(=O)(=O)NCCOc1nc(-c2cc(OC)c(OC)c(OC)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
127034756 | 136328 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 679 | 12 | 2 | 7 | 7.5 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3F)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3734829 | 136328 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 679 | 12 | 2 | 7 | 7.5 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3F)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
176 | 397 | 66 | None | -7 | 31 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
2157 | 397 | 66 | None | -7 | 31 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
2566 | 397 | 66 | None | -7 | 31 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
CHEMBL633 | 397 | 66 | None | -7 | 31 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
DB01118 | 397 | 66 | None | -7 | 31 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
18617393 | 205254 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 308 | 5 | 1 | 4 | 3.2 | CCc1ccc(CC)c(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL79066 | 205254 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 308 | 5 | 1 | 4 | 3.2 | CCc1ccc(CC)c(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
44314647 | 205062 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 647 | 13 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCCCC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL77468 | 205062 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 647 | 13 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCCCC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL2304016 | 209449 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC(C)[C@H]1NC(=O)[C@H](C(C)(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Cl)[nH]c3ccccc23)NC1=O | 10.1021/jm9600914 | ||||
10502226 | 101501 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 420 | 6 | 1 | 8 | 3.3 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1C | 10.1021/jm9700068 | ||
CHEMBL298203 | 101501 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 420 | 6 | 1 | 8 | 3.3 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Cc2ccc3c(c2)OCO3)c1C | 10.1021/jm9700068 | ||
10715441 | 175902 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 390 | 6 | 1 | 6 | 3.9 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm9700068 | ||
CHEMBL45875 | 175902 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 390 | 6 | 1 | 6 | 3.9 | Cc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm9700068 | ||
10575755 | 179793 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 455 | 5 | 2 | 6 | 4.2 | Cc1ccccc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1021/jm9608366 | ||
CHEMBL47450 | 179793 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 455 | 5 | 2 | 6 | 4.2 | Cc1ccccc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1021/jm9608366 | ||
10168195 | 61357 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 631 | 11 | 2 | 13 | 5.0 | C#CCOc1nc(-c2ccnc(-c3noc(S)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176999 | 61357 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 631 | 11 | 2 | 13 | 5.0 | C#CCOc1nc(-c2ccnc(-c3noc(S)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10744085 | 102843 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 503 | 9 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL305777 | 102843 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 503 | 9 | 1 | 8 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
10318748 | 99603 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 399 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCCC4=O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL284177 | 99603 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 399 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCCC4=O)cccc23)c1C | 10.1021/jm00008a013 | ||
44316527 | 205457 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 280 | 3 | 1 | 4 | 2.7 | Cc1ccc(C)c(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80532 | 205457 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 280 | 3 | 1 | 4 | 2.7 | Cc1ccc(C)c(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
44316831 | 205492 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 358 | 4 | 1 | 4 | 3.4 | CCc1ccc(Br)c(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80807 | 205492 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 358 | 4 | 1 | 4 | 3.4 | CCc1ccc(Br)c(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
15296635 | 99527 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 488 | 11 | 5 | 5 | 2.7 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL283591 | 99527 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 488 | 11 | 5 | 5 | 2.7 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
23445224 | 203375 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 406 | 5 | 1 | 7 | 4.0 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL65488 | 203375 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 406 | 5 | 1 | 7 | 4.0 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL356864 | 211719 | 0 | None | - | 0 | Mouse | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
CHEMBL1791006 | 208889 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H]([C@H](C)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44371396 | 49488 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 471 | 6 | 1 | 6 | 5.9 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3SC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL156532 | 49488 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 471 | 6 | 1 | 6 | 5.9 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3SC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
44371532 | 51445 | 1 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 455 | 6 | 1 | 6 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cccc(OC)c3)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL158239 | 51445 | 1 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 455 | 6 | 1 | 6 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cccc(OC)c3)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
44371571 | 119463 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 425 | 5 | 1 | 5 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL345380 | 119463 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 425 | 5 | 1 | 5 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
10473627 | 101862 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc12 | 10.1021/jm00008a013 | ||
CHEMBL30077 | 101862 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc12 | 10.1021/jm00008a013 | ||
18617395 | 205249 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 361 | 4 | 1 | 6 | 2.5 | Cc1noc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL79030 | 205249 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 361 | 4 | 1 | 6 | 2.5 | Cc1noc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10473627 | 101862 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc12 | 10.1021/jm00004a012 | ||
CHEMBL30077 | 101862 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc12 | 10.1021/jm00004a012 | ||
56681797 | 63294 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@H](C)CC | 10.1021/jm970161m | ||
CHEMBL1793924 | 63294 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@H](C)CC | 10.1021/jm970161m | ||
44213924 | 207473 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 567 | 7 | 1 | 7 | 4.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)N2N=C(c3ccc(Cl)cc3)CCC2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94426 | 207473 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 567 | 7 | 1 | 7 | 4.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)N2N=C(c3ccc(Cl)cc3)CCC2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
44266537 | 4296 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 507 | 8 | 1 | 6 | 6.4 | COc1ccc(Cn2c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3cc(OCc4ccccc4)ccc32)cc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10092 | 4296 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 507 | 8 | 1 | 6 | 6.4 | COc1ccc(Cn2c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3cc(OCc4ccccc4)ccc32)cc1 | 10.1016/0960-894X(96)00170-9 | ||
44368414 | 121261 | 0 | None | - | 0 | Pig | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 459 | 9 | 1 | 5 | 4.2 | COc1ccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2ccccc2)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL357978 | 121261 | 0 | None | - | 0 | Pig | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 459 | 9 | 1 | 5 | 4.2 | COc1ccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2ccccc2)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
10470588 | 99964 | 2 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 309 | 6 | 2 | 5 | 2.9 | CCCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00029a001 | ||
CHEMBL286682 | 99964 | 2 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 309 | 6 | 2 | 5 | 2.9 | CCCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00029a001 | ||
10470588 | 99964 | 2 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 309 | 6 | 2 | 5 | 2.9 | CCCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00008a013 | ||
CHEMBL286682 | 99964 | 2 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 309 | 6 | 2 | 5 | 2.9 | CCCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00008a013 | ||
127035068 | 136348 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 633 | 10 | 2 | 7 | 7.7 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735036 | 136348 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 633 | 10 | 2 | 7 | 7.7 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
10604119 | 11425 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 636 | 12 | 2 | 7 | 5.8 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL1180361 | 11425 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 636 | 12 | 2 | 7 | 5.8 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL123654 | 11425 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 636 | 12 | 2 | 7 | 5.8 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2C)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
23445241 | 102621 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 442 | 5 | 1 | 7 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccccc2)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL304406 | 102621 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 442 | 5 | 1 | 7 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccccc2)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
10554724 | 61735 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(C)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL177195 | 61735 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCC(C)CC2)nc1C(=O)O | 10.1021/jm950592+ | ||
12146375 | 96820 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 322 | 3 | 1 | 5 | 2.6 | Cc1noc(NS(=O)(=O)c2ccsc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL265290 | 96820 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 322 | 3 | 1 | 5 | 2.6 | Cc1noc(NS(=O)(=O)c2ccsc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
9975719 | 95996 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc12 | 10.1021/jm00008a013 | ||
CHEMBL25977 | 95996 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc12 | 10.1021/jm00008a013 | ||
9975719 | 95996 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc12 | 10.1021/jm00004a012 | ||
CHEMBL25977 | 95996 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc12 | 10.1021/jm00004a012 | ||
127034919 | 136490 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 599 | 10 | 2 | 7 | 6.6 | CCCc1nc2c(C)cc(C(=O)NC(C)C)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3736310 | 136490 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 599 | 10 | 2 | 7 | 6.6 | CCCc1nc2c(C)cc(C(=O)NC(C)C)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44384610 | 128445 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 743 | 16 | 2 | 14 | 4.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2cc(OC)c(OC)c(OC)c2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL366627 | 128445 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 743 | 16 | 2 | 14 | 4.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2cc(OC)c(OC)c(OC)c2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
137633653 | 156573 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 593 | 10 | 2 | 9 | 5.0 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC4CCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4068786 | 156573 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 593 | 10 | 2 | 9 | 5.0 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC4CCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
9868822 | 8559 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 459 | 6 | 1 | 7 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(N(C)C)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10948 | 8559 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 459 | 6 | 1 | 7 | 3.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(N(C)C)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL2304013 | 209446 | 0 | None | - | 0 | Pig | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC(C)[C@H]1NC(=O)[C@H](C(C)(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Br)[nH]c3ccccc23)NC1=O | 10.1021/jm9600914 | ||||
443289 | 708 | 47 | None | -2 | 3 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
997 | 708 | 47 | None | -2 | 3 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
CHEMBL314691 | 708 | 47 | None | -2 | 3 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
DB12054 | 708 | 47 | None | -2 | 3 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
CHEMBL336033 | 211551 | 1 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1016/j.bmc.2015.01.003 | ||||
44295224 | 14599 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 532 | 9 | 1 | 9 | 4.6 | COc1cc(C/C(C(=O)c2ccc3c(c2)CCO3)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205077 | 14599 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 532 | 9 | 1 | 9 | 4.6 | COc1cc(C/C(C(=O)c2ccc3c(c2)CCO3)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL49675 | 14599 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 532 | 9 | 1 | 9 | 4.6 | COc1cc(C/C(C(=O)c2ccc3c(c2)CCO3)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
44294929 | 14762 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206731 | 14762 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL301971 | 14762 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
44320375 | 107118 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 506 | 8 | 1 | 7 | 5.3 | COc1cc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)cc(OC)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL316187 | 107118 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 506 | 8 | 1 | 7 | 5.3 | COc1cc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)cc(OC)c1 | 10.1016/s0960-894x(00)00513-8 | ||
10252787 | 99238 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 442 | 7 | 1 | 6 | 4.6 | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3ccc4c(c3)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL281865 | 99238 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 442 | 7 | 1 | 6 | 4.6 | COc1cccc(Cn2nc(-c3ccccc3)c(Cc3ccc4c(c3)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10839618 | 203551 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 517 | 10 | 1 | 8 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL66762 | 203551 | 0 | None | - | 0 | Human | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 517 | 10 | 1 | 8 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCCN(C)C)c2)cc1 | 10.1021/jm980504w | ||
17885919 | 206387 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 526 | 9 | 2 | 8 | 4.8 | O=C(O)COc1ccccc1Cn1nc(-c2cccs2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL87801 | 206387 | 0 | None | - | 0 | Rat | 7.6 | pIC50 | = | 7.6 | Binding | ChEMBL | 526 | 9 | 2 | 8 | 4.8 | O=C(O)COc1ccccc1Cn1nc(-c2cccs2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
3795752 | 105175 | 1 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311455 | 105175 | 1 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1C | 10.1016/0960-894X(96)00441-6 | ||
44283453 | 138752 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 641 | 12 | 4 | 7 | 4.8 | CCCC[C@H](NC(=O)[C@@H](Cc1cn(C(=O)OC)c2ccccc12)NC(=O)C(CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL37807 | 138752 | 0 | None | - | 0 | Pig | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 641 | 12 | 4 | 7 | 4.8 | CCCC[C@H](NC(=O)[C@@H](Cc1cn(C(=O)OC)c2ccccc12)NC(=O)C(CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
10721106 | 61376 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 536 | 9 | 4 | 5 | 4.3 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL177023 | 61376 | 0 | None | - | 0 | Rat | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 536 | 9 | 4 | 5 | 4.3 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
10247887 | 98335 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(CN(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL27525 | 98335 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(CN(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
10247887 | 98335 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(CN(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27525 | 98335 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(CN(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL86814 | 215869 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
CHEMBL408141 | 212680 | 0 | None | - | 0 | Rat | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
CHEMBL86814 | 215869 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
CHEMBL344473 | 211683 | 0 | None | - | 0 | Pig | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](C)NC1=O | 10.1021/jm00021a021 | ||||
10444974 | 99571 | 24 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)on1 | 10.1021/jm00029a001 | ||
CHEMBL283941 | 99571 | 24 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)on1 | 10.1021/jm00029a001 | ||
10444974 | 99571 | 24 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)on1 | 10.1021/jm00008a013 | ||
CHEMBL283941 | 99571 | 24 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)on1 | 10.1021/jm00008a013 | ||
127035084 | 136358 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 707 | 13 | 2 | 9 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735151 | 136358 | 0 | None | - | 0 | Human | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 707 | 13 | 2 | 9 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44298395 | 100658 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 308 | 3 | 1 | 4 | 3.4 | Cc1onc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL292355 | 100658 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 308 | 3 | 1 | 4 | 3.4 | Cc1onc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
44298342 | 101730 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 283 | 3 | 2 | 5 | 2.1 | Cc1snc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL299831 | 101730 | 0 | None | - | 0 | Rat | 4.6 | pIC50 | = | 4.6 | Binding | ChEMBL | 283 | 3 | 2 | 5 | 2.1 | Cc1snc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
18184179 | 128996 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 654 | 13 | 2 | 12 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367017 | 128996 | 0 | None | - | 0 | Human | 5.6 | pIC50 | = | 5.6 | Binding | ChEMBL | 654 | 13 | 2 | 12 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
52950137 | 18402 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 559 | 10 | 3 | 8 | 3.8 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC(=O)O)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271863 | 18402 | 0 | None | - | 0 | Human | 6.6 | pIC50 | = | 6.6 | Binding | ChEMBL | 559 | 10 | 3 | 8 | 3.8 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC(=O)O)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
10760657 | 59993 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 355 | 7 | 1 | 6 | 4.0 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccoc1 | 10.1021/jm990378b | ||
CHEMBL173565 | 59993 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 355 | 7 | 1 | 6 | 4.0 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccoc1 | 10.1021/jm990378b | ||
10717279 | 97018 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 425 | 9 | 1 | 5 | 4.8 | CCCCCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL266996 | 97018 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 425 | 9 | 1 | 5 | 4.8 | CCCCCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
18948954 | 167882 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 360 | 4 | 2 | 5 | 3.5 | Cc1noc(NS(=O)(=O)c2cccc3c(C(C)(C)O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL431300 | 167882 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 360 | 4 | 2 | 5 | 3.5 | Cc1noc(NS(=O)(=O)c2cccc3c(C(C)(C)O)cccc23)c1C | 10.1021/jm00008a013 | ||
11783885 | 100860 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 382 | 7 | 1 | 5 | 4.6 | CCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm031041j | ||
CHEMBL293702 | 100860 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 382 | 7 | 1 | 5 | 4.6 | CCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm031041j | ||
18617340 | 105376 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 422 | 4 | 1 | 4 | 3.9 | CCc1ccc(Br)c(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311742 | 105376 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 422 | 4 | 1 | 4 | 3.9 | CCc1ccc(Br)c(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
11783885 | 100860 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 382 | 7 | 1 | 5 | 4.6 | CCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL293702 | 100860 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 382 | 7 | 1 | 5 | 4.6 | CCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
155511294 | 169545 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 469 | 6 | 1 | 8 | 2.5 | Cc1ccc(=O)n([C@@H](C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4435789 | 169545 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 469 | 6 | 1 | 8 | 2.5 | Cc1ccc(=O)n([C@@H](C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/j.bmcl.2016.06.014 | ||
44293805 | 101087 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 545 | 10 | 2 | 10 | 3.5 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCc1nn[nH]n1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL295140 | 101087 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 545 | 10 | 2 | 10 | 3.5 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCc1nn[nH]n1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10693679 | 207350 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 425 | 10 | 2 | 5 | 4.7 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C(N)=O | 10.1021/jm9707131 | ||
CHEMBL93749 | 207350 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 425 | 10 | 2 | 5 | 4.7 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C(N)=O | 10.1021/jm9707131 | ||
9848132 | 207554 | 0 | None | 1 | 2 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 483 | 6 | 1 | 8 | 2.8 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94918 | 207554 | 0 | None | 1 | 2 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 483 | 6 | 1 | 8 | 2.8 | Cc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44387111 | 166158 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 548 | 10 | 5 | 5 | 4.2 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL426413 | 166158 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 548 | 10 | 5 | 5 | 4.2 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
10506505 | 128643 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 535 | 11 | 4 | 5 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@@H](CC(=O)NC2CCCCC2)CC(C)C)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL366805 | 128643 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 535 | 11 | 4 | 5 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@@H](CC(=O)NC2CCCCC2)CC(C)C)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL137716 | 208725 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | COC(=O)n1cc(C[C@@H]2NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H]3CCCN3C(=O)[C@H](CC(=O)O)NC2=O)c2ccccc21 | 10.1021/jm00021a021 | ||||
137655525 | 158967 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 525 | 7 | 3 | 9 | 3.5 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(O)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4096346 | 158967 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 525 | 7 | 3 | 9 | 3.5 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(O)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10383850 | 99741 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.6 | CCc1c(C)noc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL285122 | 99741 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 359 | 5 | 1 | 5 | 3.6 | CCc1c(C)noc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm00008a013 | ||
10882352 | 202960 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 340 | 4 | 1 | 5 | 3.4 | CCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL63099 | 202960 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 340 | 4 | 1 | 5 | 3.4 | CCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
44279383 | 99966 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 398 | 3 | 2 | 3 | 4.2 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccccc3)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL286687 | 99966 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 398 | 3 | 2 | 3 | 4.2 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccccc3)cc21 | 10.1016/0960-894X(95)00230-Q | ||
23445221 | 203072 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 470 | 5 | 1 | 7 | 4.4 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL63937 | 203072 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 470 | 5 | 1 | 7 | 4.4 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00367-3 | ||
44327237 | 207906 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 511 | 8 | 1 | 8 | 3.5 | CCCc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL96847 | 207906 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 511 | 8 | 1 | 8 | 3.5 | CCCc1cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
15453172 | 204962 | 4 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76623 | 204962 | 4 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 392 | 4 | 1 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44213923 | 108254 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 563 | 8 | 1 | 8 | 4.1 | COc1ccc(C2=NN(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)C(=O)CC2)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL319743 | 108254 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 563 | 8 | 1 | 8 | 4.1 | COc1ccc(C2=NN(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)C(=O)CC2)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
10530457 | 62082 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 538 | 9 | 5 | 6 | 4.0 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)NO | 10.1021/jm950592+ | ||
CHEMBL177602 | 62082 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 538 | 9 | 5 | 6 | 4.0 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)NO | 10.1021/jm950592+ | ||
10168939 | 131342 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 695 | 11 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368860 | 131342 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 695 | 11 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL170600 | 208822 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)N[C@H](CC(=O)O)C(=O)O | 10.1016/0960-894X(95)00144-I | ||||
CHEMBL1201469 | 14475 | 0 | None | -1 | 4 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | None | nan | ||||
23445227 | 120799 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 472 | 6 | 1 | 8 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2COc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL355800 | 120799 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 472 | 6 | 1 | 8 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2COc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
10789525 | 61740 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2cccc(OC)c2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL177221 | 61740 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2cccc(OC)c2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
10789524 | 5160 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10607 | 5160 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OC)c2)cc1 | 10.1021/jm9606507 | ||
10896413 | 100579 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.4 | COc1ccc(CCOC2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL291841 | 100579 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.4 | COc1ccc(CCOC2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
11762291 | 100608 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccccc1C1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL292041 | 100608 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 5.2 | COc1ccccc1C1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
11059249 | 102591 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 440 | 10 | 1 | 6 | 5.3 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OCCCC)cc21 | 10.1021/jm010382z | ||
CHEMBL304202 | 102591 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 440 | 10 | 1 | 6 | 5.3 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OCCCC)cc21 | 10.1021/jm010382z | ||
11144468 | 203438 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 430 | 5 | 1 | 5 | 5.2 | CC(C)Oc1ccc2c(c1)C(c1ccccc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL65925 | 203438 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 430 | 5 | 1 | 5 | 5.2 | CC(C)Oc1ccc2c(c1)C(c1ccccc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10184817 | 9542 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 488 | 14 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)CCC | 10.1021/jm980217s | ||
CHEMBL112417 | 9542 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 488 | 14 | 1 | 5 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)CCC | 10.1021/jm980217s | ||
44314904 | 103120 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 585 | 12 | 5 | 5 | 3.6 | CSCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL307936 | 103120 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 585 | 12 | 5 | 5 | 3.6 | CSCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
155564169 | 175309 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 545 | 11 | 1 | 12 | 2.0 | COc1ccc(Cl)c(Oc2c(NS(C)(=O)=O)ncnc2OCCOc2ncc(S(C)(=O)=O)cn2)c1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4574034 | 175309 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 545 | 11 | 1 | 12 | 2.0 | COc1ccc(Cl)c(Oc2c(NS(C)(=O)=O)ncnc2OCCOc2ncc(S(C)(=O)=O)cn2)c1 | 10.1016/j.bmcl.2016.06.014 | ||
71455062 | 81650 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 669 | 14 | 1 | 12 | 5.0 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(C(F)(F)F)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163705 | 81650 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 669 | 14 | 1 | 12 | 5.0 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(C(F)(F)F)cn1 | 10.1021/jm3009103 | ||
44295005 | 10188 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)c(F)c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1160205 | 10188 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.8 | COc1ccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)c(F)c1 | 10.1016/s0960-894x(98)00301-1 | ||
10226215 | 101405 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 455 | 5 | 2 | 8 | 3.8 | Cc1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
CHEMBL297473 | 101405 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 455 | 5 | 2 | 8 | 3.8 | Cc1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
44291255 | 173435 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 455 | 5 | 2 | 8 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2C)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL45296 | 173435 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 455 | 5 | 2 | 8 | 3.8 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2C)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL414165 | 213092 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](c2cccs2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44311345 | 204194 | 0 | None | - | 1 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 663 | 13 | 3 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CCNCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70895 | 204194 | 0 | None | - | 1 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 663 | 13 | 3 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CCNCC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL414165 | 213092 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](c2cccs2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
8260 | 529 | 54 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | 10.1016/j.bmcl.2016.06.014 | ||
9912992 | 529 | 54 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL3989834 | 529 | 54 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 479 | 8 | 1 | 9 | 3.9 | COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cn1)C)c1ccncc1 | 10.1016/j.bmcl.2016.06.014 | ||
44458597 | 98763 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 535 | 7 | 3 | 8 | 2.3 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccccc2C(=O)O)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL278349 | 98763 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 535 | 7 | 3 | 8 | 2.3 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccccc2C(=O)O)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
11017071 | 9923 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 547 | 9 | 1 | 9 | 4.3 | Cc1ccc(-c2c(NS(=O)(=O)c3cccs3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL114683 | 9923 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 547 | 9 | 1 | 9 | 4.3 | Cc1ccc(-c2c(NS(=O)(=O)c3cccs3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
10994373 | 162430 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 474 | 5 | 1 | 7 | 5.0 | CC(C)Oc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL416675 | 162430 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 474 | 5 | 1 | 7 | 5.0 | CC(C)Oc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10122033 | 81648 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 631 | 15 | 1 | 13 | 4.0 | COc1cnc(OCCOc2nc(-c3ncccn3)nc(NS(=O)(=O)CCc3ccccc3)c2Oc2ccccc2OC)nc1 | 10.1021/jm3009103 | ||
CHEMBL2163703 | 81648 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 631 | 15 | 1 | 13 | 4.0 | COc1cnc(OCCOc2nc(-c3ncccn3)nc(NS(=O)(=O)CCc3ccccc3)c2Oc2ccccc2OC)nc1 | 10.1021/jm3009103 | ||
44334145 | 4620 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 4.6 | COc1ccc([C@@H]2c3nc(N(C)C(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL103090 | 4620 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 6 | 1 | 6 | 4.6 | COc1ccc([C@@H]2c3nc(N(C)C(C)C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
44352026 | 117459 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 548 | 11 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C(F)(F)F)cc1 | 10.1021/jm010237l | ||
CHEMBL339969 | 117459 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 548 | 11 | 1 | 5 | 5.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C(F)(F)F)cc1 | 10.1021/jm010237l | ||
44339840 | 9256 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 486 | 13 | 1 | 5 | 5.1 | C/C=C(\C)CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL110904 | 9256 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 486 | 13 | 1 | 5 | 5.1 | C/C=C(\C)CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
10577829 | 9635 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 518 | 13 | 1 | 7 | 3.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1OCCCO1 | 10.1021/jm980217s | ||
CHEMBL112877 | 9635 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 518 | 13 | 1 | 7 | 3.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1OCCCO1 | 10.1021/jm980217s | ||
73669821 | 117601 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 448 | 10 | 1 | 6 | 5.2 | CC(=O)c1ccc(OCc2ccc3c(c2)OCO3)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
CHEMBL3400988 | 117601 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 448 | 10 | 1 | 6 | 5.2 | CC(=O)c1ccc(OCc2ccc3c(c2)OCO3)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
21041307 | 174945 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 482 | 10 | 2 | 9 | 2.6 | CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4566095 | 174945 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 482 | 10 | 2 | 9 | 2.6 | CNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1-c1ccc(Cl)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
10274552 | 73484 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 434 | 6 | 1 | 8 | 3.6 | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C)OCO2 | 10.1021/jm9700068 | ||
CHEMBL20168 | 73484 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 434 | 6 | 1 | 8 | 3.6 | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C)OCO2 | 10.1021/jm9700068 | ||
10274552 | 73484 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 434 | 6 | 1 | 8 | 3.6 | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C)OCO2 | 10.1021/jm000349x | ||
CHEMBL20168 | 73484 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 434 | 6 | 1 | 8 | 3.6 | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C)OCO2 | 10.1021/jm000349x | ||
16004692 | 2438 | 91 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
4809 | 2438 | 91 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
7352 | 2438 | 91 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2103873 | 2438 | 91 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
DB08932 | 2438 | 91 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | 10.1016/j.bmcl.2016.06.014 | ||
10070 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1016/j.bmcl.2016.06.014 | ||
25099191 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2165326 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1016/j.bmcl.2016.06.014 | ||
DB15059 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1016/j.bmcl.2016.06.014 | ||
10070 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1021/jm3009103 | ||
25099191 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1021/jm3009103 | ||
CHEMBL2165326 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1021/jm3009103 | ||
DB15059 | 448 | 47 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 544 | 8 | 2 | 8 | 2.5 | Brc1ccc(cc1)c1c(OCCOc2ncc(cn2)Br)ncnc1NS(=O)(=O)N | 10.1021/jm3009103 | ||
71455065 | 81670 | 1 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 679 | 14 | 2 | 11 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2ccncc2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163724 | 81670 | 1 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 679 | 14 | 2 | 11 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)nc(-c2ccncc2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
17869373 | 14602 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C(=O)/C(Cc2cccc(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205094 | 14602 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C(=O)/C(Cc2cccc(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL51890 | 14602 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C(=O)/C(Cc2cccc(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
44295106 | 14710 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 472 | 7 | 1 | 7 | 4.6 | COc1ccc(C(=O)/C(Cc2ccc3c(c2)CCO3)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206319 | 14710 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 472 | 7 | 1 | 7 | 4.6 | COc1ccc(C(=O)/C(Cc2ccc3c(c2)CCO3)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL262000 | 14710 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 472 | 7 | 1 | 7 | 4.6 | COc1ccc(C(=O)/C(Cc2ccc3c(c2)CCO3)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
17869279 | 14847 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2OC)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1207701 | 14847 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2OC)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL431160 | 14847 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 460 | 8 | 1 | 7 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2OC)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
44320171 | 106930 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 504 | 6 | 1 | 5 | 6.4 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC12CC3CC(CC(C3)C1)C2 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL314974 | 106930 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 504 | 6 | 1 | 5 | 6.4 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC12CC3CC(CC(C3)C1)C2 | 10.1016/s0960-894x(00)00513-8 | ||
11135910 | 10179 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 624 | 10 | 1 | 10 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(-c4ccccn4)s3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
CHEMBL116002 | 10179 | 0 | None | - | 0 | Pig | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 624 | 10 | 1 | 10 | 5.4 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(-c4ccccn4)s3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm0102304 | ||
10205245 | 72180 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 466 | 5 | 2 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2C#N)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL19808 | 72180 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 466 | 5 | 2 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2C#N)OCO3)c1Cl | 10.1021/jm9608366 | ||
44291575 | 179411 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 466 | 5 | 2 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2C#N)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL47404 | 179411 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 466 | 5 | 2 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc3c(c2C#N)OCO3)c1Cl | 10.1021/jm9700068 | ||
10205245 | 72180 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 466 | 5 | 2 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2C#N)OCO3)c1Cl | 10.1021/jm000349x | ||
CHEMBL19808 | 72180 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 466 | 5 | 2 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2C#N)OCO3)c1Cl | 10.1021/jm000349x | ||
CHEMBL133257 | 208692 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C2CCCC2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
11634755 | 62277 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 480 | 7 | 1 | 7 | 4.9 | COc1cc(/C(C(=O)O)=C(\CC2CCCCC2)C(=O)c2ccc3c(c2)OCCO3)cc2c1OCO2 | 10.1021/jm031041j | ||
CHEMBL177886 | 62277 | 0 | None | - | 0 | Rat | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 480 | 7 | 1 | 7 | 4.9 | COc1cc(/C(C(=O)O)=C(\CC2CCCCC2)C(=O)c2ccc3c(c2)OCCO3)cc2c1OCO2 | 10.1021/jm031041j | ||
44304492 | 96531 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL262993 | 96531 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
18738878 | 194809 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 547 | 8 | 2 | 7 | 4.2 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL539420 | 194809 | 0 | None | - | 0 | Human | 8.5 | pIC50 | = | 8.5 | Binding | ChEMBL | 547 | 8 | 2 | 7 | 4.2 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
9958846 | 170153 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 537 | 13 | 1 | 10 | 3.7 | COCCOc1nc(-c2ncccn2)nc(NS(=O)(=O)CCc2ccccc2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4444693 | 170153 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 537 | 13 | 1 | 10 | 3.7 | COCCOc1nc(-c2ncccn2)nc(NS(=O)(=O)CCc2ccccc2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
71455140 | 81979 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 598 | 12 | 2 | 8 | 4.7 | CC(C)c1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
CHEMBL2165336 | 81979 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 598 | 12 | 2 | 8 | 4.7 | CC(C)c1ccc(-c2c(NS(=O)(=O)NCc3ccccc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm3009103 | ||
11123269 | 206277 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 452 | 6 | 1 | 5 | 5.8 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL87070 | 206277 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 452 | 6 | 1 | 5 | 5.8 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
10697520 | 12085 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 530 | 10 | 2 | 6 | 4.9 | CCCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL1184086 | 12085 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 530 | 10 | 2 | 6 | 4.9 | CCCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
CHEMBL331936 | 12085 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 530 | 10 | 2 | 6 | 4.9 | CCCC(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1 | 10.1021/jm990171i | ||
10530156 | 9525 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 526 | 14 | 1 | 6 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(OC)cc2OC)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL112347 | 9525 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 526 | 14 | 1 | 6 | 5.0 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc(OC)cc2OC)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
44295206 | 14761 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 580 | 12 | 1 | 11 | 4.7 | COc1cc(C/C(C(=O)c2cc(OC)c(OC)c(OC)c2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206728 | 14761 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 580 | 12 | 1 | 11 | 4.7 | COc1cc(C/C(C(=O)c2cc(OC)c(OC)c(OC)c2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL301577 | 14761 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 580 | 12 | 1 | 11 | 4.7 | COc1cc(C/C(C(=O)c2cc(OC)c(OC)c(OC)c2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
11059349 | 203486 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 446 | 6 | 1 | 6 | 4.8 | CCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm031041j | ||
CHEMBL66264 | 203486 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 446 | 6 | 1 | 6 | 4.8 | CCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm031041j | ||
15453178 | 104726 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 348 | 4 | 1 | 4 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1Cl | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL310739 | 104726 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 348 | 4 | 1 | 4 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1Cl | 10.1016/0960-894X(96)00441-6 | ||
11059349 | 203486 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 446 | 6 | 1 | 6 | 4.8 | CCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL66264 | 203486 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 446 | 6 | 1 | 6 | 4.8 | CCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
44314610 | 102829 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 671 | 12 | 6 | 5 | 3.9 | CC(C)CC(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)N[C@H](Cc1c(Br)[nH]c2ccccc12)C(=O)NC(Cc1c[nH]cn1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL305650 | 102829 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 671 | 12 | 6 | 5 | 3.9 | CC(C)CC(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)N[C@H](Cc1c(Br)[nH]c2ccccc12)C(=O)NC(Cc1c[nH]cn1)C(=O)O | 10.1021/jm9600914 | ||
44314619 | 204663 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 631 | 12 | 5 | 4 | 4.5 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL73925 | 204663 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 631 | 12 | 5 | 4 | 4.5 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
71451529 | 81664 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 632 | 14 | 2 | 12 | 3.4 | CCCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163719 | 81664 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 632 | 14 | 2 | 12 | 3.4 | CCCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
10504920 | 163086 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 480 | 6 | 2 | 9 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CC#N)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL417719 | 163086 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 480 | 6 | 2 | 9 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CC#N)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL284250 | 210837 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | None | None | None | CCCC[C@H](NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)[C@@H](NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1016/0960-894X(95)00237-N | ||||
10579100 | 166317 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 | 10.1021/jm031041j | ||
CHEMBL122614 | 166317 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 | 10.1021/jm031041j | ||
CHEMBL427303 | 166317 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 | 10.1021/jm031041j | ||
10579100 | 166317 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL122614 | 166317 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL427303 | 166317 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 578 | 10 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(Cc2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
10695363 | 5222 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 462 | 6 | 1 | 7 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(SC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10636 | 5222 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 462 | 6 | 1 | 7 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(SC)cc2)cc1 | 10.1021/jm9606507 | ||
73669820 | 117602 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 462 | 10 | 1 | 7 | 5.5 | CC(=O)c1ccc(OCc2ccc3nsnc3c2)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
CHEMBL3400989 | 117602 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 462 | 10 | 1 | 7 | 5.5 | CC(=O)c1ccc(OCc2ccc3nsnc3c2)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
44380952 | 27457 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 679 | 10 | 1 | 9 | 7.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(-c3cccs3)nc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL136871 | 27457 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 679 | 10 | 1 | 9 | 7.3 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(-c3cccs3)nc2OCCOc2ncc(Br)cn2)cc1 | 10.1016/s0960-894x(01)00682-5 | ||
44291897 | 101266 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 482 | 7 | 2 | 9 | 3.6 | COc1cc(C#N)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(OC)c1 | 10.1021/jm9608366 | ||
CHEMBL296456 | 101266 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 482 | 7 | 2 | 9 | 3.6 | COc1cc(C#N)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(OC)c1 | 10.1021/jm9608366 | ||
9956918 | 170859 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 482 | 7 | 2 | 9 | 3.6 | COc1cc(C#N)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1OC | 10.1021/jm9700068 | ||
CHEMBL44544 | 170859 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 482 | 7 | 2 | 9 | 3.6 | COc1cc(C#N)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1OC | 10.1021/jm9700068 | ||
44279172 | 108625 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 532 | 10 | 2 | 6 | 4.6 | CCCCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL32075 | 108625 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 532 | 10 | 2 | 6 | 4.6 | CCCCCNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
10022121 | 101802 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 371 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCC4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL30032 | 101802 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 371 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N4CCCC4)cccc23)c1C | 10.1021/jm00008a013 | ||
9957225 | 5233 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 490 | 8 | 0 | 8 | 4.7 | COc1ccc(C2OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10644 | 5233 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 490 | 8 | 0 | 8 | 4.7 | COc1ccc(C2OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
18738880 | 168150 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 561 | 8 | 2 | 7 | 4.5 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)NC)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL433221 | 168150 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 561 | 8 | 2 | 7 | 4.5 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)NC)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
10738157 | 59222 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2cccnc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL170348 | 59222 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2cccnc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10714797 | 120691 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 380 | 7 | 1 | 6 | 4.1 | Cc1ccccc1C(Oc1cc(OCc2cncs2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL354740 | 120691 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 380 | 7 | 1 | 6 | 4.1 | Cc1ccccc1C(Oc1cc(OCc2cncs2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10622380 | 101428 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 426 | 7 | 1 | 7 | 3.9 | COc1cccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c1 | 10.1021/jm9700068 | ||
CHEMBL297679 | 101428 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 426 | 7 | 1 | 7 | 3.9 | COc1cccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c1 | 10.1021/jm9700068 | ||
CHEMBL2369736 | 209641 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N(C)[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||||
CHEMBL65559 | 215838 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
9850566 | 4163 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 551 | 8 | 1 | 8 | 6.1 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OCc1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10016 | 4163 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 551 | 8 | 1 | 8 | 6.1 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OCc1ccccc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL342615 | 211652 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CS(=O)(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44311527 | 204100 | 0 | None | - | 1 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 675 | 12 | 2 | 11 | 7.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2cccs2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70365 | 204100 | 0 | None | - | 1 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 675 | 12 | 2 | 11 | 7.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2cccs2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL148751 | 208761 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CN(Cc1ccccc1)C(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
10836474 | 61750 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 432 | 9 | 1 | 5 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc(OC)cc2OC)cc1 | 10.1021/jm031041j | ||
CHEMBL177287 | 61750 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 432 | 9 | 1 | 5 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc(OC)cc2OC)cc1 | 10.1021/jm031041j | ||
10788853 | 6078 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc(OC)cc3OC)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10808 | 6078 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc(OC)cc3OC)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10717504 | 98485 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 430 | 6 | 0 | 6 | 4.5 | COc1ccc(C2(OC)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL276173 | 98485 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 430 | 6 | 0 | 6 | 4.5 | COc1ccc(C2(OC)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10717504 | 98485 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 430 | 6 | 0 | 6 | 4.5 | COc1ccc(C2(OC)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL276173 | 98485 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 430 | 6 | 0 | 6 | 4.5 | COc1ccc(C2(OC)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
10522605 | 206755 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 361 | 6 | 1 | 4 | 5.0 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1C#N)CO | 10.1021/jm970847e | ||
CHEMBL90191 | 206755 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 361 | 6 | 1 | 4 | 5.0 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1C#N)CO | 10.1021/jm970847e | ||
10595639 | 207048 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 375 | 6 | 1 | 4 | 5.1 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1C#N)C(=O)O | 10.1021/jm970847e | ||
CHEMBL91810 | 207048 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 375 | 6 | 1 | 4 | 5.1 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1C#N)C(=O)O | 10.1021/jm970847e | ||
10697377 | 61057 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 523 | 10 | 4 | 6 | 4.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL176513 | 61057 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 523 | 10 | 4 | 6 | 4.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL3349461 | 211386 | 0 | None | - | 0 | Pig | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00089a028 | ||||
18617366 | 167812 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 394 | 3 | 1 | 4 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc(Br)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL430822 | 167812 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 394 | 3 | 1 | 4 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc(Br)cc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44314864 | 103009 | 0 | None | - | 0 | Pig | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 566 | 11 | 5 | 5 | 3.4 | CCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL307077 | 103009 | 0 | None | - | 0 | Pig | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 566 | 11 | 5 | 5 | 3.4 | CCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
10788691 | 206740 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 428 | 6 | 1 | 3 | 6.0 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1Br)C(=O)O | 10.1021/jm970847e | ||
CHEMBL90094 | 206740 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 428 | 6 | 1 | 3 | 6.0 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1Br)C(=O)O | 10.1021/jm970847e | ||
127035544 | 136335 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 721 | 14 | 2 | 9 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3cc(OC)ccc3OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3734870 | 136335 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 721 | 14 | 2 | 9 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3cc(OC)ccc3OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
10549875 | 59770 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2cccc3c2OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL172691 | 59770 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2cccc3c2OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL2367550 | 209561 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||||
10506524 | 61150 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 536 | 9 | 4 | 5 | 4.2 | CNC(=O)c1nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)oc1C | 10.1021/jm950592+ | ||
CHEMBL176565 | 61150 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 536 | 9 | 4 | 5 | 4.2 | CNC(=O)c1nc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)oc1C | 10.1021/jm950592+ | ||
10743900 | 127781 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 497 | 11 | 4 | 5 | 4.0 | CCN(CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C)o1 | 10.1021/jm950592+ | ||
CHEMBL366387 | 127781 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 497 | 11 | 4 | 5 | 4.0 | CCN(CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C)o1 | 10.1021/jm950592+ | ||
CHEMBL432683 | 213611 | 0 | None | - | 0 | Pig | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44368396 | 44562 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 506 | 8 | 2 | 5 | 4.9 | COc1ccc(C(=O)N(Cc2cc3c(cc2Cl)OCO3)C(Cc2c[nH]c3ccccc23)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152017 | 44562 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 506 | 8 | 2 | 5 | 4.9 | COc1ccc(C(=O)N(Cc2cc3c(cc2Cl)OCO3)C(Cc2c[nH]c3ccccc23)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
95285 | 97244 | 37 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 256 | 3 | 2 | 5 | 1.7 | O=S(=O)(Nc1nccs1)c1ccc(O)cc1 | 10.1021/jm00008a013 | ||
CHEMBL26894 | 97244 | 37 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 256 | 3 | 2 | 5 | 1.7 | O=S(=O)(Nc1nccs1)c1ccc(O)cc1 | 10.1021/jm00008a013 | ||
CHEMBL1791272 | 208894 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)[C@H](C)CC)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00152-J | ||||
10027408 | 97116 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 463 | 10 | 2 | 5 | 6.1 | Cc1noc(NS(=O)(=O)c2cccc3c(NCCCCCc4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL26786 | 97116 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 463 | 10 | 2 | 5 | 6.1 | Cc1noc(NS(=O)(=O)c2cccc3c(NCCCCCc4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
23445410 | 106117 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 412 | 4 | 1 | 5 | 4.6 | Cc1ccccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL313551 | 106117 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 412 | 4 | 1 | 5 | 4.6 | Cc1ccccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
23445379 | 130073 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 456 | 6 | 1 | 6 | 4.8 | Cc1ccc(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL367776 | 130073 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 456 | 6 | 1 | 6 | 4.8 | Cc1ccc(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
44459299 | 89578 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 520 | 7 | 3 | 6 | 4.4 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2c[nH]c3cc(C(=O)O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL23752 | 89578 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 520 | 7 | 3 | 6 | 4.4 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2c[nH]c3cc(C(=O)O)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
44293754 | 101938 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 531 | 9 | 2 | 10 | 3.5 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(c1nn[nH]n1)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL301371 | 101938 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 531 | 9 | 2 | 10 | 3.5 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(c1nn[nH]n1)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10552051 | 101144 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 463 | 6 | 2 | 9 | 3.3 | CC(=O)c1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C)OCO2 | 10.1021/jm9608366 | ||
CHEMBL295583 | 101144 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 463 | 6 | 2 | 9 | 3.3 | CC(=O)c1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C)OCO2 | 10.1021/jm9608366 | ||
18704821 | 99793 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 419 | 5 | 1 | 5 | 3.7 | COc1nc(Br)cnc1NS(=O)(=O)c1ccccc1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL285512 | 99793 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 419 | 5 | 1 | 5 | 3.7 | COc1nc(Br)cnc1NS(=O)(=O)c1ccccc1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
44279367 | 99726 | 0 | None | - | 0 | Pig | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 485 | 11 | 5 | 4 | 2.0 | CC(C)C[C@H](NC(=O)N1CCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL285031 | 99726 | 0 | None | - | 0 | Pig | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 485 | 11 | 5 | 4 | 2.0 | CC(C)C[C@H](NC(=O)N1CCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10575356 | 9677 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 446 | 8 | 1 | 4 | 3.7 | CCCN(C)C(=O)CN1C[C@H](c2ccc(F)c(F)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL113184 | 9677 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 446 | 8 | 1 | 4 | 3.7 | CCCN(C)C(=O)CN1C[C@H](c2ccc(F)c(F)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10551532 | 110557 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 450 | 8 | 1 | 4 | 3.9 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)CCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL325444 | 110557 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 450 | 8 | 1 | 4 | 3.9 | CCCN(C)C(=O)CN1C[C@H](c2ccc3c(c2)CCC3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
127035219 | 136333 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 677 | 12 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3734849 | 136333 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 677 | 12 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44293719 | 96627 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 581 | 12 | 2 | 10 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1cc(OC)c(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL263723 | 96627 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 581 | 12 | 2 | 10 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1cc(OC)c(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
11800505 | 62205 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 536 | 11 | 3 | 6 | 5.1 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@@H](CC(=O)NC2CCCCC2)CC(C)C)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL177839 | 62205 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 536 | 11 | 3 | 6 | 5.1 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@@H](CC(=O)NC2CCCCC2)CC(C)C)nc1C(=O)O | 10.1021/jm9505932 | ||
10570511 | 207086 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 360 | 6 | 1 | 4 | 4.2 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(N)=O)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL92092 | 207086 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 360 | 6 | 1 | 4 | 4.2 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(N)=O)c1ccccc1 | 10.1021/jm970847e | ||
44276577 | 106830 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 459 | 7 | 1 | 7 | 4.1 | COc1cccc(Cn2[nH]c(-c3ccc([N+](=O)[O-])cc3)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144850 | 106830 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 459 | 7 | 1 | 7 | 4.1 | COc1cccc(Cn2[nH]c(-c3ccc([N+](=O)[O-])cc3)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10357554 | 97536 | 1 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL27065 | 97536 | 1 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1021/jm00004a012 | ||
44368539 | 45144 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 475 | 9 | 2 | 6 | 3.9 | COc1cccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2ccc(O)cc2)C(=O)O)c1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152552 | 45144 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 475 | 9 | 2 | 6 | 3.9 | COc1cccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2ccc(O)cc2)C(=O)O)c1 | 10.1016/s0960-894x(01)00009-9 | ||
10476286 | 96399 | 0 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 403 | 6 | 1 | 7 | 3.2 | CCOC(=O)c1c(C)noc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL26206 | 96399 | 0 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 403 | 6 | 1 | 7 | 3.2 | CCOC(=O)c1c(C)noc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm00008a013 | ||
127037496 | 136378 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 613 | 12 | 2 | 7 | 6.9 | CCCCNC(=O)c1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4S(=O)(=O)Nc4onc(C)c4C)cc3)c2c1 | 10.1039/C4MD00499J | ||
CHEMBL3735311 | 136378 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 613 | 12 | 2 | 7 | 6.9 | CCCCNC(=O)c1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4S(=O)(=O)Nc4onc(C)c4C)cc3)c2c1 | 10.1039/C4MD00499J | ||
22998508 | 206909 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 412 | 4 | 1 | 5 | 4.6 | Cc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL91073 | 206909 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 412 | 4 | 1 | 5 | 4.6 | Cc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
10020445 | 101341 | 0 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N(C)C)c3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL29705 | 101341 | 0 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N(C)C)c3c2)c1C | 10.1021/jm00008a013 | ||
10020445 | 101341 | 0 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N(C)C)c3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL29705 | 101341 | 0 | None | - | 0 | Rat | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N(C)C)c3c2)c1C | 10.1021/jm00004a012 | ||
10645779 | 97140 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 419 | 4 | 1 | 4 | 4.2 | Cc1cc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL268116 | 97140 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 419 | 4 | 1 | 4 | 4.2 | Cc1cc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
10832243 | 203480 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 358 | 5 | 1 | 6 | 2.5 | COc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1 | 10.1021/jm9604585 | ||
CHEMBL6624 | 203480 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 358 | 5 | 1 | 6 | 2.5 | COc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1 | 10.1021/jm9604585 | ||
10692649 | 203083 | 1 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 404 | 4 | 1 | 3 | 4.5 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)cc3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6400 | 203083 | 1 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 404 | 4 | 1 | 3 | 4.5 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)cc3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL293874 | 210869 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)CN(C)C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00089a028 | ||||
18738879 | 90204 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 548 | 8 | 2 | 7 | 4.8 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL23833 | 90204 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 548 | 8 | 2 | 7 | 4.8 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
18738879 | 90204 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 548 | 8 | 2 | 7 | 4.8 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)O)cc21 | 10.1007/s00044-004-0021-y | ||
CHEMBL23833 | 90204 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 548 | 8 | 2 | 7 | 4.8 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)O)cc21 | 10.1007/s00044-004-0021-y | ||
10548486 | 174092 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 391 | 5 | 2 | 6 | 3.7 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm9608366 | ||
CHEMBL45456 | 174092 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 391 | 5 | 2 | 6 | 3.7 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm9608366 | ||
44327661 | 164566 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 483 | 5 | 1 | 8 | 2.7 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL421563 | 164566 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 483 | 5 | 1 | 8 | 2.7 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44327226 | 207892 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 497 | 7 | 1 | 8 | 3.1 | CCc1cc(C)nn(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c1=O | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL96762 | 207892 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 497 | 7 | 1 | 8 | 3.1 | CCc1cc(C)nn(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c1=O | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL132542 | 208680 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)CN(C)C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10647372 | 207094 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 454 | 8 | 1 | 6 | 3.1 | CCN(CC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9212 | 207094 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 454 | 8 | 1 | 6 | 3.1 | CCN(CC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL329609 | 211295 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(N)=O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10665805 | 98150 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 354 | 4 | 1 | 6 | 3.0 | CCC1=C(c2ccc3c(c2)OCO3)C(=O)OC1(O)c1ccc(OC)cc1 | 10.1021/jm9606507 | ||
CHEMBL273951 | 98150 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 354 | 4 | 1 | 6 | 3.0 | CCC1=C(c2ccc3c(c2)OCO3)C(=O)OC1(O)c1ccc(OC)cc1 | 10.1021/jm9606507 | ||
44298381 | 195881 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 476 | 9 | 2 | 7 | 4.9 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL55909 | 195881 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 476 | 9 | 2 | 7 | 4.9 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
44279408 | 104634 | 0 | None | - | 0 | Pig | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 521 | 13 | 6 | 4 | 2.7 | CC(C)C[C@H](NC(=O)NCc1ccccc1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31051 | 104634 | 0 | None | - | 0 | Pig | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 521 | 13 | 6 | 4 | 2.7 | CC(C)C[C@H](NC(=O)NCc1ccccc1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44327868 | 111417 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 906 | 24 | 9 | 8 | 3.9 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC12CC3CC(CC(C3)C1)C2)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL327523 | 111417 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 906 | 24 | 9 | 8 | 3.9 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC12CC3CC(CC(C3)C1)C2)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL2369713 | 209632 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00152-J | ||||
CHEMBL1793934 | 208909 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)N(C)C(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@@H](C)CC)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm970161m | ||||
44327399 | 161519 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 539 | 7 | 1 | 8 | 4.2 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)N2N=C(c3cccs3)CCC2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL412865 | 161519 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 539 | 7 | 1 | 8 | 4.2 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)N2N=C(c3cccs3)CCC2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
44327734 | 208077 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 561 | 8 | 1 | 9 | 3.9 | COc1ccc(-c2ccc(=O)n(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)n2)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL97851 | 208077 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 561 | 8 | 1 | 9 | 3.9 | COc1ccc(-c2ccc(=O)n(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)n2)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL282340 | 210828 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)[C@H](N)C(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](CC(=O)O)C(=O)O | 10.1016/0960-894X(95)00221-E | ||||
44284506 | 167935 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 596 | 14 | 4 | 4 | 4.6 | CC(C)C[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)N(C)C(=O)[C@@H](CC(C)C)NC(=O)Cc1ccccc1Cl)C(=O)O | 10.1021/jm00087a001 | ||
CHEMBL431699 | 167935 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 596 | 14 | 4 | 4 | 4.6 | CC(C)C[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)N(C)C(=O)[C@@H](CC(C)C)NC(=O)Cc1ccccc1Cl)C(=O)O | 10.1021/jm00087a001 | ||
10555806 | 12090 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 616 | 12 | 2 | 7 | 6.0 | CC(C)OCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL1184095 | 12090 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 616 | 12 | 2 | 7 | 6.0 | CC(C)OCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL332289 | 12090 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 616 | 12 | 2 | 7 | 6.0 | CC(C)OCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
23445505 | 203534 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 412 | 5 | 1 | 7 | 4.0 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL66641 | 203534 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 412 | 5 | 1 | 7 | 4.0 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1016/S0960-894X(97)00367-3 | ||
44314676 | 102897 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 589 | 12 | 5 | 4 | 4.6 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL306171 | 102897 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 589 | 12 | 5 | 4 | 4.6 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
10577388 | 15547 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cc(C)ccc2C)cc1 | 10.1021/jm990170q | ||
CHEMBL122111 | 15547 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2cc(C)ccc2C)cc1 | 10.1021/jm990170q | ||
10625270 | 113348 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(C)cccc2C)cc1 | 10.1021/jm990170q | ||
CHEMBL331767 | 113348 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(C)cccc2C)cc1 | 10.1021/jm990170q | ||
70240112 | 171579 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 626 | 10 | 2 | 11 | 5.0 | CC#CCOc1nc(-c2ccnc(-c3nnn[nH]3)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4465332 | 171579 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 626 | 10 | 2 | 11 | 5.0 | CC#CCOc1nc(-c2ccnc(-c3nnn[nH]3)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
44310016 | 203816 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 489 | 6 | 1 | 9 | 4.8 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4nsnc4c3)c2cc1OC | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL68557 | 203816 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 489 | 6 | 1 | 9 | 4.8 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4nsnc4c3)c2cc1OC | 10.1016/s0960-894x(97)10151-2 | ||
44386143 | 130666 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 571 | 9 | 3 | 6 | 5.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368360 | 130666 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 571 | 9 | 3 | 6 | 5.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
44310016 | 203816 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 489 | 6 | 1 | 9 | 4.8 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4nsnc4c3)c2cc1OC | 10.1021/jm0300429 | ||
CHEMBL68557 | 203816 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 489 | 6 | 1 | 9 | 4.8 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4nsnc4c3)c2cc1OC | 10.1021/jm0300429 | ||
CHEMBL422285 | 213262 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CCC[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44279312 | 107298 | 0 | None | - | 0 | Pig | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 565 | 12 | 6 | 4 | 3.5 | CC(C)C[C@H](NC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31746 | 107298 | 0 | None | - | 0 | Pig | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 565 | 12 | 6 | 4 | 3.5 | CC(C)C[C@H](NC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44305079 | 102064 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL302189 | 102064 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 354 | 4 | 1 | 5 | 3.8 | CC(C)Oc1ccc2c(c1)C=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
44293813 | 184085 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 581 | 12 | 2 | 10 | 3.9 | CCOc1ccc2c(c1)[C@H](c1cc(OC)c(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL48261 | 184085 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 581 | 12 | 2 | 10 | 3.9 | CCOc1ccc2c(c1)[C@H](c1cc(OC)c(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
44270523 | 48586 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 724 | 14 | 1 | 9 | 8.0 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL15573 | 48586 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 724 | 14 | 1 | 9 | 8.0 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL404763 | 212509 | 0 | None | - | 0 | Pig | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)C(C)(C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44293716 | 101389 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 433 | 6 | 1 | 6 | 4.0 | COc1ccc([C@@H]2c3cc(OC)ccc3[C@@H](c3ccc4c(c3)OCO4)N2CC(=O)O)cc1 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL297353 | 101389 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 433 | 6 | 1 | 6 | 4.0 | COc1ccc([C@@H]2c3cc(OC)ccc3[C@@H](c3ccc4c(c3)OCO4)N2CC(=O)O)cc1 | 10.1016/s0960-894x(01)00273-6 | ||
18936171 | 196483 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 489 | 7 | 1 | 8 | 4.2 | COc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc3c(c2)OCO3)c2c(OC)c(OC)ccc21 | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL56348 | 196483 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 489 | 7 | 1 | 8 | 4.2 | COc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc3c(c2)OCO3)c2c(OC)c(OC)ccc21 | 10.1016/S0960-894X(97)00319-3 | ||
44332546 | 107186 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 491 | 5 | 0 | 7 | 5.7 | O=C(OCc1ccc2c(c1)OCO2)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL316648 | 107186 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 491 | 5 | 0 | 7 | 5.7 | O=C(OCc1ccc2c(c1)OCO2)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
44322947 | 206678 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 428 | 5 | 1 | 6 | 4.3 | COc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL89689 | 206678 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 428 | 5 | 1 | 6 | 4.3 | COc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
10067069 | 99458 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 360 | 4 | 1 | 6 | 3.0 | COC(=O)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL283195 | 99458 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 360 | 4 | 1 | 6 | 3.0 | COC(=O)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
44385805 | 61266 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 532 | 10 | 1 | 10 | 4.1 | C#CCOc1nc(-c2cnccn2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176698 | 61266 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 532 | 10 | 1 | 10 | 4.1 | C#CCOc1nc(-c2cnccn2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10230375 | 129623 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 534 | 9 | 2 | 11 | 2.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367317 | 129623 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 534 | 9 | 2 | 11 | 2.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
44384557 | 131364 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 504 | 9 | 1 | 10 | 3.3 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL369003 | 131364 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 504 | 9 | 1 | 10 | 3.3 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
23445547 | 112315 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2cc(-c3ccccc3)cs2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL329375 | 112315 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2cc(-c3ccccc3)cs2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL303204 | 210895 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](C)N(C)C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00089a028 | ||||
22467219 | 85319 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 492 | 6 | 2 | 7 | 3.3 | Cc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(CO)ccc23)cc1 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261362 | 85319 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 492 | 6 | 2 | 7 | 3.3 | Cc1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(CO)ccc23)cc1 | 10.1007/s00044-004-0021-y | ||
44320461 | 106322 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 514 | 6 | 1 | 5 | 6.6 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1Cc1ccc(Cl)c(Cl)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL313920 | 106322 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 514 | 6 | 1 | 5 | 6.6 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1Cc1ccc(Cl)c(Cl)c1 | 10.1016/s0960-894x(00)00513-8 | ||
10457385 | 112661 | 0 | None | - | 1 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 469 | 6 | 1 | 8 | 2.5 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL330424 | 112661 | 0 | None | - | 1 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 469 | 6 | 1 | 8 | 2.5 | Cc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL263537 | 210550 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)N(C)C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10670664 | 207294 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 438 | 8 | 2 | 6 | 2.6 | C=CCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9342 | 207294 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 438 | 8 | 2 | 6 | 2.6 | C=CCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10792636 | 168491 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.4 | CCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(CC)cccc2CC)cc1 | 10.1021/jm990170q | ||
CHEMBL435385 | 168491 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.4 | CCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(CC)cccc2CC)cc1 | 10.1021/jm990170q | ||
44327423 | 207518 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 483 | 6 | 1 | 8 | 2.8 | Cc1cc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)nc1C | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94720 | 207518 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 483 | 6 | 1 | 8 | 2.8 | Cc1cc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)nc1C | 10.1016/S0960-894X(96)00617-8 | ||
9998563 | 96816 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)c2ccccc12 | 10.1021/jm00008a013 | ||
CHEMBL26527 | 96816 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)c2ccccc12 | 10.1021/jm00008a013 | ||
10895198 | 100927 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 426 | 9 | 1 | 6 | 5.0 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2cccc(OCCC)c21 | 10.1021/jm010382z | ||
CHEMBL294123 | 100927 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 426 | 9 | 1 | 6 | 5.0 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2cccc(OCCC)c21 | 10.1021/jm010382z | ||
44298612 | 195502 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 281 | 4 | 2 | 5 | 1.9 | CCc1c(NS(=O)(=O)c2ccc(N)cc2)noc1C | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL55405 | 195502 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 281 | 4 | 2 | 5 | 1.9 | CCc1c(NS(=O)(=O)c2ccc(N)cc2)noc1C | 10.1016/s0960-894x(00)00366-8 | ||
9998563 | 96816 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)c2ccccc12 | 10.1021/jm00004a012 | ||
CHEMBL26527 | 96816 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)c2ccccc12 | 10.1021/jm00004a012 | ||
44332638 | 4344 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 477 | 6 | 0 | 6 | 6.0 | COc1ccc(COC(=O)C(c2ccc3c(c2)OCO3)c2c3ccccc3nc3ccccc23)cc1 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL101239 | 4344 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 477 | 6 | 0 | 6 | 6.0 | COc1ccc(COC(=O)C(c2ccc3c(c2)OCO3)c2c3ccccc3nc3ccccc23)cc1 | 10.1016/S0960-894X(96)00551-3 | ||
137643691 | 158234 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 569 | 10 | 2 | 7 | 5.5 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4088634 | 158234 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 569 | 10 | 2 | 7 | 5.5 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC4CCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
23445538 | 60041 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 456 | 6 | 1 | 6 | 4.8 | Cc1ccc(OCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL173805 | 60041 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 456 | 6 | 1 | 6 | 4.8 | Cc1ccc(OCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
23445272 | 127724 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 440 | 6 | 1 | 5 | 4.7 | Cc1ccc(CCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL366364 | 127724 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 440 | 6 | 1 | 5 | 4.7 | Cc1ccc(CCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
10615322 | 203395 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 316 | 4 | 1 | 7 | 1.9 | COC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL65639 | 203395 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 316 | 4 | 1 | 7 | 1.9 | COC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/S0960-894X(97)00367-3 | ||
11762081 | 203296 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 446 | 7 | 1 | 5 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL64851 | 203296 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 446 | 7 | 1 | 5 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL307324 | 210956 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CC(=O)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](C(C)C)C(=O)N1C | 10.1021/jm00089a028 | ||||
CHEMBL319719 | 211198 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10503067 | 8138 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 436 | 5 | 1 | 6 | 4.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2CC2CCCCCC2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10919 | 8138 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 436 | 5 | 1 | 6 | 4.9 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2CC2CCCCCC2)cc1 | 10.1021/jm9606507 | ||
11762081 | 203296 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 446 | 7 | 1 | 5 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64851 | 203296 | 0 | None | - | 0 | Rat | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 446 | 7 | 1 | 5 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)cc3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
155519245 | 170320 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 592 | 10 | 2 | 10 | 4.2 | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(N3CCOCC3)nc2OCCO)c1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4447261 | 170320 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 592 | 10 | 2 | 10 | 4.2 | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)nc(N3CCOCC3)nc2OCCO)c1 | 10.1016/j.bmcl.2016.06.014 | ||
22467240 | 99159 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 558 | 7 | 2 | 9 | 3.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(-c4nn[nH]n4)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL281378 | 99159 | 0 | None | - | 0 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 558 | 7 | 2 | 9 | 3.8 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(-c4nn[nH]n4)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
10305334 | 129021 | 0 | None | - | 1 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 680 | 12 | 2 | 11 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367036 | 129021 | 0 | None | - | 1 | Human | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | 680 | 12 | 2 | 11 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccc1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL138120 | 208728 | 0 | None | - | 0 | Pig | 7.5 | pIC50 | = | 7.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CC(=O)O)C(=O)N2CCC[C@@H]2C(=O)N[C@@H](C(C)C)C(=O)N1C | 10.1021/jm00021a021 | ||||
11133491 | 102142 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 416 | 3 | 1 | 6 | 4.2 | O=C(O)C1=C(c2ccc3c(c2)OCO3)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
CHEMBL302659 | 102142 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 416 | 3 | 1 | 6 | 4.2 | O=C(O)C1=C(c2ccc3c(c2)OCO3)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
10950843 | 202929 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1cccc(OC)c1)O2 | 10.1021/jm010382z | ||
CHEMBL62951 | 202929 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1cccc(OC)c1)O2 | 10.1021/jm010382z | ||
44279370 | 107179 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 426 | 4 | 2 | 3 | 4.7 | CCc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL31662 | 107179 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 426 | 4 | 2 | 3 | 4.7 | CCc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL1790451 | 208866 | 0 | None | - | 0 | Pig | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | None | None | None | CC(=O)N[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(C)C)[C@H](C)O)C1c2ccccc2CCc2ccccc21 | 10.1016/0960-894X(95)00349-X | ||||
10790376 | 166885 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 466 | 6 | 1 | 6 | 3.3 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N2CCCCC2)cc1 | 10.1021/jm9505369 | ||
CHEMBL428644 | 166885 | 0 | None | - | 0 | Rat | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 466 | 6 | 1 | 6 | 3.3 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N2CCCCC2)cc1 | 10.1021/jm9505369 | ||
44266655 | 5011 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 445 | 5 | 1 | 7 | 4.5 | COc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10523 | 5011 | 0 | None | - | 0 | Human | 6.5 | pIC50 | = | 6.5 | Binding | ChEMBL | 445 | 5 | 1 | 7 | 4.5 | COc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
44371420 | 50880 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cccc(OC)c3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL157763 | 50880 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3cccc(OC)c3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
10425958 | 99925 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc(N)c3ccccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL286406 | 99925 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc(N)c3ccccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL438194 | 213730 | 14 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
44327881 | 161651 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 1044 | 26 | 9 | 8 | 6.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL413179 | 161651 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 1044 | 26 | 9 | 8 | 6.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
44298613 | 195504 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 287 | 3 | 2 | 5 | 2.0 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1Cl | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL55406 | 195504 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 287 | 3 | 2 | 5 | 2.0 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1Cl | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL438768 | 213773 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
44277387 | 106823 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 450 | 7 | 2 | 6 | 3.0 | O=C(O)COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144800 | 106823 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 450 | 7 | 2 | 6 | 3.0 | O=C(O)COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10425958 | 99925 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc(N)c3ccccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL286406 | 99925 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc(N)c3ccccc23)c1C | 10.1021/jm00004a012 | ||
44266645 | 207734 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 417 | 5 | 1 | 6 | 4.7 | COc1ccc(-n2c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3cc(OC)ccc32)cc1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL9588 | 207734 | 0 | None | - | 0 | Human | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 417 | 5 | 1 | 6 | 4.7 | COc1ccc(-n2c(C(=O)O)c(-c3ccc4c(c3)OCO4)c3cc(OC)ccc32)cc1 | 10.1016/0960-894X(96)00170-9 | ||
127034918 | 136433 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 599 | 11 | 2 | 7 | 6.6 | CCCNC(=O)c1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4S(=O)(=O)Nc4onc(C)c4C)cc3)c2c1 | 10.1039/C4MD00499J | ||
CHEMBL3735797 | 136433 | 0 | None | - | 0 | Human | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | 599 | 11 | 2 | 7 | 6.6 | CCCNC(=O)c1cc(C)c2nc(CCC)n(Cc3ccc(-c4ccccc4S(=O)(=O)Nc4onc(C)c4C)cc3)c2c1 | 10.1039/C4MD00499J | ||
CHEMBL263025 | 210535 | 0 | None | - | 0 | Pig | 4.5 | pIC50 | = | 4.5 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)CNC(=O)[C@@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44386523 | 132557 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 621 | 10 | 4 | 6 | 5.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2c(F)c(F)c(F)c(F)c2F)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL369874 | 132557 | 0 | None | - | 0 | Rat | 5.5 | pIC50 | = | 5.5 | Binding | ChEMBL | 621 | 10 | 4 | 6 | 5.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2c(F)c(F)c(F)c(F)c2F)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL421190 | 213246 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
CHEMBL2304009 | 209442 | 0 | None | - | 0 | Pig | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Br)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
CHEMBL87243 | 215870 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00070a001 | ||||
44327347 | 96734 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 1102 | 26 | 9 | 8 | 7.1 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C1c2ccccc2CCc2ccccc21)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL264579 | 96734 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 1102 | 26 | 9 | 8 | 7.1 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C1c2ccccc2CCc2ccccc21)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
44368516 | 44781 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 451 | 11 | 2 | 6 | 4.1 | COc1ccc(CN(Cc2cc(OC)cc(OC)c2)C(Cc2ccc(O)cc2)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152203 | 44781 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 451 | 11 | 2 | 6 | 4.1 | COc1ccc(CN(Cc2cc(OC)cc(OC)c2)C(Cc2ccc(O)cc2)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
10816835 | 61355 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 567 | 11 | 4 | 5 | 5.7 | CCCc1sc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL176992 | 61355 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 567 | 11 | 4 | 5 | 5.7 | CCCc1sc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
137652304 | 157202 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 544 | 10 | 3 | 8 | 3.7 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCCN)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4076290 | 157202 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 544 | 10 | 3 | 8 | 3.7 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCCN)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
22998446 | 106605 | 0 | None | - | 0 | Human | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2ccc(-c3ccccc3)s2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL314320 | 106605 | 0 | None | - | 0 | Human | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2ccc(-c3ccccc3)s2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
443289 | 708 | 47 | None | 2 | 3 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
997 | 708 | 47 | None | 2 | 3 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
CHEMBL314691 | 708 | 47 | None | 2 | 3 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
DB12054 | 708 | 47 | None | 2 | 3 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1007/s00044-013-0542-3 | ||||
11798762 | 206600 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 475 | 9 | 1 | 7 | 3.1 | CCCS(=O)(=O)CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL8911 | 206600 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 475 | 9 | 1 | 7 | 3.1 | CCCS(=O)(=O)CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10768346 | 131517 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 522 | 10 | 5 | 5 | 4.0 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL369202 | 131517 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 522 | 10 | 5 | 5 | 4.0 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
24997097 | 18441 | 3 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 501 | 7 | 3 | 7 | 4.0 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(O)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1272137 | 18441 | 3 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 501 | 7 | 3 | 7 | 4.0 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(O)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
44309445 | 102672 | 4 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 370 | 4 | 1 | 5 | 3.4 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc4c(c3)OCO4)cccc12 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL304761 | 102672 | 4 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 370 | 4 | 1 | 5 | 3.4 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc4c(c3)OCO4)cccc12 | 10.1016/s0960-894x(97)10151-2 | ||
10816963 | 113302 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 574 | 12 | 2 | 7 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC)cc1 | 10.1021/jm990170q | ||
CHEMBL331625 | 113302 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 574 | 12 | 2 | 7 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC)cc1 | 10.1021/jm990170q | ||
CHEMBL289687 | 210852 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
10602726 | 165762 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 549 | 10 | 4 | 5 | 5.1 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C2CC2)o1 | 10.1021/jm950591h | ||
CHEMBL424764 | 165762 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 549 | 10 | 4 | 5 | 5.1 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C2CC2)o1 | 10.1021/jm950591h | ||
44332623 | 4734 | 1 | None | - | 0 | Human | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 2.9 | Cc1cc(C(C(N)=O)c2ccc3c(c2)OCO3)c2ccccc2n1 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103886 | 4734 | 1 | None | - | 0 | Human | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 2.9 | Cc1cc(C(C(N)=O)c2ccc3c(c2)OCO3)c2ccccc2n1 | 10.1016/S0960-894X(96)00551-3 | ||
137655285 | 158953 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 568 | 10 | 3 | 10 | 3.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCCN)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4096211 | 158953 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 568 | 10 | 3 | 10 | 3.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCCN)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
44177614 | 129625 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 547 | 10 | 1 | 9 | 5.4 | C=CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367339 | 129625 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 547 | 10 | 1 | 9 | 5.4 | C=CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
22467229 | 98929 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 519 | 7 | 2 | 7 | 4.1 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(CN)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL279703 | 98929 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 519 | 7 | 2 | 7 | 4.1 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(CN)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
44385008 | 131335 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 574 | 10 | 2 | 9 | 4.9 | C#CCOc1nc(-c2ccnc(CO)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368829 | 131335 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 574 | 10 | 2 | 9 | 4.9 | C#CCOc1nc(-c2ccnc(CO)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
19010493 | 98328 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 543 | 11 | 1 | 7 | 6.5 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)O)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL275179 | 98328 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 543 | 11 | 1 | 7 | 6.5 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)O)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
42630532 | 18367 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 4.9 | C=CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1271479 | 18367 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 4.9 | C=CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
42630532 | 18367 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 4.9 | C=CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271479 | 18367 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 4.9 | C=CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
24997097 | 18441 | 3 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 501 | 7 | 3 | 7 | 4.0 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(O)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1272137 | 18441 | 3 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 501 | 7 | 3 | 7 | 4.0 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(O)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
10173807 | 50852 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 455 | 6 | 1 | 6 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL157742 | 50852 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 455 | 6 | 1 | 6 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
18995990 | 99328 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1cccc(Sc2c(C(=O)O)n(Cc3cc(OC)c4c(c3)OCO4)c3cc4c(cc23)OCO4)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL282426 | 99328 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1cccc(Sc2c(C(=O)O)n(Cc3cc(OC)c4c(c3)OCO4)c3cc4c(cc23)OCO4)c1 | 10.1016/0960-894X(96)00232-6 | ||
10160887 | 100120 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 447 | 5 | 1 | 7 | 5.0 | O=C(O)c1c(Sc2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28779 | 100120 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 447 | 5 | 1 | 7 | 5.0 | O=C(O)c1c(Sc2ccc3c(c2)OCO3)c2ccccc2n1Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL411797 | 212934 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
44298277 | 194976 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 474 | 9 | 1 | 7 | 5.1 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCC=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL54773 | 194976 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 474 | 9 | 1 | 7 | 5.1 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCC=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
10288713 | 102016 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 4.6 | CCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL301840 | 102016 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 4.6 | CCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)c(=O)n2Cc1ccccc1OC | 10.1016/S0960-894X(97)00319-3 | ||
CHEMBL62514 | 215821 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC(=O)N[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(C)C)C1c2ccccc2CCc2ccccc21 | 10.1016/0960-894X(95)00349-X | ||||
10383832 | 168155 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc2c1 | 10.1021/jm00008a013 | ||
CHEMBL433234 | 168155 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc2c1 | 10.1021/jm00008a013 | ||
10540843 | 85810 | 9 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 282 | 4 | 1 | 3 | 4.0 | Cc1c(C(=O)O)oc2cccc(OCc3ccccc3)c12 | 10.1007/s00044-013-0542-3 | ||
CHEMBL2296889 | 85810 | 9 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 282 | 4 | 1 | 3 | 4.0 | Cc1c(C(=O)O)oc2cccc(OCc3ccccc3)c12 | 10.1007/s00044-013-0542-3 | ||
CHEMBL408141 | 212680 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
18617407 | 204957 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76576 | 204957 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
44276886 | 106806 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 410 | 4 | 1 | 4 | 4.2 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1ccccc1Cl | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144600 | 106806 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 410 | 4 | 1 | 4 | 4.2 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1ccccc1Cl | 10.1016/s0960-894x(00)00232-8 | ||
44277368 | 106818 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 480 | 8 | 2 | 7 | 3.0 | COc1ccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c(OCC(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144733 | 106818 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 480 | 8 | 2 | 7 | 3.0 | COc1ccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2=O)c(OCC(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10070783 | 97027 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL267094 | 97027 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
10383832 | 168155 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc2c1 | 10.1021/jm00004a012 | ||
CHEMBL433234 | 168155 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cc(S(=O)(=O)Nc3onc(C)c3C)ccc2c1 | 10.1021/jm00004a012 | ||
44368482 | 44654 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 523 | 8 | 2 | 7 | 4.2 | O=C(O)C(Cc1ccc(O)cc1)N(Cc1cc2c(cc1Cl)OCO2)C(=O)/C=C/c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152091 | 44654 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 523 | 8 | 2 | 7 | 4.2 | O=C(O)C(Cc1ccc(O)cc1)N(Cc1cc2c(cc1Cl)OCO2)C(=O)/C=C/c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
4550514 | 97176 | 6 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 386 | 5 | 3 | 5 | 3.7 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL26842 | 97176 | 6 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 386 | 5 | 3 | 5 | 3.7 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)c1C | 10.1021/jm00008a013 | ||
127035083 | 136331 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 677 | 12 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3ccc(OC)cc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3734835 | 136331 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 677 | 12 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3ccc(OC)cc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
76320429 | 85812 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 324 | 4 | 1 | 6 | 3.6 | Cc1c(C(=O)O)oc2cccc(OCc3ccc4nonc4c3)c12 | 10.1007/s00044-013-0542-3 | ||
CHEMBL2296900 | 85812 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 324 | 4 | 1 | 6 | 3.6 | Cc1c(C(=O)O)oc2cccc(OCc3ccc4nonc4c3)c12 | 10.1007/s00044-013-0542-3 | ||
10875450 | 9792 | 0 | None | - | 0 | Pig | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 565 | 11 | 1 | 10 | 4.9 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2nccc(C)n2)c1 | 10.1021/jm0102304 | ||
CHEMBL113927 | 9792 | 0 | None | - | 0 | Pig | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 565 | 11 | 1 | 10 | 4.9 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2nccc(C)n2)c1 | 10.1021/jm0102304 | ||
18704814 | 100094 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 475 | 7 | 1 | 5 | 4.9 | COc1nc(Br)cnc1NS(=O)(=O)c1ccccc1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL287581 | 100094 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 475 | 7 | 1 | 5 | 4.9 | COc1nc(Br)cnc1NS(=O)(=O)c1ccccc1-c1ccc(CC(C)C)cc1 | 10.1016/S0960-894X(97)00228-X | ||
44279173 | 107236 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 476 | 6 | 2 | 6 | 3.1 | CNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL31696 | 107236 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 476 | 6 | 2 | 6 | 3.1 | CNC(=O)c1cccc(S(=O)(=O)Nc2ncc(Br)nc2OC)c1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
44279237 | 110505 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 462 | 6 | 2 | 6 | 2.8 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc(C(N)=O)c1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
CHEMBL32512 | 110505 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 462 | 6 | 2 | 6 | 2.8 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc(C(N)=O)c1-c1ccccc1 | 10.1016/S0960-894X(97)00228-X | ||
44309996 | 203736 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 483 | 5 | 1 | 8 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccc4nsnc4c3)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL67971 | 203736 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 483 | 5 | 1 | 8 | 5.2 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccc4nsnc4c3)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL342913 | 211672 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | COC(=O)C[C@@H]1NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C1=O | 10.1021/jm00021a021 | ||||
44279300 | 106506 | 0 | None | - | 0 | Pig | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 472 | 13 | 5 | 4 | 2.4 | CC(C)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31405 | 106506 | 0 | None | - | 0 | Pig | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 472 | 13 | 5 | 4 | 2.4 | CC(C)CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44279350 | 168152 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 428 | 4 | 2 | 4 | 4.2 | COc1cccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)c1 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL433229 | 168152 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 428 | 4 | 2 | 4 | 4.2 | COc1cccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)c1 | 10.1016/0960-894X(95)00230-Q | ||
10390467 | 97099 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 481 | 6 | 1 | 5 | 6.4 | Cc1noc(NS(=O)(=O)c2cccc3c(N=C(c4ccccc4)c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL26776 | 97099 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 481 | 6 | 1 | 5 | 6.4 | Cc1noc(NS(=O)(=O)c2cccc3c(N=C(c4ccccc4)c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
10373814 | 14867 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 1016 | 2 | 6 | 12 | 7.0 | O=C1NCCc2ccc(c(Br)c2)Oc2cc(ccc2O)CCNC(=O)/C(=N/O)Cc2cc(Br)c(OS(=O)(=O)O)c(c2)Oc2c(Br)cc(cc2Br)C/C1=N\O | 10.1021/np50099a026 | ||
CHEMBL1207961 | 14867 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 1016 | 2 | 6 | 12 | 7.0 | O=C1NCCc2ccc(c(Br)c2)Oc2cc(ccc2O)CCNC(=O)/C(=N/O)Cc2cc(Br)c(OS(=O)(=O)O)c(c2)Oc2c(Br)cc(cc2Br)C/C1=N\O | 10.1021/np50099a026 | ||
CHEMBL465400 | 14867 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 1016 | 2 | 6 | 12 | 7.0 | O=C1NCCc2ccc(c(Br)c2)Oc2cc(ccc2O)CCNC(=O)/C(=N/O)Cc2cc(Br)c(OS(=O)(=O)O)c(c2)Oc2c(Br)cc(cc2Br)C/C1=N\O | 10.1021/np50099a026 | ||
10793886 | 59788 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 615 | 11 | 4 | 5 | 6.3 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(Cc2ccccc2)s1 | 10.1021/jm950591h | ||
CHEMBL172760 | 59788 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 615 | 11 | 4 | 5 | 6.3 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(Cc2ccccc2)s1 | 10.1021/jm950591h | ||
10625083 | 206623 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 496 | 10 | 1 | 5 | 5.3 | CCCCN(CCCC)C(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL8925 | 206623 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 496 | 10 | 1 | 5 | 5.3 | CCCCN(CCCC)C(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10833400 | 161870 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 376 | 4 | 1 | 5 | 3.5 | Cc1cc(Cl)nnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL415106 | 161870 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 376 | 4 | 1 | 5 | 3.5 | Cc1cc(Cl)nnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
11793650 | 97295 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 372 | 6 | 1 | 6 | 2.9 | CCOc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1 | 10.1021/jm9604585 | ||
CHEMBL269237 | 97295 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 372 | 6 | 1 | 6 | 2.9 | CCOc1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1 | 10.1021/jm9604585 | ||
25211074 | 18453 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 543 | 10 | 2 | 7 | 5.1 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1272244 | 18453 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 543 | 10 | 2 | 7 | 5.1 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL405599 | 212545 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10767505 | 5268 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 494 | 6 | 1 | 8 | 3.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(S(C)(=O)=O)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10661 | 5268 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 494 | 6 | 1 | 8 | 3.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(S(C)(=O)=O)cc2)cc1 | 10.1021/jm9606507 | ||
10673715 | 9519 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 528 | 14 | 1 | 5 | 5.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCCC(F)(F)F | 10.1021/jm980217s | ||
CHEMBL112314 | 9519 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 528 | 14 | 1 | 5 | 5.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCCC(F)(F)F | 10.1021/jm980217s | ||
10650210 | 102759 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 545 | 9 | 1 | 9 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL305267 | 102759 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 545 | 9 | 1 | 9 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(OCCN3CCOCC3)c2)cc1 | 10.1021/jm980504w | ||
10361993 | 99538 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 373 | 5 | 1 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL283652 | 99538 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 373 | 5 | 1 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
44304492 | 96531 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||
CHEMBL262993 | 96531 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||
CHEMBL133257 | 208692 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C2CCCC2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44311232 | 204084 | 0 | None | - | 1 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 658 | 13 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70293 | 204084 | 0 | None | - | 1 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 658 | 13 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311233 | 204086 | 0 | None | - | 1 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 630 | 12 | 2 | 13 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70303 | 204086 | 0 | None | - | 1 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 630 | 12 | 2 | 13 | 4.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL133257 | 208692 | 0 | None | - | 0 | Pig | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C2CCCC2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10961277 | 100990 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 446 | 5 | 2 | 6 | 4.9 | CC(C)Oc1ccc2c(c1)C(c1ccc(O)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL294496 | 100990 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 446 | 5 | 2 | 6 | 4.9 | CC(C)Oc1ccc2c(c1)C(c1ccc(O)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10391968 | 188410 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL50232 | 188410 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
25211074 | 18453 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 543 | 10 | 2 | 7 | 5.1 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1272244 | 18453 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 543 | 10 | 2 | 7 | 5.1 | CCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
11058717 | 202793 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 412 | 8 | 1 | 6 | 4.6 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OCC)cc21 | 10.1021/jm010382z | ||
CHEMBL62348 | 202793 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 412 | 8 | 1 | 6 | 4.6 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OCC)cc21 | 10.1021/jm010382z | ||
9807200 | 85316 | 0 | None | 346 | 2 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 536 | 7 | 2 | 8 | 3.6 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(=O)O)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261359 | 85316 | 0 | None | 346 | 2 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 536 | 7 | 2 | 8 | 3.6 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(=O)O)ccc12 | 10.1007/s00044-004-0021-y | ||
71451528 | 81660 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 631 | 14 | 1 | 12 | 4.3 | CCCCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2163715 | 81660 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 631 | 14 | 1 | 12 | 4.3 | CCCCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
21041249 | 81633 | 1 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 648 | 11 | 1 | 8 | 4.7 | CN(Cc1ccccc1)S(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
CHEMBL2163688 | 81633 | 1 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 648 | 11 | 1 | 8 | 4.7 | CN(Cc1ccccc1)S(=O)(=O)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1 | 10.1021/jm3009103 | ||
71451525 | 81642 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 629 | 12 | 1 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1021/jm3009103 | ||
CHEMBL2163697 | 81642 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 629 | 12 | 1 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1021/jm3009103 | ||
71451528 | 81660 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 631 | 14 | 1 | 12 | 4.3 | CCCCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163715 | 81660 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 631 | 14 | 1 | 12 | 4.3 | CCCCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
11059576 | 203270 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL64726 | 203270 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1ccc2c(c1)C(c1ccc(OC)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
21041266 | 81983 | 1 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 584 | 10 | 2 | 8 | 3.3 | O=S(=O)(Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1)NC1CC1 | 10.1021/jm3009103 | ||
CHEMBL2165340 | 81983 | 1 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 584 | 10 | 2 | 8 | 3.3 | O=S(=O)(Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc(Br)cc1)NC1CC1 | 10.1021/jm3009103 | ||
10625633 | 207116 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 514 | 12 | 1 | 8 | 2.4 | COCCN(CCOC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9223 | 207116 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 514 | 12 | 1 | 8 | 2.4 | COCCN(CCOC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10697636 | 167796 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 536 | 13 | 1 | 7 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1SCCS1 | 10.1021/jm980217s | ||
CHEMBL430683 | 167796 | 0 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 536 | 13 | 1 | 7 | 4.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCC1SCCS1 | 10.1021/jm980217s | ||
10279940 | 101324 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 527 | 8 | 2 | 10 | 3.6 | CC(=O)OCCc1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
CHEMBL296927 | 101324 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 527 | 8 | 2 | 10 | 3.6 | CC(=O)OCCc1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
44333578 | 4573 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 417 | 5 | 1 | 5 | 4.4 | CCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL102773 | 4573 | 0 | None | - | 0 | Human | 8.4 | pIC50 | = | 8.4 | Binding | ChEMBL | 417 | 5 | 1 | 5 | 4.4 | CCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
44439111 | 97147 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 979 | 31 | 2 | 15 | 7.0 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOc2ccc(CC(=O)N(C)Cc3cc(-c4ncco4)ccc3-c3ccccc3S(=O)(=O)Nc3ccno3)cc2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL268201 | 97147 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 979 | 31 | 2 | 15 | 7.0 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOc2ccc(CC(=O)N(C)Cc3cc(-c4ncco4)ccc3-c3ccccc3S(=O)(=O)Nc3ccno3)cc2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
44295032 | 14758 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1cccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206717 | 14758 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1cccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)c1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL299572 | 14758 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 520 | 10 | 1 | 9 | 4.7 | COc1cccc(C(=O)/C(Cc2cc(OC)c(OC)c(OC)c2)=C(\C(=O)O)c2ccc3nsnc3c2)c1 | 10.1016/s0960-894x(98)00301-1 | ||
9959298 | 60485 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 552 | 10 | 2 | 7 | 5.4 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)N(C)C2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL175698 | 60485 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 552 | 10 | 2 | 7 | 5.4 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)N(C)C2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
10625530 | 207017 | 3 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
CHEMBL9162 | 207017 | 3 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
10625530 | 207017 | 3 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9162 | 207017 | 3 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10917653 | 203354 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 468 | 11 | 1 | 6 | 6.1 | CCCCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL65292 | 203354 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 468 | 11 | 1 | 6 | 6.1 | CCCCCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.ejmech.2016.06.006 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.ejmech.2016.06.006 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.ejmech.2016.06.006 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.ejmech.2016.06.006 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.ejmech.2016.06.006 | ||
104865 | 703 | 99 | None | -1 | 4 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2015.01.003 | ||
3494 | 703 | 99 | None | -1 | 4 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2015.01.003 | ||
392 | 703 | 99 | None | -1 | 4 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2015.01.003 | ||
CHEMBL957 | 703 | 99 | None | -1 | 4 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2015.01.003 | ||
DB00559 | 703 | 99 | None | -1 | 4 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmc.2015.01.003 | ||
17885921 | 106774 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 453 | 6 | 1 | 6 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccn2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL314454 | 106774 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 453 | 6 | 1 | 6 | 5.2 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccn2)nn1CC1CCCCC1 | 10.1016/s0960-894x(00)00513-8 | ||
11798504 | 97094 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 468 | 9 | 1 | 6 | 3.5 | CCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL267695 | 97094 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 468 | 9 | 1 | 6 | 3.5 | CCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10648135 | 9310 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 472 | 13 | 1 | 5 | 4.7 | C/C=C/CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL111218 | 9310 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 472 | 13 | 1 | 5 | 4.7 | C/C=C/CC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
44314581 | 104850 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 591 | 11 | 6 | 5 | 2.8 | Cc1[nH]c2ccccc2c1C[C@@H](NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)NC(Cc1c[nH]cn1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL311134 | 104850 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 591 | 11 | 6 | 5 | 2.8 | Cc1[nH]c2ccccc2c1C[C@@H](NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)NC(Cc1c[nH]cn1)C(=O)O | 10.1021/jm9600914 | ||
11798504 | 97094 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 468 | 9 | 1 | 6 | 3.5 | CCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL267695 | 97094 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 468 | 9 | 1 | 6 | 3.5 | CCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
11113473 | 203346 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 472 | 6 | 1 | 5 | 6.3 | CC(C)Oc1ccc2c(c1)C(c1ccc(C(C)C)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL65201 | 203346 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 472 | 6 | 1 | 5 | 6.3 | CC(C)Oc1ccc2c(c1)C(c1ccc(C(C)C)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL2304006 | 209439 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | None | None | None | O=C(O)C[C@H]1NC(=O)[C@H](Cc2c(Br)[nH]c3ccccc23)NC(=O)[C@@H](C2CC2)NC(=O)[C@H](C2CCCC2)NC(=O)[C@@H]2CCCN2C1=O | 10.1021/jm9600914 | ||||
44320419 | 107047 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 496 | 7 | 2 | 6 | 5.1 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1CCC(C(=O)O)CC1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315805 | 107047 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 496 | 7 | 2 | 6 | 5.1 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1CCC(C(=O)O)CC1 | 10.1016/s0960-894x(00)00513-8 | ||
10576428 | 14555 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 473 | 8 | 2 | 6 | 4.3 | COc1ccc(C(=O)/C(Cc2ccc(NC(C)=O)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL10905 | 14555 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 473 | 8 | 2 | 6 | 4.3 | COc1ccc(C(=O)/C(Cc2ccc(NC(C)=O)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL1204673 | 14555 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 473 | 8 | 2 | 6 | 4.3 | COc1ccc(C(=O)/C(Cc2ccc(NC(C)=O)cc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL328942 | 211293 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
18617318 | 105586 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 394 | 3 | 1 | 4 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2Br)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL312266 | 105586 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 394 | 3 | 1 | 4 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2Br)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10526002 | 8019 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 417 | 5 | 1 | 7 | 3.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccnc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10910 | 8019 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 417 | 5 | 1 | 7 | 3.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccnc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL2304018 | 209451 | 0 | None | - | 0 | Pig | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Cl)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
18004820 | 16421 | 0 | None | - | 1 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 527 | 9 | 2 | 7 | 4.7 | CCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL12333 | 16421 | 0 | None | - | 1 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 527 | 9 | 2 | 7 | 4.7 | CCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
71456865 | 81673 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 632 | 14 | 2 | 11 | 3.7 | COc1nc(NS(=O)(=O)NCc2ccccc2)c(Oc2ccccc2OC)c(OCCOc2ncc(Br)cn2)n1 | 10.1021/jm3009103 | ||
CHEMBL2163727 | 81673 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 632 | 14 | 2 | 11 | 3.7 | COc1nc(NS(=O)(=O)NCc2ccccc2)c(Oc2ccccc2OC)c(OCCOc2ncc(Br)cn2)n1 | 10.1021/jm3009103 | ||
10504148 | 207236 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 459 | 10 | 1 | 5 | 6.7 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1ccccn1 | 10.1021/jm9707131 | ||
CHEMBL92965 | 207236 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 459 | 10 | 1 | 5 | 6.7 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1ccccn1 | 10.1021/jm9707131 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL2369709 | 209629 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00152-J | ||||
CHEMBL405100 | 212520 | 0 | None | - | 0 | Pig | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCSC)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
CHEMBL438820 | 213777 | 0 | None | - | 0 | Pig | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
10002033 | 100985 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 417 | 7 | 2 | 7 | 3.6 | CCOC(=O)C(C)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL29448 | 100985 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 417 | 7 | 2 | 7 | 3.6 | CCOC(=O)C(C)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
10718141 | 5191 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 444 | 5 | 1 | 7 | 3.6 | COC(=O)c1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10622 | 5191 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 444 | 5 | 1 | 7 | 3.6 | COC(=O)c1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10027018 | 98461 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 454 | 4 | 1 | 5 | 5.1 | O=C1OC(O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL275991 | 98461 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 454 | 4 | 1 | 5 | 5.1 | O=C1OC(O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
44279413 | 99924 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 400 | 2 | 2 | 3 | 3.3 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(Br)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL286395 | 99924 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 400 | 2 | 2 | 3 | 3.3 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(Br)cc21 | 10.1016/0960-894X(95)00230-Q | ||
10716071 | 207293 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 401 | 7 | 1 | 5 | 5.4 | O=[N+]([O-])c1ccc(OCc2ccsc2)cc1/C=C(/CO)c1ccccc1Cl | 10.1021/jm970847e | ||
CHEMBL93411 | 207293 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 401 | 7 | 1 | 5 | 5.4 | O=[N+]([O-])c1ccc(OCc2ccsc2)cc1/C=C(/CO)c1ccccc1Cl | 10.1021/jm970847e | ||
44298330 | 101521 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 518 | 10 | 1 | 8 | 5.4 | COC(=O)CCCc1onc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Sc1cccc(OC)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL298340 | 101521 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 518 | 10 | 1 | 8 | 5.4 | COC(=O)CCCc1onc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Sc1cccc(OC)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL85341 | 215865 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
10792782 | 131338 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368847 | 131338 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL147510 | 208755 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
10087191 | 101810 | 1 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL30039 | 101810 | 1 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N)cccc23)c1C | 10.1021/jm00029a001 | ||
10087191 | 101810 | 1 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL30039 | 101810 | 1 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2cccc3c(N)cccc23)c1C | 10.1021/jm00008a013 | ||
5329 | 169452 | 119 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | 10.1021/jm00008a013 | ||
CHEMBL443 | 169452 | 119 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | 10.1021/jm00008a013 | ||
CHEMBL405709 | 212553 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
5329 | 169452 | 119 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | 10.1021/jm00004a012 | ||
CHEMBL443 | 169452 | 119 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | 10.1021/jm00004a012 | ||
44327619 | 207415 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 511 | 6 | 1 | 8 | 3.5 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc(C(C)(C)C)ccc2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL94102 | 207415 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 511 | 6 | 1 | 8 | 3.5 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)n2nc(C(C)(C)C)ccc2=O)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
44327714 | 207916 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 575 | 8 | 1 | 9 | 4.2 | COc1ccc(-c2cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)n2)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL96935 | 207916 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 575 | 8 | 1 | 9 | 4.2 | COc1ccc(-c2cc(C)c(=O)n(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)n2)cc1 | 10.1016/S0960-894X(96)00617-8 | ||
182140 | 189073 | 32 | None | - | 0 | Human | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 430 | 8 | 0 | 7 | 3.7 | COC[C@@H]1Cc2cc(OC)c3c(c2[C@H](c2ccc(OC)c(OC)c2)[C@H]1COC)OCO3 | 10.1021/np50124a006 | ||
CHEMBL510130 | 189073 | 32 | None | - | 0 | Human | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 430 | 8 | 0 | 7 | 3.7 | COC[C@@H]1Cc2cc(OC)c3c(c2[C@H](c2ccc(OC)c(OC)c2)[C@H]1COC)OCO3 | 10.1021/np50124a006 | ||
44277130 | 99426 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 450 | 8 | 1 | 7 | 3.6 | COc1cccc(Cn2nc(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2OCCO)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL283037 | 99426 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 450 | 8 | 1 | 7 | 3.6 | COc1cccc(Cn2nc(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2OCCO)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44277131 | 106808 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 380 | 5 | 1 | 3 | 4.0 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc(F)cc3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144603 | 106808 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 380 | 5 | 1 | 3 | 4.0 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc(F)cc3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44357135 | 116221 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 642 | 10 | 6 | 8 | -0.1 | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)c2ccccc2NC=O)NC1=O | 10.1021/jm00021a021 | ||
CHEMBL335863 | 116221 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 642 | 10 | 6 | 8 | -0.1 | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)c2ccccc2NC=O)NC1=O | 10.1021/jm00021a021 | ||
10814222 | 9520 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 470 | 10 | 1 | 6 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccc(OC)cc2OC)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL112325 | 9520 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 470 | 10 | 1 | 6 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccc(OC)cc2OC)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
18995992 | 99810 | 0 | None | - | 1 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1ccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28563 | 99810 | 0 | None | - | 1 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1ccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc1OC | 10.1016/0960-894X(96)00232-6 | ||
44339755 | 9747 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 12 | 1 | 7 | 2.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CN1CCCCS1(=O)=O | 10.1021/jm980217s | ||
CHEMBL113589 | 9747 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 12 | 1 | 7 | 2.7 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CN1CCCCS1(=O)=O | 10.1021/jm980217s | ||
10763680 | 120756 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 403 | 7 | 1 | 6 | 4.1 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1OC(C(=O)O)c1ccccc1 | 10.1021/jm990378b | ||
CHEMBL355413 | 120756 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 403 | 7 | 1 | 6 | 4.1 | N#Cc1ccc(OCc2ccc3c(c2)OCO3)cc1OC(C(=O)O)c1ccccc1 | 10.1021/jm990378b | ||
9894460 | 206686 | 9 | None | -24 | 3 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL313871 | 206686 | 9 | None | -24 | 3 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL8978 | 206686 | 9 | None | -24 | 3 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00617-8 | ||
10554410 | 120356 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 538 | 10 | 3 | 7 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)OC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL353320 | 120356 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 538 | 10 | 3 | 7 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)OC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
10916597 | 203292 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm031041j | ||
CHEMBL64832 | 203292 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 410 | 7 | 1 | 5 | 5.4 | CCCCC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm031041j | ||
CHEMBL304756 | 210952 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00089a028 | ||||
11058658 | 203225 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 409 | 7 | 1 | 5 | 4.8 | CCCCC1=C(C(N)=O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL64558 | 203225 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 409 | 7 | 1 | 5 | 4.8 | CCCCC1=C(C(N)=O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL337897 | 211577 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
4642915 | 97909 | 1 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 402 | 5 | 3 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccc(N/C(S)=N/c3ccccc3)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL27256 | 97909 | 1 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 402 | 5 | 3 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccc(N/C(S)=N/c3ccccc3)cc2)c1C | 10.1021/jm00008a013 | ||
44213925 | 111677 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 593 | 9 | 1 | 9 | 4.1 | COc1ccc(C2=NN(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)C(=O)CC2)cc1OC | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL328683 | 111677 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 593 | 9 | 1 | 9 | 4.1 | COc1ccc(C2=NN(C(C(=O)NS(=O)(=O)c3ccc(C(C)C)cc3)c3ccc4c(c3)OCO4)C(=O)CC2)cc1OC | 10.1016/S0960-894X(96)00617-8 | ||
44266532 | 4469 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 401 | 3 | 1 | 6 | 4.5 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10211 | 4469 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 401 | 3 | 1 | 6 | 4.5 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2ccccc2n1-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
10816264 | 59899 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 539 | 9 | 4 | 5 | 5.0 | Cc1sc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL173181 | 59899 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 539 | 9 | 4 | 5 | 5.0 | Cc1sc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
10840476 | 131815 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 553 | 10 | 4 | 5 | 5.3 | CCc1sc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL369420 | 131815 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 553 | 10 | 4 | 5 | 5.3 | CCc1sc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
23445345 | 203037 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 378 | 5 | 1 | 7 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccccc2)c1C | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL63611 | 203037 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 378 | 5 | 1 | 7 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccccc2)c1C | 10.1016/S0960-894X(97)00367-3 | ||
10280531 | 162907 | 0 | None | - | 1 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 5.1 | CCCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL417429 | 162907 | 0 | None | - | 1 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 5.1 | CCCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
10366742 | 107081 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.5 | CCCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL316012 | 107081 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.5 | CCCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(96)00496-9 | ||
44371410 | 49391 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 439 | 5 | 1 | 5 | 5.5 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3C)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL156453 | 49391 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 439 | 5 | 1 | 5 | 5.5 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3C)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL406279 | 212579 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
44383187 | 60135 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 617 | 13 | 4 | 5 | 4.5 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCc1cccc(CCC(=O)O)c1 | 10.1016/0960-894X(95)00144-I | ||
CHEMBL173974 | 60135 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 617 | 13 | 4 | 5 | 4.5 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCc1cccc(CCC(=O)O)c1 | 10.1016/0960-894X(95)00144-I | ||
15296635 | 99527 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 488 | 11 | 5 | 5 | 2.7 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL283591 | 99527 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 488 | 11 | 5 | 5 | 2.7 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44279516 | 99823 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 512 | 13 | 5 | 5 | 2.6 | CC(C)C[C@H](NC(=O)Cc1cccs1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL285729 | 99823 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 512 | 13 | 5 | 5 | 2.6 | CC(C)C[C@H](NC(=O)Cc1cccs1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
15340613 | 106817 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 414 | 6 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(-c3ccccc3)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144732 | 106817 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 414 | 6 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(-c3ccccc3)c(Cc3ccc4c(c3)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44317215 | 205240 | 2 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 266 | 3 | 1 | 4 | 2.4 | Cc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78952 | 205240 | 2 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 266 | 3 | 1 | 4 | 2.4 | Cc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/0960-894X(96)00441-6 | ||
10816963 | 113302 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 574 | 12 | 2 | 7 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC)cc1 | 10.1021/jm990170q | ||
CHEMBL331625 | 113302 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 574 | 12 | 2 | 7 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC)cc1 | 10.1021/jm990170q | ||
CHEMBL1791015 | 208892 | 0 | None | - | 0 | Pig | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H]([C@H](C)O)NC(=O)[C@@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44368417 | 44619 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 504 | 12 | 2 | 6 | 4.9 | COc1ccc(CN(Cc2cc(OC)c(OC)c(OC)c2)C(Cc2c[nH]c3ccccc23)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152065 | 44619 | 0 | None | - | 0 | Pig | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 504 | 12 | 2 | 6 | 4.9 | COc1ccc(CN(Cc2cc(OC)c(OC)c(OC)c2)C(Cc2c[nH]c3ccccc23)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
10383833 | 100080 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2c1 | 10.1021/jm00008a013 | ||
CHEMBL28751 | 100080 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2c1 | 10.1021/jm00008a013 | ||
10383833 | 100080 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2c1 | 10.1021/jm00004a012 | ||
CHEMBL28751 | 100080 | 0 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2c1 | 10.1021/jm00004a012 | ||
CHEMBL265066 | 96786 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 646 | 8 | 2 | 13 | 5.8 | COC(=O)C1=C(C)N=C(C)/C(=C(/O)OC(=O)C2=C(C)N=C(C)/C(=C(/O)OC)[C@@H]2c2cccc([N+](=O)[O-])c2)[C@H]1c1cccc([N+](=O)[O-])c1 | 10.1016/S0960-894X(01)81025-8 | ||
9913198 | 5288 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 484 | 5 | 1 | 6 | 4.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(C(F)(F)F)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10676 | 5288 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 484 | 5 | 1 | 6 | 4.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(C(F)(F)F)c2)cc1 | 10.1021/jm9606507 | ||
11733450 | 203397 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 474 | 6 | 1 | 7 | 5.0 | CCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL65658 | 203397 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 474 | 6 | 1 | 7 | 5.0 | CCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
10502577 | 12372 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 426 | 7 | 1 | 7 | 3.9 | COc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9700068 | ||
CHEMBL1185771 | 12372 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 426 | 7 | 1 | 7 | 3.9 | COc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9700068 | ||
CHEMBL432109 | 12372 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 426 | 7 | 1 | 7 | 3.9 | COc1ccc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)cc1 | 10.1021/jm9700068 | ||
10599829 | 97100 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 454 | 9 | 2 | 6 | 3.2 | CCCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL267761 | 97100 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 454 | 9 | 2 | 6 | 3.2 | CCCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44266575 | 4611 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 459 | 6 | 1 | 7 | 5.2 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10302 | 4611 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 459 | 6 | 1 | 7 | 5.2 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2-c1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
44317005 | 205003 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76949 | 205003 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.4 | Cc1noc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
10070783 | 97027 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL267094 | 97027 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 420 | 4 | 1 | 5 | 4.5 | O=C1OC(O)(c2ccc(Cl)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
44298305 | 194565 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 504 | 10 | 2 | 7 | 5.3 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC(=O)O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL53097 | 194565 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 504 | 10 | 2 | 7 | 5.3 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC(=O)O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
44276948 | 106809 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 396 | 5 | 1 | 3 | 4.5 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc(Cl)cc3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144604 | 106809 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 396 | 5 | 1 | 3 | 4.5 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccc(Cl)cc3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
9820754 | 108535 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 371 | 3 | 0 | 5 | 4.4 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL320236 | 108535 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 371 | 3 | 0 | 5 | 4.4 | COC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
10604167 | 12385 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 640 | 10 | 2 | 6 | 6.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL1185826 | 12385 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 640 | 10 | 2 | 6 | 6.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL434986 | 12385 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 640 | 10 | 2 | 6 | 6.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
10647172 | 206743 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 449 | 6 | 1 | 5 | 4.6 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2Cc2ccc(F)cc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL9012 | 206743 | 0 | None | - | 0 | Rat | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 449 | 6 | 1 | 5 | 4.6 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2Cc2ccc(F)cc2)cc1 | 10.1021/jm9505369 | ||
44265906 | 97240 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 441 | 9 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CCOCC(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL268902 | 97240 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 441 | 9 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CCOCC(C)C)cc1 | 10.1021/jm9505369 | ||
18617377 | 205451 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 344 | 3 | 1 | 4 | 3.2 | Cc1ccc(C)c(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80484 | 205451 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 344 | 3 | 1 | 4 | 3.2 | Cc1ccc(C)c(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
10668427 | 165320 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 395 | 7 | 1 | 6 | 3.8 | N#Cc1ccc(OCc2ccnnc2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
CHEMBL423608 | 165320 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 395 | 7 | 1 | 6 | 3.8 | N#Cc1ccc(OCc2ccnnc2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
10765750 | 163135 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 445 | 8 | 1 | 6 | 3.0 | CC[S+]([O-])CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL417972 | 163135 | 0 | None | - | 0 | Rat | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 445 | 8 | 1 | 6 | 3.0 | CC[S+]([O-])CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44383753 | 60036 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 466 | 5 | 1 | 5 | 5.7 | Cc1cc(C)c(/C=C/c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL173761 | 60036 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 466 | 5 | 1 | 5 | 5.7 | Cc1cc(C)c(/C=C/c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
44439105 | 168686 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 848 | 26 | 2 | 12 | 6.5 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOc2ccc(-c3ccccc3S(=O)(=O)Nc3ccno3)c(CN(C)C(=O)CC(C)(C)C)c2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL436821 | 168686 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 848 | 26 | 2 | 12 | 6.5 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOc2ccc(-c3ccccc3S(=O)(=O)Nc3ccno3)c(CN(C)C(=O)CC(C)(C)C)c2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
10357554 | 97536 | 1 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL27065 | 97536 | 1 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 302 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2cccc3ccccc23)c1C | 10.1016/0960-894X(96)00441-6 | ||
10972369 | 168044 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 448 | 6 | 3 | 6 | 4.9 | COc1ccc(C2=C(C(=O)O)C(c3ccc(O)c(O)c3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL432489 | 168044 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 448 | 6 | 3 | 6 | 4.9 | COc1ccc(C2=C(C(=O)O)C(c3ccc(O)c(O)c3)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
11801544 | 61747 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 589 | 10 | 4 | 6 | 5.1 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2C3CC4CC(C3)CC2C4)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL177261 | 61747 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 589 | 10 | 4 | 6 | 5.1 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2C3CC4CC(C3)CC2C4)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL135907 | 208712 | 0 | None | - | 0 | Pig | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
23445562 | 100588 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 398 | 5 | 1 | 7 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccccc2)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL291891 | 100588 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 398 | 5 | 1 | 7 | 3.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccccc2)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL438194 | 213730 | 14 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
CHEMBL34540 | 211685 | 14 | None | - | 0 | Rat | 4.4 | pIC50 | = | 4.4 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.5b01781 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.5b01781 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.5b01781 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.5b01781 | ||
10839947 | 117276 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL339657 | 117276 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm3009103 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm3009103 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm3009103 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm3009103 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm3009103 | ||
10741025 | 181657 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 424 | 6 | 1 | 6 | 4.5 | Cc1cc(C)cc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c1 | 10.1021/jm9700068 | ||
CHEMBL47765 | 181657 | 0 | None | - | 0 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 424 | 6 | 1 | 6 | 4.5 | Cc1cc(C)cc(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c1 | 10.1021/jm9700068 | ||
CHEMBL347948 | 211691 | 0 | None | - | 0 | Mouse | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H](NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H]1CCCN1C(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
18184234 | 62179 | 0 | None | - | 2 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL177802 | 62179 | 0 | None | - | 2 | Human | 7.4 | pIC50 | = | 7.4 | Binding | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
10599230 | 206972 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 440 | 8 | 2 | 6 | 2.8 | CCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
CHEMBL9141 | 206972 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 440 | 8 | 2 | 6 | 2.8 | CCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm031041j | ||
10599230 | 206972 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 440 | 8 | 2 | 6 | 2.8 | CCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9141 | 206972 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 440 | 8 | 2 | 6 | 2.8 | CCCNC(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
11767189 | 9926 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 601 | 11 | 1 | 10 | 5.8 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2cnc3ccccc3n2)c1 | 10.1021/jm0102304 | ||
CHEMBL114704 | 9926 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 601 | 11 | 1 | 10 | 5.8 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2cnc3ccccc3n2)c1 | 10.1021/jm0102304 | ||
10793053 | 11426 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 564 | 9 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL1180363 | 11426 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 564 | 9 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL123994 | 11426 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 564 | 9 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2ccccc2)cc1 | 10.1021/jm990171i | ||
15340617 | 99209 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 464 | 8 | 1 | 7 | 3.7 | COc1cccc(Cn2nc(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2OCC(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL281677 | 99209 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 464 | 8 | 1 | 7 | 3.7 | COc1cccc(Cn2nc(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2OCC(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44386621 | 61247 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL176653 | 61247 | 0 | None | - | 0 | Rat | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
10650331 | 132547 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 551 | 10 | 3 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)N(C)C(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL369821 | 132547 | 0 | None | - | 0 | Human | 6.4 | pIC50 | = | 6.4 | Binding | ChEMBL | 551 | 10 | 3 | 6 | 5.0 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)N(C)C(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
56678451 | 63296 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 937 | 25 | 8 | 8 | 4.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C(c1ccccc1)c1ccccc1)N(C)C(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||
CHEMBL1793927 | 63296 | 0 | None | - | 0 | Human | 5.4 | pIC50 | = | 5.4 | Binding | ChEMBL | 937 | 25 | 8 | 8 | 4.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C(c1ccccc1)c1ccccc1)N(C)C(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||
10205429 | 61576 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 470 | 8 | 2 | 9 | 2.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(C)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL177111 | 61576 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 470 | 8 | 2 | 9 | 2.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(C)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
71458717 | 81641 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 433 | 9 | 2 | 10 | 1.5 | COc1ccccc1Oc1c(NS(C)(=O)=O)nc(-c2ncccn2)nc1OCCO | 10.1021/jm3009103 | ||
CHEMBL2163696 | 81641 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 433 | 9 | 2 | 10 | 1.5 | COc1ccccc1Oc1c(NS(C)(=O)=O)nc(-c2ncccn2)nc1OCCO | 10.1021/jm3009103 | ||
10598840 | 60464 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 432 | 9 | 1 | 5 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)cc(OC)c2)cc1 | 10.1021/jm031041j | ||
CHEMBL175545 | 60464 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 432 | 9 | 1 | 5 | 4.7 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)cc(OC)c2)cc1 | 10.1021/jm031041j | ||
10670372 | 97218 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)cc(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL268754 | 97218 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)cc(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
44314664 | 204673 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 615 | 12 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CCCC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL74000 | 204673 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 615 | 12 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CCCC1)C(=O)O | 10.1021/jm9600914 | ||
76330201 | 85320 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 526 | 6 | 1 | 7 | 4.5 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(Cl)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261363 | 85320 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 526 | 6 | 1 | 7 | 4.5 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(Cl)ccc12 | 10.1007/s00044-004-0021-y | ||
10479787 | 59585 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 468 | 6 | 1 | 5 | 5.3 | Cc1cc(C)c(CCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL171972 | 59585 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 468 | 6 | 1 | 5 | 5.3 | Cc1cc(C)c(CCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
18995988 | 100309 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 389 | 6 | 1 | 4 | 5.5 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccccc3)c3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28948 | 100309 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 389 | 6 | 1 | 4 | 5.5 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccccc3)c3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
10029811 | 97928 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 525 | 8 | 2 | 5 | 6.4 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(=O)CC(c4ccccc4)c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27262 | 97928 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 525 | 8 | 2 | 5 | 6.4 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(=O)CC(c4ccccc4)c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
44279127 | 99460 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 432 | 3 | 2 | 3 | 4.8 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccc(Cl)cc3)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL283200 | 99460 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 432 | 3 | 2 | 3 | 4.8 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccc(Cl)cc3)cc21 | 10.1016/0960-894X(95)00230-Q | ||
10815168 | 168127 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 497 | 5 | 2 | 6 | 5.2 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(C(C)(C)C)cc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL433074 | 168127 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 497 | 5 | 2 | 6 | 5.2 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(C(C)(C)C)cc2)c1Br | 10.1021/jm9608366 | ||
9869444 | 97217 | 0 | None | - | 1 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2c1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL268751 | 97217 | 0 | None | - | 1 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2c1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL342440 | 211651 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | None | None | None | CCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
23445250 | 168082 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 468 | 6 | 1 | 5 | 5.8 | Cc1cc(CC(C)C)ccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL432815 | 168082 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 468 | 6 | 1 | 5 | 5.8 | Cc1cc(CC(C)C)ccc1-c1ccsc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
44316515 | 204981 | 2 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 360 | 4 | 1 | 5 | 2.9 | COc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76779 | 204981 | 2 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 360 | 4 | 1 | 5 | 2.9 | COc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
44314472 | 103771 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 594 | 13 | 5 | 5 | 4.2 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL309003 | 103771 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 594 | 13 | 5 | 5 | 4.2 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
10626177 | 60361 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 535 | 11 | 4 | 5 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)CC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL174871 | 60361 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 535 | 11 | 4 | 5 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)CC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
44283420 | 161768 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 594 | 13 | 5 | 5 | 4.2 | CCCC[C@H](NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL414175 | 161768 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 594 | 13 | 5 | 5 | 4.2 | CCCC[C@H](NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
23548251 | 81652 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 661 | 16 | 1 | 14 | 4.0 | COc1cc(OC)nc(OCCOc2nc(-c3ncccn3)nc(NS(=O)(=O)CCc3ccccc3)c2Oc2ccccc2OC)n1 | 10.1021/jm3009103 | ||
CHEMBL2163707 | 81652 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 661 | 16 | 1 | 14 | 4.0 | COc1cc(OC)nc(OCCOc2nc(-c3ncccn3)nc(NS(=O)(=O)CCc3ccccc3)c2Oc2ccccc2OC)n1 | 10.1021/jm3009103 | ||
11801523 | 8224 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 588 | 16 | 1 | 7 | 5.3 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCC)cc1 | 10.1021/jm970101g | ||
CHEMBL109242 | 8224 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 588 | 16 | 1 | 7 | 5.3 | CCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCC)cc1 | 10.1021/jm970101g | ||
10961960 | 202853 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 487 | 8 | 1 | 7 | 4.4 | CCCCC1=C(C(=O)NS(C)(=O)=O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL62633 | 202853 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 487 | 8 | 1 | 7 | 4.4 | CCCCC1=C(C(=O)NS(C)(=O)=O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL304260 | 210950 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
9830495 | 131123 | 0 | None | - | 1 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 618 | 14 | 2 | 9 | 5.0 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368617 | 131123 | 0 | None | - | 1 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 618 | 14 | 2 | 9 | 5.0 | CCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
137661460 | 159351 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 565 | 10 | 2 | 9 | 4.4 | C=CCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4100579 | 159351 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 565 | 10 | 2 | 9 | 4.4 | C=CCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL2370255 | 209796 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10645550 | 97323 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccccc1C1(O)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1ccccc1 | 10.1021/jm9606507 | ||
CHEMBL269461 | 97323 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccccc1C1(O)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1ccccc1 | 10.1021/jm9606507 | ||
11145841 | 100928 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 528 | 9 | 1 | 6 | 6.9 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC3CCCC3)cc1)O2 | 10.1021/jm010382z | ||
CHEMBL294127 | 100928 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 528 | 9 | 1 | 6 | 6.9 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC3CCCC3)cc1)O2 | 10.1021/jm010382z | ||
44279129 | 106968 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 428 | 4 | 2 | 4 | 4.2 | COc1ccccc1-c1ccc2c(c1)C(=O)c1ccccc1[C@@H]1[C@H](C(=O)O)[C@H](C(=O)O)[C@H]21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL31524 | 106968 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 428 | 4 | 2 | 4 | 4.2 | COc1ccccc1-c1ccc2c(c1)C(=O)c1ccccc1[C@@H]1[C@H](C(=O)O)[C@H](C(=O)O)[C@H]21 | 10.1016/0960-894X(95)00230-Q | ||
44277245 | 106820 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 392 | 6 | 1 | 4 | 3.9 | COc1ccc(Cc2c(C(F)(F)F)[nH]n(Cc3cccc(OC)c3)c2=O)cc1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144736 | 106820 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 392 | 6 | 1 | 4 | 3.9 | COc1ccc(Cc2c(C(F)(F)F)[nH]n(Cc3cccc(OC)c3)c2=O)cc1 | 10.1016/s0960-894x(00)00232-8 | ||
44385522 | 59596 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 642 | 13 | 2 | 11 | 4.2 | CCS(=O)(=O)NCCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172029 | 59596 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 642 | 13 | 2 | 11 | 4.2 | CCS(=O)(=O)NCCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9808545 | 11420 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 588 | 11 | 2 | 7 | 5.2 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL1180353 | 11420 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 588 | 11 | 2 | 7 | 5.2 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL123408 | 11420 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 588 | 11 | 2 | 7 | 5.2 | COCCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
10571380 | 60046 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 373 | 7 | 1 | 4 | 4.7 | Cc1ccccc1C(Oc1cc(OCc2ccccc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173838 | 60046 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 373 | 7 | 1 | 4 | 4.7 | Cc1ccccc1C(Oc1cc(OCc2ccccc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
9845967 | 11061 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL10801 | 11061 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL1178000 | 11061 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL51530 | 11061 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL433853 | 213624 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)(C)S)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
44371450 | 48834 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(OC)c(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)c1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL155937 | 48834 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 485 | 7 | 1 | 7 | 5.2 | COc1ccc(OC)c(-c2c(C(=O)O)c(=O)n(Cc3ccccc3OC)c3c2oc2ccccc23)c1 | 10.1016/s0960-894x(99)00040-2 | ||
15453210 | 205223 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 376 | 5 | 1 | 6 | 2.6 | COc1ccc(S(=O)(=O)Nc2onc(C)c2Br)cc1OC | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78853 | 205223 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 376 | 5 | 1 | 6 | 2.6 | COc1ccc(S(=O)(=O)Nc2onc(C)c2Br)cc1OC | 10.1016/0960-894X(96)00441-6 | ||
44316458 | 205418 | 2 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 408 | 3 | 1 | 4 | 3.6 | Cc1noc(NS(=O)(=O)c2cc(Br)ccc2Br)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80317 | 205418 | 2 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 408 | 3 | 1 | 4 | 3.6 | Cc1noc(NS(=O)(=O)c2cc(Br)ccc2Br)c1C | 10.1016/0960-894X(96)00441-6 | ||
10404449 | 99476 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 331 | 4 | 1 | 5 | 3.0 | Cc1cnoc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL283300 | 99476 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 331 | 4 | 1 | 5 | 3.0 | Cc1cnoc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm00008a013 | ||
9865706 | 98106 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 400 | 4 | 1 | 5 | 4.1 | Cc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL273613 | 98106 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 400 | 4 | 1 | 5 | 4.1 | Cc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
44385523 | 61034 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 666 | 13 | 2 | 9 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL176418 | 61034 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 666 | 13 | 2 | 9 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL409777 | 212761 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
9957883 | 98629 | 0 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL27732 | 98629 | 0 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 507 | 7 | 1 | 9 | 5.0 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00232-6 | ||
10626031 | 109671 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 529 | 13 | 1 | 7 | 2.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1C(=O)CCC1=O | 10.1021/jm980217s | ||
CHEMBL322799 | 109671 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 529 | 13 | 1 | 7 | 2.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1C(=O)CCC1=O | 10.1021/jm980217s | ||
10767210 | 111288 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 484 | 12 | 1 | 4 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cccc(F)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL326719 | 111288 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 484 | 12 | 1 | 4 | 5.1 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cccc(F)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
9871837 | 15171 | 0 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 535 | 10 | 2 | 7 | 4.9 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1039/C4MD00499J | ||
CHEMBL12106 | 15171 | 0 | None | - | 1 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 535 | 10 | 2 | 7 | 4.9 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1039/C4MD00499J | ||
44458650 | 84874 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 521 | 7 | 2 | 8 | 2.7 | COc1ccccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL22367 | 84874 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 521 | 7 | 2 | 8 | 2.7 | COc1ccccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
10619391 | 60208 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173251 | 60208 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL174092 | 60208 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10547407 | 78336 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1[C@H](Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL2110232 | 78336 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1[C@H](Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10453733 | 112284 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 402 | 9 | 1 | 5 | 4.8 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2cccnc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL329181 | 112284 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 402 | 9 | 1 | 5 | 4.8 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2cccnc2)ccc1C#N | 10.1021/jm9707131 | ||
9953204 | 207409 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL94071 | 207409 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm9707131 | ||
10210086 | 61251 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 571 | 10 | 2 | 12 | 3.0 | C#CCOc1nc(-c2ccnc(-c3nn[nH]n3)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176664 | 61251 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 571 | 10 | 2 | 12 | 3.0 | C#CCOc1nc(-c2ccnc(-c3nn[nH]n3)c2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10361107 | 162024 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 359 | 5 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL416026 | 162024 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 359 | 5 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(C)C)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL64271 | 215830 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00349-X | ||||
10281929 | 9361 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 588 | 16 | 1 | 7 | 5.3 | CCCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
CHEMBL111517 | 9361 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 588 | 16 | 1 | 7 | 5.3 | CCCCCCCS(=O)(=O)N(CCC)CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm970101g | ||
10553490 | 181092 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 501 | 8 | 3 | 10 | 2.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2OCCO)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL47604 | 181092 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 501 | 8 | 3 | 10 | 2.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2OCCO)OCO3)c1Cl | 10.1021/jm9608366 | ||
44386921 | 61250 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 384 | 5 | 1 | 6 | 3.8 | COC1=C(C(=O)O)[C@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm031041j | ||
CHEMBL176661 | 61250 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 384 | 5 | 1 | 6 | 3.8 | COC1=C(C(=O)O)[C@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm031041j | ||
10721344 | 7508 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 548 | 13 | 1 | 8 | 3.0 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCOC | 10.1021/jm970101g | ||
CHEMBL108748 | 7508 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 548 | 13 | 1 | 8 | 3.0 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)CCOC | 10.1021/jm970101g | ||
10918390 | 19289 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 522 | 12 | 1 | 5 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)cc1 | 10.1021/jm010237l | ||
CHEMBL129060 | 19289 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 522 | 12 | 1 | 5 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(CC)cc1 | 10.1021/jm010237l | ||
9807178 | 202968 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 384 | 5 | 1 | 6 | 3.8 | COC1=C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL63121 | 202968 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 384 | 5 | 1 | 6 | 3.8 | COC1=C(C(=O)O)[C@@H](c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
10767280 | 108641 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 486 | 14 | 1 | 5 | 5.1 | C=C(C)CCC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL320763 | 108641 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 486 | 14 | 1 | 5 | 5.1 | C=C(C)CCC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
44458669 | 84644 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 505 | 6 | 2 | 7 | 3.0 | Cc1ccccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL22249 | 84644 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 505 | 6 | 2 | 7 | 3.0 | Cc1ccccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(N)=O)ccc12 | 10.1016/s0960-894x(01)00660-6 | ||
107810 | 1671 | 30 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 604 | 12 | 4 | 6 | 3.4 | CC(C[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccn1)Cc1cn(c2c1cccc2)C)NC(=O)N1CCCCCC1)C | 10.1016/0960-894X(95)00144-I | ||
998 | 1671 | 30 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 604 | 12 | 4 | 6 | 3.4 | CC(C[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccn1)Cc1cn(c2c1cccc2)C)NC(=O)N1CCCCCC1)C | 10.1016/0960-894X(95)00144-I | ||
CHEMBL352396 | 1671 | 30 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 604 | 12 | 4 | 6 | 3.4 | CC(C[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccn1)Cc1cn(c2c1cccc2)C)NC(=O)N1CCCCCC1)C | 10.1016/0960-894X(95)00144-I | ||
22009947 | 85315 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 536 | 7 | 2 | 8 | 3.6 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(=O)O)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261358 | 85315 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 536 | 7 | 2 | 8 | 3.6 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(=O)O)ccc12 | 10.1007/s00044-004-0021-y | ||
9984193 | 101130 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
CHEMBL295440 | 101130 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
9984193 | 101130 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL295440 | 101130 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10649119 | 11406 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 502 | 8 | 2 | 6 | 4.1 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL1180318 | 11406 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 502 | 8 | 2 | 6 | 4.1 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
CHEMBL121761 | 11406 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 502 | 8 | 2 | 6 | 4.1 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(C)c2ccccc2)cc1 | 10.1021/jm990171i | ||
73669994 | 117604 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 429 | 9 | 1 | 7 | 4.7 | N#Cc1ccc(OCc2ccc3nonc3c2)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
CHEMBL3400996 | 117604 | 0 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 429 | 9 | 1 | 7 | 4.7 | N#Cc1ccc(OCc2ccc3nonc3c2)cc1OC(CCC(=O)O)c1ccccc1 | 10.1016/j.bmc.2015.01.003 | ||
44314750 | 165628 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 647 | 13 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL424422 | 165628 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 647 | 13 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
10140965 | 101145 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 485 | 7 | 3 | 9 | 3.0 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CCO)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL295588 | 101145 | 0 | None | - | 0 | Human | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 485 | 7 | 3 | 9 | 3.0 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CCO)OCO3)c1Cl | 10.1021/jm9608366 | ||
44283419 | 100289 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 647 | 13 | 5 | 4 | 5.1 | CCCC[C@H](NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
CHEMBL289349 | 100289 | 0 | None | - | 0 | Pig | 8.3 | pIC50 | = | 8.3 | Binding | ChEMBL | 647 | 13 | 5 | 4 | 5.1 | CCCC[C@H](NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1016/0960-894X(95)00237-N | ||
44314905 | 205024 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 567 | 12 | 5 | 4 | 4.0 | CCCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL77083 | 205024 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 567 | 12 | 5 | 4 | 4.0 | CCCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
44333867 | 4610 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 403 | 4 | 1 | 5 | 4.1 | COc1ccc([C@@H]2c3nc(C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL103001 | 4610 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 403 | 4 | 1 | 5 | 4.1 | COc1ccc([C@@H]2c3nc(C)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1016/s0960-894x(02)00663-7 | ||
10415822 | 129793 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 579 | 9 | 3 | 7 | 4.7 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCOC23CCCCC3)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL367551 | 129793 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 579 | 9 | 3 | 7 | 4.7 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCOC23CCCCC3)nc1C(=O)O | 10.1021/jm950592+ | ||
11798998 | 206812 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9050 | 206812 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 482 | 10 | 1 | 6 | 3.9 | CCCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1016/0960-894X(96)00441-6 | ||
10415348 | 61058 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 557 | 9 | 3 | 6 | 4.8 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL176514 | 61058 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 557 | 9 | 3 | 6 | 4.8 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL438733 | 213768 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]2CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N2)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00077a013 | ||||
10647642 | 8068 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 460 | 6 | 2 | 7 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(C(=O)O)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10915 | 8068 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 460 | 6 | 2 | 7 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc(C(=O)O)c2)cc1 | 10.1021/jm9606507 | ||
11799625 | 113771 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2ccc(C)c(C)c2)cc1 | 10.1021/jm990170q | ||
CHEMBL332431 | 113771 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 502 | 7 | 2 | 6 | 4.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2ccc(C)c(C)c2)cc1 | 10.1021/jm990170q | ||
9871561 | 174776 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 527 | 10 | 2 | 8 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cc2)nc(C(F)(F)F)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4562189 | 174776 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 527 | 10 | 2 | 8 | 4.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cc2)nc(C(F)(F)F)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
9873255 | 59604 | 0 | None | - | 2 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 591 | 14 | 2 | 10 | 3.8 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172071 | 59604 | 0 | None | - | 2 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 591 | 14 | 2 | 10 | 3.8 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm9604585 | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm9604585 | ||
10553017 | 98079 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 488 | 7 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)c2ccccc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL273476 | 98079 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 488 | 7 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)c2ccccc2)cc1 | 10.1021/jm9505369 | ||
10502023 | 122366 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1cccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)c1 | 10.1021/jm031041j | ||
CHEMBL360066 | 122366 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1cccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)c1 | 10.1021/jm031041j | ||
CHEMBL384728 | 212311 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
3370402 | 105764 | 5 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 252 | 3 | 1 | 4 | 2.1 | Cc1noc(NS(=O)(=O)c2ccccc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL312670 | 105764 | 5 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 252 | 3 | 1 | 4 | 2.1 | Cc1noc(NS(=O)(=O)c2ccccc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
10740614 | 98280 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1cccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)c1 | 10.1021/jm9606507 | ||
CHEMBL274857 | 98280 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1cccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)c1 | 10.1021/jm9606507 | ||
10714851 | 111898 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 381 | 7 | 1 | 5 | 4.9 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL328786 | 111898 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 381 | 7 | 1 | 5 | 4.9 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1ccccc1 | 10.1021/jm970847e | ||
44211959 | 55406 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 620 | 12 | 1 | 9 | 5.5 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(C)(=O)=O)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL16197 | 55406 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 620 | 12 | 1 | 9 | 5.5 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(C)(=O)=O)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
44368480 | 44578 | 0 | None | - | 0 | Pig | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 495 | 13 | 1 | 7 | 4.4 | COc1ccc(CC(C(=O)O)N(Cc2ccc(OC)cc2)Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152034 | 44578 | 0 | None | - | 0 | Pig | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 495 | 13 | 1 | 7 | 4.4 | COc1ccc(CC(C(=O)O)N(Cc2ccc(OC)cc2)Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
10017402 | 101865 | 2 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 295 | 5 | 2 | 5 | 2.5 | CCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00008a013 | ||
CHEMBL30078 | 101865 | 2 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 295 | 5 | 2 | 5 | 2.5 | CCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00008a013 | ||
44328057 | 96865 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 986 | 26 | 9 | 9 | 4.9 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)c1cccnc1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL265734 | 96865 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 986 | 26 | 9 | 9 | 4.9 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)c1cccnc1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL2370253 | 209794 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
44279351 | 99916 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 412 | 3 | 2 | 3 | 4.5 | Cc1ccccc1-c1ccc2c(c1)C(=O)c1ccccc1[C@@H]1[C@H](C(=O)O)[C@H](C(=O)O)[C@H]21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL286333 | 99916 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 412 | 3 | 2 | 3 | 4.5 | Cc1ccccc1-c1ccc2c(c1)C(=O)c1ccccc1[C@@H]1[C@H](C(=O)O)[C@H](C(=O)O)[C@H]21 | 10.1016/0960-894X(95)00230-Q | ||
31771 | 96937 | 37 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL26630 | 96937 | 37 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
10017402 | 101865 | 2 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 295 | 5 | 2 | 5 | 2.5 | CCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00004a012 | ||
CHEMBL30078 | 101865 | 2 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 295 | 5 | 2 | 5 | 2.5 | CCNc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm00004a012 | ||
10454873 | 96393 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 421 | 6 | 1 | 5 | 4.6 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1Cc1ccccc1 | 10.1021/jm00008a013 | ||
CHEMBL26203 | 96393 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 421 | 6 | 1 | 5 | 4.6 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1Cc1ccccc1 | 10.1021/jm00008a013 | ||
44383536 | 120371 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 362 | 3 | 2 | 5 | 2.9 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)[C@@]2(C)CCCC(C)(C)C12 | 10.1016/s0960-894x(00)00136-0 | ||
CHEMBL353502 | 120371 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 362 | 3 | 2 | 5 | 2.9 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)[C@@]2(C)CCCC(C)(C)C12 | 10.1016/s0960-894x(00)00136-0 | ||
10671298 | 203429 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 450 | 6 | 1 | 6 | 3.7 | CCOc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6588 | 203429 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 450 | 6 | 1 | 6 | 3.7 | CCOc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
10789830 | 96989 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 453 | 4 | 1 | 4 | 3.7 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(I)cn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL266684 | 96989 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 453 | 4 | 1 | 4 | 3.7 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(I)cn3)cccc12 | 10.1021/jm9604585 | ||
10740942 | 203518 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 422 | 4 | 2 | 6 | 3.0 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3O)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6647 | 203518 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 422 | 4 | 2 | 6 | 3.0 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncc(Br)nc3O)cccc12 | 10.1021/jm9604585 | ||
10595728 | 203527 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 376 | 4 | 1 | 5 | 3.5 | Cc1cc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nnc1Cl | 10.1021/jm9604585 | ||
CHEMBL6660 | 203527 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 376 | 4 | 1 | 5 | 3.5 | Cc1cc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)nnc1Cl | 10.1021/jm9604585 | ||
10644647 | 120474 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.1 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccc(Cl)cc1 | 10.1021/jm990378b | ||
CHEMBL354428 | 120474 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.1 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccc(Cl)cc1 | 10.1021/jm990378b | ||
9845562 | 4709 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(C)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10374 | 4709 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 430 | 5 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(C)cc2)cc1 | 10.1021/jm9606507 | ||
44279535 | 104109 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 527 | 11 | 5 | 4 | 3.2 | CC(C)C[C@H](NC(=O)N1C(C)CCCC1C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL30944 | 104109 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 527 | 11 | 5 | 4 | 3.2 | CC(C)C[C@H](NC(=O)N1C(C)CCCC1C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44314675 | 98100 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 603 | 13 | 5 | 4 | 5.0 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)CC)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL273583 | 98100 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 603 | 13 | 5 | 4 | 5.0 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)CC)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL2304005 | 209438 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | None | None | None | Cc1[nH]c2ccccc2c1C[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC1=O | 10.1021/jm9600914 | ||||
9955093 | 166272 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 443 | 7 | 1 | 5 | 5.2 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1Br | 10.1021/jm990378b | ||
CHEMBL427117 | 166272 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 443 | 7 | 1 | 5 | 5.2 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1Br | 10.1021/jm990378b | ||
10281606 | 129646 | 0 | None | - | 1 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 575 | 9 | 2 | 10 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL367382 | 129646 | 0 | None | - | 1 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 575 | 9 | 2 | 10 | 4.2 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
9809270 | 131314 | 0 | None | - | 2 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 622 | 14 | 2 | 12 | 2.3 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368738 | 131314 | 0 | None | - | 2 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 622 | 14 | 2 | 12 | 2.3 | CCCS(=O)(=O)NCCOc1nc(N2CCOCC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
10896930 | 9790 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2cccnn2)c1 | 10.1021/jm0102304 | ||
CHEMBL113888 | 9790 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 551 | 11 | 1 | 10 | 4.6 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2cccnn2)c1 | 10.1021/jm0102304 | ||
44373550 | 119824 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 331 | 3 | 2 | 5 | 2.1 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1Br | 10.1021/jm00004a012 | ||
CHEMBL348641 | 119824 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 331 | 3 | 2 | 5 | 2.1 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1Br | 10.1021/jm00004a012 | ||
10647182 | 109695 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 449 | 8 | 2 | 4 | 3.9 | CCCN(C)C(=O)CN1C[C@H](c2ccc3cc[nH]c3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL322935 | 109695 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 449 | 8 | 2 | 4 | 3.9 | CCCN(C)C(=O)CN1C[C@H](c2ccc3cc[nH]c3c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10579195 | 131313 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 584 | 10 | 5 | 4 | 5.7 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(-c2ccccc2)[nH]1 | 10.1021/jm950591h | ||
CHEMBL368711 | 131313 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 584 | 10 | 5 | 4 | 5.7 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(-c2ccccc2)[nH]1 | 10.1021/jm950591h | ||
10531664 | 168518 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 601 | 10 | 4 | 5 | 6.4 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(-c2ccccc2)s1 | 10.1021/jm950591h | ||
CHEMBL435537 | 168518 | 0 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 601 | 10 | 4 | 5 | 6.4 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(-c2ccccc2)s1 | 10.1021/jm950591h | ||
9897092 | 59906 | 0 | None | - | 1 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 779 | 17 | 2 | 13 | 6.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2cc(OC)c(OC)c(OC)c2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL173201 | 59906 | 0 | None | - | 1 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 779 | 17 | 2 | 13 | 6.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2cc(OC)c(OC)c(OC)c2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
23445523 | 59991 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 472 | 6 | 1 | 8 | 3.9 | Cc1noc(NS(=O)(=O)c2sccc2COc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL173557 | 59991 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 472 | 6 | 1 | 8 | 3.9 | Cc1noc(NS(=O)(=O)c2sccc2COc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
9961347 | 11930 | 1 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 664 | 13 | 2 | 7 | 6.6 | Cc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL1182945 | 11930 | 1 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 664 | 13 | 2 | 7 | 6.6 | Cc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL273642 | 11930 | 1 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 664 | 13 | 2 | 7 | 6.6 | Cc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
10764220 | 207061 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 413 | 8 | 1 | 6 | 3.3 | CCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9189 | 207061 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 413 | 8 | 1 | 6 | 3.3 | CCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10907399 | 202933 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 516 | 11 | 1 | 6 | 6.8 | CCCCOc1ccc(C2Oc3ccc(OCCCC)cc3C(c3ccc4c(c3)OCO4)=C2C(=O)O)cc1 | 10.1021/jm010382z | ||
CHEMBL62976 | 202933 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 516 | 11 | 1 | 6 | 6.8 | CCCCOc1ccc(C2Oc3ccc(OCCCC)cc3C(c3ccc4c(c3)OCO4)=C2C(=O)O)cc1 | 10.1021/jm010382z | ||
10745212 | 131521 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 548 | 10 | 5 | 4 | 4.9 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C2CC2)[nH]1 | 10.1021/jm950591h | ||
CHEMBL369257 | 131521 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 548 | 10 | 5 | 4 | 4.9 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C2CC2)[nH]1 | 10.1021/jm950591h | ||
10550844 | 97280 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 435 | 5 | 1 | 6 | 3.7 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)c2ccco2)cc1 | 10.1021/jm9505369 | ||
CHEMBL269140 | 97280 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 435 | 5 | 1 | 6 | 3.7 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2C(=O)c2ccco2)cc1 | 10.1021/jm9505369 | ||
10548721 | 59628 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 395 | 8 | 1 | 6 | 4.4 | COc1ccccc1C(Oc1cc(OCc2ccsc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL172164 | 59628 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 395 | 8 | 1 | 6 | 4.4 | COc1ccccc1C(Oc1cc(OCc2ccsc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
44316768 | 205220 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 358 | 4 | 1 | 4 | 3.4 | CCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78830 | 205220 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 358 | 4 | 1 | 4 | 3.4 | CCc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
44279458 | 99690 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 531 | 13 | 6 | 5 | 2.0 | CC(C)C[C@H](NC(=O)N(CCO)C(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL284785 | 99690 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 531 | 13 | 6 | 5 | 2.0 | CC(C)C[C@H](NC(=O)N(CCO)C(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
9910709 | 59318 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 433 | 7 | 1 | 5 | 5.4 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1C(F)(F)F | 10.1021/jm990378b | ||
CHEMBL170715 | 59318 | 0 | None | - | 0 | Rat | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 433 | 7 | 1 | 5 | 5.4 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1C(F)(F)F | 10.1021/jm990378b | ||
10144372 | 166030 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 562 | 10 | 2 | 11 | 3.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL425682 | 166030 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 562 | 10 | 2 | 11 | 3.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ncccn2)nc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
10344511 | 59653 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 466 | 5 | 1 | 5 | 5.7 | Cc1cc(C)c(/C=C/c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL172248 | 59653 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 466 | 5 | 1 | 5 | 5.7 | Cc1cc(C)c(/C=C/c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
44279290 | 107001 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 547 | 11 | 5 | 4 | 3.0 | CC(C)C[C@H](NC(=O)N1CCc2ccccc2C1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31546 | 107001 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 547 | 11 | 5 | 4 | 3.0 | CC(C)C[C@H](NC(=O)N1CCc2ccccc2C1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10971076 | 202840 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 386 | 3 | 1 | 4 | 4.7 | Cc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm010382z | ||
CHEMBL62585 | 202840 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 386 | 3 | 1 | 4 | 4.7 | Cc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm010382z | ||
44279128 | 106885 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 428 | 4 | 2 | 4 | 4.2 | COc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL31469 | 106885 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 428 | 4 | 2 | 4 | 4.2 | COc1ccc(-c2ccc3c(c2)C(=O)c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@H]32)cc1 | 10.1016/0960-894X(95)00230-Q | ||
44298393 | 199808 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 432 | 6 | 1 | 6 | 5.2 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2C)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL59425 | 199808 | 0 | None | - | 0 | Rat | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 432 | 6 | 1 | 6 | 5.2 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2C)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL136583 | 208716 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10546317 | 207143 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 358 | 8 | 1 | 2 | 5.7 | O=C(O)CC/C(=C/c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL92402 | 207143 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 358 | 8 | 1 | 2 | 5.7 | O=C(O)CC/C(=C/c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
10106336 | 97878 | 8 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 254 | 3 | 2 | 5 | 1.5 | Cc1cc(NS(=O)(=O)c2ccc(O)cc2)no1 | 10.1021/jm00008a013 | ||
CHEMBL27248 | 97878 | 8 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 254 | 3 | 2 | 5 | 1.5 | Cc1cc(NS(=O)(=O)c2ccc(O)cc2)no1 | 10.1021/jm00008a013 | ||
18617394 | 105602 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 294 | 3 | 1 | 4 | 3.0 | Cc1cc(C)c(S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL312372 | 105602 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 294 | 3 | 1 | 4 | 3.0 | Cc1cc(C)c(S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/0960-894X(96)00441-6 | ||
10106336 | 97878 | 8 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 254 | 3 | 2 | 5 | 1.5 | Cc1cc(NS(=O)(=O)c2ccc(O)cc2)no1 | 10.1021/jm00004a012 | ||
CHEMBL27248 | 97878 | 8 | None | - | 0 | Rat | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 254 | 3 | 2 | 5 | 1.5 | Cc1cc(NS(=O)(=O)c2ccc(O)cc2)no1 | 10.1021/jm00004a012 | ||
10815167 | 101166 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 497 | 7 | 2 | 6 | 5.4 | CCC(C)c1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
CHEMBL295697 | 101166 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 497 | 7 | 2 | 6 | 5.4 | CCC(C)c1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1021/jm9608366 | ||
23445313 | 165613 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 470 | 6 | 1 | 6 | 5.1 | Cc1cc(C)c(OCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL424371 | 165613 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 470 | 6 | 1 | 6 | 5.1 | Cc1cc(C)c(OCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
44279516 | 99823 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 512 | 13 | 5 | 5 | 2.6 | CC(C)C[C@H](NC(=O)Cc1cccs1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL285729 | 99823 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 512 | 13 | 5 | 5 | 2.6 | CC(C)C[C@H](NC(=O)Cc1cccs1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL96822 | 215897 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NS(C)(=O)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10426645 | 163051 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL417651 | 163051 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1C | 10.1021/jm00008a013 | ||
44291602 | 101153 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 515 | 8 | 2 | 10 | 3.6 | COC(=O)c1cc(OC)cc(OC)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm9608366 | ||
CHEMBL295632 | 101153 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 515 | 8 | 2 | 10 | 3.6 | COC(=O)c1cc(OC)cc(OC)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl | 10.1021/jm9608366 | ||
44279409 | 99831 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 555 | 11 | 5 | 4 | 4.0 | CC(C)C[C@H](NC(=O)N1CCCCCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL285782 | 99831 | 0 | None | - | 0 | Pig | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 555 | 11 | 5 | 4 | 4.0 | CC(C)C[C@H](NC(=O)N1CCCCCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
23445533 | 60382 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.0 | Cc1ccc(CCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL175045 | 60382 | 0 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.0 | Cc1ccc(CCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
18617354 | 205454 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80507 | 205454 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
23445445 | 102633 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 377 | 5 | 2 | 6 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1C | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL304481 | 102633 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 377 | 5 | 2 | 6 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccccc2)c1C | 10.1016/S0960-894X(97)00367-3 | ||
127034917 | 136510 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 654 | 12 | 2 | 8 | 6.2 | CCCc1nc2c(C)cc(C(=O)NCCN3CCCC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3736507 | 136510 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 654 | 12 | 2 | 8 | 6.2 | CCCc1nc2c(C)cc(C(=O)NCCN3CCCC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44266628 | 4733 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 417 | 5 | 1 | 6 | 4.7 | COc1cccc(-c2c(C(=O)O)n(-c3ccc4c(c3)OCO4)c3ccc(OC)cc23)c1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10388 | 4733 | 0 | None | - | 0 | Human | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 417 | 5 | 1 | 6 | 4.7 | COc1cccc(-c2c(C(=O)O)n(-c3ccc4c(c3)OCO4)c3ccc(OC)cc23)c1 | 10.1016/0960-894X(96)00170-9 | ||
127035545 | 136344 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 721 | 14 | 2 | 9 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3734955 | 136344 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 721 | 14 | 2 | 9 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
11797486 | 12011 | 1 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 442 | 6 | 2 | 8 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL1183448 | 12011 | 1 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 442 | 6 | 2 | 8 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
CHEMBL297557 | 12011 | 1 | None | - | 0 | Human | 7.3 | pIC50 | = | 7.3 | Binding | ChEMBL | 442 | 6 | 2 | 8 | 3.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(O)Cc2ccc3c(c2)OCO3)c1Cl | 10.1021/jm9700068 | ||
44279325 | 111598 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 501 | 12 | 6 | 4 | 2.5 | CC(C)C[C@H](NC(=O)NCC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL32845 | 111598 | 0 | None | - | 0 | Pig | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 501 | 12 | 6 | 4 | 2.5 | CC(C)C[C@H](NC(=O)NCC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
76326542 | 85313 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 504 | 7 | 1 | 6 | 5.2 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccccc21 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261356 | 85313 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 504 | 7 | 1 | 6 | 5.2 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccccc21 | 10.1007/s00044-004-0021-y | ||
10337624 | 100070 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N(C)C)cc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL287451 | 100070 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N(C)C)cc23)c1C | 10.1021/jm00008a013 | ||
15340616 | 106807 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 420 | 4 | 1 | 6 | 3.3 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1ccc2c(c1)OCO2 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144602 | 106807 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 420 | 4 | 1 | 6 | 3.3 | O=c1c(Cc2ccc3c(c2)OCO3)c(C(F)(F)F)[nH]n1Cc1ccc2c(c1)OCO2 | 10.1016/s0960-894x(00)00232-8 | ||
10337624 | 100070 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N(C)C)cc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL287451 | 100070 | 0 | None | - | 0 | Rat | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3ccc(N(C)C)cc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL137011 | 208720 | 0 | None | - | 0 | Pig | 5.3 | pIC50 | = | 5.3 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC2CCCCC2)NC1=O | 10.1021/jm00021a021 | ||||
127034757 | 136370 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 679 | 12 | 2 | 7 | 7.5 | CCCc1nc2c(C)cc(C(=O)NCCc3ccc(F)cc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735265 | 136370 | 0 | None | - | 0 | Human | 4.3 | pIC50 | = | 4.3 | Binding | ChEMBL | 679 | 12 | 2 | 7 | 7.5 | CCCc1nc2c(C)cc(C(=O)NCCc3ccc(F)cc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
10185233 | 60032 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 497 | 8 | 2 | 8 | 3.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL173721 | 60032 | 0 | None | - | 0 | Human | 6.3 | pIC50 | = | 6.3 | Binding | ChEMBL | 497 | 8 | 2 | 8 | 3.8 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCC#CCO | 10.1016/s0960-894x(02)01084-3 | ||
44279145 | 110517 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 515 | 13 | 5 | 4 | 3.0 | CC(C)C[C@H](NC(=O)N(C(C)C)C(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL32518 | 110517 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 515 | 13 | 5 | 4 | 3.0 | CC(C)C[C@H](NC(=O)N(C(C)C)C(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44295097 | 14731 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 604 | 13 | 1 | 9 | 7.0 | COc1ccc(C(=O)/C(Cc2cc(OC(C)C)c(OC(C)C)c(OC(C)C)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206461 | 14731 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 604 | 13 | 1 | 9 | 7.0 | COc1ccc(C(=O)/C(Cc2cc(OC(C)C)c(OC(C)C)c(OC(C)C)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL276362 | 14731 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 604 | 13 | 1 | 9 | 7.0 | COc1ccc(C(=O)/C(Cc2cc(OC(C)C)c(OC(C)C)c(OC(C)C)c2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
10621170 | 11208 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 402 | 5 | 2 | 8 | 3.0 | Cc1cc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)no1 | 10.1021/jm9608366 | ||
CHEMBL1178890 | 11208 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 402 | 5 | 2 | 8 | 3.0 | Cc1cc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)no1 | 10.1021/jm9608366 | ||
CHEMBL48120 | 11208 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 402 | 5 | 2 | 8 | 3.0 | Cc1cc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)no1 | 10.1021/jm9608366 | ||
CHEMBL149091 | 208763 | 0 | None | - | 0 | Mouse | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
10549815 | 61584 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 416 | 8 | 1 | 4 | 5.0 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc(C)cc2)cc1 | 10.1021/jm031041j | ||
CHEMBL177123 | 61584 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 416 | 8 | 1 | 4 | 5.0 | COc1ccc(C/C(C(=O)c2ccc(OC)cc2)=C(/C(=O)O)c2ccc(C)cc2)cc1 | 10.1021/jm031041j | ||
10047521 | 8598 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 416 | 6 | 1 | 5 | 4.4 | COc1ccc(CC2=C(c3ccc(C)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10951 | 8598 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 416 | 6 | 1 | 5 | 4.4 | COc1ccc(CC2=C(c3ccc(C)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
10815883 | 59554 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 522 | 9 | 5 | 4 | 4.3 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL171855 | 59554 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 522 | 9 | 5 | 4 | 4.3 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
10815883 | 59554 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 522 | 9 | 5 | 4 | 4.3 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL171855 | 59554 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 522 | 9 | 5 | 4 | 4.3 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
10043017 | 99253 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 4 | 1 | 4 | 4.3 | C=C(C)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00029a001 | ||
CHEMBL281942 | 99253 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 4 | 1 | 4 | 4.3 | C=C(C)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00029a001 | ||
10043017 | 99253 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 4 | 1 | 4 | 4.3 | C=C(C)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL281942 | 99253 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 4 | 1 | 4 | 4.3 | C=C(C)c1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
234762 | 99975 | 31 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 256 | 3 | 2 | 6 | 0.9 | Nc1ccc(S(=O)(=O)Nc2nncs2)cc1 | 10.1021/jm00008a013 | ||
CHEMBL286737 | 99975 | 31 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 256 | 3 | 2 | 6 | 0.9 | Nc1ccc(S(=O)(=O)Nc2nncs2)cc1 | 10.1021/jm00008a013 | ||
44332807 | 107208 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 447 | 5 | 0 | 5 | 6.0 | O=C(OCc1ccccc1)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL316792 | 107208 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 447 | 5 | 0 | 5 | 6.0 | O=C(OCc1ccccc1)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
10649086 | 175229 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 500 | 5 | 3 | 8 | 4.0 | Cc1noc(NS(=O)(=O)c2ccsc2NC(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL45723 | 175229 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 500 | 5 | 3 | 8 | 4.0 | Cc1noc(NS(=O)(=O)c2ccsc2NC(=O)Nc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
18995998 | 162367 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 523 | 9 | 1 | 9 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3cc(OC)c4c(c3)OCO4)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL416570 | 162367 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 523 | 9 | 1 | 9 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3cc(OC)c4c(c3)OCO4)c3cc(OC)c(OC)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
44293631 | 167779 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 463 | 7 | 2 | 7 | 4.1 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL430572 | 167779 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 463 | 7 | 2 | 7 | 4.1 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL328942 | 211293 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm970161m | ||||
44265858 | 167568 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 509 | 12 | 1 | 6 | 4.1 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(N)=O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL430084 | 167568 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 509 | 12 | 1 | 6 | 4.1 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(N)=O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44386144 | 61954 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 555 | 9 | 3 | 7 | 5.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)n2ccc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL177431 | 61954 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 555 | 9 | 3 | 7 | 5.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)n2ccc3ccccc32)nc1C(=O)O | 10.1021/jm950592+ | ||
23445336 | 60146 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 468 | 6 | 1 | 5 | 5.3 | Cc1cc(C)c(CCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL173977 | 60146 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 468 | 6 | 1 | 5 | 5.3 | Cc1cc(C)c(CCc2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL2370070 | 209756 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL216082 | 209294 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10426645 | 163051 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL417651 | 163051 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc(-c3ccccc3)c2)c1C | 10.1016/0960-894X(96)00441-6 | ||
44279333 | 106193 | 0 | None | - | 0 | Pig | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 513 | 11 | 5 | 4 | 2.6 | CC(C)C[C@H](NC(=O)N1CCC(C)CC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31388 | 106193 | 0 | None | - | 0 | Pig | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 513 | 11 | 5 | 4 | 2.6 | CC(C)C[C@H](NC(=O)N1CCC(C)CC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44294580 | 14603 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 502 | 8 | 1 | 7 | 5.8 | COc1ccc(C(=O)/C(Cc2ccc(OC(C)(C)C)cc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205104 | 14603 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 502 | 8 | 1 | 7 | 5.8 | COc1ccc(C(=O)/C(Cc2ccc(OC(C)(C)C)cc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL52338 | 14603 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 502 | 8 | 1 | 7 | 5.8 | COc1ccc(C(=O)/C(Cc2ccc(OC(C)(C)C)cc2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
127034916 | 136375 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 668 | 12 | 2 | 8 | 6.6 | CCCc1nc2c(C)cc(C(=O)NCCN3CCCCC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735302 | 136375 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 668 | 12 | 2 | 8 | 6.6 | CCCc1nc2c(C)cc(C(=O)NCCN3CCCCC3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL432091 | 213609 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
44384723 | 130861 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 563 | 13 | 2 | 10 | 3.0 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL368528 | 130861 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 563 | 13 | 2 | 10 | 3.0 | CCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
9853025 | 59787 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 690 | 14 | 2 | 13 | 3.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172759 | 59787 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 690 | 14 | 2 | 13 | 3.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
44320212 | 106973 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 520 | 9 | 2 | 7 | 4.7 | O=C(O)COc1ccccc1Cn1nc(-c2ccccc2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315280 | 106973 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 520 | 9 | 2 | 7 | 4.7 | O=C(O)COc1ccccc1Cn1nc(-c2ccccc2)c(Cc2cc3c(cc2Cl)OCO3)c1C(=O)O | 10.1016/s0960-894x(00)00513-8 | ||
44386161 | 61246 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 573 | 9 | 1 | 9 | 5.6 | CCC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL176650 | 61246 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 573 | 9 | 1 | 9 | 5.6 | CCC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
18996000 | 99324 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 491 | 9 | 1 | 7 | 6.1 | CCCOc1ccc2c(Sc3cccc(OC)c3)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL282398 | 99324 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 491 | 9 | 1 | 7 | 6.1 | CCCOc1ccc2c(Sc3cccc(OC)c3)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2c1 | 10.1016/0960-894X(96)00232-6 | ||
10476492 | 169168 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 407 | 6 | 2 | 5 | 4.9 | Cc1noc(NS(=O)(=O)c2cccc3c(NCc4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL440653 | 169168 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 407 | 6 | 2 | 5 | 4.9 | Cc1noc(NS(=O)(=O)c2cccc3c(NCc4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL343379 | 211676 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
15453209 | 205108 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 358 | 3 | 1 | 4 | 3.5 | Cc1cc(C)c(S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL77962 | 205108 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 358 | 3 | 1 | 4 | 3.5 | Cc1cc(C)c(S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/0960-894X(96)00441-6 | ||
19347988 | 98856 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 316 | 4 | 1 | 4 | 4.8 | COc1cccc(Sc2c(C(=O)O)sc3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL27911 | 98856 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 316 | 4 | 1 | 4 | 4.8 | COc1cccc(Sc2c(C(=O)O)sc3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
10289348 | 9281 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 516 | 16 | 1 | 5 | 5.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(CCC)CCC | 10.1021/jm980217s | ||
CHEMBL111023 | 9281 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 516 | 16 | 1 | 5 | 5.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(CCC)CCC | 10.1021/jm980217s | ||
44215416 | 175056 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 649 | 11 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccnc(-c3noc(=S)[nH]3)c2)nc1OCC1CCCO1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4568468 | 175056 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 649 | 11 | 2 | 13 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccnc(-c3noc(=S)[nH]3)c2)nc1OCC1CCCO1 | 10.1016/j.bmcl.2016.06.014 | ||
44212539 | 204070 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 671 | 12 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL70203 | 204070 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 671 | 12 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
10739431 | 59550 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 394 | 7 | 1 | 5 | 4.4 | N#Cc1ccc(OCc2ccncc2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
CHEMBL171844 | 59550 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 394 | 7 | 1 | 5 | 4.4 | N#Cc1ccc(OCc2ccncc2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
10740501 | 60252 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 414 | 7 | 1 | 6 | 4.8 | Cc1ccccc1C(Oc1cc(OCc2ccc3ncoc3c2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL174235 | 60252 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 414 | 7 | 1 | 6 | 4.8 | Cc1ccccc1C(Oc1cc(OCc2ccc3ncoc3c2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
11799541 | 181245 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 499 | 8 | 3 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CCCO)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL47620 | 181245 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 499 | 8 | 3 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CCCO)OCO3)c1Cl | 10.1021/jm9608366 | ||
44212539 | 204070 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 671 | 12 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70203 | 204070 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 671 | 12 | 2 | 12 | 5.9 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311135 | 204167 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 607 | 11 | 2 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70800 | 204167 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 607 | 11 | 2 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44293720 | 182462 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 551 | 11 | 2 | 9 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL47868 | 182462 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 551 | 11 | 2 | 9 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10554539 | 101216 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 543 | 9 | 2 | 11 | 3.4 | CC(=O)OCCOc1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
CHEMBL296129 | 101216 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 543 | 9 | 2 | 11 | 3.4 | CC(=O)OCCOc1cc2c(cc1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm9608366 | ||
137647152 | 157626 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 581 | 10 | 2 | 9 | 4.8 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4081426 | 157626 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 581 | 10 | 2 | 9 | 4.8 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10429404 | 104851 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 372 | 5 | 1 | 4 | 3.7 | CCc1ccc(CC)c(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311138 | 104851 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 372 | 5 | 1 | 4 | 3.7 | CCc1ccc(CC)c(S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/0960-894X(96)00441-6 | ||
44320315 | 107030 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 496 | 7 | 2 | 7 | 5.0 | O=C(O)c1cccc(Cn2nc(-c3cccs3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL315638 | 107030 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 496 | 7 | 2 | 7 | 5.0 | O=C(O)c1cccc(Cn2nc(-c3cccs3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
11006147 | 12396 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 550 | 11 | 2 | 10 | 4.7 | COc1cccc(Oc2c(NCCOc3ncccn3)ncnc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 | 10.1021/jm0102304 | ||
CHEMBL1185931 | 12396 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 550 | 11 | 2 | 10 | 4.7 | COc1cccc(Oc2c(NCCOc3ncccn3)ncnc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 | 10.1021/jm0102304 | ||
CHEMBL442031 | 12396 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 550 | 11 | 2 | 10 | 4.7 | COc1cccc(Oc2c(NCCOc3ncccn3)ncnc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 | 10.1021/jm0102304 | ||
2809510 | 129280 | 5 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 362 | 5 | 1 | 7 | 2.8 | COC(=O)c1cc(S(=O)(=O)Nc2cccc(-c3cnco3)c2)oc1C | 10.1021/jm031041j | ||
CHEMBL367093 | 129280 | 5 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 362 | 5 | 1 | 7 | 2.8 | COC(=O)c1cc(S(=O)(=O)Nc2cccc(-c3cnco3)c2)oc1C | 10.1021/jm031041j | ||
10531650 | 168237 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 600 | 11 | 1 | 7 | 5.0 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)cc1 | 10.1021/jm970101g | ||
CHEMBL433842 | 168237 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 600 | 11 | 1 | 7 | 5.0 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)cc1 | 10.1021/jm970101g | ||
10918533 | 102816 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 536 | 8 | 1 | 6 | 6.8 | CC(C)Oc1ccc2c(c1)C(c1ccc(OCc3ccccc3)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL305577 | 102816 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 536 | 8 | 1 | 6 | 6.8 | CC(C)Oc1ccc2c(c1)C(c1ccc(OCc3ccccc3)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
52949155 | 18379 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 557 | 10 | 2 | 7 | 5.4 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271640 | 18379 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 557 | 10 | 2 | 7 | 5.4 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
44315008 | 102804 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 665 | 13 | 5 | 5 | 4.7 | CCSCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL305524 | 102804 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 665 | 13 | 5 | 5 | 4.7 | CCSCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
44458604 | 98585 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 559 | 6 | 2 | 7 | 3.7 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL276982 | 98585 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 559 | 6 | 2 | 7 | 3.7 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
10239569 | 14756 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 534 | 9 | 1 | 10 | 4.4 | COc1cc(C/C(C(=O)c2ccc3c(c2)OCO3)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206715 | 14756 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 534 | 9 | 1 | 10 | 4.4 | COc1cc(C/C(C(=O)c2ccc3c(c2)OCO3)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL299328 | 14756 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 534 | 9 | 1 | 10 | 4.4 | COc1cc(C/C(C(=O)c2ccc3c(c2)OCO3)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
52943105 | 18447 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 529 | 9 | 2 | 7 | 4.7 | CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1272190 | 18447 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 529 | 9 | 2 | 7 | 4.7 | CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
52943105 | 18447 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 529 | 9 | 2 | 7 | 4.7 | CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1272190 | 18447 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 529 | 9 | 2 | 7 | 4.7 | CCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
10137382 | 182160 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 427 | 5 | 3 | 7 | 3.8 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(O)c1 | 10.1021/jm9608366 | ||
CHEMBL47827 | 182160 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 427 | 5 | 3 | 7 | 3.8 | Cc1ccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(O)c1 | 10.1021/jm9608366 | ||
10527706 | 96972 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 454 | 8 | 1 | 6 | 3.1 | CCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL266594 | 96972 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 454 | 8 | 1 | 6 | 3.1 | CCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10671037 | 131418 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL273660 | 131418 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL369085 | 131418 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 8 | 1 | 6 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2cc(OC)c3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
10503525 | 5835 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10794 | 5835 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 6 | 1 | 7 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
44314609 | 204725 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 720 | 12 | 6 | 4 | 5.6 | CC(C)CC(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)N[C@H](Cc1c(Br)[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL74471 | 204725 | 0 | None | - | 0 | Pig | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 720 | 12 | 6 | 4 | 5.6 | CC(C)CC(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)N[C@H](Cc1c(Br)[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm9600914 | ||
71460535 | 81656 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 693 | 15 | 1 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)CCCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163711 | 81656 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 693 | 15 | 1 | 12 | 5.1 | COc1ccccc1Oc1c(NS(=O)(=O)CCCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
11826259 | 202882 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 437 | 8 | 1 | 7 | 4.5 | CC(C)Oc1ccc2c(c1)C(OCCCC#N)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL62759 | 202882 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 437 | 8 | 1 | 7 | 4.5 | CC(C)Oc1ccc2c(c1)C(OCCCC#N)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
71455139 | 81974 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 556 | 11 | 2 | 8 | 3.6 | O=S(=O)(NCc1ccccc1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccccc1 | 10.1021/jm3009103 | ||
CHEMBL2165331 | 81974 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 556 | 11 | 2 | 8 | 3.6 | O=S(=O)(NCc1ccccc1)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccccc1 | 10.1021/jm3009103 | ||
10697883 | 11207 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 548 | 8 | 3 | 10 | 2.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CNS(C)(=O)=O)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL1178885 | 11207 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 548 | 8 | 3 | 10 | 2.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CNS(C)(=O)=O)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL47828 | 11207 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 548 | 8 | 3 | 10 | 2.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CNS(C)(=O)=O)OCO3)c1Cl | 10.1021/jm9608366 | ||
21979601 | 81971 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 602 | 13 | 2 | 10 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)ncnc1OCCOc1ncc(Br)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2165328 | 81971 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 602 | 13 | 2 | 10 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)ncnc1OCCOc1ncc(Br)cn1 | 10.1016/j.bmcl.2016.06.014 | ||
71462248 | 81674 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 676 | 17 | 2 | 12 | 3.8 | COCCOc1nc(NS(=O)(=O)NCc2ccccc2)c(Oc2ccccc2OC)c(OCCOc2ncc(Br)cn2)n1 | 10.1021/jm3009103 | ||
CHEMBL2163728 | 81674 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 676 | 17 | 2 | 12 | 3.8 | COCCOc1nc(NS(=O)(=O)NCc2ccccc2)c(Oc2ccccc2OC)c(OCCOc2ncc(Br)cn2)n1 | 10.1021/jm3009103 | ||
21979601 | 81971 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 602 | 13 | 2 | 10 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)ncnc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2165328 | 81971 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 602 | 13 | 2 | 10 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)NCc2ccccc2)ncnc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
10360201 | 95657 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1onc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL25816 | 95657 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1onc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
9974857 | 97365 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 345 | 5 | 2 | 5 | 3.7 | CCNc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL26978 | 97365 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 345 | 5 | 2 | 5 | 3.7 | CCNc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL1788127 | 211093 | 8 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL313760 | 211093 | 8 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
10506868 | 63227 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.7 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL179138 | 63227 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 550 | 10 | 5 | 5 | 4.7 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
44266594 | 4170 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 491 | 8 | 1 | 8 | 4.8 | COc1ccc(-c2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OC)cc23)cc1OC | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10019 | 4170 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 491 | 8 | 1 | 8 | 4.8 | COc1ccc(-c2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OC)cc23)cc1OC | 10.1016/0960-894X(96)00170-9 | ||
44266646 | 98537 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 475 | 6 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL276638 | 98537 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 475 | 6 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00170-9 | ||
10577879 | 9237 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 520 | 9 | 0 | 9 | 4.5 | COc1ccc(C2(OC)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL11082 | 9237 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 520 | 9 | 0 | 9 | 4.5 | COc1ccc(C2(OC)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9606507 | ||
345351 | 9327 | 4 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 386 | 4 | 1 | 5 | 3.8 | O=C1OC(O)(c2ccccc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL11131 | 9327 | 4 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 386 | 4 | 1 | 5 | 3.8 | O=C1OC(O)(c2ccccc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
10763444 | 111620 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.0 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1ccccc1F | 10.1021/jm970847e | ||
CHEMBL328580 | 111620 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.0 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1[N+](=O)[O-])c1ccccc1F | 10.1021/jm970847e | ||
10597928 | 112738 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 6 | 1 | 3 | 5.9 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1Br)CO | 10.1021/jm970847e | ||
CHEMBL330543 | 112738 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 6 | 1 | 3 | 5.9 | Cc1ccccc1/C(=C\c1cc(OCc2ccsc2)ccc1Br)CO | 10.1021/jm970847e | ||
10690863 | 206840 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 375 | 7 | 1 | 4 | 4.8 | O=C(O)/C(=C/c1cc(OCc2ccccc2)ccc1[N+](=O)[O-])c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL90666 | 206840 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 375 | 7 | 1 | 4 | 4.8 | O=C(O)/C(=C/c1cc(OCc2ccccc2)ccc1[N+](=O)[O-])c1ccccc1 | 10.1021/jm970847e | ||
44277263 | 106810 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 440 | 5 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3cc4c(cc3Cl)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144605 | 106810 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 440 | 5 | 1 | 5 | 4.2 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3cc4c(cc3Cl)OCO4)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
10403526 | 101858 | 1 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cc(N)ccc3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL30075 | 101858 | 1 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cc(N)ccc3c2)c1C | 10.1021/jm00004a012 | ||
44270522 | 45776 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 744 | 15 | 1 | 10 | 8.2 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1ccc(CC(C)C)s1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL15310 | 45776 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 744 | 15 | 1 | 10 | 8.2 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1ccc(CC(C)C)s1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
44368390 | 45276 | 0 | None | - | 0 | Pig | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 475 | 9 | 2 | 6 | 3.9 | COc1ccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2ccc(O)cc2)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152654 | 45276 | 0 | None | - | 0 | Pig | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 475 | 9 | 2 | 6 | 3.9 | COc1ccc(CN(C(=O)/C=C/c2ccc3c(c2)OCO3)C(Cc2ccc(O)cc2)C(=O)O)cc1 | 10.1016/s0960-894x(01)00009-9 | ||
14673588 | 4375 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10143 | 4375 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00170-9 | ||
14673588 | 4375 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL10143 | 4375 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00232-6 | ||
10735178 | 207178 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 330 | 6 | 1 | 2 | 4.9 | O=C(O)/C(=C/c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL92607 | 207178 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 330 | 6 | 1 | 2 | 4.9 | O=C(O)/C(=C/c1cccc(OCc2ccccc2)c1)c1ccccc1 | 10.1021/jm970847e | ||
22998396 | 100787 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2ccsc2-c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL293232 | 100787 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2ccsc2-c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
22998396 | 100787 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2ccsc2-c2ccccc2)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL293232 | 100787 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2ccsc2-c2ccccc2)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
10685758 | 203087 | 2 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 302 | 4 | 2 | 6 | 1.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)O)c1C | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL64006 | 203087 | 2 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 302 | 4 | 2 | 6 | 1.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)O)c1C | 10.1016/S0960-894X(97)00367-3 | ||
192311 | 107247 | 4 | None | - | 1 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 513 | 11 | 5 | 4 | 2.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31702 | 107247 | 4 | None | - | 1 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 513 | 11 | 5 | 4 | 2.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10627805 | 16547 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 630 | 7 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(Br)cccc2Br)cc1 | 10.1021/jm990170q | ||
CHEMBL123926 | 16547 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 630 | 7 | 2 | 6 | 5.4 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(Br)cccc2Br)cc1 | 10.1021/jm990170q | ||
22467231 | 98263 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 515 | 6 | 1 | 7 | 4.5 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C#N)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL274758 | 98263 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 515 | 6 | 1 | 7 | 4.5 | CC(C)c1ccc(S(=O)(=O)NC(=O)C(c2ccc3c(c2)OCO3)c2cn(C)c3cc(C#N)ccc23)cc1 | 10.1016/s0960-894x(01)00660-6 | ||
52943235 | 18085 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 571 | 12 | 2 | 7 | 5.9 | CCCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1269101 | 18085 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 571 | 12 | 2 | 7 | 5.9 | CCCCCOc1ccc2c(c1)c(=O)c(Cc1cccc(C(=O)O)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
44332803 | 4675 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 335 | 3 | 0 | 5 | 3.6 | COC(=O)C(c1ccc2c(c1)OCO2)c1cc(C)nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103497 | 4675 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 335 | 3 | 0 | 5 | 3.6 | COC(=O)C(c1ccc2c(c1)OCO2)c1cc(C)nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
22998414 | 202993 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 422 | 5 | 1 | 9 | 3.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1C | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL63290 | 202993 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 422 | 5 | 1 | 9 | 3.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1C | 10.1016/S0960-894X(97)00367-3 | ||
9984393 | 60042 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 527 | 11 | 4 | 5 | 2.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00144-I | ||
CHEMBL173808 | 60042 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 527 | 11 | 4 | 5 | 2.8 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00144-I | ||
18617345 | 105177 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311461 | 105177 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 384 | 3 | 1 | 4 | 3.9 | Cc1noc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
10918216 | 202819 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 508 | 7 | 1 | 6 | 6.0 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OCc4ccccc4)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL62450 | 202819 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 508 | 7 | 1 | 6 | 6.0 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OCc4ccccc4)cc32)cc1 | 10.1021/jm010382z | ||
10576889 | 11204 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 485 | 6 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cccc(C(=O)O)c2)c1Br | 10.1021/jm9608366 | ||
CHEMBL1178864 | 11204 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 485 | 6 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cccc(C(=O)O)c2)c1Br | 10.1021/jm9608366 | ||
CHEMBL47008 | 11204 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 485 | 6 | 3 | 7 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cccc(C(=O)O)c2)c1Br | 10.1021/jm9608366 | ||
23445457 | 128998 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 470 | 6 | 1 | 6 | 5.1 | Cc1cc(C)c(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL367024 | 128998 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 470 | 6 | 1 | 6 | 5.1 | Cc1cc(C)c(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00132-7 | ||
23445304 | 131320 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 484 | 6 | 1 | 7 | 4.4 | Cc1cc2c(cc1CCc1sccc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL368780 | 131320 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 484 | 6 | 1 | 7 | 4.4 | Cc1cc2c(cc1CCc1sccc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL407771 | 212659 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CCCC[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
18995989 | 100527 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 583 | 9 | 1 | 9 | 6.6 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OCc1ccccc1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL29147 | 100527 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 583 | 9 | 1 | 9 | 6.6 | COc1cc2c(Sc3ccc4c(c3)OCO4)c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c2cc1OCc1ccccc1 | 10.1016/0960-894X(96)00232-6 | ||
10711546 | 205453 | 7 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2ccccc2Br)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80506 | 205453 | 7 | None | - | 1 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2ccccc2Br)c1C | 10.1016/0960-894X(96)00441-6 | ||
44279360 | 106563 | 0 | None | - | 0 | Pig | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 498 | 13 | 5 | 4 | 2.9 | CC(C)C[C@H](NC(=O)CC1CCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31426 | 106563 | 0 | None | - | 0 | Pig | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 498 | 13 | 5 | 4 | 2.9 | CC(C)C[C@H](NC(=O)CC1CCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10602475 | 60340 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 537 | 9 | 3 | 6 | 4.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL174658 | 60340 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 537 | 9 | 3 | 6 | 4.6 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
44327585 | 161759 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 992 | 26 | 9 | 8 | 5.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C1CCCCC1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL414082 | 161759 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 992 | 26 | 9 | 8 | 5.7 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C1CCCCC1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL2304017 | 209450 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CSC(C)(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(C#N)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
44298324 | 195846 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 448 | 7 | 2 | 7 | 4.4 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL55876 | 195846 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 448 | 7 | 2 | 7 | 4.4 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
23445457 | 128998 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 470 | 6 | 1 | 6 | 5.1 | Cc1cc(C)c(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL367024 | 128998 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 470 | 6 | 1 | 6 | 5.1 | Cc1cc(C)c(OCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
44383537 | 59219 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 388 | 4 | 2 | 5 | 3.4 | C/C=C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)[C@@]2(C)CCCC(C)(C)C12 | 10.1016/s0960-894x(00)00136-0 | ||
CHEMBL170335 | 59219 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 388 | 4 | 2 | 5 | 3.4 | C/C=C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)[C@@]2(C)CCCC(C)(C)C12 | 10.1016/s0960-894x(00)00136-0 | ||
127036867 | 137357 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 614 | 11 | 3 | 8 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3cccc(OC)c3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3753134 | 137357 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 614 | 11 | 3 | 8 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3cccc(OC)c3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
9896468 | 170645 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 703 | 13 | 2 | 10 | 6.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCCC(=O)Nc1ccccc1C(C)C | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4451582 | 170645 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 703 | 13 | 2 | 10 | 6.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(N2CCOCC2)nc1OCCC(=O)Nc1ccccc1C(C)C | 10.1016/j.bmcl.2016.06.014 | ||
10646616 | 203743 | 3 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 436 | 5 | 1 | 6 | 3.3 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6800 | 203743 | 3 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 436 | 5 | 1 | 6 | 3.3 | COc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
10555208 | 12373 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 578 | 9 | 2 | 6 | 5.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL1185774 | 12373 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 578 | 9 | 2 | 6 | 5.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
CHEMBL432227 | 12373 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 578 | 9 | 2 | 6 | 5.5 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)c2ccccc2C)cc1 | 10.1021/jm990171i | ||
10740507 | 129018 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 7 | 1 | 4 | 4.9 | CCc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
CHEMBL367032 | 129018 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 7 | 1 | 4 | 4.9 | CCc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1021/jm031041j | ||
10693110 | 98270 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 5 | 1 | 5 | 4.4 | CCc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL274805 | 98270 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 5 | 1 | 5 | 4.4 | CCc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
11733215 | 203113 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 459 | 6 | 1 | 6 | 4.6 | COc1ccc(C2=C(C(N)=O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64127 | 203113 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 459 | 6 | 1 | 6 | 4.6 | COc1ccc(C2=C(C(N)=O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
44298409 | 194975 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 490 | 10 | 2 | 7 | 5.2 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCCO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL54770 | 194975 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 490 | 10 | 2 | 7 | 5.2 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCCO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
44383771 | 59818 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 371 | 7 | 1 | 6 | 4.5 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccsc1 | 10.1021/jm990378b | ||
CHEMBL172879 | 59818 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 371 | 7 | 1 | 6 | 4.5 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccsc1 | 10.1021/jm990378b | ||
10717923 | 98665 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 439 | 5 | 2 | 6 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL277595 | 98665 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 439 | 5 | 2 | 6 | 4.7 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1016/S0960-894X(97)00133-9 | ||
10550094 | 203058 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 420 | 4 | 1 | 5 | 3.6 | Cc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6382 | 203058 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 420 | 4 | 1 | 5 | 3.6 | Cc1nc(Br)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
10740138 | 204067 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnc(Br)nc3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL7019 | 204067 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 406 | 4 | 1 | 5 | 3.3 | CN(C)c1cccc2c(S(=O)(=O)Nc3cnc(Br)nc3)cccc12 | 10.1021/jm9604585 | ||
44327890 | 141387 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 985 | 26 | 9 | 8 | 5.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)c1ccccc1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
CHEMBL384052 | 141387 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 985 | 26 | 9 | 8 | 5.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)c1ccccc1)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||
44298304 | 101528 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 503 | 10 | 2 | 7 | 4.7 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC(N)=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL298395 | 101528 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 503 | 10 | 2 | 7 | 4.7 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCCC(N)=O)c1 | 10.1016/s0960-894x(00)00366-8 | ||
10496523 | 203258 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 328 | 4 | 1 | 5 | 2.5 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncccn3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6468 | 203258 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 328 | 4 | 1 | 5 | 2.5 | CN(C)c1cccc2c(S(=O)(=O)Nc3ncccn3)cccc12 | 10.1021/jm9604585 | ||
17869231 | 14594 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 548 | 11 | 1 | 9 | 5.5 | COc1cc(C/C(C(=O)c2ccc(OC(C)C)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205061 | 14594 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 548 | 11 | 1 | 9 | 5.5 | COc1cc(C/C(C(=O)c2ccc(OC(C)C)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL48315 | 14594 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 548 | 11 | 1 | 9 | 5.5 | COc1cc(C/C(C(=O)c2ccc(OC(C)C)cc2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
9853077 | 59597 | 0 | None | - | 2 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 696 | 13 | 2 | 12 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172030 | 59597 | 0 | None | - | 2 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 696 | 13 | 2 | 12 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL1791008 | 208891 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(C)C)NC1=O | 10.1021/jm00021a021 | ||||
44327238 | 107380 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 497 | 8 | 1 | 8 | 3.1 | CCCc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
CHEMBL318017 | 107380 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 497 | 8 | 1 | 8 | 3.1 | CCCc1ccc(=O)n(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)n1 | 10.1016/S0960-894X(96)00617-8 | ||
44277036 | 170193 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 492 | 10 | 1 | 7 | 4.5 | COc1cccc(Cn2nc(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2OCCCC(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL444545 | 170193 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 492 | 10 | 1 | 7 | 4.5 | COc1cccc(Cn2nc(C(F)(F)F)c(Cc3ccc4c(c3)OCO4)c2OCCCC(=O)O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
44294712 | 14760 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 566 | 11 | 1 | 9 | 5.6 | COc1cc(C/C(C(=O)c2ccc(OC(C)C)c(F)c2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1206722 | 14760 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 566 | 11 | 1 | 9 | 5.6 | COc1cc(C/C(C(=O)c2ccc(OC(C)C)c(F)c2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL300201 | 14760 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 566 | 11 | 1 | 9 | 5.6 | COc1cc(C/C(C(=O)c2ccc(OC(C)C)c(F)c2)=C(/C(=O)O)c2ccc3nsnc3c2)cc(OC)c1OC | 10.1016/s0960-894x(98)00301-1 | ||
11071689 | 9429 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 549 | 11 | 1 | 8 | 5.8 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccccc2)c1 | 10.1021/jm0102304 | ||
CHEMBL111876 | 9429 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 549 | 11 | 1 | 8 | 5.8 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccccc2)c1 | 10.1021/jm0102304 | ||
23445468 | 11200 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 459 | 5 | 3 | 9 | 2.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(O)nn2)c1Br | 10.1021/jm9608366 | ||
CHEMBL1178818 | 11200 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 459 | 5 | 3 | 9 | 2.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(O)nn2)c1Br | 10.1021/jm9608366 | ||
CHEMBL44615 | 11200 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 459 | 5 | 3 | 9 | 2.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(O)nn2)c1Br | 10.1021/jm9608366 | ||
CHEMBL263295 | 210542 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
44279677 | 102199 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 478 | 2 | 2 | 3 | 4.0 | O=C1c2cc(Br)ccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(Br)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL30297 | 102199 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 478 | 2 | 2 | 3 | 4.0 | O=C1c2cc(Br)ccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(Br)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL147908 | 208758 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
23445412 | 102235 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 426 | 5 | 1 | 7 | 4.3 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL303203 | 102235 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 426 | 5 | 1 | 7 | 4.3 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c(C)c1 | 10.1016/S0960-894X(97)00367-3 | ||
44385942 | 61346 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2C)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL176913 | 61346 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2C)nc1C(=O)O | 10.1021/jm950592+ | ||
10449431 | 100006 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 332 | 4 | 1 | 5 | 3.3 | COc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00029a001 | ||
CHEMBL28692 | 100006 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 332 | 4 | 1 | 5 | 3.3 | COc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00029a001 | ||
44276828 | 96743 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 324 | 5 | 3 | 6 | 1.0 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)CN)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL26470 | 96743 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 324 | 5 | 3 | 6 | 1.0 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)CN)cc2)c1C | 10.1021/jm00008a013 | ||
10449431 | 100006 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 332 | 4 | 1 | 5 | 3.3 | COc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL28692 | 100006 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 332 | 4 | 1 | 5 | 3.3 | COc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL436884 | 213667 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
44383537 | 59219 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 388 | 4 | 2 | 5 | 3.4 | C/C=C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)[C@@]2(C)CCCC(C)(C)C12 | 10.1016/s0960-894x(00)00136-0 | ||
CHEMBL170335 | 59219 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 388 | 4 | 2 | 5 | 3.4 | C/C=C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(O)[C@]2(O)[C@@]2(C)CCCC(C)(C)C12 | 10.1016/s0960-894x(00)00136-0 | ||
6450144 | 122535 | 8 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 632 | 5 | 3 | 6 | 8.1 | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(COC(=O)/C=C/c4ccc(O)c(O)c4)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 | 10.1016/j.bmc.2015.06.055 | ||
CHEMBL3601500 | 122535 | 8 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 632 | 5 | 3 | 6 | 8.1 | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(COC(=O)/C=C/c4ccc(O)c(O)c4)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 | 10.1016/j.bmc.2015.06.055 | ||
11728313 | 163251 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 368 | 6 | 1 | 5 | 4.2 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL418667 | 163251 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 368 | 6 | 1 | 5 | 4.2 | CCCCOC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccccc21 | 10.1021/jm010382z | ||
CHEMBL2304008 | 209441 | 0 | None | - | 0 | Pig | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CSC(C)(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c(Br)[nH]c3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O | 10.1021/jm9600914 | ||||
19363918 | 14604 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 474 | 7 | 1 | 8 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc3c(c2)OCO3)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1205106 | 14604 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 474 | 7 | 1 | 8 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc3c(c2)OCO3)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL52535 | 14604 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 474 | 7 | 1 | 8 | 4.4 | COc1ccc(C(=O)/C(Cc2ccc3c(c2)OCO3)=C(\C(=O)O)c2ccc3nsnc3c2)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
44293927 | 101991 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 507 | 9 | 1 | 8 | 4.4 | CCOc1ccc2c(c1)[C@@H](c1cc(OC)c(OC)c(OC)c1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL301723 | 101991 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 507 | 9 | 1 | 8 | 4.4 | CCOc1ccc2c(c1)[C@@H](c1cc(OC)c(OC)c(OC)c1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
135884434 | 130539 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 628 | 10 | 2 | 12 | 5.2 | C#CCOc1nc(-c2ccnc(-c3noc(O)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368117 | 130539 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 628 | 10 | 2 | 12 | 5.2 | C#CCOc1nc(-c2ccnc(-c3noc(O)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
44386535 | 131339 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2cccc(F)c2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368853 | 131339 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2cccc(F)c2)nc1C(=O)O | 10.1021/jm950592+ | ||
10403526 | 101858 | 1 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cc(N)ccc3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL30075 | 101858 | 1 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cc(N)ccc3c2)c1C | 10.1021/jm00008a013 | ||
10815902 | 166187 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 523 | 10 | 5 | 5 | 4.6 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL426589 | 166187 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 523 | 10 | 5 | 5 | 4.6 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
44332578 | 4284 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 413 | 3 | 0 | 5 | 5.6 | CC(C)(C)OC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100874 | 4284 | 0 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 413 | 3 | 0 | 5 | 5.6 | CC(C)(C)OC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL431874 | 213605 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00070a001 | ||||
44279251 | 100033 | 0 | None | - | 0 | Pig | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 486 | 12 | 5 | 4 | 2.8 | CC(C)C[C@H](NC(=O)CC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL287141 | 100033 | 0 | None | - | 0 | Pig | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 486 | 12 | 5 | 4 | 2.8 | CC(C)C[C@H](NC(=O)CC(C)(C)C)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
10265127 | 96807 | 2 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(F)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL26522 | 96807 | 2 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(F)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL3301647 | 211306 | 0 | None | - | 0 | Pig | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](C(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
10880982 | 102739 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 296 | 2 | 1 | 4 | 3.0 | O=C(O)C1=Cc2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
CHEMBL305149 | 102739 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 296 | 2 | 1 | 4 | 3.0 | O=C(O)C1=Cc2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
10880982 | 102739 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 296 | 2 | 1 | 4 | 3.0 | O=C(O)C1=Cc2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
CHEMBL305149 | 102739 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 296 | 2 | 1 | 4 | 3.0 | O=C(O)C1=Cc2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
CHEMBL385492 | 212329 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00015a003 | ||||
10737416 | 59694 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 363 | 7 | 1 | 5 | 4.2 | Cc1ccccc1C(Oc1cc(OCc2ccoc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL172412 | 59694 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 363 | 7 | 1 | 5 | 4.2 | Cc1ccccc1C(Oc1cc(OCc2ccoc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
44293526 | 101330 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 563 | 11 | 2 | 8 | 4.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(C)(C)C(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL296974 | 101330 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 563 | 11 | 2 | 8 | 4.9 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCC(C)(C)C(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10336018 | 102081 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 318 | 3 | 2 | 5 | 3.0 | Cc1noc(NS(=O)(=O)c2cccc3c(O)cccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL30228 | 102081 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 318 | 3 | 2 | 5 | 3.0 | Cc1noc(NS(=O)(=O)c2cccc3c(O)cccc23)c1C | 10.1021/jm00004a012 | ||
22998438 | 203056 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 456 | 5 | 1 | 7 | 4.1 | Cc1ccccc1OC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL63805 | 203056 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 456 | 5 | 1 | 7 | 4.1 | Cc1ccccc1OC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
10602451 | 61723 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 536 | 11 | 3 | 6 | 5.1 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)CC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL177179 | 61723 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 536 | 11 | 3 | 6 | 5.1 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)CC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
1011 | 3327 | 29 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 609 | 12 | 3 | 10 | 4.8 | OC[C@H](COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ccc(cc1)OC)O | 10.1016/j.bmcl.2016.06.014 | ||
5312146 | 3327 | 29 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 609 | 12 | 3 | 10 | 4.8 | OC[C@H](COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ccc(cc1)OC)O | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL1628620 | 3327 | 29 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 609 | 12 | 3 | 10 | 4.8 | OC[C@H](COc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ccc(cc1)OC)O | 10.1016/j.bmcl.2016.06.014 | ||
10531851 | 59722 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 614 | 11 | 3 | 7 | 5.3 | CC(C)C[C@H](NC(=O)N1CCCCCC1)c1nc(C(=O)N[C@H](Cc2ccccn2)C(=O)O)c(Cc2cn(C)c3ccccc23)o1 | 10.1021/jm950591h | ||
CHEMBL172506 | 59722 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 614 | 11 | 3 | 7 | 5.3 | CC(C)C[C@H](NC(=O)N1CCCCCC1)c1nc(C(=O)N[C@H](Cc2ccccn2)C(=O)O)c(Cc2cn(C)c3ccccc23)o1 | 10.1021/jm950591h | ||
10529715 | 207127 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)CC(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9228 | 207127 | 0 | None | - | 0 | Rat | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)CC(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10694547 | 207052 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 443 | 10 | 1 | 7 | 2.9 | COCCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL9183 | 207052 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 443 | 10 | 1 | 7 | 2.9 | COCCOCCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10836835 | 97072 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 440 | 7 | 2 | 5 | 3.8 | CCCCNC(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL267483 | 97072 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 440 | 7 | 2 | 5 | 3.8 | CCCCNC(=O)N1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10599453 | 207249 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 445 | 9 | 1 | 6 | 5.2 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL93097 | 207249 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 445 | 9 | 1 | 6 | 5.2 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N | 10.1021/jm9707131 | ||
5340 | 168706 | 106 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | 10.1021/jm00008a013 | ||
CHEMBL437 | 168706 | 106 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | 10.1021/jm00008a013 | ||
5340 | 168706 | 106 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | 10.1021/jm030480f | ||
CHEMBL437 | 168706 | 106 | None | - | 0 | Human | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | 10.1021/jm030480f | ||
18995991 | 100272 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 537 | 8 | 1 | 10 | 5.0 | COc1cc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc(OC)c1OC | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL28920 | 100272 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 537 | 8 | 1 | 10 | 5.0 | COc1cc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)cc(OC)c1OC | 10.1016/0960-894X(96)00232-6 | ||
10649585 | 109746 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 518 | 14 | 1 | 7 | 3.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCC1OCCO1 | 10.1021/jm980217s | ||
CHEMBL323175 | 109746 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 518 | 14 | 1 | 7 | 3.9 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCCC1OCCO1 | 10.1021/jm980217s | ||
22574723 | 15906 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 549 | 11 | 2 | 7 | 5.2 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CC)c1 | 10.1039/C4MD00499J | ||
CHEMBL12233 | 15906 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 549 | 11 | 2 | 7 | 5.2 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CC)c1 | 10.1039/C4MD00499J | ||
20747575 | 98396 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 579 | 12 | 2 | 8 | 5.0 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COC)c1 | 10.1039/C4MD00499J | ||
CHEMBL275545 | 98396 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 579 | 12 | 2 | 8 | 5.0 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COC)c1 | 10.1039/C4MD00499J | ||
71455064 | 81667 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 694 | 14 | 1 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)N(C)Cc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163721 | 81667 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 694 | 14 | 1 | 12 | 4.5 | COc1ccccc1Oc1c(NS(=O)(=O)N(C)Cc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
10693270 | 60039 | 1 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL172144 | 60039 | 1 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173792 | 60039 | 1 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1C(Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10601191 | 112777 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 492 | 11 | 3 | 6 | 5.7 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1cc(C(=O)O)[nH]n1 | 10.1021/jm9707131 | ||
CHEMBL330679 | 112777 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 492 | 11 | 3 | 6 | 5.7 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1-c1cc(C(=O)O)[nH]n1 | 10.1021/jm9707131 | ||
22010244 | 206778 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL90320 | 206778 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm9707131 | ||
10740214 | 207281 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 408 | 9 | 1 | 6 | 4.9 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2cnsc2)ccc1C#N | 10.1021/jm9707131 | ||
CHEMBL93331 | 207281 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 408 | 9 | 1 | 6 | 4.9 | Cc1ccccc1[C@@H](CCC(=O)O)Oc1cc(OCc2cnsc2)ccc1C#N | 10.1021/jm9707131 | ||
10190108 | 130672 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 681 | 12 | 2 | 12 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL368386 | 130672 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 681 | 12 | 2 | 12 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccncc2)nc1OCC#CCOC(=O)Nc1ccccn1 | 10.1016/s0960-894x(02)01084-3 | ||
44333887 | 108598 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 7 | 2 | 6 | 3.9 | CCNCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL320631 | 108598 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 446 | 7 | 2 | 6 | 3.9 | CCNCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
44311528 | 204119 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 633 | 12 | 2 | 10 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70487 | 204119 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 633 | 12 | 2 | 10 | 6.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C2CC2)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
44311284 | 204222 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 635 | 12 | 2 | 10 | 6.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL71070 | 204222 | 0 | None | - | 1 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 635 | 12 | 2 | 10 | 6.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C(C)C)nc1OCCOC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
137642741 | 158215 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 553 | 9 | 2 | 9 | 4.2 | CCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4088349 | 158215 | 0 | None | - | 0 | Human | 8.2 | pIC50 | = | 8.2 | Binding | ChEMBL | 553 | 9 | 2 | 9 | 4.2 | CCOc1ccc2c(c1)c(=O)c(Cc1cccc(-c3nnn[nH]3)c1)c(C(=O)O)n2Cc1cc2c(cc1CC)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10224228 | 179588 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 424 | 6 | 1 | 6 | 4.5 | Cc1ccc(C)c(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c1 | 10.1021/jm9700068 | ||
CHEMBL47424 | 179588 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 424 | 6 | 1 | 6 | 4.5 | Cc1ccc(C)c(CC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Cl)c1 | 10.1021/jm9700068 | ||
101039204 | 158903 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 610 | 7 | 6 | 6 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4095638 | 158903 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 610 | 7 | 6 | 6 | 0.8 | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1016/j.bmcl.2017.04.049 | ||
11742628 | 98207 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL274383 | 98207 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 5 | 1 | 6 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
9845967 | 11061 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL10801 | 11061 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL1178000 | 11061 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL51530 | 11061 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/S0960-894X(97)00002-4 | ||
52944276 | 18397 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 559 | 11 | 3 | 8 | 4.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCCCO)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271807 | 18397 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 559 | 11 | 3 | 8 | 4.1 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCCCO)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
9845967 | 11061 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL10801 | 11061 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL1178000 | 11061 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
CHEMBL51530 | 11061 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 416 | 7 | 1 | 5 | 4.4 | COc1ccc(C(=O)/C(Cc2ccccc2)=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1 | 10.1016/s0960-894x(98)00301-1 | ||
104865 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
3494 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
392 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
CHEMBL957 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
DB00559 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
10790686 | 5218 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 474 | 5 | 1 | 8 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc3c(c2)OCCO3)cc1 | 10.1021/jm9606507 | ||
CHEMBL10635 | 5218 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 474 | 5 | 1 | 8 | 3.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc3c(c2)OCCO3)cc1 | 10.1021/jm9606507 | ||
44458999 | 168204 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 525 | 6 | 2 | 7 | 3.3 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccc(Cl)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL433619 | 168204 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 525 | 6 | 2 | 7 | 3.3 | Cn1cc(C(C(=O)NS(=O)(=O)c2ccc(Cl)cc2)c2ccc3c(c2)OCO3)c2ccc(C(N)=O)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
104865 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(01)00682-5 | ||
3494 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(01)00682-5 | ||
392 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(01)00682-5 | ||
CHEMBL957 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(01)00682-5 | ||
DB00559 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/s0960-894x(01)00682-5 | ||
104865 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
3494 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
392 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
CHEMBL957 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
DB00559 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm0102304 | ||
44385593 | 129448 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 530 | 10 | 5 | 5 | 4.5 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL367208 | 129448 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 530 | 10 | 5 | 5 | 4.5 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
10553316 | 97047 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL267279 | 97047 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 496 | 11 | 1 | 6 | 4.3 | CCCCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
44439108 | 167090 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 1267 | 53 | 3 | 22 | 5.7 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC(=O)N(C)Cc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2ccno2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL429019 | 167090 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 1267 | 53 | 3 | 22 | 5.7 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC(=O)N(C)Cc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2ccno2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
71451527 | 81651 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 641 | 15 | 1 | 12 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(C2CC2)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163706 | 81651 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 641 | 15 | 1 | 12 | 4.8 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(C2CC2)cn1 | 10.1021/jm3009103 | ||
71462246 | 81662 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 604 | 12 | 2 | 12 | 2.6 | CNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163717 | 81662 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 604 | 12 | 2 | 12 | 2.6 | CNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
10667000 | 97143 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 372 | 5 | 1 | 6 | 2.8 | COc1nc(C)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
CHEMBL268174 | 97143 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 372 | 5 | 1 | 6 | 2.8 | COc1nc(C)cnc1NS(=O)(=O)c1cccc2c(N(C)C)cccc12 | 10.1021/jm9604585 | ||
10765171 | 7863 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc(OC)c(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10901 | 7863 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 432 | 7 | 1 | 6 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3ccc(OC)c(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
11798228 | 98468 | 2 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 461 | 6 | 1 | 8 | 3.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc([N+](=O)[O-])c2)cc1 | 10.1021/jm9606507 | ||
CHEMBL276018 | 98468 | 2 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 461 | 6 | 1 | 8 | 3.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cccc([N+](=O)[O-])c2)cc1 | 10.1021/jm9606507 | ||
9863916 | 60251 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 365 | 7 | 1 | 5 | 4.4 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1 | 10.1021/jm990378b | ||
CHEMBL174229 | 60251 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 365 | 7 | 1 | 5 | 4.4 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1ccccc1 | 10.1021/jm990378b | ||
44320432 | 206232 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 442 | 6 | 1 | 7 | 3.6 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1OCCO1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL86821 | 206232 | 0 | None | - | 0 | Rat | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 442 | 6 | 1 | 7 | 3.6 | O=C(O)c1c(Cc2cc3c(cc2Cl)OCO3)c(-c2ccccc2)nn1CC1OCCO1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL433893 | 213625 | 0 | None | - | 0 | Mouse | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
9980487 | 5238 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 436 | 6 | 1 | 5 | 4.8 | COc1ccc(CC2=C(c3ccc(Cl)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10648 | 5238 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 436 | 6 | 1 | 5 | 4.8 | COc1ccc(CC2=C(c3ccc(Cl)cc3)C(=O)OC2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm9606507 | ||
10692351 | 9362 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 400 | 5 | 0 | 5 | 4.7 | COc1ccc(C2OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL11152 | 9362 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 400 | 5 | 0 | 5 | 4.7 | COc1ccc(C2OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
10894688 | 203483 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1cccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)c1 | 10.1021/jm010382z | ||
CHEMBL66246 | 203483 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1cccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)c1 | 10.1021/jm010382z | ||
10835638 | 111529 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 6 | 1 | 3 | 5.7 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1Br)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL328057 | 111529 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 414 | 6 | 1 | 3 | 5.7 | O=C(O)/C(=C/c1cc(OCc2ccsc2)ccc1Br)c1ccccc1 | 10.1021/jm970847e | ||
10739089 | 111601 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 389 | 8 | 1 | 4 | 5.6 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/CCC(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL328464 | 111601 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 389 | 8 | 1 | 4 | 5.6 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/CCC(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL1793933 | 208908 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H]([C@@H](C)CC)N(C)C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm970161m | ||||
19010490 | 53505 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 648 | 13 | 1 | 9 | 6.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)C(C)C)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL16018 | 53505 | 0 | None | - | 0 | Human | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 648 | 13 | 1 | 9 | 6.3 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)C(C)C)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL85341 | 215865 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
127029203 | 137402 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 628 | 12 | 3 | 8 | 5.8 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3753458 | 137402 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 628 | 12 | 3 | 8 | 5.8 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
18617322 | 205437 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 350 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2Cl)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80438 | 205437 | 0 | None | - | 0 | Human | 7.2 | pIC50 | = | 7.2 | Binding | ChEMBL | 350 | 3 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2Cl)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44371531 | 164841 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 467 | 6 | 1 | 5 | 6.3 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3C(C)C)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL422002 | 164841 | 0 | None | - | 0 | Rat | 6.2 | pIC50 | = | 6.2 | Binding | ChEMBL | 467 | 6 | 1 | 5 | 6.3 | COc1ccc(-c2c(C(=O)O)c(=O)n(Cc3ccccc3C(C)C)c3c2oc2ccccc23)cc1 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL438768 | 213773 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)80156-6 | ||||
CHEMBL2370247 | 209790 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](C(c2ccccc2)c2ccccc2)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H]([C@@H](C)CC)NC1=O | 10.1021/jm00015a003 | ||||
127026040 | 137454 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 591 | 11 | 3 | 8 | 4.6 | CCCc1nc2c(C)cc(C(=O)NCCN3CCCC3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3753888 | 137454 | 0 | None | - | 0 | Human | 5.2 | pIC50 | = | 5.2 | Binding | ChEMBL | 591 | 11 | 3 | 8 | 4.6 | CCCc1nc2c(C)cc(C(=O)NCCN3CCCC3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
44298597 | 100810 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 343 | 5 | 2 | 5 | 3.0 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1Cc1ccccc1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL293376 | 100810 | 0 | None | - | 0 | Rat | 4.2 | pIC50 | = | 4.2 | Binding | ChEMBL | 343 | 5 | 2 | 5 | 3.0 | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1Cc1ccccc1 | 10.1016/s0960-894x(00)00366-8 | ||
18617333 | 105500 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 424 | 4 | 1 | 5 | 3.3 | COc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL312187 | 105500 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 424 | 4 | 1 | 5 | 3.3 | COc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44459247 | 87994 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 575 | 8 | 1 | 7 | 4.9 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)N(C)C)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
CHEMBL23444 | 87994 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 575 | 8 | 1 | 7 | 4.9 | CCn1cc(C(C(=O)NS(=O)(=O)c2ccc(C(C)C)cc2)c2ccc3c(c2)OCO3)c2ccc(C(=O)N(C)C)cc21 | 10.1016/s0960-894x(01)00660-6 | ||
44385127 | 61338 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 482 | 5 | 1 | 7 | 4.8 | Cc1cc2c(cc1/C=C/c1ccsc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL176854 | 61338 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 482 | 5 | 1 | 7 | 4.8 | Cc1cc2c(cc1/C=C/c1ccsc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
44316994 | 204927 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 266 | 3 | 1 | 4 | 2.4 | Cc1cccc(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL76420 | 204927 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 266 | 3 | 1 | 4 | 2.4 | Cc1cccc(S(=O)(=O)Nc2onc(C)c2C)c1 | 10.1016/0960-894X(96)00441-6 | ||
127036866 | 137244 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 614 | 11 | 3 | 8 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3752117 | 137244 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 614 | 11 | 3 | 8 | 5.7 | CCCc1nc2c(C)cc(C(=O)NCc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
18184256 | 129457 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 662 | 13 | 2 | 13 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367275 | 129457 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 662 | 13 | 2 | 13 | 3.0 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
71458720 | 81655 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 665 | 13 | 1 | 12 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)Cc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
CHEMBL2163710 | 81655 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 665 | 13 | 1 | 12 | 4.7 | COc1ccccc1Oc1c(NS(=O)(=O)Cc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncc(Br)cn1 | 10.1021/jm3009103 | ||
44384652 | 61255 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 582 | 8 | 1 | 9 | 5.2 | Cc1noc(NS(=O)(=O)c2sccc2/C=C/c2cc3c(cc2COC2CCOCC2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL176675 | 61255 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 582 | 8 | 1 | 9 | 5.2 | Cc1noc(NS(=O)(=O)c2sccc2/C=C/c2cc3c(cc2COC2CCOCC2)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL353605 | 211704 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)NC(C)(C)C(=O)O | 10.1016/0960-894X(95)00144-I | ||||
10672060 | 9228 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 470 | 10 | 1 | 6 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccc(OC)c(OC)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL110794 | 9228 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 470 | 10 | 1 | 6 | 3.4 | CCCN(C)C(=O)CN1C[C@H](c2ccc(OC)c(OC)c2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
10626501 | 128497 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 550 | 10 | 5 | 4 | 5.1 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C(C)C)[nH]1 | 10.1021/jm950591h | ||
CHEMBL366745 | 128497 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 550 | 10 | 5 | 4 | 5.1 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(C(C)C)[nH]1 | 10.1021/jm950591h | ||
10721386 | 60345 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 550 | 11 | 5 | 5 | 4.8 | CCn1cc(C[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)c2nc(C(=O)O)c(C)[nH]2)c2ccccc21 | 10.1021/jm950592+ | ||
CHEMBL174686 | 60345 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 550 | 11 | 5 | 5 | 4.8 | CCn1cc(C[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)c2nc(C(=O)O)c(C)[nH]2)c2ccccc21 | 10.1021/jm950592+ | ||
10603414 | 61035 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 585 | 10 | 4 | 5 | 5.9 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(-c2ccccc2)o1 | 10.1021/jm950591h | ||
CHEMBL176420 | 61035 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 585 | 10 | 4 | 5 | 5.9 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(-c2ccccc2)o1 | 10.1021/jm950591h | ||
71455061 | 81644 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 511 | 11 | 1 | 12 | 2.4 | COc1ccccc1Oc1c(NS(C)(=O)=O)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1021/jm3009103 | ||
CHEMBL2163699 | 81644 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 511 | 11 | 1 | 12 | 2.4 | COc1ccccc1Oc1c(NS(C)(=O)=O)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1021/jm3009103 | ||
11826173 | 202797 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC)cc32)cc1 | 10.1021/jm031041j | ||
CHEMBL62363 | 202797 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC)cc32)cc1 | 10.1021/jm031041j | ||
11826173 | 202797 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL62363 | 202797 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 432 | 5 | 1 | 6 | 4.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccc(OC)cc32)cc1 | 10.1021/jm010382z | ||
44385490 | 131782 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 532 | 10 | 4 | 7 | 4.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccn2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL369386 | 131782 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 532 | 10 | 4 | 7 | 4.2 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)Nc2ccccn2)nc1C(=O)O | 10.1021/jm950592+ | ||
10833686 | 203382 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 380 | 4 | 1 | 7 | 2.4 | COC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL65531 | 203382 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 380 | 4 | 1 | 7 | 2.4 | COC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
44266621 | 98534 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 387 | 4 | 1 | 5 | 4.7 | COc1ccc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(-c3ccccc3)c2c1 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL276615 | 98534 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 387 | 4 | 1 | 5 | 4.7 | COc1ccc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(-c3ccccc3)c2c1 | 10.1016/0960-894X(96)00170-9 | ||
10722389 | 12093 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 606 | 10 | 2 | 6 | 6.0 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL1184099 | 12093 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 606 | 10 | 2 | 6 | 6.0 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL332424 | 12093 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 606 | 10 | 2 | 6 | 6.0 | CCc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)c1ccccc1C | 10.1021/jm990171i | ||
10621704 | 59963 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 414 | 7 | 1 | 6 | 4.8 | Cc1ccccc1C(Oc1cc(OCc2ccc3ocnc3c2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173444 | 59963 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 414 | 7 | 1 | 6 | 4.8 | Cc1ccccc1C(Oc1cc(OCc2ccc3ocnc3c2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL151361 | 208770 | 0 | None | - | 0 | Mouse | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
44270498 | 98896 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 702 | 13 | 1 | 10 | 7.2 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(CC(C)C)s1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL279419 | 98896 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 702 | 13 | 1 | 10 | 7.2 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)NS(=O)(=O)c1ccc(CC(C)C)s1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
10577941 | 61328 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 522 | 10 | 6 | 4 | 4.3 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL176794 | 61328 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 522 | 10 | 6 | 4 | 4.3 | Cc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL2370070 | 209756 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
44276596 | 106815 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 458 | 8 | 1 | 6 | 4.2 | COc1ccc(Cc2[nH]n(Cc3cccc(OC)c3)c(=O)c2Cc2ccc3c(c2)OCO3)cc1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144728 | 106815 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 458 | 8 | 1 | 6 | 4.2 | COc1ccc(Cc2[nH]n(Cc3cccc(OC)c3)c(=O)c2Cc2ccc3c(c2)OCO3)cc1 | 10.1016/s0960-894x(00)00232-8 | ||
10477792 | 173780 | 2 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 430 | 8 | 0 | 7 | 3.7 | COC[C@@H]1Cc2cc3c(c(OC)c2[C@H](c2ccc(OC)c(OC)c2)[C@H]1COC)OCO3 | 10.1021/np50124a006 | ||
CHEMBL453822 | 173780 | 2 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 430 | 8 | 0 | 7 | 3.7 | COC[C@@H]1Cc2cc3c(c(OC)c2[C@H](c2ccc(OC)c(OC)c2)[C@H]1COC)OCO3 | 10.1021/np50124a006 | ||
10305181 | 60419 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 666 | 11 | 2 | 12 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)NC1CCCCC1 | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175278 | 60419 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 666 | 11 | 2 | 12 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)NC1CCCCC1 | 10.1016/s0960-894x(02)01084-3 | ||
10578300 | 129964 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)OC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL367645 | 129964 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)OC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
44279126 | 100699 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 466 | 3 | 2 | 3 | 5.5 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccc(Cl)cc3Cl)cc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL29265 | 100699 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 466 | 3 | 2 | 3 | 5.5 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccc(-c3ccc(Cl)cc3Cl)cc21 | 10.1016/0960-894X(95)00230-Q | ||
44284490 | 100198 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 616 | 13 | 3 | 5 | 3.9 | CNC(=O)[C@H](Cc1ccccn1)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)N(C)C(=O)[C@@H](CC(=O)N1CCCCCC1)CC(C)C | 10.1021/jm00087a001 | ||
CHEMBL288514 | 100198 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 616 | 13 | 3 | 5 | 3.9 | CNC(=O)[C@H](Cc1ccccn1)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)N(C)C(=O)[C@@H](CC(=O)N1CCCCCC1)CC(C)C | 10.1021/jm00087a001 | ||
CHEMBL1206620 | 208584 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H](NC(=O)N1CCCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)N(C)CC(=O)O | 10.1021/jm00087a001 | ||||
CHEMBL287980 | 208584 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H](NC(=O)N1CCCCCC1)C(=O)N(C)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccn1)C(=O)N(C)CC(=O)O | 10.1021/jm00087a001 | ||||
44332641 | 4708 | 0 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 384 | 4 | 0 | 4 | 5.2 | COC(=O)C(Cc1c2ccccc2cc2ccccc12)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL103731 | 4708 | 0 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 384 | 4 | 0 | 4 | 5.2 | COC(=O)C(Cc1c2ccccc2cc2ccccc12)c1ccc2c(c1)OCO2 | 10.1016/S0960-894X(96)00551-3 | ||
10598270 | 96915 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 421 | 6 | 1 | 5 | 4.1 | CCCC#CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL266144 | 96915 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 421 | 6 | 1 | 5 | 4.1 | CCCC#CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10744041 | 97273 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 502 | 8 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)Cc2ccccc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL269108 | 97273 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 502 | 8 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)N(C)Cc2ccccc2)cc1 | 10.1021/jm9505369 | ||
11101703 | 167894 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 412 | 7 | 1 | 5 | 5.3 | CCCC[C@@H]1c2cc(OC(C)C)ccc2O[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1021/jm031041j | ||
CHEMBL431372 | 167894 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 412 | 7 | 1 | 5 | 5.3 | CCCC[C@@H]1c2cc(OC(C)C)ccc2O[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1021/jm031041j | ||
11101703 | 167894 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 412 | 7 | 1 | 5 | 5.3 | CCCC[C@@H]1c2cc(OC(C)C)ccc2O[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1021/jm010382z | ||
CHEMBL431372 | 167894 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 412 | 7 | 1 | 5 | 5.3 | CCCC[C@@H]1c2cc(OC(C)C)ccc2O[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)O | 10.1021/jm010382z | ||
44293736 | 188127 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 463 | 7 | 2 | 7 | 4.1 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL49850 | 188127 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 463 | 7 | 2 | 7 | 4.1 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL147058 | 208754 | 0 | None | - | 0 | Mouse | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
9874557 | 129712 | 0 | None | - | 2 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 667 | 15 | 2 | 10 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL367443 | 129712 | 0 | None | - | 2 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 667 | 15 | 2 | 10 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(C2CC2)nc1OCCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
10516176 | 205177 | 3 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccccc2F)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78499 | 205177 | 3 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccccc2F)c1C | 10.1016/0960-894X(96)00441-6 | ||
44298278 | 194644 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 462 | 8 | 2 | 7 | 4.5 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL53168 | 194644 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 462 | 8 | 2 | 7 | 4.5 | COc1cccc(Sc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)noc2CCO)c1 | 10.1016/s0960-894x(00)00366-8 | ||
10626522 | 130257 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 551 | 11 | 4 | 5 | 5.2 | CCCc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL367989 | 130257 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 551 | 11 | 4 | 5 | 5.2 | CCCc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
9961347 | 11930 | 1 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 664 | 13 | 2 | 7 | 6.6 | Cc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL1182945 | 11930 | 1 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 664 | 13 | 2 | 7 | 6.6 | Cc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
CHEMBL273642 | 11930 | 1 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 664 | 13 | 2 | 7 | 6.6 | Cc1ccccc1C(NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OCCOC(C)C)cc1)c1ccccc1C | 10.1021/jm990171i | ||
137638953 | 156823 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 579 | 10 | 2 | 9 | 4.6 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC4CC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4071505 | 156823 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 579 | 10 | 2 | 9 | 4.6 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC4CC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
11728411 | 202858 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 372 | 3 | 1 | 4 | 4.4 | O=C(O)C1=C(c2ccccc2)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
CHEMBL62659 | 202858 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 372 | 3 | 1 | 4 | 4.4 | O=C(O)C1=C(c2ccccc2)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
5344 | 173449 | 101 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00029a001 | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00029a001 | ||
5344 | 173449 | 101 | None | - | 1 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00008a013 | ||
11728411 | 202858 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 372 | 3 | 1 | 4 | 4.4 | O=C(O)C1=C(c2ccccc2)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
CHEMBL62659 | 202858 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 372 | 3 | 1 | 4 | 4.4 | O=C(O)C1=C(c2ccccc2)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
5344 | 173449 | 101 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm030480f | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm030480f | ||
10334781 | 95981 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL25970 | 95981 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1C | 10.1021/jm00008a013 | ||
9983872 | 101696 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 511 | 9 | 2 | 5 | 6.9 | Cc1noc(NS(=O)(=O)c2cccc3c(NCCC(c4ccccc4)c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL29954 | 101696 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 511 | 9 | 2 | 5 | 6.9 | Cc1noc(NS(=O)(=O)c2cccc3c(NCCC(c4ccccc4)c4ccccc4)cccc23)c1C | 10.1021/jm00008a013 | ||
10336018 | 102081 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 318 | 3 | 2 | 5 | 3.0 | Cc1noc(NS(=O)(=O)c2cccc3c(O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL30228 | 102081 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 318 | 3 | 2 | 5 | 3.0 | Cc1noc(NS(=O)(=O)c2cccc3c(O)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL413825 | 213064 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | C[C@@H]1NC(=O)[C@@H]([C@@H](C)O)NC(=O)CNC(=O)[C@@H](Cc2c[nH]cn2)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CC(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)NC(=O)[C@H]2CCCN2C1=O | 10.1016/0960-894X(95)00084-7 | ||||
10840422 | 131340 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 550 | 11 | 5 | 4 | 4.9 | CCCc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
CHEMBL368854 | 131340 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 550 | 11 | 5 | 4 | 4.9 | CCCc1[nH]c([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1C(=O)O | 10.1021/jm950591h | ||
10624915 | 206210 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 490 | 6 | 2 | 6 | 4.5 | COc1ccc(NC(=O)N2C[C@@H](c3ccc4c(c3)OCO4)[C@H](C(=O)O)[C@H]2c2ccc(OC)cc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL8671 | 206210 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 490 | 6 | 2 | 6 | 4.5 | COc1ccc(NC(=O)N2C[C@@H](c3ccc4c(c3)OCO4)[C@H](C(=O)O)[C@H]2c2ccc(OC)cc2)cc1 | 10.1021/jm9505369 | ||
18617288 | 205123 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 316 | 3 | 1 | 4 | 2.5 | Cc1noc(NS(=O)(=O)c2ccccc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78080 | 205123 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 316 | 3 | 1 | 4 | 2.5 | Cc1noc(NS(=O)(=O)c2ccccc2)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44320444 | 206420 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 481 | 7 | 2 | 8 | 4.0 | O=C(O)c1cc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)on1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL88019 | 206420 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 481 | 7 | 2 | 8 | 4.0 | O=C(O)c1cc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)on1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL146866 | 208753 | 0 | None | - | 0 | Mouse | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
44384651 | 128473 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 498 | 6 | 2 | 8 | 4.0 | Cc1noc(NS(=O)(=O)c2sccc2/C=C/c2cc3c(cc2CO)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL366680 | 128473 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 498 | 6 | 2 | 8 | 4.0 | Cc1noc(NS(=O)(=O)c2sccc2/C=C/c2cc3c(cc2CO)OCO3)c1Br | 10.1016/S0960-894X(97)00133-9 | ||
44332624 | 4150 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 356 | 3 | 1 | 4 | 3.7 | NC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100120 | 4150 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 356 | 3 | 1 | 4 | 3.7 | NC(=O)C(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
10743872 | 97178 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 496 | 13 | 1 | 6 | 5.2 | CCCCN(CCCC)CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL268432 | 97178 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 496 | 13 | 1 | 6 | 5.2 | CCCCN(CCCC)CCN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
3847484 | 203710 | 3 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 360 | 4 | 1 | 3 | 4.4 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)cc3)cccc12 | 10.1021/jm9604585 | ||
CHEMBL6778 | 203710 | 3 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 360 | 4 | 1 | 3 | 4.4 | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Cl)cc3)cccc12 | 10.1021/jm9604585 | ||
10145418 | 81643 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 601 | 14 | 1 | 12 | 4.0 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL2163698 | 81643 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 601 | 14 | 1 | 12 | 4.0 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL354082 | 211706 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)N[C@H](CO)C(=O)O | 10.1016/0960-894X(95)00144-I | ||||
CHEMBL354152 | 211707 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)N[C@H](Cc1cn(C)c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00144-I | ||||
10646372 | 5420 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 432 | 5 | 2 | 7 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(O)cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10744 | 5420 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 432 | 5 | 2 | 7 | 3.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc(O)cc2)cc1 | 10.1021/jm9606507 | ||
10950392 | 202931 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 448 | 5 | 1 | 5 | 5.4 | CC(C)Oc1ccc2c(c1)C(c1ccc(F)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
CHEMBL62966 | 202931 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 448 | 5 | 1 | 5 | 5.4 | CC(C)Oc1ccc2c(c1)C(c1ccc(F)cc1)=C(C(=O)O)C(c1ccc3c(c1)OCO3)O2 | 10.1021/jm010382z | ||
11113542 | 203187 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 476 | 8 | 1 | 6 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)cc3OC)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
CHEMBL64398 | 203187 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 476 | 8 | 1 | 6 | 5.5 | COc1ccc(C2=C(C(=O)O)C(c3ccc(OC)cc3OC)Oc3ccc(OC(C)C)cc32)cc1 | 10.1021/jm010382z | ||
44314575 | 103545 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 601 | 13 | 5 | 5 | 4.2 | CSCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL308584 | 103545 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 601 | 13 | 5 | 5 | 4.2 | CSCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
22010244 | 206778 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm970847e | ||
CHEMBL90320 | 206778 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 407 | 9 | 1 | 5 | 5.5 | Cc1ccccc1C(CCC(=O)O)Oc1cc(OCc2ccsc2)ccc1C#N | 10.1021/jm970847e | ||
44439106 | 153583 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 1005 | 37 | 2 | 17 | 5.8 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOCCOCCOCCC(=O)N(C)Cc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2ccno2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
CHEMBL398070 | 153583 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 1005 | 37 | 2 | 17 | 5.8 | CC(=O)CC(=O)CCc1ccc(NC(=O)CCOCCOCCOCCOCCOCCOCCOCCC(=O)N(C)Cc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2ccno2)cc1 | 10.1016/j.bmcl.2006.10.009 | ||
10145418 | 81643 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 601 | 14 | 1 | 12 | 4.0 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1021/jm3009103 | ||
CHEMBL2163698 | 81643 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 601 | 14 | 1 | 12 | 4.0 | COc1ccccc1Oc1c(NS(=O)(=O)CCc2ccccc2)nc(-c2ncccn2)nc1OCCOc1ncccn1 | 10.1021/jm3009103 | ||
44304492 | 96531 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||
CHEMBL262993 | 96531 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 949 | 23 | 9 | 8 | 4.3 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||
CHEMBL265614 | 210633 | 19 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(C)=O)C1c2ccccc2CCc2ccccc21)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00349-X | ||||
104865 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
10230835 | 110206 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 546 | 12 | 1 | 7 | 4.0 | CCCS(=O)(=O)N(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)CC(C)C | 10.1021/jm970101g | ||
CHEMBL323789 | 110206 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 546 | 12 | 1 | 7 | 4.0 | CCCS(=O)(=O)N(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)CC(C)C | 10.1021/jm970101g | ||
10383884 | 205186 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 2.9 | CNc1ccc(C)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL78563 | 205186 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 2.9 | CNc1ccc(C)cc1S(=O)(=O)Nc1onc(C)c1Br | 10.1016/0960-894X(96)00441-6 | ||
44314660 | 104338 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 633 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCC1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL310111 | 104338 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 633 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCC1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL2304011 | 209444 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | Cc1[nH]c2ccccc2c1C[C@@H]1NC(=O)[C@@H](C2CC2)NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC1=O | 10.1021/jm9600914 | ||||
10766385 | 98400 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm9606507 | ||
CHEMBL275559 | 98400 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 460 | 6 | 1 | 7 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cc(OC)c4c(c3)OCO4)=C2Cc2ccccc2)cc1C | 10.1021/jm9606507 | ||
44333889 | 5051 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 463 | 7 | 1 | 6 | 5.3 | CCCSc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
CHEMBL105494 | 5051 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 463 | 7 | 1 | 6 | 5.3 | CCCSc1ccc2c(n1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(02)00663-7 | ||
10647373 | 96942 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 454 | 8 | 2 | 6 | 3.0 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)NCC(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL266337 | 96942 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 454 | 8 | 2 | 6 | 3.0 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CC(=O)NCC(C)C)cc1 | 10.1021/jm9505369 | ||
10817057 | 9662 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 580 | 11 | 1 | 7 | 4.7 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1 | 10.1021/jm970101g | ||
CHEMBL113087 | 9662 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 580 | 11 | 1 | 7 | 4.7 | CCCN(CCN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1 | 10.1021/jm970101g | ||
9840391 | 104512 | 6 | None | - | 1 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL310427 | 104512 | 6 | None | - | 1 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
9803428 | 102177 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 442 | 5 | 1 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL302872 | 102177 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 442 | 5 | 1 | 9 | 3.4 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1Cl | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL336033 | 211551 | 1 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | CC(C)C[C@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC1=O | 10.1021/jm00021a021 | ||||
104865 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1039/C5MD00169B | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1039/C5MD00169B | ||
392 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1039/C5MD00169B | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1039/C5MD00169B | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1039/C5MD00169B | ||
10504689 | 9409 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 474 | 6 | 1 | 8 | 3.6 | COC(=O)c1cccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)c1 | 10.1021/jm9606507 | ||
CHEMBL11176 | 9409 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 474 | 6 | 1 | 8 | 3.6 | COC(=O)c1cccc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OC)cc2)c1 | 10.1021/jm9606507 | ||
10840410 | 204037 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 550 | 10 | 2 | 10 | 3.3 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCC(=O)O)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL70017 | 204037 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 550 | 10 | 2 | 10 | 3.3 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCC(=O)O)c2)cc1 | 10.1021/jm980504w | ||
CHEMBL2304006 | 209439 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | O=C(O)C[C@H]1NC(=O)[C@H](Cc2c(Br)[nH]c3ccccc23)NC(=O)[C@@H](C2CC2)NC(=O)[C@H](C2CCCC2)NC(=O)[C@@H]2CCCN2C1=O | 10.1021/jm9600914 | ||||
CHEMBL411171 | 212844 | 0 | None | - | 1 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00077a013 | ||||
22467266 | 85317 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 522 | 7 | 2 | 8 | 3.4 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(CO)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261360 | 85317 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 522 | 7 | 2 | 8 | 3.4 | COc1cc(C)ccc1S(=O)(=O)NC(=O)C(c1ccc2c(c1)OCO2)c1cn(C)c2cc(CO)ccc12 | 10.1007/s00044-004-0021-y | ||
10626362 | 11419 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 544 | 8 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL1180351 | 11419 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 544 | 8 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
CHEMBL123316 | 11419 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 544 | 8 | 2 | 6 | 5.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)NC(c2ccccc2)C(C)(C)C)cc1 | 10.1021/jm990171i | ||
22467230 | 85326 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 536 | 8 | 1 | 8 | 4.0 | COCc1ccc2c(C(C(=O)NS(=O)(=O)c3ccc(C)cc3OC)c3ccc4c(c3)OCO4)cn(C)c2c1 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261601 | 85326 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 536 | 8 | 1 | 8 | 4.0 | COCc1ccc2c(C(C(=O)NS(=O)(=O)c3ccc(C)cc3OC)c3ccc4c(c3)OCO4)cn(C)c2c1 | 10.1007/s00044-004-0021-y | ||
11038925 | 9826 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 550 | 11 | 1 | 9 | 5.2 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccccn2)c1 | 10.1021/jm0102304 | ||
CHEMBL114105 | 9826 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 550 | 11 | 1 | 9 | 5.2 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ccccn2)c1 | 10.1021/jm0102304 | ||
9826741 | 100730 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 486 | 5 | 1 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL292802 | 100730 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 486 | 5 | 1 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00367-3 | ||
9826741 | 100730 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 486 | 5 | 1 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
CHEMBL292802 | 100730 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 486 | 5 | 1 | 9 | 3.6 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Oc2ccc3c(c2)OCO3)c1Br | 10.1016/S0960-894X(97)00132-7 | ||
10068813 | 98000 | 8 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 387 | 8 | 2 | 5 | 4.8 | CCCCCNc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL27299 | 98000 | 8 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 387 | 8 | 2 | 5 | 4.8 | CCCCCNc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.0c01093 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.0c01093 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.0c01093 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.0c01093 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/acs.jmedchem.0c01093 | ||
10406285 | 111625 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 361 | 6 | 1 | 4 | 4.8 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL328600 | 111625 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 361 | 6 | 1 | 4 | 4.8 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/C(=O)O)c1ccccc1 | 10.1021/jm970847e | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
18184229 | 59578 | 0 | None | - | 2 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL171950 | 59578 | 0 | None | - | 2 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 605 | 15 | 2 | 10 | 4.2 | CCCS(=O)(=O)NCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
44266552 | 4481 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10218 | 4481 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 473 | 7 | 1 | 7 | 5.3 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
44266567 | 98205 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 461 | 5 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(-c3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL274368 | 98205 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 461 | 5 | 1 | 8 | 4.5 | COc1cc2c(-c3ccc4c(c3)OCO4)c(C(=O)O)n(-c3ccc4c(c3)OCO4)c2cc1OC | 10.1016/0960-894X(96)00170-9 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/S0960-894X(97)00400-9 | ||
19432672 | 204198 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 606 | 11 | 3 | 9 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCNC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70924 | 204198 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 606 | 11 | 3 | 9 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCNC(=O)Nc1ccccn1 | 10.1016/S0960-894X(97)00400-9 | ||
10623877 | 8456 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 461 | 6 | 1 | 8 | 3.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc([N+](=O)[O-])cc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL10940 | 8456 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 461 | 6 | 1 | 8 | 3.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2ccc([N+](=O)[O-])cc2)cc1 | 10.1021/jm9606507 | ||
11015023 | 102693 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 406 | 3 | 1 | 4 | 5.1 | O=C(O)C1=C(c2ccc(Cl)cc2)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
CHEMBL304875 | 102693 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 406 | 3 | 1 | 4 | 5.1 | O=C(O)C1=C(c2ccc(Cl)cc2)c2ccccc2OC1c1ccc2c(c1)OCO2 | 10.1021/jm010382z | ||
19095644 | 169688 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccccc2)nc1OCCO | 10.1021/acs.jmedchem.0c01093 | ||
CHEMBL4438132 | 169688 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccccc2)nc1OCCO | 10.1021/acs.jmedchem.0c01093 | ||
14041110 | 99986 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 322 | 2 | 2 | 3 | 2.5 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccccc21 | 10.1016/0960-894X(95)00230-Q | ||
CHEMBL286808 | 99986 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 322 | 2 | 2 | 3 | 2.5 | O=C1c2ccccc2[C@@H]2[C@H](C(=O)O)[C@H](C(=O)O)[C@@H]2c2ccccc21 | 10.1016/0960-894X(95)00230-Q | ||
10497859 | 163402 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 347 | 6 | 1 | 4 | 4.7 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/CO)c1ccccc1 | 10.1021/jm970847e | ||
CHEMBL419694 | 163402 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 347 | 6 | 1 | 4 | 4.7 | N#Cc1ccc(OCc2ccsc2)cc1/C=C(/CO)c1ccccc1 | 10.1021/jm970847e | ||
44298325 | 195654 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 446 | 7 | 1 | 6 | 5.5 | CCc1onc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Sc1cccc(OC)c1 | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL55664 | 195654 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 446 | 7 | 1 | 6 | 5.5 | CCc1onc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Sc1cccc(OC)c1 | 10.1016/s0960-894x(00)00366-8 | ||
19095644 | 169688 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccccc2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4438132 | 169688 | 0 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccccc2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
5344 | 173449 | 101 | None | - | 1 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00004a012 | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1021/jm00004a012 | ||
44386621 | 61247 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL176653 | 61247 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 549 | 10 | 4 | 6 | 4.5 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CC3CCC2C3)nc1C(=O)O | 10.1021/jm950592+ | ||
44266542 | 162786 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 521 | 7 | 1 | 7 | 6.1 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc(OCc3ccccc3)ccc2n1Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL417246 | 162786 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 521 | 7 | 1 | 7 | 6.1 | O=C(O)c1c(-c2ccc3c(c2)OCO3)c2cc(OCc3ccccc3)ccc2n1Cc1ccc2c(c1)OCO2 | 10.1016/0960-894X(96)00170-9 | ||
44368428 | 44546 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 521 | 9 | 2 | 5 | 5.5 | O=C(O)C(Cc1ccc(O)cc1)N(Cc1ccccc1-c1ccccc1)C(=O)/C=C/c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152001 | 44546 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 521 | 9 | 2 | 5 | 5.5 | O=C(O)C(Cc1ccc(O)cc1)N(Cc1ccccc1-c1ccccc1)C(=O)/C=C/c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL330489 | 211309 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00070a001 | ||||
CHEMBL86737 | 215867 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00070a001 | ||||
CHEMBL330489 | 211309 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/S0960-894X(01)81215-4 | ||||
10627378 | 60393 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 598 | 11 | 5 | 4 | 5.6 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(Cc2ccccc2)[nH]1 | 10.1021/jm950591h | ||
CHEMBL175103 | 60393 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 598 | 11 | 5 | 4 | 5.6 | CC(C)C[C@H](NC(=O)N1CCCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)O)c(Cc2ccccc2)[nH]1 | 10.1021/jm950591h | ||
18995996 | 99174 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 569 | 10 | 1 | 8 | 6.9 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OCc4ccccc4)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL281451 | 99174 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 569 | 10 | 1 | 8 | 6.9 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc(OC)c(OCc4ccccc4)cc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
44279366 | 99633 | 0 | None | - | 0 | Pig | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 499 | 11 | 5 | 4 | 2.4 | CC(C)C[C@H](NC(=O)N1CCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL284392 | 99633 | 0 | None | - | 0 | Pig | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 499 | 11 | 5 | 4 | 2.4 | CC(C)C[C@H](NC(=O)N1CCCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
44384757 | 166124 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 482 | 5 | 1 | 7 | 4.8 | Cc1cc2c(cc1/C=C/c1sccc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL426218 | 166124 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 482 | 5 | 1 | 7 | 4.8 | Cc1cc2c(cc1/C=C/c1sccc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
11103152 | 163216 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)c(OC)c1)O2 | 10.1021/jm010382z | ||
CHEMBL418473 | 163216 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 504 | 9 | 1 | 7 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)c(OC)c1)O2 | 10.1021/jm010382z | ||
44314580 | 205114 | 0 | None | - | 0 | Pig | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 608 | 13 | 5 | 5 | 4.5 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL78023 | 205114 | 0 | None | - | 0 | Pig | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 608 | 13 | 5 | 5 | 4.5 | CCCCC(NC(=O)[C@@H](Cc1c(C#N)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C(C)C(C)C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL441006 | 213852 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC(=O)[C@H](Cc1c[nH]c2ccccc12)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00084-7 | ||||
23445388 | 206501 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL88506 | 206501 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 398 | 4 | 1 | 5 | 4.3 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccccc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
9917072 | 62073 | 0 | None | - | 2 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 619 | 16 | 2 | 10 | 4.6 | CCCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL177538 | 62073 | 0 | None | - | 2 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 619 | 16 | 2 | 10 | 4.6 | CCCS(=O)(=O)NCCCOc1nc(C2CC2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01083-1 | ||
23445408 | 111608 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.5 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccc(CC(C)C)cc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL328517 | 111608 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 454 | 6 | 1 | 5 | 5.5 | Cc1noc(NS(=O)(=O)c2sccc2-c2ccc(CC(C)C)cc2)c1Br | 10.1016/S0960-894X(96)00496-9 | ||
44270602 | 98830 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 688 | 13 | 1 | 10 | 7.0 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1cccs1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL278930 | 98830 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 688 | 13 | 1 | 10 | 7.0 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)cc(CCC)c1OC(C(=O)NS(=O)(=O)c1cccs1)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
1009 | 194 | 25 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm990170q | ||
5310991 | 194 | 25 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm990170q | ||
CHEMBL332794 | 194 | 25 | None | - | 1 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm990170q | ||
44383535 | 59250 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 280 | 4 | 1 | 5 | 1.5 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(OC)[C@]2(O)CC1 | 10.1016/s0960-894x(00)00136-0 | ||
CHEMBL170446 | 59250 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 280 | 4 | 1 | 5 | 1.5 | C/C=C/C=C/C(=O)O[C@@H]1C=C2COC(OC)[C@]2(O)CC1 | 10.1016/s0960-894x(00)00136-0 | ||
10960638 | 101041 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 414 | 4 | 1 | 4 | 5.6 | CC(C)c1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm010382z | ||
CHEMBL294793 | 101041 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 414 | 4 | 1 | 4 | 5.6 | CC(C)c1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm010382z | ||
23445358 | 111536 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 412 | 4 | 1 | 5 | 4.6 | Cc1cccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL328089 | 111536 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 412 | 4 | 1 | 5 | 4.6 | Cc1cccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1016/S0960-894X(96)00496-9 | ||
10546830 | 101348 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 365 | 4 | 2 | 6 | 1.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(N)=O)c1Br | 10.1021/jm9608366 | ||
CHEMBL297107 | 101348 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 365 | 4 | 2 | 6 | 1.7 | Cc1noc(NS(=O)(=O)c2ccsc2C(N)=O)c1Br | 10.1021/jm9608366 | ||
44386069 | 59705 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 704 | 13 | 2 | 11 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL172441 | 59705 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 704 | 13 | 2 | 11 | 5.5 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCNS(=O)(=O)c1ccc(C)cc1 | 10.1016/s0960-894x(02)01083-1 | ||
18995999 | 98484 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 477 | 6 | 1 | 8 | 5.0 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL27617 | 98484 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 477 | 6 | 1 | 8 | 5.0 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3cc4c(cc23)OCO4)c1 | 10.1016/0960-894X(96)00232-6 | ||
44384611 | 128628 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 644 | 10 | 2 | 12 | 5.8 | C#CCOc1nc(-c2ccnc(-c3noc(S)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL366797 | 128628 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 644 | 10 | 2 | 12 | 5.8 | C#CCOc1nc(-c2ccnc(-c3noc(S)n3)c2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10405292 | 97548 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3cc(N(C)C)ccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL27073 | 97548 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3cc(N(C)C)ccc23)c1C | 10.1021/jm00008a013 | ||
44316526 | 205398 | 2 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 344 | 3 | 1 | 4 | 3.2 | Cc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80180 | 205398 | 2 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 344 | 3 | 1 | 4 | 3.2 | Cc1ccc(Br)cc1S(=O)(=O)Nc1onc(C)c1C | 10.1016/0960-894X(96)00441-6 | ||
10674642 | 113343 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 574 | 10 | 3 | 7 | 4.7 | CCc1cc(C(=O)O)cc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL331758 | 113343 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 574 | 10 | 3 | 7 | 4.7 | CCc1cc(C(=O)O)cc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
10405292 | 97548 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3cc(N(C)C)ccc23)c1C | 10.1021/jm00004a012 | ||
CHEMBL27073 | 97548 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3cc(N(C)C)ccc23)c1C | 10.1021/jm00004a012 | ||
19010508 | 56315 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 501 | 9 | 1 | 7 | 5.5 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)O)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
CHEMBL16306 | 56315 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 501 | 9 | 1 | 7 | 5.5 | CCCc1cc(Cn2c(CC)nc3c(C)cc(C)nc32)ccc1OC(C(=O)O)c1ccc2c(c1)OCO2 | 10.1016/0960-894X(95)00186-W | ||
14973488 | 113780 | 0 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 295 | 4 | 1 | 5 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(N(C)C)cc2)c1C | 10.1021/jm00029a001 | ||
CHEMBL332471 | 113780 | 0 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 295 | 4 | 1 | 5 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(N(C)C)cc2)c1C | 10.1021/jm00029a001 | ||
14973488 | 113780 | 0 | None | - | 0 | Rat | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 295 | 4 | 1 | 5 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(N(C)C)cc2)c1C | 10.1021/jm00004a012 | ||
CHEMBL332471 | 113780 | 0 | None | - | 0 | Rat | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 295 | 4 | 1 | 5 | 2.2 | Cc1noc(NS(=O)(=O)c2ccc(N(C)C)cc2)c1C | 10.1021/jm00004a012 | ||
44293685 | 101753 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1cccc(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL300000 | 101753 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 521 | 10 | 2 | 8 | 3.9 | CCOc1ccc2c(c1)[C@@H](c1cccc(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10576377 | 11975 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1cccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
CHEMBL1183291 | 11975 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1cccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
CHEMBL288967 | 11975 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 471 | 6 | 2 | 7 | 3.9 | COc1cccc(NC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
44384715 | 60332 | 0 | None | - | 1 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 559 | 9 | 1 | 9 | 5.2 | CC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL174607 | 60332 | 0 | None | - | 1 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 559 | 9 | 1 | 9 | 5.2 | CC#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
44265861 | 97179 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 481 | 11 | 1 | 6 | 5.1 | CCCC(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL268433 | 97179 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 481 | 11 | 1 | 6 | 5.1 | CCCC(CCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL433406 | 213617 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)NC)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
5344 | 173449 | 101 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL308208 | 210960 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H]2CCCN2C1=O | 10.1021/jm00089a028 | ||||
CHEMBL341751 | 211637 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H]2CCCN2C1=O | 10.1021/jm00021a021 | ||||
10763577 | 59869 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 401 | 7 | 1 | 4 | 5.3 | Cc1ccccc1C(Oc1cc(OCc2c(C)cccc2C)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173054 | 59869 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 401 | 7 | 1 | 4 | 5.3 | Cc1ccccc1C(Oc1cc(OCc2c(C)cccc2C)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
10916428 | 162671 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm031041j | ||
CHEMBL417050 | 162671 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm031041j | ||
15289331 | 99536 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 433 | 6 | 1 | 6 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL283648 | 99536 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 433 | 6 | 1 | 6 | 5.3 | COc1cccc(Sc2c(C(=O)O)n(Cc3ccc4c(c3)OCO4)c3ccccc23)c1 | 10.1016/0960-894X(96)00232-6 | ||
10916428 | 162671 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm010382z | ||
CHEMBL417050 | 162671 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 402 | 4 | 1 | 5 | 4.4 | COc1ccc(C2=C(C(=O)O)C(c3ccc4c(c3)OCO4)Oc3ccccc32)cc1 | 10.1021/jm010382z | ||
9810400 | 98579 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 710 | 14 | 2 | 12 | 5.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
CHEMBL276949 | 98579 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 710 | 14 | 2 | 12 | 5.6 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCCNS(=O)(=O)c1cccs1 | 10.1016/s0960-894x(02)01083-1 | ||
10338501 | 102028 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00004a012 | ||
CHEMBL30199 | 102028 | 1 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00004a012 | ||
10275056 | 112482 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 440 | 6 | 1 | 5 | 5.2 | CCCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
CHEMBL329890 | 112482 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 440 | 6 | 1 | 5 | 5.2 | CCCc1ccc(-c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(96)00496-9 | ||
9998564 | 99453 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cccc(S(=O)(=O)Nc3onc(C)c3C)c2c1 | 10.1021/jm00008a013 | ||
CHEMBL283175 | 99453 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cccc(S(=O)(=O)Nc3onc(C)c3C)c2c1 | 10.1021/jm00008a013 | ||
9998564 | 99453 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cccc(S(=O)(=O)Nc3onc(C)c3C)c2c1 | 10.1021/jm00004a012 | ||
CHEMBL283175 | 99453 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1ccc2cccc(S(=O)(=O)Nc3onc(C)c3C)c2c1 | 10.1021/jm00004a012 | ||
10602312 | 59633 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 531 | 11 | 5 | 5 | 4.5 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NCc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL172178 | 59633 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 531 | 11 | 5 | 5 | 4.5 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NCc2ccccc2)nc1C(=O)O | 10.1021/jm950592+ | ||
10571971 | 168148 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 382 | 9 | 1 | 4 | 5.6 | Cc1ccccc1C(CCC(=O)O)Oc1cccc(OCc2ccsc2)c1 | 10.1021/jm9707131 | ||
CHEMBL433209 | 168148 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 382 | 9 | 1 | 4 | 5.6 | Cc1ccccc1C(CCC(=O)O)Oc1cccc(OCc2ccsc2)c1 | 10.1021/jm9707131 | ||
137639474 | 156873 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 607 | 10 | 2 | 9 | 5.4 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC4CCCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL4072165 | 156873 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 607 | 10 | 2 | 9 | 5.4 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(-c4nnn[nH]4)c3)c(=O)c3cc(OCC4CCCC4)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10696788 | 175891 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 501 | 5 | 2 | 9 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2NC(=O)Oc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL45872 | 175891 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 501 | 5 | 2 | 9 | 3.9 | Cc1noc(NS(=O)(=O)c2ccsc2NC(=O)Oc2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
10338501 | 102028 | 1 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00029a001 | ||
CHEMBL30199 | 102028 | 1 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00029a001 | ||
10475320 | 96469 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 387 | 5 | 2 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(=O)C(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
CHEMBL26252 | 96469 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 387 | 5 | 2 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2cccc3c(NC(=O)C(C)C)cccc23)c1C | 10.1021/jm00008a013 | ||
10338501 | 102028 | 1 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
CHEMBL30199 | 102028 | 1 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 359 | 4 | 2 | 5 | 3.2 | CC(=O)Nc1cccc2c(S(=O)(=O)Nc3onc(C)c3C)cccc12 | 10.1021/jm00008a013 | ||
56678452 | 63297 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@H](C)CC)C(=O)CNC(=O)[C@H](N)Cc1c[nH]c2ccccc12 | 10.1021/jm970161m | ||
CHEMBL1793928 | 63297 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 937 | 26 | 9 | 9 | 3.6 | CC[C@H](C)[C@H](NC(=O)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)[C@H](C)CC)C(=O)CNC(=O)[C@H](N)Cc1c[nH]c2ccccc12 | 10.1021/jm970161m | ||
44311288 | 204161 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 592 | 11 | 1 | 10 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)c1cccnc1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70781 | 204161 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 592 | 11 | 1 | 10 | 5.3 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)c1cccnc1 | 10.1016/S0960-894X(97)00400-9 | ||
14673588 | 4375 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00232-6 | ||
CHEMBL10143 | 4375 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00232-6 | ||
14673588 | 4375 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00170-9 | ||
CHEMBL10143 | 4375 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 342 | 6 | 1 | 4 | 5.0 | CC(C)Oc1c(C(=O)O)sc2ccc(OCc3ccccc3)cc12 | 10.1016/0960-894X(96)00170-9 | ||
10790183 | 206222 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 461 | 8 | 1 | 6 | 4.3 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CCOc2ccccc2)cc1 | 10.1021/jm9505369 | ||
CHEMBL8677 | 206222 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 461 | 8 | 1 | 6 | 4.3 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CCOc2ccccc2)cc1 | 10.1021/jm9505369 | ||
127026058 | 137221 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 600 | 10 | 3 | 8 | 6.0 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3751899 | 137221 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 600 | 10 | 3 | 8 | 6.0 | CCCc1nc2c(C)cc(C(=O)Nc3ccccc3OC)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
10839533 | 101418 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 513 | 5 | 2 | 9 | 2.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)NC(=O)c2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
CHEMBL297599 | 101418 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 513 | 5 | 2 | 9 | 2.9 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)NC(=O)c2ccc3c(c2)OCO3)c1Br | 10.1021/jm9700068 | ||
10839947 | 117276 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
CHEMBL339657 | 117276 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 530 | 9 | 2 | 6 | 5.0 | CCc1cccc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm990170q | ||
44320777 | 206182 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 550 | 10 | 2 | 8 | 4.7 | COc1ccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c(OCC(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
CHEMBL86505 | 206182 | 0 | None | - | 0 | Rat | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 550 | 10 | 2 | 8 | 4.7 | COc1ccc(Cn2nc(-c3ccccc3)c(Cc3cc4c(cc3Cl)OCO4)c2C(=O)O)c(OCC(=O)O)c1 | 10.1016/s0960-894x(00)00513-8 | ||
10415067 | 45335 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 546 | 8 | 2 | 6 | 5.0 | O=C(O)C(Cc1c[nH]c2ccccc12)N(Cc1cc2c(cc1Cl)OCO2)C(=O)/C=C/c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
CHEMBL152713 | 45335 | 0 | None | - | 0 | Pig | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 546 | 8 | 2 | 6 | 5.0 | O=C(O)C(Cc1c[nH]c2ccccc12)N(Cc1cc2c(cc1Cl)OCO2)C(=O)/C=C/c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00009-9 | ||
10449375 | 95740 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 331 | 4 | 1 | 5 | 3.0 | Cc1cc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)on1 | 10.1021/jm00008a013 | ||
CHEMBL25854 | 95740 | 0 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 331 | 4 | 1 | 5 | 3.0 | Cc1cc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)on1 | 10.1021/jm00008a013 | ||
CHEMBL289687 | 210852 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
3811690 | 205387 | 3 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2ccc(Br)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80129 | 205387 | 3 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2ccc(Br)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL289687 | 210852 | 0 | None | - | 0 | Human | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(95)00152-J | ||||
127035082 | 136486 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 677 | 12 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3cccc(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3736262 | 136486 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 677 | 12 | 2 | 8 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCc3cccc(OC)c3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
15411002 | 108525 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 563 | 9 | 1 | 10 | 4.2 | CNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
CHEMBL320183 | 108525 | 0 | None | - | 0 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 563 | 9 | 1 | 10 | 4.2 | CNC(=O)OC1(c2ccc(OC)cc2)OC(=O)C(c2ccc3c(c2)OCO3)=C1Cc1cc(OC)c(OC)c(OC)c1 | 10.1016/S0960-894X(97)00002-4 | ||
44314661 | 102998 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 603 | 14 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CCCC)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL306977 | 102998 | 0 | None | - | 0 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 603 | 14 | 5 | 4 | 5.1 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(CCCC)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
10646514 | 59309 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 434 | 7 | 1 | 6 | 5.1 | N#Cc1ccc(OCc2ccc3ncoc3c2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
CHEMBL170681 | 59309 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 434 | 7 | 1 | 6 | 5.1 | N#Cc1ccc(OCc2ccc3ncoc3c2)cc1OC(C(=O)O)c1ccccc1Cl | 10.1021/jm990378b | ||
10619391 | 60208 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL173251 | 60208 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL174092 | 60208 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 374 | 7 | 1 | 5 | 4.0 | Cc1ccccc1C(Oc1cc(OCc2ccncc2)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
9931773 | 78335 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1[C@H](Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
CHEMBL2110231 | 78335 | 0 | None | - | 0 | Rat | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 417 | 7 | 1 | 6 | 4.4 | Cc1ccccc1[C@H](Oc1cc(OCc2ccc3c(c2)OCO3)ccc1C#N)C(=O)O | 10.1021/jm990378b | ||
44311285 | 102272 | 0 | None | - | 1 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 635 | 13 | 2 | 10 | 6.4 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(Oc2ccccc2OC)c(OCCOC(=O)Nc2ccccn2)n1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL303428 | 102272 | 0 | None | - | 1 | Human | 8.1 | pIC50 | = | 8.1 | Binding | ChEMBL | 635 | 13 | 2 | 10 | 6.4 | CCCc1nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(Oc2ccccc2OC)c(OCCOC(=O)Nc2ccccn2)n1 | 10.1016/S0960-894X(97)00400-9 | ||
10992620 | 203327 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 384 | 5 | 1 | 6 | 3.8 | COC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
CHEMBL65070 | 203327 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 384 | 5 | 1 | 6 | 3.8 | COC1=C(C(=O)O)C(c2ccc3c(c2)OCO3)Oc2ccc(OC(C)C)cc21 | 10.1021/jm010382z | ||
44314646 | 205016 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 633 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCCC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL77033 | 205016 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 633 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1CCCCCC1)C(=O)O | 10.1021/jm9600914 | ||
44314889 | 103715 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 633 | 12 | 5 | 4 | 4.7 | CCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL308815 | 103715 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 633 | 12 | 5 | 4 | 4.7 | CCCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
44314620 | 103118 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 587 | 12 | 5 | 4 | 4.4 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL307903 | 103118 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 587 | 12 | 5 | 4 | 4.4 | CCCCC(NC(=O)[C@@H](Cc1c(Cl)[nH]c2ccccc12)NC(=O)C(NC(=O)N1[C@@H](C)CCC[C@H]1C)C1CC1)C(=O)O | 10.1021/jm9600914 | ||
23445404 | 100884 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 456 | 5 | 1 | 7 | 4.1 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00367-3 | ||
CHEMBL293877 | 100884 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 456 | 5 | 1 | 7 | 4.1 | Cc1ccc(OC(=O)c2sccc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00367-3 | ||
10119105 | 101420 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 526 | 7 | 2 | 9 | 3.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CC(=O)N(C)C)OCO3)c1Cl | 10.1021/jm9608366 | ||
CHEMBL297618 | 101420 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 526 | 7 | 2 | 9 | 3.1 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2cc3c(cc2CC(=O)N(C)C)OCO3)c1Cl | 10.1021/jm9608366 | ||
10650062 | 60414 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
CHEMBL175228 | 60414 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 537 | 10 | 4 | 6 | 4.8 | Cc1[nH]c([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)OC(=O)NC2CCCCC2)nc1C(=O)O | 10.1021/jm9505932 | ||
155517241 | 170134 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 522 | 14 | 2 | 11 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4444355 | 170134 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 522 | 14 | 2 | 11 | 2.9 | CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1Oc1ccccc1OC | 10.1016/j.bmcl.2016.06.014 | ||
10129267 | 81659 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 617 | 13 | 1 | 12 | 3.9 | CCCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163714 | 81659 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 617 | 13 | 1 | 12 | 3.9 | CCCS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
44314723 | 204975 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 583 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL76735 | 204975 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 583 | 13 | 5 | 4 | 4.7 | CCCCC(NC(=O)[C@@H](Cc1c(C)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
44314659 | 205097 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 631 | 12 | 5 | 4 | 4.5 | C=CCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
CHEMBL77853 | 205097 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8.0 | Binding | ChEMBL | 631 | 12 | 5 | 4 | 4.5 | C=CCC(NC(=O)[C@@H](Cc1c(Br)[nH]c2ccccc12)NC(=O)C(CC(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(=O)O | 10.1021/jm9600914 | ||
52949155 | 18379 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 557 | 10 | 2 | 7 | 5.4 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
CHEMBL1271640 | 18379 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 557 | 10 | 2 | 7 | 5.4 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OCC(C)C)ccc31)OCO2 | 10.1016/j.bmcl.2017.04.049 | ||
10814318 | 9120 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 472 | 14 | 1 | 5 | 4.7 | C=CCCC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
CHEMBL110064 | 9120 | 0 | None | - | 0 | Rat | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 472 | 14 | 1 | 5 | 4.7 | C=CCCC[C@H]1[C@H](C(=O)O)[C@@H](c2ccc3c(c2)OCO3)CN1CC(=O)N(CCCC)CCCC | 10.1021/jm980217s | ||
52944083 | 18386 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 557 | 10 | 2 | 7 | 5.5 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OC(C)CC)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
CHEMBL1271691 | 18386 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 557 | 10 | 2 | 7 | 5.5 | CCc1cc2c(cc1Cn1c(C(=O)O)c(Cc3cccc(C(=O)O)c3)c(=O)c3cc(OC(C)CC)ccc31)OCO2 | 10.1016/j.bmcl.2010.08.074 | ||
71456864 | 81663 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 618 | 13 | 2 | 12 | 3.0 | CCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
CHEMBL2163718 | 81663 | 0 | None | - | 0 | Human | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 618 | 13 | 2 | 12 | 3.0 | CCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCOc2ncc(Br)cn2)c1Oc1ccccc1OC | 10.1021/jm3009103 | ||
11734340 | 163687 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 552 | 10 | 1 | 10 | 4.6 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccncc2)nc1 | 10.1021/jm0102304 | ||
CHEMBL420501 | 163687 | 0 | None | - | 0 | Pig | 8.0 | pIC50 | = | 8 | Binding | ChEMBL | 552 | 10 | 1 | 10 | 4.6 | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)c2-c2ccncc2)nc1 | 10.1021/jm0102304 | ||
10501279 | 98190 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cccc(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
CHEMBL274307 | 98190 | 0 | None | - | 0 | Human | 7.1 | pIC50 | = | 7.1 | Binding | ChEMBL | 402 | 6 | 1 | 5 | 4.1 | COc1ccc(C2(O)OC(=O)C(c3cccc(OC)c3)=C2Cc2ccccc2)cc1 | 10.1021/jm9606507 | ||
44371516 | 50955 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 469 | 7 | 1 | 6 | 5.6 | CCOc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc(OC)cc2)c2oc3ccccc3c21 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL157827 | 50955 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 469 | 7 | 1 | 6 | 5.6 | CCOc1ccccc1Cn1c(=O)c(C(=O)O)c(-c2ccc(OC)cc2)c2oc3ccccc3c21 | 10.1016/s0960-894x(99)00040-2 | ||
CHEMBL279259 | 210816 | 0 | None | - | 0 | Mouse | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](N)CCCNC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(00)80326-1 | ||||
11794876 | 207153 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 393 | 7 | 1 | 4 | 4.9 | O=C(O)/C(=C/c1cc(OCc2ccccc2)ccc1[N+](=O)[O-])c1ccccc1F | 10.1021/jm970847e | ||
CHEMBL92446 | 207153 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 393 | 7 | 1 | 4 | 4.9 | O=C(O)/C(=C/c1cc(OCc2ccccc2)ccc1[N+](=O)[O-])c1ccccc1F | 10.1021/jm970847e | ||
44213651 | 4267 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 343 | 3 | 1 | 4 | 4.2 | OCC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
CHEMBL100795 | 4267 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 343 | 3 | 1 | 4 | 4.2 | OCC(c1ccc2c(c1)OCO2)c1c2ccccc2nc2ccccc12 | 10.1016/S0960-894X(96)00551-3 | ||
10742024 | 96914 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 446 | 7 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CCc2ccccn2)cc1 | 10.1021/jm9505369 | ||
CHEMBL266143 | 96914 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 446 | 7 | 1 | 6 | 3.9 | COc1ccc([C@@H]2[C@@H](C(=O)O)[C@H](c3ccc4c(c3)OCO4)CN2CCc2ccccn2)cc1 | 10.1021/jm9505369 | ||
10841134 | 60418 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 589 | 10 | 4 | 6 | 5.3 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC23CC4CC(CC(C4)C2)C3)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL175277 | 60418 | 0 | None | - | 0 | Rat | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 589 | 10 | 4 | 6 | 5.3 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC23CC4CC(CC(C4)C2)C3)nc1C(=O)O | 10.1021/jm950592+ | ||
44311321 | 204162 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 607 | 11 | 2 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)Nc1cccnc1 | 10.1016/S0960-894X(97)00400-9 | ||
CHEMBL70788 | 204162 | 0 | None | - | 0 | Human | 6.1 | pIC50 | = | 6.1 | Binding | ChEMBL | 607 | 11 | 2 | 10 | 5.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(C)nc1OCCOC(=O)Nc1cccnc1 | 10.1016/S0960-894X(97)00400-9 | ||
5344 | 173449 | 101 | None | - | 1 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | 10.1016/s0960-894x(00)00366-8 | ||
10015852 | 99413 | 2 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 268 | 3 | 2 | 5 | 1.8 | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C | 10.1021/jm00004a012 | ||
CHEMBL282961 | 99413 | 2 | None | - | 0 | Rat | 5.1 | pIC50 | = | 5.1 | Binding | ChEMBL | 268 | 3 | 2 | 5 | 1.8 | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C | 10.1021/jm00004a012 | ||
22616255 | 205510 | 11 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL80945 | 205510 | 11 | None | - | 0 | Human | 4.1 | pIC50 | = | 4.1 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
23445333 | 127780 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 484 | 6 | 1 | 7 | 4.4 | Cc1cc2c(cc1CCc1ccsc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL366378 | 127780 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 484 | 6 | 1 | 7 | 4.4 | Cc1cc2c(cc1CCc1ccsc1S(=O)(=O)Nc1onc(C)c1Br)OCO2 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL313984 | 211100 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
CHEMBL317099 | 211175 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00015a003 | ||||
10792636 | 168491 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.4 | CCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(CC)cccc2CC)cc1 | 10.1021/jm990170q | ||
CHEMBL435385 | 168491 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 544 | 10 | 2 | 6 | 5.4 | CCOc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(CC)cccc2CC)cc1 | 10.1021/jm990170q | ||
CHEMBL315658 | 211168 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00070a001 | ||||
127026042 | 137232 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 620 | 11 | 3 | 9 | 3.8 | CCCc1nc2c(C)cc(C(=O)NCCN3CCN(C)CC3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL3751986 | 137232 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 620 | 11 | 3 | 9 | 3.8 | CCCc1nc2c(C)cc(C(=O)NCCN3CCN(C)CC3)cc2n1Cc1ccc(-c2ccccc2C(=O)Nc2nnn[nH]2)cc1 | 10.1039/C5MD00169B | ||
CHEMBL315658 | 211168 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
11145367 | 9985 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 487 | 10 | 1 | 8 | 4.4 | COCCOc1ncnc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1cccc(OC)c1 | 10.1021/jm0102304 | ||
CHEMBL114985 | 9985 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 487 | 10 | 1 | 8 | 4.4 | COCCOc1ncnc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1cccc(OC)c1 | 10.1021/jm0102304 | ||
10745418 | 113965 | 1 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 558 | 9 | 2 | 6 | 6.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 | 10.1021/jm990170q | ||
CHEMBL332627 | 113965 | 1 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 558 | 9 | 2 | 6 | 6.2 | COc1ccc([C@H]2[C@H](C(=O)O)[C@@H](c3ccc4c(c3)OCO4)CN2CC(=O)Nc2c(C(C)C)cccc2C(C)C)cc1 | 10.1021/jm990170q | ||
10015852 | 99413 | 2 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 268 | 3 | 2 | 5 | 1.8 | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C | 10.1021/jm00029a001 | ||
CHEMBL282961 | 99413 | 2 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 268 | 3 | 2 | 5 | 1.8 | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C | 10.1021/jm00029a001 | ||
10015852 | 99413 | 2 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 268 | 3 | 2 | 5 | 1.8 | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL282961 | 99413 | 2 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 268 | 3 | 2 | 5 | 1.8 | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C | 10.1021/jm00008a013 | ||
11813885 | 167770 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 579 | 12 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCCOc2ncc(C)cn2)c1 | 10.1021/jm0102304 | ||
CHEMBL430515 | 167770 | 0 | None | - | 0 | Pig | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 579 | 12 | 1 | 10 | 5.3 | COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCCOc2ncc(C)cn2)c1 | 10.1021/jm0102304 | ||
CHEMBL313056 | 211088 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00070a001 | ||||
10576217 | 9729 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 467 | 12 | 1 | 5 | 4.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cccnc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL113494 | 9729 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 467 | 12 | 1 | 5 | 4.4 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cccnc2)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 | 10.1021/jm960077r | ||
CHEMBL146155 | 208752 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
11798109 | 12327 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 457 | 7 | 2 | 7 | 4.2 | COc1cccc(NCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
CHEMBL1185459 | 12327 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 457 | 7 | 2 | 7 | 4.2 | COc1cccc(NCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
CHEMBL416086 | 12327 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 457 | 7 | 2 | 7 | 4.2 | COc1cccc(NCc2sccc2S(=O)(=O)Nc2onc(C)c2Br)c1 | 10.1021/jm9608366 | ||
23445544 | 61345 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 438 | 5 | 1 | 5 | 5.1 | Cc1ccc(/C=C/c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
CHEMBL176912 | 61345 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 438 | 5 | 1 | 5 | 5.1 | Cc1ccc(/C=C/c2ccsc2S(=O)(=O)Nc2onc(C)c2Br)cc1 | 10.1016/S0960-894X(97)00133-9 | ||
3887 | 2059 | 45 | None | -436 | 4 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | None | None | None | None | 10.1021/acs.jmedchem.5b01781 | ||||
5311192 | 2059 | 45 | None | -436 | 4 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | None | None | None | None | 10.1021/acs.jmedchem.5b01781 | ||||
CHEMBL72410 | 2059 | 45 | None | -436 | 4 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | None | None | None | None | 10.1021/acs.jmedchem.5b01781 | ||||
44386002 | 60266 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 503 | 9 | 1 | 9 | 3.9 | C#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL174326 | 60266 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 503 | 9 | 1 | 9 | 3.9 | C#CCOc1nc(-c2ccncc2)nc(NS(=O)(=O)c2ccc(C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
11005242 | 202872 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)cc1)O2 | 10.1021/jm010382z | ||
CHEMBL62719 | 202872 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 474 | 8 | 1 | 6 | 5.6 | CCCCOc1ccc2c(c1)C(c1ccc3c(c1)OCO3)=C(C(=O)O)C(c1ccc(OC)cc1)O2 | 10.1021/jm010382z | ||
44293682 | 185662 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.4 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL48652 | 185662 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.4 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
10553165 | 9708 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 492 | 7 | 1 | 6 | 5.4 | O=C1OC(O)(c2ccc(OCc3ccccc3)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL11341 | 9708 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 492 | 7 | 1 | 6 | 5.4 | O=C1OC(O)(c2ccc(OCc3ccccc3)cc2)C(Cc2ccccc2)=C1c1ccc2c(c1)OCO2 | 10.1021/jm9606507 | ||
CHEMBL414917 | 213137 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | None | None | None | NC(=O)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)C1c2ccccc2CCc2ccccc21)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/0960-894X(95)00084-7 | ||||
CHEMBL289687 | 210852 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81215-4 | ||||
CHEMBL289687 | 210852 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00095a029 | ||||
127035085 | 136407 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 661 | 12 | 2 | 7 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
CHEMBL3735574 | 136407 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 661 | 12 | 2 | 7 | 7.4 | CCCc1nc2c(C)cc(C(=O)NCCc3ccccc3)cc2n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1039/C4MD00499J | ||
44293741 | 186937 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.4 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
CHEMBL49040 | 186937 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.4 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1021/jm031041j | ||
44293868 | 101563 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 551 | 11 | 2 | 9 | 3.9 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL298664 | 101563 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 551 | 11 | 2 | 9 | 3.9 | CCOc1ccc2c(c1)[C@H](c1ccc(OC)c(OC)c1OCC(=O)O)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
44293741 | 186937 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.4 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL49040 | 186937 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 447 | 7 | 1 | 6 | 4.4 | CCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)N(CC(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
44384766 | 59635 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 532 | 10 | 1 | 10 | 4.1 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL172184 | 59635 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 532 | 10 | 1 | 10 | 4.1 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)C)cn2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
44385940 | 130646 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC(C)C2)nc1C(=O)O | 10.1021/jm950592+ | ||
CHEMBL368255 | 130646 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 551 | 10 | 4 | 6 | 4.9 | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)NC2CCCC(C)C2)nc1C(=O)O | 10.1021/jm950592+ | ||
44386421 | 60707 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 537 | 10 | 4 | 5 | 4.5 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1CC(=O)O | 10.1021/jm950592+ | ||
CHEMBL176093 | 60707 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 537 | 10 | 4 | 5 | 4.5 | Cc1oc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](CC(C)C)NC(=O)N2CCCCCC2)nc1CC(=O)O | 10.1021/jm950592+ | ||
9807456 | 60443 | 0 | None | - | 1 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 545 | 9 | 1 | 9 | 4.8 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
CHEMBL175435 | 60443 | 0 | None | - | 1 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 545 | 9 | 1 | 9 | 4.8 | C#CCOc1nc(-c2ncccn2)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC | 10.1016/s0960-894x(02)01084-3 | ||
10195727 | 203904 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 487 | 7 | 1 | 8 | 5.6 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nsnc2c1 | 10.1016/s0960-894x(97)10151-2 | ||
CHEMBL69150 | 203904 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 487 | 7 | 1 | 8 | 5.6 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nsnc2c1 | 10.1016/s0960-894x(97)10151-2 | ||
10195727 | 203904 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 487 | 7 | 1 | 8 | 5.6 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nsnc2c1 | 10.1021/jm0300429 | ||
CHEMBL69150 | 203904 | 0 | None | - | 0 | Human | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 487 | 7 | 1 | 8 | 5.6 | CCCOc1ccc2c(c1)c(-c1ccc3c(c1)OCO3)c(C(=O)O)n2Cc1ccc2nsnc2c1 | 10.1021/jm0300429 | ||
44279360 | 106563 | 0 | None | - | 0 | Pig | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 498 | 13 | 5 | 4 | 2.9 | CC(C)C[C@H](NC(=O)CC1CCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
CHEMBL31426 | 106563 | 0 | None | - | 0 | Pig | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 498 | 13 | 5 | 4 | 2.9 | CC(C)C[C@H](NC(=O)CC1CCCC1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCC(=O)O | 10.1016/0960-894X(95)00221-E | ||
11048815 | 102288 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1ccc2c(c1)OC(c1ccc3c(c1)OCO3)C(C(=O)O)=C2c1ccc(OC)cc1 | 10.1021/jm010382z | ||
CHEMBL303531 | 102288 | 0 | None | - | 0 | Rat | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 460 | 7 | 1 | 6 | 5.2 | CCCOc1ccc2c(c1)OC(c1ccc3c(c1)OCO3)C(C(=O)O)=C2c1ccc(OC)cc1 | 10.1021/jm010382z | ||
10625738 | 169469 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 517 | 6 | 2 | 6 | 5.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(-c3ccccc3)cc2)c1Br | 10.1021/jm9608366 | ||
CHEMBL44321 | 169469 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 517 | 6 | 2 | 6 | 5.5 | Cc1noc(NS(=O)(=O)c2ccsc2C(=O)Nc2ccc(-c3ccccc3)cc2)c1Br | 10.1021/jm9608366 | ||
9801094 | 59461 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.1 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1cccc(Cl)c1 | 10.1021/jm990378b | ||
CHEMBL171446 | 59461 | 0 | None | - | 0 | Rat | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | 399 | 7 | 1 | 5 | 5.1 | N#Cc1ccc(OCc2ccsc2)cc1OC(C(=O)O)c1cccc(Cl)c1 | 10.1021/jm990378b | ||
CHEMBL359235 | 211782 | 0 | None | - | 0 | Mouse | 7.0 | pIC50 | = | 7.0 | Binding | ChEMBL | None | None | None | CC[C@@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@H](C)CC | 10.1016/S0960-894X(01)81219-1 | ||||
44316686 | 103490 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 286 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccccc2Cl)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL308521 | 103490 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6.0 | Binding | ChEMBL | 286 | 3 | 1 | 4 | 2.7 | Cc1noc(NS(=O)(=O)c2ccccc2Cl)c1C | 10.1016/0960-894X(96)00441-6 | ||
10021240 | 95466 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 357 | 6 | 2 | 5 | 3.7 | Cc1noc(NS(=O)(=O)c2ccc(NCc3ccccc3)cc2)c1C | 10.1021/jm00029a001 | ||
CHEMBL25730 | 95466 | 0 | None | - | 0 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 357 | 6 | 2 | 5 | 3.7 | Cc1noc(NS(=O)(=O)c2ccc(NCc3ccccc3)cc2)c1C | 10.1021/jm00029a001 | ||
10021240 | 95466 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 357 | 6 | 2 | 5 | 3.7 | Cc1noc(NS(=O)(=O)c2ccc(NCc3ccccc3)cc2)c1C | 10.1021/jm00008a013 | ||
CHEMBL25730 | 95466 | 0 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 357 | 6 | 2 | 5 | 3.7 | Cc1noc(NS(=O)(=O)c2ccc(NCc3ccccc3)cc2)c1C | 10.1021/jm00008a013 | ||
10087192 | 99555 | 1 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N)c3c2)c1C | 10.1021/jm00008a013 | ||
CHEMBL283879 | 99555 | 1 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N)c3c2)c1C | 10.1021/jm00008a013 | ||
10087192 | 99555 | 1 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N)c3c2)c1C | 10.1021/jm00004a012 | ||
CHEMBL283879 | 99555 | 1 | None | - | 0 | Rat | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 317 | 3 | 2 | 5 | 2.8 | Cc1noc(NS(=O)(=O)c2ccc3cccc(N)c3c2)c1C | 10.1021/jm00004a012 | ||
44276993 | 106827 | 0 | None | - | 0 | Rat | 4.0 | pIC50 | = | 4.0 | Binding | ChEMBL | 362 | 5 | 1 | 3 | 3.8 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccccc3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
CHEMBL3144831 | 106827 | 0 | None | - | 0 | Rat | 4.0 | pIC50 | = | 4.0 | Binding | ChEMBL | 362 | 5 | 1 | 3 | 3.8 | COc1cccc(Cn2[nH]c(C(F)(F)F)c(Cc3ccccc3)c2=O)c1 | 10.1016/s0960-894x(00)00232-8 | ||
5472495 | 186609 | 47 | None | - | 1 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 372 | 4 | 1 | 3 | 4.0 | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 | nan | ||
CHEMBL488025 | 186609 | 47 | None | - | 1 | Human | 5.0 | pIC50 | = | 5.0 | Binding | ChEMBL | 372 | 4 | 1 | 3 | 4.0 | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 | nan | ||
18617381 | 105654 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 300 | 3 | 1 | 4 | 3.1 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2C)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL312551 | 105654 | 0 | None | - | 0 | Human | 6.0 | pIC50 | = | 6 | Binding | ChEMBL | 300 | 3 | 1 | 4 | 3.1 | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2C)c1C | 10.1016/0960-894X(96)00441-6 | ||
15453170 | 104874 | 4 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
CHEMBL311258 | 104874 | 4 | None | - | 0 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c1C | 10.1016/0960-894X(96)00441-6 | ||
1009 | 194 | 25 | None | - | 1 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm990170q | ||
5310991 | 194 | 25 | None | - | 1 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm990170q | ||
CHEMBL332794 | 194 | 25 | None | - | 1 | Human | 5.0 | pIC50 | = | 5 | Binding | ChEMBL | 558 | 11 | 2 | 6 | 5.8 | CCCOc1ccc(cc1)[C@@H]1N(CC(=O)Nc2c(CC)cccc2CC)C[C@@H]([C@H]1C(=O)O)c1ccc2c(c1)OCO2 | 10.1021/jm990170q | ||
44284481 | 213702 | 0 | None | -6 | 5 | Rat | 9.8 | pKd | = | 9.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL437472 | 213702 | 0 | None | -6 | 5 | Rat | 9.8 | pKd | = | 9.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL409577 | 212746 | 0 | None | - | 1 | Rat | 9.5 | pKd | = | 9.5 | Binding | ChEMBL | None | None | None | CCCC[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC(=O)[C@H](C)NC(=O)[C@@H](CO)NC(=O)[C@H](N)CSSC[C@H](C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC1=O | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL442316 | 213888 | 0 | None | - | 1 | Rat | 9.2 | pKd | = | 9.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
19095644 | 169688 | 0 | None | - | 1 | Rat | 6.9 | pKd | = | 6.9 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccccc2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4438132 | 169688 | 0 | None | - | 1 | Rat | 6.9 | pKd | = | 6.9 | Binding | ChEMBL | 549 | 10 | 2 | 8 | 5.4 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ccccc2)nc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL438470 | 213749 | 0 | None | - | 1 | Rat | 6.9 | pKd | = | 6.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](C)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL412467 | 212970 | 0 | None | - | 1 | Rat | 5.9 | pKd | = | 5.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
19735343 | 176027 | 0 | None | - | 1 | Rat | 5.8 | pKd | = | 5.8 | Binding | ChEMBL | 473 | 7 | 2 | 6 | 4.0 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4590568 | 176027 | 0 | None | - | 1 | Rat | 5.8 | pKd | = | 5.8 | Binding | ChEMBL | 473 | 7 | 2 | 6 | 4.0 | O=S(=O)(Nc1ncnc(OCCO)c1-c1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL409577 | 212746 | 0 | None | - | 1 | Rat | 7.8 | pKd | = | 7.8 | Binding | ChEMBL | None | None | None | CCCC[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC(=O)[C@H](C)NC(=O)[C@@H](CO)NC(=O)[C@H](N)CSSC[C@H](C(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)[C@@H](C)CC)[C@@H](C)CC)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC1=O | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL386629 | 212362 | 0 | None | - | 1 | Rat | 6.7 | pKd | = | 6.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](C)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
155519384 | 170394 | 0 | None | - | 1 | Rat | 7.7 | pKd | = | 7.7 | Binding | ChEMBL | 674 | 12 | 1 | 13 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)c1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4448273 | 170394 | 0 | None | - | 1 | Rat | 7.7 | pKd | = | 7.7 | Binding | ChEMBL | 674 | 12 | 1 | 13 | 4.1 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(N2CCOCC2)nc1OCC#CCOC(=O)c1ccccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL438027 | 213720 | 0 | None | - | 1 | Rat | 5.7 | pKd | = | 5.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL263581 | 210553 | 0 | None | - | 1 | Rat | 8.7 | pKd | = | 8.7 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL410001 | 212771 | 0 | None | - | 1 | Rat | 5.5 | pKd | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL412467 | 212970 | 0 | None | - | 1 | Rat | 7.5 | pKd | = | 7.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL409171 | 212726 | 0 | None | - | 1 | Rat | 5.5 | pKd | = | 5.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/S0960-894X(01)81085-4 | ||||
104865 | 703 | 99 | None | -1 | 4 | Rat | 7.4 | pKd | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
3494 | 703 | 99 | None | -1 | 4 | Rat | 7.4 | pKd | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
392 | 703 | 99 | None | -1 | 4 | Rat | 7.4 | pKd | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL957 | 703 | 99 | None | -1 | 4 | Rat | 7.4 | pKd | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
DB00559 | 703 | 99 | None | -1 | 4 | Rat | 7.4 | pKd | = | 7.4 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1016/j.bmcl.2016.06.014 | ||
10395582 | 16936 | 0 | None | - | 1 | Rat | 5.4 | pKd | = | 5.4 | Binding | ChEMBL | 806 | 8 | 6 | 13 | 3.2 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)Nc4ccccc4)C(C)(C)C)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | 10.1016/S0960-894X(01)81085-4 | ||
CHEMBL125377 | 16936 | 0 | None | - | 1 | Rat | 5.4 | pKd | = | 5.4 | Binding | ChEMBL | 806 | 8 | 6 | 13 | 3.2 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)Nc4ccccc4)C(C)(C)C)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | 10.1016/S0960-894X(01)81085-4 | ||
CHEMBL414286 | 213097 | 0 | None | - | 1 | Rat | 6.4 | pKd | = | 6.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](C)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL409578 | 212747 | 0 | None | - | 1 | Rat | 5.3 | pKd | = | 5.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](NC(C)=O)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL412346 | 212961 | 0 | None | - | 1 | Rat | 7.3 | pKd | = | 7.3 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL438027 | 213720 | 0 | None | - | 1 | Rat | 8.2 | pKd | = | 8.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL268318 | 210721 | 0 | None | - | 1 | Rat | 6.2 | pKd | = | 6.2 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](C)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL442316 | 213888 | 0 | None | - | 1 | Rat | 7.1 | pKd | = | 7.1 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL414286 | 213097 | 0 | None | - | 1 | Rat | 8.0 | pKd | = | 8.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](C)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/S0960-894X(01)81085-4 | ||||
CHEMBL407887 | 212669 | 0 | None | - | 1 | Rat | 6.0 | pKd | = | 6.0 | Binding | ChEMBL | None | None | None | CSCC[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC(=O)[C@@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC1=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c3ccccc13)C(=O)O)CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N2 | 10.1016/S0960-894X(01)81085-4 | ||||
10983585 | 173250 | 0 | None | - | 1 | Rat | 6.0 | pKd | = | 6.0 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4525321 | 173250 | 0 | None | - | 1 | Rat | 6.0 | pKd | = | 6.0 | Binding | ChEMBL | 473 | 9 | 2 | 8 | 3.7 | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ncnc1OCCO | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL409171 | 212726 | 0 | None | - | 1 | Rat | 7.0 | pKd | = | 7.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1016/S0960-894X(01)81085-4 | ||||
44277840 | 98226 | 0 | None | 81283 | 2 | Human | 11.0 | pKi | = | 11 | Binding | ChEMBL | 522 | 7 | 1 | 7 | 5.8 | Cc1onc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2N(C)C(=O)CC(C)(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL274489 | 98226 | 0 | None | 81283 | 2 | Human | 11.0 | pKi | = | 11 | Binding | ChEMBL | 522 | 7 | 1 | 7 | 5.8 | Cc1onc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2N(C)C(=O)CC(C)(C)C)c1C | 10.1021/jm020289q | ||
11071765 | 169183 | 0 | None | 8709 | 2 | Human | 11.0 | pKi | = | 11 | Binding | ChEMBL | 556 | 9 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)Cc2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL440780 | 169183 | 0 | None | 8709 | 2 | Human | 11.0 | pKi | = | 11 | Binding | ChEMBL | 556 | 9 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)Cc2ccccc2)c1C | 10.1021/jm020289q | ||
44275660 | 98648 | 0 | None | - | 1 | Human | 11.0 | pKi | = | 11 | Binding | ChEMBL | 522 | 8 | 2 | 7 | 5.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CNC(=O)CC(C)(C)C)c1C | 10.1021/jm030480f | ||
CHEMBL277447 | 98648 | 0 | None | - | 1 | Human | 11.0 | pKi | = | 11 | Binding | ChEMBL | 522 | 8 | 2 | 7 | 5.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CNC(=O)CC(C)(C)C)c1C | 10.1021/jm030480f | ||
9852318 | 9582 | 8 | None | 2691 | 2 | Human | 10.8 | pKi | = | 10.8 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL112624 | 9582 | 8 | None | 2691 | 2 | Human | 10.8 | pKi | = | 10.8 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
CHEMBL1627022 | 9582 | 8 | None | 2691 | 2 | Human | 10.8 | pKi | = | 10.8 | Binding | ChEMBL | 613 | 11 | 2 | 9 | 4.5 | Cc1ccc(-c2c(NS(=O)(=O)c3ccc(C(C)(C)CO)cc3)ncnc2OCCOc2ncc(Br)cn2)cc1 | 10.1021/jm000538f | ||
10119517 | 99206 | 0 | None | 169824 | 2 | Human | 10.7 | pKi | = | 10.7 | Binding | ChEMBL | 536 | 8 | 1 | 7 | 5.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)CC(C)(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL281659 | 99206 | 0 | None | 169824 | 2 | Human | 10.7 | pKi | = | 10.7 | Binding | ChEMBL | 536 | 8 | 1 | 7 | 5.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)CC(C)(C)C)c1C | 10.1021/jm020289q | ||
11124425 | 99836 | 0 | None | 75857 | 2 | Human | 10.7 | pKi | = | 10.7 | Binding | ChEMBL | 543 | 7 | 1 | 8 | 5.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cn2ccc(C(F)(F)F)n2)c1C | 10.1021/jm020289q | ||
CHEMBL285832 | 99836 | 0 | None | 75857 | 2 | Human | 10.7 | pKi | = | 10.7 | Binding | ChEMBL | 543 | 7 | 1 | 8 | 5.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cn2ccc(C(F)(F)F)n2)c1C | 10.1021/jm020289q | ||
10918301 | 101469 | 0 | None | 7585 | 2 | Human | 10.7 | pKi | = | 10.7 | Binding | ChEMBL | 514 | 8 | 1 | 7 | 6.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)c2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL29793 | 101469 | 0 | None | 7585 | 2 | Human | 10.7 | pKi | = | 10.7 | Binding | ChEMBL | 514 | 8 | 1 | 7 | 6.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)c2ccccc2)c1C | 10.1021/jm020289q | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 10.6 | pKi | = | 10.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.ejmech.2013.01.044 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 10.6 | pKi | = | 10.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.ejmech.2013.01.044 | ||||
11731054 | 98783 | 0 | None | 21379 | 2 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 522 | 7 | 1 | 7 | 5.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)C(C)(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL27855 | 98783 | 0 | None | 21379 | 2 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 522 | 7 | 1 | 7 | 5.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)C(C)(C)C)c1C | 10.1021/jm020289q | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm030528p | ||
186002 | 102815 | 23 | None | -1 | 3 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 531 | 10 | 2 | 6 | 5.4 | CCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1C[C@H](C)C(=O)O)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm030528p | ||
CHEMBL305576 | 102815 | 23 | None | -1 | 3 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 531 | 10 | 2 | 6 | 5.4 | CCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1C[C@H](C)C(=O)O)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm030528p | ||
44284481 | 213702 | 0 | None | -6 | 5 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
CHEMBL437472 | 213702 | 0 | None | -6 | 5 | Rat | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/acs.jmedchem.5b01781 | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm9505369 | ||
9936145 | 18995 | 2 | None | - | 1 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 510 | 11 | 1 | 4 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)c(F)c1 | 10.1021/jm010237l | ||
CHEMBL128818 | 18995 | 2 | None | - | 1 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 510 | 11 | 1 | 4 | 5.3 | CCCCN(CCCC)C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(C)c(F)c1 | 10.1021/jm010237l | ||
44284481 | 213702 | 0 | None | -3 | 5 | Pig | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||||
CHEMBL437472 | 213702 | 0 | None | -3 | 5 | Pig | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||||
9958321 | 79122 | 0 | None | 19498 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 520 | 7 | 1 | 7 | 5.2 | Cc1onc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN2CCC(C)(C)C2=O)c1C | 10.1021/jm020289q | ||
CHEMBL2113316 | 79122 | 0 | None | 19498 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 520 | 7 | 1 | 7 | 5.2 | Cc1onc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN2CCC(C)(C)C2=O)c1C | 10.1021/jm020289q | ||
11813553 | 99318 | 0 | None | 14454 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 542 | 8 | 1 | 7 | 5.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)c2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL282359 | 99318 | 0 | None | 14454 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 542 | 8 | 1 | 7 | 5.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)c2ccccc2)c1C | 10.1021/jm020289q | ||
11027595 | 100213 | 0 | None | 19952 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 508 | 8 | 1 | 7 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)C(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL28863 | 100213 | 0 | None | 19952 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 508 | 8 | 1 | 7 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)C(C)C)c1C | 10.1021/jm020289q | ||
10918368 | 102496 | 0 | None | 21379 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 520 | 7 | 1 | 7 | 5.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN2CC(C)(C)CC2=O)c1C | 10.1021/jm020289q | ||
CHEMBL30405 | 102496 | 0 | None | 21379 | 2 | Human | 10.4 | pKi | = | 10.4 | Binding | ChEMBL | 520 | 7 | 1 | 7 | 5.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN2CC(C)(C)CC2=O)c1C | 10.1021/jm020289q | ||
159594 | 520 | 45 | None | -1 | 3 | Rat | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
3487 | 520 | 45 | None | -1 | 3 | Rat | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
CHEMBL9194 | 520 | 45 | None | -1 | 3 | Rat | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
DB06199 | 520 | 45 | None | -1 | 3 | Rat | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 10.1021/jm010237l | ||
11082168 | 99187 | 0 | None | 7585 | 2 | Human | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 548 | 8 | 1 | 7 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)CC(F)(F)F)c1C | 10.1021/jm020289q | ||
CHEMBL281549 | 99187 | 0 | None | 7585 | 2 | Human | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 548 | 8 | 1 | 7 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)CC(F)(F)F)c1C | 10.1021/jm020289q | ||
10929533 | 100327 | 0 | None | 10964 | 2 | Human | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 534 | 9 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C(=O)C(C)C)C2CC2)c1C | 10.1021/jm020289q | ||
CHEMBL28963 | 100327 | 0 | None | 10964 | 2 | Human | 10.3 | pKi | = | 10.3 | Binding | ChEMBL | 534 | 9 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C(=O)C(C)C)C2CC2)c1C | 10.1021/jm020289q | ||
9914310 | 206620 | 8 | None | 1995 | 2 | Human | 10.2 | pKi | = | 10.2 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL8923 | 206620 | 8 | None | 1995 | 2 | Human | 10.2 | pKi | = | 10.2 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1CC(c2ccc3c(c2)OCO3)C(C(=O)O)C1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
11762890 | 100635 | 0 | None | 14791 | 2 | Human | 10.2 | pKi | = | 10.2 | Binding | ChEMBL | 505 | 8 | 2 | 9 | 5.3 | Cc1cc(NCc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)no1 | 10.1021/jm020289q | ||
CHEMBL29223 | 100635 | 0 | None | 14791 | 2 | Human | 10.2 | pKi | = | 10.2 | Binding | ChEMBL | 505 | 8 | 2 | 9 | 5.3 | Cc1cc(NCc2cc(-c3ncco3)ccc2-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)no1 | 10.1021/jm020289q | ||
131845706 | 3446 | 6 | None | -11 | 2 | Rat | 10.1 | pKi | = | 10.1 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
71308726 | 3446 | 6 | None | -11 | 2 | Rat | 10.1 | pKi | = | 10.1 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
995 | 3446 | 6 | None | -11 | 2 | Rat | 10.1 | pKi | = | 10.1 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
CHEMBL1222310 | 3446 | 6 | None | -11 | 2 | Rat | 10.1 | pKi | = | 10.1 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
CHEMBL4524099 | 3446 | 6 | None | -11 | 2 | Rat | 10.1 | pKi | = | 10.1 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
44284481 | 213702 | 0 | None | -6 | 5 | Rat | 10.0 | pKi | = | 10.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
CHEMBL437472 | 213702 | 0 | None | -6 | 5 | Rat | 10.0 | pKi | = | 10.0 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
9937336 | 174655 | 1 | None | 229 | 2 | Human | 10.0 | pKi | = | 10.0 | Binding | ChEMBL | 510 | 9 | 1 | 7 | 4.8 | CCCc1nc(C)ccc1O[C@@H](C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL4559129 | 174655 | 1 | None | 229 | 2 | Human | 10.0 | pKi | = | 10.0 | Binding | ChEMBL | 510 | 9 | 1 | 7 | 4.8 | CCCc1nc(C)ccc1O[C@@H](C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1016/j.bmcl.2016.06.014 | ||
9865409 | 102302 | 0 | None | 199 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 394 | 8 | 1 | 6 | 3.2 | COc1cc(C)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL303631 | 102302 | 0 | None | 199 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 394 | 8 | 1 | 6 | 3.2 | COc1cc(C)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
9894460 | 206686 | 9 | None | 24 | 3 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm9505369 | ||
CHEMBL313871 | 206686 | 9 | None | 24 | 3 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm9505369 | ||
CHEMBL8978 | 206686 | 9 | None | 24 | 3 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 539 | 10 | 2 | 7 | 4.8 | CCCc1cc(C(=O)O)ccc1OC(C(=O)NS(=O)(=O)c1ccc(C(C)C)cc1)c1ccc2c(c1)OCO2 | 10.1021/jm9505369 | ||
12286 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1021/jm980217s | ||
6433095 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1021/jm980217s | ||
CHEMBL109648 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1021/jm980217s | ||
DB06677 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 10.1021/jm980217s | ||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.bmcl.2013.01.025 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/j.bmcl.2013.01.025 | ||||
44284481 | 213702 | 0 | None | -4 | 5 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm8007618 | ||||
CHEMBL437472 | 213702 | 0 | None | -4 | 5 | Human | 9.9 | pKi | = | 9.9 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](CO)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm8007618 | ||||
10973161 | 101017 | 0 | None | 6456 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 502 | 8 | 2 | 9 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CNc2ccncn2)c1C | 10.1021/jm020289q | ||
CHEMBL29464 | 101017 | 0 | None | 6456 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 502 | 8 | 2 | 9 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CNc2ccncn2)c1C | 10.1021/jm020289q | ||
11103326 | 167881 | 0 | None | 12589 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 520 | 8 | 1 | 7 | 5.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)CC(F)(F)F)c1C | 10.1021/jm020289q | ||
CHEMBL431296 | 167881 | 0 | None | 12589 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 520 | 8 | 1 | 7 | 5.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)CC(F)(F)F)c1C | 10.1021/jm020289q | ||
9870830 | 206691 | 38 | None | 66 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9505369 | ||
CHEMBL8981 | 206691 | 38 | None | 66 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 506 | 8 | 1 | 9 | 3.8 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OC)c2)cc1 | 10.1021/jm9505369 | ||
23670447 | 3007 | 2 | None | 114 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm980217s | ||
999 | 3007 | 2 | None | 114 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm980217s | ||
CHEMBL1204799 | 3007 | 2 | None | 114 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm980217s | ||
CHEMBL25438 | 3007 | 2 | None | 114 | 2 | Human | 9.8 | pKi | = | 9.8 | Binding | ChEMBL | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 10.1021/jm980217s | ||
108002 | 3468 | 23 | None | 56 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm970101g | ||
3528 | 3468 | 23 | None | 56 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm970101g | ||
CHEMBL8823 | 3468 | 23 | None | 56 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm970101g | ||
11754273 | 100946 | 0 | None | 21877 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 466 | 7 | 2 | 7 | 4.1 | CC(=O)NCc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm000105c | ||
CHEMBL29422 | 100946 | 0 | None | 21877 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 466 | 7 | 2 | 7 | 4.1 | CC(=O)NCc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm000105c | ||
11059912 | 99312 | 0 | None | 23988 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 481 | 9 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2COCC(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL282303 | 99312 | 0 | None | 23988 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 481 | 9 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2COCC(C)C)c1C | 10.1021/jm020289q | ||
10972867 | 99675 | 0 | None | 19952 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 480 | 7 | 1 | 7 | 4.4 | CC(=O)N(C)Cc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm020289q | ||
CHEMBL284656 | 99675 | 0 | None | 19952 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 480 | 7 | 1 | 7 | 4.4 | CC(=O)N(C)Cc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm020289q | ||
11754273 | 100946 | 0 | None | 21877 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 466 | 7 | 2 | 7 | 4.1 | CC(=O)NCc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm020289q | ||
CHEMBL29422 | 100946 | 0 | None | 21877 | 2 | Human | 9.7 | pKi | = | 9.7 | Binding | ChEMBL | 466 | 7 | 2 | 7 | 4.1 | CC(=O)NCc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm020289q | ||
131845706 | 3446 | 6 | None | -11 | 2 | Rat | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
71308726 | 3446 | 6 | None | -11 | 2 | Rat | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
995 | 3446 | 6 | None | -11 | 2 | Rat | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
CHEMBL1222310 | 3446 | 6 | None | -11 | 2 | Rat | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
CHEMBL4524099 | 3446 | 6 | None | -11 | 2 | Rat | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | None | None | None | None | 10.1021/jm00087a001 | ||||
46228086 | 199811 | 0 | None | 707 | 2 | Mouse | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | 598 | 10 | 1 | 9 | 4.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCBr)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL594265 | 199811 | 0 | None | 707 | 2 | Mouse | 9.6 | pKi | = | 9.6 | Binding | ChEMBL | 598 | 10 | 1 | 9 | 4.6 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCBr)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
11123603 | 101769 | 0 | None | 14125 | 2 | Human | 9.5 | pKi | = | 9.5 | Binding | ChEMBL | 475 | 7 | 1 | 8 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cn2ccnc2)c1C | 10.1021/jm020289q | ||
CHEMBL30009 | 101769 | 0 | None | 14125 | 2 | Human | 9.5 | pKi | = | 9.5 | Binding | ChEMBL | 475 | 7 | 1 | 8 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cn2ccnc2)c1C | 10.1021/jm020289q | ||
11730445 | 101881 | 0 | None | 4677 | 2 | Human | 9.5 | pKi | = | 9.5 | Binding | ChEMBL | 475 | 7 | 1 | 8 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cn2cccn2)c1C | 10.1021/jm020289q | ||
CHEMBL30092 | 101881 | 0 | None | 4677 | 2 | Human | 9.5 | pKi | = | 9.5 | Binding | ChEMBL | 475 | 7 | 1 | 8 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cn2cccn2)c1C | 10.1021/jm020289q | ||
46228118 | 202519 | 0 | None | 263 | 2 | Mouse | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 690 | 13 | 1 | 12 | 4.7 | COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCOc3ccc(S(C)(=O)=O)cc3)cc2)cc(OC)c1OC | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL611626 | 202519 | 0 | None | 263 | 2 | Mouse | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 690 | 13 | 1 | 12 | 4.7 | COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCOc3ccc(S(C)(=O)=O)cc3)cc2)cc(OC)c1OC | 10.1016/j.bmc.2009.08.058 | ||
11082049 | 99532 | 0 | None | 933 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 534 | 7 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN2CCCC(C)(C)C2=O)c1C | 10.1021/jm020289q | ||
CHEMBL283610 | 99532 | 0 | None | 933 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 534 | 7 | 1 | 7 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN2CCCC(C)(C)C2=O)c1C | 10.1021/jm020289q | ||
10432263 | 102125 | 0 | None | 85 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 420 | 8 | 1 | 6 | 3.4 | COc1nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)nc2c1CCC2 | 10.1021/jm960274q | ||
CHEMBL302564 | 102125 | 0 | None | 85 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 420 | 8 | 1 | 6 | 3.4 | COc1nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)nc2c1CCC2 | 10.1021/jm960274q | ||
10864118 | 101441 | 0 | None | 4265 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 508 | 8 | 1 | 7 | 5.2 | CC(=O)N(Cc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C)C(C)C | 10.1021/jm020289q | ||
CHEMBL29775 | 101441 | 0 | None | 4265 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 508 | 8 | 1 | 7 | 5.2 | CC(=O)N(Cc1cc(-c2ncco2)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C)C(C)C | 10.1021/jm020289q | ||
11477084 | 3583 | 53 | None | 1 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
216235 | 3583 | 53 | None | 1 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
3548 | 3583 | 53 | None | 1 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
3950 | 3583 | 53 | None | 1 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
CHEMBL282724 | 3583 | 53 | None | 1 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
DB06268 | 3583 | 53 | None | 1 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm9700068 | ||
11477084 | 3583 | 53 | None | -1 | 2 | Rat | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
216235 | 3583 | 53 | None | -1 | 2 | Rat | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
3548 | 3583 | 53 | None | -1 | 2 | Rat | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
3950 | 3583 | 53 | None | -1 | 2 | Rat | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
CHEMBL282724 | 3583 | 53 | None | -1 | 2 | Rat | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
DB06268 | 3583 | 53 | None | -1 | 2 | Rat | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | 10.1021/jm030528p | ||
108002 | 3468 | 23 | None | 56 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm00037a003 | ||
3528 | 3468 | 23 | None | 56 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm00037a003 | ||
CHEMBL8823 | 3468 | 23 | None | 56 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm00037a003 | ||
108002 | 3468 | 23 | None | 56 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm9505369 | ||
3528 | 3468 | 23 | None | 56 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm9505369 | ||
CHEMBL8823 | 3468 | 23 | None | 56 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H]([C@@H]([C@H]2c1ccc2c(c1)OCO2)C(=O)O)c1ccc(cc1OCC(=O)O)OC | 10.1021/jm9505369 | ||
44339756 | 110745 | 0 | None | - | 1 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | Cc1cc2c(cc1CC(=O)c1ccsc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm980217s | ||
CHEMBL326059 | 110745 | 0 | None | - | 1 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 454 | 6 | 1 | 8 | 4.0 | Cc1cc2c(cc1CC(=O)c1ccsc1S(=O)(=O)Nc1onc(C)c1Cl)OCO2 | 10.1021/jm980217s | ||
9849547 | 183982 | 0 | None | 34 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1OCC(=O)O)[C@@H](C(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
CHEMBL48196 | 183982 | 0 | None | 34 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 520 | 10 | 2 | 7 | 4.7 | CCCOc1ccc2c(c1)[C@H](c1ccc(OC)cc1OCC(=O)O)[C@@H](C(=O)O)[C@@H]2c1ccc2c(c1)OCO2 | 10.1016/s0960-894x(01)00273-6 | ||
11734435 | 101275 | 0 | None | 6456 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 562 | 9 | 1 | 7 | 6.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)CC2CCCCC2)c1C | 10.1021/jm020289q | ||
CHEMBL29652 | 101275 | 0 | None | 6456 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | ChEMBL | 562 | 9 | 1 | 7 | 6.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)CC2CCCCC2)c1C | 10.1021/jm020289q | ||
9915028 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210307 | ||
CHEMBL111612 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210307 | ||
CHEMBL4761843 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210307 | ||
9915028 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm010237l | ||
CHEMBL111612 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm010237l | ||
CHEMBL4761843 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm010237l | ||
9915028 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL111612 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
CHEMBL4761843 | 9379 | 18 | None | 28183 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 532 | 15 | 1 | 6 | 5.5 | CCCCN(CCCC)C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CC(C)(C)CCC | 10.1021/jm980217s | ||
10815239 | 108531 | 0 | None | 125 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 500 | 10 | 1 | 7 | 5.0 | COc1ccc(OC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
CHEMBL320224 | 108531 | 0 | None | 125 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 500 | 10 | 1 | 7 | 5.0 | COc1ccc(OC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
11794992 | 4940 | 0 | None | 39810 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cocn3)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL104848 | 4940 | 0 | None | 39810 | 2 | Human | 9.3 | pKi | = | 9.3 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cocn3)cc2)c1C | 10.1021/jm000105c | ||
11812665 | 99740 | 0 | None | 18197 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 467 | 8 | 1 | 7 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2COC(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL285118 | 99740 | 0 | None | 18197 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 467 | 8 | 1 | 7 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2COC(C)C)c1C | 10.1021/jm020289q | ||
11124545 | 101346 | 0 | None | 4168 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 557 | 9 | 1 | 8 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)Cc2ccccn2)c1C | 10.1021/jm020289q | ||
CHEMBL29710 | 101346 | 0 | None | 4168 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 557 | 9 | 1 | 8 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)C(=O)Cc2ccccn2)c1C | 10.1021/jm020289q | ||
10907333 | 102055 | 0 | None | 1819 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 508 | 7 | 2 | 7 | 4.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CC(=O)NC(C)(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL30215 | 102055 | 0 | None | 1819 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 508 | 7 | 2 | 7 | 4.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CC(=O)NC(C)(C)C)c1C | 10.1021/jm020289q | ||
10786696 | 102760 | 0 | None | 223 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 392 | 8 | 1 | 5 | 3.8 | CCc1cc(C)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL305270 | 102760 | 0 | None | 223 | 2 | Human | 9.2 | pKi | = | 9.2 | Binding | ChEMBL | 392 | 8 | 1 | 5 | 3.8 | CCc1cc(C)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
11081276 | 101196 | 0 | None | 2238 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cc2ncco2)c1C | 10.1021/jm020289q | ||
CHEMBL29598 | 101196 | 0 | None | 2238 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 476 | 7 | 1 | 8 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2Cc2ncco2)c1C | 10.1021/jm020289q | ||
10973218 | 100942 | 0 | None | 3388 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 506 | 8 | 2 | 7 | 5.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CNCC(F)(F)F)c1C | 10.1021/jm020289q | ||
CHEMBL29420 | 100942 | 0 | None | 3388 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 506 | 8 | 2 | 7 | 5.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CNCC(F)(F)F)c1C | 10.1021/jm020289q | ||
44311692 | 103139 | 0 | None | -3 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 667 | 13 | 3 | 7 | 4.5 | C=CCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL308102 | 103139 | 0 | None | -3 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 667 | 13 | 3 | 7 | 4.5 | C=CCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
9822616 | 121966 | 0 | None | 17782 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL359273 | 121966 | 0 | None | 17782 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
9979632 | 102874 | 0 | None | 41 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 422 | 8 | 1 | 7 | 2.8 | COc1nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)nc2c1CCO2 | 10.1021/jm960274q | ||
CHEMBL305980 | 102874 | 0 | None | 41 | 2 | Human | 9.1 | pKi | = | 9.1 | Binding | ChEMBL | 422 | 8 | 1 | 7 | 2.8 | COc1nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)nc2c1CCO2 | 10.1021/jm960274q | ||
17979744 | 18222 | 0 | None | - | 1 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 657 | 10 | 1 | 8 | 6.6 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CN3CCC(C)(C)C3=O)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12703 | 18222 | 0 | None | - | 1 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 657 | 10 | 1 | 8 | 6.6 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CN3CCC(C)(C)C3=O)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
197712 | 102153 | 57 | None | 194 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)O | 10.1021/jm960274q | ||
CHEMBL302753 | 102153 | 57 | None | 194 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 378 | 7 | 1 | 5 | 3.5 | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)O | 10.1021/jm960274q | ||
10763862 | 163193 | 0 | None | 1096 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 406 | 9 | 1 | 5 | 4.0 | CCc1cc(CC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL418326 | 163193 | 0 | None | 1096 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 406 | 9 | 1 | 5 | 4.0 | CCc1cc(CC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
11733544 | 99207 | 0 | None | 7244 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 480 | 7 | 1 | 7 | 4.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CC(=O)N(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL281668 | 99207 | 0 | None | 7244 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 480 | 7 | 1 | 7 | 4.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CC(=O)N(C)C)c1C | 10.1021/jm020289q | ||
11103112 | 99840 | 0 | None | 4570 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 501 | 8 | 1 | 7 | 6.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2COc2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL28586 | 99840 | 0 | None | 4570 | 2 | Human | 9.0 | pKi | = | 9 | Binding | ChEMBL | 501 | 8 | 1 | 7 | 6.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2COc2ccccc2)c1C | 10.1021/jm020289q | ||
45257114 | 199840 | 0 | None | 218 | 2 | Mouse | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCF)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL594482 | 199840 | 0 | None | 218 | 2 | Mouse | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCF)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
178103 | 167927 | 14 | None | 100 | 2 | Human | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 506 | 10 | 2 | 7 | 4.6 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCCO)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm970101g | ||
CHEMBL431651 | 167927 | 14 | None | 100 | 2 | Human | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 506 | 10 | 2 | 7 | 4.6 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCCO)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm970101g | ||
45257114 | 199840 | 0 | None | 218 | 2 | Mouse | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCF)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL594482 | 199840 | 0 | None | 218 | 2 | Mouse | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCF)c2)cc1 | 10.1021/jm101110w | ||
178103 | 167927 | 14 | None | 100 | 2 | Human | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 506 | 10 | 2 | 7 | 4.6 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCCO)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm980217s | ||
CHEMBL431651 | 167927 | 14 | None | 100 | 2 | Human | 9.0 | pKi | = | 9.0 | Binding | ChEMBL | 506 | 10 | 2 | 7 | 4.6 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OCCO)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm980217s | ||
46228117 | 199761 | 0 | None | 1 | 2 | Mouse | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 690 | 13 | 1 | 12 | 4.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOc3ccc(S(C)(=O)=O)cc3)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL593928 | 199761 | 0 | None | 1 | 2 | Mouse | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 690 | 13 | 1 | 12 | 4.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOc3ccc(S(C)(=O)=O)cc3)c2)cc1 | 10.1016/j.bmc.2009.08.058 | ||
10840560 | 4635 | 0 | None | 2 | 2 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 558 | 13 | 1 | 8 | 5.2 | COc1cc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc(OC)c1OC | 10.1021/jm9910425 | ||
CHEMBL103201 | 4635 | 0 | None | 2 | 2 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 558 | 13 | 1 | 8 | 5.2 | COc1cc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc(OC)c1OC | 10.1021/jm9910425 | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1016/s0960-894x(01)00791-0 | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1016/s0960-894x(01)00791-0 | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm300682j | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm300682j | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm300682j | ||
13016 | 667 | 13 | None | -1 | 4 | Rat | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm030528p | ||
9843631 | 667 | 13 | None | -1 | 4 | Rat | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm030528p | ||
CHEMBL24461 | 667 | 13 | None | -1 | 4 | Rat | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm030528p | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm020138n | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm020138n | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm020138n | ||
13016 | 667 | 13 | None | -1 | 4 | Rat | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1016/j.bmcl.2016.06.014 | ||
9843631 | 667 | 13 | None | -1 | 4 | Rat | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL24461 | 667 | 13 | None | -1 | 4 | Rat | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1016/j.bmcl.2016.06.014 | ||
51003306 | 58033 | 0 | None | 295 | 2 | Mouse | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 670 | 19 | 1 | 12 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCF)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672880 | 58033 | 0 | None | 295 | 2 | Mouse | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 670 | 19 | 1 | 12 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCF)c2)cc1 | 10.1021/jm101110w | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm000105c | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm000105c | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm000105c | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm020289q | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm020289q | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm020289q | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm030480f | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm030480f | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10.1021/jm030480f | ||
9938533 | 105386 | 4 | None | -1 | 2 | Human | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@@H](NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
CHEMBL311854 | 105386 | 4 | None | -1 | 2 | Human | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@@H](NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
10553793 | 4429 | 0 | None | 75 | 2 | Human | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | 512 | 11 | 2 | 6 | 4.8 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(C(=O)O)cc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
CHEMBL101742 | 4429 | 0 | None | 75 | 2 | Human | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | 512 | 11 | 2 | 6 | 4.8 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(C(=O)O)cc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
11113812 | 100769 | 0 | None | 1258 | 2 | Human | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | 497 | 7 | 1 | 6 | 6.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2/C=C\c2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL29313 | 100769 | 0 | None | 1258 | 2 | Human | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | 497 | 7 | 1 | 6 | 6.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2/C=C\c2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL1790180 | 208860 | 0 | None | -72 | 3 | Rat | 8.8 | pKi | = | 8.8 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CCc3ccc(O)cc3)NC(=O)[C@H]([C@H](C)O)NC(=O)[C@@H](Cc3ccccc3)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
9938533 | 105386 | 4 | None | -1 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@@H](NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL311854 | 105386 | 4 | None | -1 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@@H](NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00387-4 | ||
9895957 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1016/j.bmc.2012.06.011 | ||
CHEMBL11706 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1016/j.bmc.2012.06.011 | ||
44311728 | 104326 | 0 | None | -13 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 653 | 12 | 3 | 7 | 4.4 | C=CS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL310039 | 104326 | 0 | None | -13 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 653 | 12 | 3 | 7 | 4.4 | C=CS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
9895957 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1021/jm020138n | ||
CHEMBL11706 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1021/jm020138n | ||
9895957 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1021/jm058225d | ||
CHEMBL11706 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1021/jm058225d | ||
10555112 | 4705 | 0 | None | 12 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 572 | 14 | 2 | 8 | 4.6 | COc1cc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)ccc1OCC(=O)O | 10.1021/jm9910425 | ||
CHEMBL103695 | 4705 | 0 | None | 12 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 572 | 14 | 2 | 8 | 4.6 | COc1cc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)ccc1OCC(=O)O | 10.1021/jm9910425 | ||
11799974 | 4499 | 0 | None | 12 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 514 | 12 | 1 | 7 | 4.8 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(OC)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL102307 | 4499 | 0 | None | 12 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 514 | 12 | 1 | 7 | 4.8 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(OC)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
44311805 | 204543 | 0 | None | -26 | 2 | Human | 8.0 | pKi | = | 8 | Binding | ChEMBL | 669 | 12 | 3 | 7 | 4.7 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NS(=O)(=O)C(C)C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL73000 | 204543 | 0 | None | -26 | 2 | Human | 8.0 | pKi | = | 8 | Binding | ChEMBL | 669 | 12 | 3 | 7 | 4.7 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NS(=O)(=O)C(C)C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
13015 | 1518 | 30 | None | - | 1 | Human | 8.0 | pKi | = | 8 | Binding | ChEMBL | 536 | 8 | 1 | 7 | 5.8 | CC1=C(ON=C1NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)C4=NC=CO4)CN(C)C(=O)CC(C)(C)C)C | 10.1021/jm058225d | ||
156690 | 1518 | 30 | None | - | 1 | Human | 8.0 | pKi | = | 8 | Binding | ChEMBL | 536 | 8 | 1 | 7 | 5.8 | CC1=C(ON=C1NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)C4=NC=CO4)CN(C)C(=O)CC(C)(C)C)C | 10.1021/jm058225d | ||
CHEMBL383581 | 1518 | 30 | None | - | 1 | Human | 8.0 | pKi | = | 8 | Binding | ChEMBL | 536 | 8 | 1 | 7 | 5.8 | CC1=C(ON=C1NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)C4=NC=CO4)CN(C)C(=O)CC(C)(C)C)C | 10.1021/jm058225d | ||
10812403 | 39070 | 0 | None | 120 | 2 | Rat | 7.0 | pKi | = | 7 | Binding | ChEMBL | 427 | 7 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2C(N)=O)c1C | 10.1021/jm970872k | ||
CHEMBL146904 | 39070 | 0 | None | 120 | 2 | Rat | 7.0 | pKi | = | 7 | Binding | ChEMBL | 427 | 7 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2C(N)=O)c1C | 10.1021/jm970872k | ||
10573784 | 165313 | 0 | None | 95 | 2 | Rat | 7.0 | pKi | = | 7 | Binding | ChEMBL | 413 | 7 | 2 | 5 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2CN)c1C | 10.1021/jm970872k | ||
CHEMBL423583 | 165313 | 0 | None | 95 | 2 | Rat | 7.0 | pKi | = | 7 | Binding | ChEMBL | 413 | 7 | 2 | 5 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2CN)c1C | 10.1021/jm970872k | ||
1481 | 2053 | 116 | None | -112 | 3 | Human | 5.0 | pKi | = | 5 | Binding | ChEMBL | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | 10.1021/jm300682j | ||
3749 | 2053 | 116 | None | -112 | 3 | Human | 5.0 | pKi | = | 5 | Binding | ChEMBL | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | 10.1021/jm300682j | ||
589 | 2053 | 116 | None | -112 | 3 | Human | 5.0 | pKi | = | 5 | Binding | ChEMBL | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | 10.1021/jm300682j | ||
6908 | 2053 | 116 | None | -112 | 3 | Human | 5.0 | pKi | = | 5 | Binding | ChEMBL | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | 10.1021/jm300682j | ||
CHEMBL1513 | 2053 | 116 | None | -112 | 3 | Human | 5.0 | pKi | = | 5 | Binding | ChEMBL | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | 10.1021/jm300682j | ||
DB01029 | 2053 | 116 | None | -112 | 3 | Human | 5.0 | pKi | = | 5 | Binding | ChEMBL | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | 10.1021/jm300682j | ||
10619232 | 121969 | 0 | None | - | 1 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 371 | 5 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2N(C)C)c1C | 10.1021/jm970872k | ||
CHEMBL359332 | 121969 | 0 | None | - | 1 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 371 | 5 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2N(C)C)c1C | 10.1021/jm970872k | ||
44267891 | 18727 | 0 | None | - | 1 | Human | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 532 | 8 | 1 | 7 | 5.9 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12779 | 18727 | 0 | None | - | 1 | Human | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 532 | 8 | 1 | 7 | 5.9 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
44333366 | 107399 | 0 | None | -1 | 2 | Human | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 570 | 12 | 1 | 8 | 5.2 | COc1ccc(CCOC(c2ccc(C)cc2)(c2ccc(C)cc2)C(Oc2nc3c(c(OC)n2)COC3)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL318146 | 107399 | 0 | None | -1 | 2 | Human | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 570 | 12 | 1 | 8 | 5.2 | COc1ccc(CCOC(c2ccc(C)cc2)(c2ccc(C)cc2)C(Oc2nc3c(c(OC)n2)COC3)C(=O)O)cc1 | 10.1021/jm9910425 | ||
10742005 | 203674 | 0 | None | 162 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 446 | 9 | 1 | 7 | 3.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2cccc(F)c2)c2cccc(F)c2)n1 | 10.1021/jm960274q | ||
CHEMBL67536 | 203674 | 0 | None | 162 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 446 | 9 | 1 | 7 | 3.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2cccc(F)c2)c2cccc(F)c2)n1 | 10.1021/jm960274q | ||
10740258 | 109651 | 0 | None | 1096 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1cnc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)o1 | 10.1021/jm000105c | ||
CHEMBL322674 | 109651 | 0 | None | 1096 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1cnc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)o1 | 10.1021/jm000105c | ||
10321341 | 145411 | 0 | None | 93 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 446 | 7 | 1 | 5 | 5.2 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm00037a003 | ||
CHEMBL39142 | 145411 | 0 | None | 93 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 446 | 7 | 1 | 5 | 5.2 | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | 10.1021/jm00037a003 | ||
10598958 | 41404 | 0 | None | - | 1 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 434 | 6 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(S(=O)(=O)C(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL149050 | 41404 | 0 | None | - | 1 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 434 | 6 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(S(=O)(=O)C(C)C)cc2)c1C | 10.1021/jm970872k | ||
10715881 | 121515 | 0 | None | 37 | 2 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 398 | 5 | 1 | 4 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL358545 | 121515 | 0 | None | 37 | 2 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 398 | 5 | 1 | 4 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)(C)C)cc2)c1C | 10.1021/jm970872k | ||
9848710 | 169056 | 4 | None | -301 | 4 | Pig | 5.0 | pKi | = | 5.0 | Binding | ChEMBL | 497 | 9 | 3 | 3 | 4.3 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccccc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL439759 | 169056 | 4 | None | -301 | 4 | Pig | 5.0 | pKi | = | 5.0 | Binding | ChEMBL | 497 | 9 | 3 | 3 | 4.3 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccccc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/0960-894X(96)00421-0 | ||
9848710 | 169056 | 4 | None | -301 | 4 | Human | 5.0 | pKi | = | 5.0 | Binding | ChEMBL | 497 | 9 | 3 | 3 | 4.3 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccccc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL439759 | 169056 | 4 | None | -301 | 4 | Human | 5.0 | pKi | = | 5.0 | Binding | ChEMBL | 497 | 9 | 3 | 3 | 4.3 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccccc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
10761748 | 121000 | 0 | None | - | 1 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 371 | 5 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccc(N(C)C)c2)c1C | 10.1021/jm970872k | ||
CHEMBL356591 | 121000 | 0 | None | - | 1 | Rat | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 371 | 5 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccc(N(C)C)c2)c1C | 10.1021/jm970872k | ||
44286764 | 145796 | 0 | None | - | 1 | Human | 5.0 | pKi | = | 5.0 | Binding | ChEMBL | 314 | 3 | 1 | 1 | 4.7 | O=C(O)[C@@H]1[C@@H](c2ccccc2)c2ccccc2[C@H]1c1ccccc1 | 10.1021/jm00037a003 | ||
CHEMBL39171 | 145796 | 0 | None | - | 1 | Human | 5.0 | pKi | = | 5.0 | Binding | ChEMBL | 314 | 3 | 1 | 1 | 4.7 | O=C(O)[C@@H]1[C@@H](c2ccccc2)c2ccccc2[C@H]1c1ccccc1 | 10.1021/jm00037a003 | ||
10503999 | 41284 | 0 | None | 6 | 2 | Rat | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 456 | 8 | 3 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)CN)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL148953 | 41284 | 0 | None | 6 | 2 | Rat | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 456 | 8 | 3 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)CN)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10762600 | 168278 | 0 | None | 154 | 2 | Rat | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1onc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL434082 | 168278 | 0 | None | 154 | 2 | Rat | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1onc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10209324 | 14458 | 0 | None | - | 1 | Human | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 546 | 8 | 1 | 7 | 6.2 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(C)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12013 | 14458 | 0 | None | - | 1 | Human | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 546 | 8 | 1 | 7 | 6.2 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(C)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
44311851 | 204640 | 0 | None | -162 | 2 | Human | 6.9 | pKi | = | 6.9 | Binding | ChEMBL | 564 | 10 | 3 | 5 | 4.9 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccon3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL73697 | 204640 | 0 | None | -162 | 2 | Human | 6.9 | pKi | = | 6.9 | Binding | ChEMBL | 564 | 10 | 3 | 5 | 4.9 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccon3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
10692125 | 203040 | 0 | None | 26 | 2 | Human | 6.9 | pKi | = | 6.9 | Binding | ChEMBL | 396 | 8 | 2 | 7 | 2.3 | COc1cc(OC)nc(OC(C(=O)O)C(O)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL63648 | 203040 | 0 | None | 26 | 2 | Human | 6.9 | pKi | = | 6.9 | Binding | ChEMBL | 396 | 8 | 2 | 7 | 2.3 | COc1cc(OC)nc(OC(C(=O)O)C(O)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
44314607 | 161237 | 0 | None | -1412 | 2 | Pig | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 1534 | 46 | 19 | 18 | -0.2 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
77282208 | 161237 | 0 | None | -1412 | 2 | Pig | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 1534 | 46 | 19 | 18 | -0.2 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL412003 | 161237 | 0 | None | -1412 | 2 | Pig | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 1534 | 46 | 19 | 18 | -0.2 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
10620897 | 41586 | 0 | None | 14 | 2 | Rat | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 398 | 6 | 1 | 4 | 5.3 | Cc1cccc(-c2ccc(CC(C)C)cc2)c1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL149171 | 41586 | 0 | None | 14 | 2 | Rat | 5.9 | pKi | = | 5.9 | Binding | ChEMBL | 398 | 6 | 1 | 4 | 5.3 | Cc1cccc(-c2ccc(CC(C)C)cc2)c1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL4513786 | 213944 | 7 | None | -2344 | 8 | Human | 4.9 | pKi | = | 4.9 | Binding | ChEMBL | None | None | None | CCCCN(CCCC)C(=O)CN1C[C@@H](c2cc(OC)c3c(c2)OCO3)[C@H](C(=O)O)[C@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210307 | ||||
CHEMBL4796803 | 213944 | 7 | None | -2344 | 8 | Human | 4.9 | pKi | = | 4.9 | Binding | ChEMBL | None | None | None | CCCCN(CCCC)C(=O)CN1C[C@@H](c2cc(OC)c3c(c2)OCO3)[C@H](C(=O)O)[C@H]1CC(C)(C)CCC | 10.6019/CHEMBL5210307 | ||||
5344 | 173449 | 101 | None | - | 1 | Human | 4.9 | pKi | = | 4.9 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | nan | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Human | 4.9 | pKi | = | 4.9 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | nan | ||
10740469 | 39275 | 0 | None | 154 | 2 | Rat | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 413 | 7 | 2 | 5 | 5.0 | CNc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL147081 | 39275 | 0 | None | 154 | 2 | Rat | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 413 | 7 | 2 | 5 | 5.0 | CNc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
10668636 | 121946 | 0 | None | 147 | 2 | Rat | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 399 | 6 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL359167 | 121946 | 0 | None | 147 | 2 | Rat | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 399 | 6 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10166561 | 10032 | 0 | None | - | 1 | Human | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 562 | 9 | 2 | 8 | 5.4 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CO)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL11528 | 10032 | 0 | None | - | 1 | Human | 7.9 | pKi | = | 7.9 | Binding | ChEMBL | 562 | 9 | 2 | 8 | 5.4 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CO)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
10809354 | 121109 | 1 | None | - | 1 | Rat | 6.9 | pKi | = | 6.9 | Binding | ChEMBL | 373 | 5 | 1 | 6 | 3.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2[N+](=O)[O-])c1C | 10.1021/jm970872k | ||
CHEMBL357580 | 121109 | 1 | None | - | 1 | Rat | 6.9 | pKi | = | 6.9 | Binding | ChEMBL | 373 | 5 | 1 | 6 | 3.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2[N+](=O)[O-])c1C | 10.1021/jm970872k | ||
19934544 | 206177 | 0 | None | -2 | 2 | Human | 4.9 | pKi | = | 4.9 | Binding | ChEMBL | 482 | 7 | 3 | 4 | 4.9 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)Cc3c[nH]c4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL86489 | 206177 | 0 | None | -2 | 2 | Human | 4.9 | pKi | = | 4.9 | Binding | ChEMBL | 482 | 7 | 3 | 4 | 4.9 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)Cc3c[nH]c4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
44267862 | 15330 | 0 | None | - | 1 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 571 | 9 | 1 | 8 | 5.9 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CC#N)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12144 | 15330 | 0 | None | - | 1 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 571 | 9 | 1 | 8 | 5.9 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(CC#N)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
10453858 | 160078 | 0 | None | 31 | 2 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 404 | 4 | 2 | 5 | 4.1 | COc1ccc([C@@H]2c3cc(O)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
CHEMBL41087 | 160078 | 0 | None | 31 | 2 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 404 | 4 | 2 | 5 | 4.1 | COc1ccc([C@@H]2c3cc(O)ccc3[C@H](c3ccc4c(c3)OCO4)[C@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
10837085 | 102282 | 0 | None | 39 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 446 | 9 | 1 | 7 | 3.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2F)c2ccccc2F)n1 | 10.1021/jm960274q | ||
CHEMBL303501 | 102282 | 0 | None | 39 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 446 | 9 | 1 | 7 | 3.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2F)c2ccccc2F)n1 | 10.1021/jm960274q | ||
10670204 | 41504 | 0 | None | 17 | 2 | Rat | 5.8 | pKi | = | 5.8 | Binding | ChEMBL | 428 | 7 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2C(=O)O)c1C | 10.1021/jm970872k | ||
CHEMBL149111 | 41504 | 0 | None | 17 | 2 | Rat | 5.8 | pKi | = | 5.8 | Binding | ChEMBL | 428 | 7 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2C(=O)O)c1C | 10.1021/jm970872k | ||
10603135 | 109717 | 0 | None | 1 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 570 | 14 | 1 | 7 | 6.0 | CCc1ccc(C(OCCc2ccc(OC)cc2)(c2ccc(CC)cc2)C(Oc2nc(C)cc(OC)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL322996 | 109717 | 0 | None | 1 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 570 | 14 | 1 | 7 | 6.0 | CCc1ccc(C(OCCc2ccc(OC)cc2)(c2ccc(CC)cc2)C(Oc2nc(C)cc(OC)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
10521320 | 119739 | 0 | None | - | 1 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 343 | 4 | 2 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2N)c1C | 10.1021/jm970872k | ||
CHEMBL347958 | 119739 | 0 | None | - | 1 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 343 | 4 | 2 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2N)c1C | 10.1021/jm970872k | ||
10549727 | 164863 | 0 | None | 125 | 2 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 414 | 7 | 1 | 5 | 5.0 | COc1cccc(S(=O)(=O)Nc2onc(C)c2C)c1-c1ccc(CC(C)C)cc1 | 10.1021/jm970872k | ||
CHEMBL422128 | 164863 | 0 | None | 125 | 2 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 414 | 7 | 1 | 5 | 5.0 | COc1cccc(S(=O)(=O)Nc2onc(C)c2C)c1-c1ccc(CC(C)C)cc1 | 10.1021/jm970872k | ||
44267893 | 98389 | 0 | None | - | 1 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 535 | 10 | 2 | 7 | 4.9 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL275523 | 98389 | 0 | None | - | 1 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 535 | 10 | 2 | 7 | 4.9 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
10740953 | 5284 | 0 | None | 758 | 2 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 423 | 5 | 1 | 6 | 5.0 | Cc1nc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)oc1C | 10.1021/jm000105c | ||
CHEMBL106749 | 5284 | 0 | None | 758 | 2 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 423 | 5 | 1 | 6 | 5.0 | Cc1nc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)oc1C | 10.1021/jm000105c | ||
44274885 | 94057 | 0 | None | 29 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 454 | 10 | 1 | 7 | 4.5 | COc1cc(OC)nc(CC(C(=O)O)C(C)(Oc2ccc(SC)cc2)c2ccccc2)n1 | 10.1021/jm030480f | ||
CHEMBL24906 | 94057 | 0 | None | 29 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 454 | 10 | 1 | 7 | 4.5 | COc1cc(OC)nc(CC(C(=O)O)C(C)(Oc2ccc(SC)cc2)c2ccccc2)n1 | 10.1021/jm030480f | ||
44307287 | 203735 | 0 | None | 29 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 470 | 10 | 0 | 9 | 4.1 | COC(=O)C(Oc1nc(OC)cc(OC)n1)C(C)(Oc1ccc(SC)cc1)c1ccccc1 | 10.1021/jm960274q | ||
CHEMBL67957 | 203735 | 0 | None | 29 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 470 | 10 | 0 | 9 | 4.1 | COC(=O)C(Oc1nc(OC)cc(OC)n1)C(C)(Oc1ccc(SC)cc1)c1ccccc1 | 10.1021/jm960274q | ||
176 | 397 | 66 | None | -7 | 31 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
2157 | 397 | 66 | None | -7 | 31 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
2566 | 397 | 66 | None | -7 | 31 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
CHEMBL633 | 397 | 66 | None | -7 | 31 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
DB01118 | 397 | 66 | None | -7 | 31 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | nan | ||
10620185 | 119625 | 0 | None | 89 | 2 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 386 | 6 | 1 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(OC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL346853 | 119625 | 0 | None | 89 | 2 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 386 | 6 | 1 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(OC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10741144 | 119743 | 0 | None | 407 | 2 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 427 | 8 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NC=O)c1C | 10.1021/jm970872k | ||
CHEMBL347982 | 119743 | 0 | None | 407 | 2 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 427 | 8 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NC=O)c1C | 10.1021/jm970872k | ||
17979733 | 97214 | 0 | None | - | 1 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 576 | 10 | 1 | 8 | 6.0 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(COC)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL268706 | 97214 | 0 | None | - | 1 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 576 | 10 | 1 | 8 | 6.0 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(COC)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
44303033 | 203195 | 0 | None | - | 1 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 472 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2C(c3ccc(Cl)c(Cl)c3)C(=O)O[C@@]2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm990504b | ||
CHEMBL64424 | 203195 | 0 | None | - | 1 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 472 | 6 | 1 | 5 | 5.4 | COc1ccc(CC2C(c3ccc(Cl)c(Cl)c3)C(=O)O[C@@]2(O)c2ccc(OC)cc2)cc1 | 10.1021/jm990504b | ||
9934204 | 106918 | 0 | None | -1 | 2 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 465 | 7 | 2 | 4 | 6.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NCc3cccc4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL314915 | 106918 | 0 | None | -1 | 2 | Human | 4.8 | pKi | = | 4.8 | Binding | ChEMBL | 465 | 7 | 2 | 4 | 6.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NCc3cccc4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
10836754 | 203567 | 0 | None | 14 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 438 | 11 | 1 | 7 | 3.7 | CCOc1cc(OCC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL66893 | 203567 | 0 | None | 14 | 2 | Human | 6.8 | pKi | = | 6.8 | Binding | ChEMBL | 438 | 11 | 1 | 7 | 3.7 | CCOc1cc(OCC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
10691437 | 5050 | 0 | None | -1 | 4 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL105490 | 5050 | 0 | None | -1 | 4 | Rat | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
443289 | 708 | 47 | None | 2 | 3 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00019-P | ||||
997 | 708 | 47 | None | 2 | 3 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00019-P | ||||
CHEMBL314691 | 708 | 47 | None | 2 | 3 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00019-P | ||||
DB12054 | 708 | 47 | None | 2 | 3 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(95)00019-P | ||||
10691437 | 5050 | 0 | None | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL105490 | 5050 | 0 | None | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL1201469 | 14475 | 0 | None | -1 | 4 | Human | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | None | None | None | None | nan | ||||
22103797 | 41348 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 408 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nccn3C)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL149010 | 41348 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 408 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nccn3C)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
5122650 | 102904 | 5 | None | 100 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 364 | 7 | 1 | 5 | 3.2 | COC(c1ccccc1)(c1ccccc1)C(Oc1nccc(C)n1)C(=O)O | 10.1021/jm960274q | ||
CHEMBL306218 | 102904 | 5 | None | 100 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 364 | 7 | 1 | 5 | 3.2 | COC(c1ccccc1)(c1ccccc1)C(Oc1nccc(C)n1)C(=O)O | 10.1021/jm960274q | ||
11797288 | 203593 | 0 | None | 89 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 438 | 11 | 1 | 7 | 3.7 | CCCOC(c1ccccc1)(c1ccccc1)C(Oc1nc(OC)cc(OC)n1)C(=O)O | 10.1021/jm960274q | ||
CHEMBL67084 | 203593 | 0 | None | 89 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 438 | 11 | 1 | 7 | 3.7 | CCCOC(c1ccccc1)(c1ccccc1)C(Oc1nc(OC)cc(OC)n1)C(=O)O | 10.1021/jm960274q | ||
10669224 | 108439 | 0 | None | 1778 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 409 | 6 | 1 | 6 | 4.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(Cc3ncco3)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL319924 | 108439 | 0 | None | 1778 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 409 | 6 | 1 | 6 | 4.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(Cc3ncco3)cc2)c1C | 10.1021/jm000105c | ||
10673091 | 163301 | 0 | None | 4 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 502 | 10 | 1 | 5 | 5.8 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(Cl)cc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
CHEMBL418992 | 163301 | 0 | None | 4 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 502 | 10 | 1 | 5 | 5.8 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(Cl)cc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
10836583 | 39663 | 0 | None | 43 | 2 | Rat | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 434 | 7 | 1 | 5 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(OCc3ccccc3)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL147521 | 39663 | 0 | None | 43 | 2 | Rat | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 434 | 7 | 1 | 5 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(OCc3ccccc3)cc2)c1C | 10.1021/jm970872k | ||
10643748 | 121411 | 0 | None | 29 | 2 | Rat | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccc(CC(C)C)c2)c1C | 10.1021/jm970872k | ||
CHEMBL358226 | 121411 | 0 | None | 29 | 2 | Rat | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 384 | 6 | 1 | 4 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccc(CC(C)C)c2)c1C | 10.1021/jm970872k | ||
10813050 | 44023 | 0 | None | 602 | 2 | Rat | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 441 | 9 | 2 | 5 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2CNC=O)c1C | 10.1021/jm970872k | ||
CHEMBL151440 | 44023 | 0 | None | 602 | 2 | Rat | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 441 | 9 | 2 | 5 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2CNC=O)c1C | 10.1021/jm970872k | ||
9895957 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL11706 | 10641 | 18 | None | 3 | 3 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 659 | 11 | 1 | 7 | 6.8 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CN2CCC(C)(C)C2=O)c1 | 10.1016/s0960-894x(03)00018-0 | ||
10835335 | 4805 | 0 | None | 50118 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1coc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)n1 | 10.1021/jm000105c | ||
CHEMBL104223 | 4805 | 0 | None | 50118 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1coc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)n1 | 10.1021/jm000105c | ||
11799973 | 4400 | 0 | None | 31 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 514 | 11 | 1 | 7 | 5.1 | COc1ccc(COC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
CHEMBL101587 | 4400 | 0 | None | 31 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 514 | 11 | 1 | 7 | 5.1 | COc1ccc(COC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
9893800 | 107203 | 12 | None | 2 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 528 | 12 | 1 | 7 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)[C@H](Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/acs.jmedchem.5b01781 | ||
CHEMBL316735 | 107203 | 12 | None | 2 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 528 | 12 | 1 | 7 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)[C@H](Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/acs.jmedchem.5b01781 | ||
9893800 | 107203 | 12 | None | 2 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 528 | 12 | 1 | 7 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)[C@H](Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
CHEMBL316735 | 107203 | 12 | None | 2 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 528 | 12 | 1 | 7 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)[C@H](Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
44311727 | 204446 | 0 | None | -9 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 669 | 13 | 3 | 7 | 4.7 | CCCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL72348 | 204446 | 0 | None | -9 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 669 | 13 | 3 | 7 | 4.7 | CCCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
76312118 | 85318 | 0 | None | 691 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 522 | 7 | 2 | 8 | 3.4 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(CO)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261361 | 85318 | 0 | None | 691 | 2 | Human | 8.7 | pKi | = | 8.7 | Binding | ChEMBL | 522 | 7 | 2 | 8 | 3.4 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(CO)ccc12 | 10.1007/s00044-004-0021-y | ||
18660521 | 41667 | 0 | None | 2754 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 405 | 5 | 1 | 5 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL149232 | 41667 | 0 | None | 2754 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 405 | 5 | 1 | 5 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
44311915 | 104764 | 0 | None | -6 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 703 | 12 | 3 | 7 | 5.4 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NS(=O)(=O)c2ccccc2)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL310920 | 104764 | 0 | None | -6 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 703 | 12 | 3 | 7 | 5.4 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NS(=O)(=O)c2ccccc2)c1 | 10.1016/s0960-894x(98)00387-4 | ||
10768897 | 107630 | 1 | None | 6 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 544 | 13 | 1 | 8 | 4.8 | COc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(OC)c(OC)c2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
CHEMBL319031 | 107630 | 1 | None | 6 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 544 | 13 | 1 | 8 | 4.8 | COc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(OC)c(OC)c2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
51003307 | 58034 | 0 | None | 3548 | 2 | Mouse | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 751 | 21 | 1 | 15 | 4.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCc3cn(CCOCCOCCOCCF)nn3)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672881 | 58034 | 0 | None | 3548 | 2 | Mouse | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 751 | 21 | 1 | 15 | 4.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCc3cn(CCOCCOCCOCCF)nn3)c2)cc1 | 10.1021/jm101110w | ||
45257115 | 201309 | 0 | None | 39 | 2 | Mouse | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.2 | COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCF)cc2)cc(OC)c1OC | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL604286 | 201309 | 0 | None | 39 | 2 | Mouse | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 538 | 10 | 1 | 9 | 4.2 | COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCF)cc2)cc(OC)c1OC | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL1790180 | 208860 | 0 | None | -72 | 3 | Rat | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@@H](N)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CCc3ccc(O)cc3)NC(=O)[C@H]([C@H](C)O)NC(=O)[C@@H](Cc3ccccc3)NC2=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1021/jm00087a001 | ||||
11049336 | 99912 | 0 | None | 3630 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 497 | 7 | 1 | 6 | 6.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2/C=C/c2ccccc2)c1C | 10.1021/jm020289q | ||
CHEMBL286279 | 99912 | 0 | None | 3630 | 2 | Human | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 497 | 7 | 1 | 6 | 6.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2/C=C/c2ccccc2)c1C | 10.1021/jm020289q | ||
10670965 | 42296 | 0 | None | 851 | 2 | Rat | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 444 | 9 | 2 | 6 | 4.3 | Cc1noc(NS(=O)(=O)c2cccc(OCCO)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL149819 | 42296 | 0 | None | 851 | 2 | Rat | 8.6 | pKi | = | 8.6 | Binding | ChEMBL | 444 | 9 | 2 | 6 | 4.3 | Cc1noc(NS(=O)(=O)c2cccc(OCCO)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
44311804 | 102991 | 0 | None | -12 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 683 | 14 | 3 | 7 | 5.1 | CCCCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL306950 | 102991 | 0 | None | -12 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 683 | 14 | 3 | 7 | 5.1 | CCCCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
10501931 | 43843 | 0 | None | 64 | 2 | Rat | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 414 | 7 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2CO)c1C | 10.1021/jm970872k | ||
CHEMBL151160 | 43843 | 0 | None | 64 | 2 | Rat | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 414 | 7 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2CO)c1C | 10.1021/jm970872k | ||
10668819 | 121088 | 0 | None | 602 | 2 | Rat | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 402 | 6 | 1 | 4 | 5.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2F)c1C | 10.1021/jm970872k | ||
CHEMBL357395 | 121088 | 0 | None | 602 | 2 | Rat | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 402 | 6 | 1 | 4 | 5.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2F)c1C | 10.1021/jm970872k | ||
22574798 | 15488 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 579 | 13 | 2 | 8 | 5.2 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COCC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12175 | 15488 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 579 | 13 | 2 | 8 | 5.2 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COCC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
17979749 | 17815 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 550 | 8 | 1 | 7 | 6.0 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(F)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12590 | 17815 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 550 | 8 | 1 | 7 | 6.0 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(F)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
44267860 | 167101 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 590 | 11 | 1 | 8 | 6.4 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(COCC)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL429037 | 167101 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 590 | 11 | 1 | 8 | 6.4 | CCCc1nc2c(n1Cc1ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)c(COCC)c1)C(=O)CCCC2 | 10.1016/s0960-894x(03)00018-0 | ||
10599129 | 102209 | 0 | None | 5 | 2 | Human | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 438 | 9 | 1 | 7 | 3.5 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccc(C)cc2)c2ccc(C)cc2)n1 | 10.1021/jm960274q | ||
CHEMBL303034 | 102209 | 0 | None | 5 | 2 | Human | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 438 | 9 | 1 | 7 | 3.5 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccc(C)cc2)c2ccc(C)cc2)n1 | 10.1021/jm960274q | ||
44314882 | 157152 | 0 | None | -380 | 2 | Pig | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 1562 | 47 | 19 | 18 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
77282212 | 157152 | 0 | None | -380 | 2 | Pig | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 1562 | 47 | 19 | 18 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL407559 | 157152 | 0 | None | -380 | 2 | Pig | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 1562 | 47 | 19 | 18 | 0.4 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
10813228 | 107633 | 0 | None | 46 | 2 | Human | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 445 | 5 | 1 | 6 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nc4ccccc4o3)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL319036 | 107633 | 0 | None | 46 | 2 | Human | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 445 | 5 | 1 | 6 | 5.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nc4ccccc4o3)cc2)c1C | 10.1021/jm000105c | ||
10545378 | 39186 | 0 | None | - | 1 | Rat | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 344 | 5 | 1 | 5 | 3.9 | Cc1noc(NS(=O)(=O)c2ccccc2Oc2ccccc2)c1C | 10.1021/jm970872k | ||
CHEMBL147007 | 39186 | 0 | None | - | 1 | Rat | 5.7 | pKi | = | 5.7 | Binding | ChEMBL | 344 | 5 | 1 | 5 | 3.9 | Cc1noc(NS(=O)(=O)c2ccccc2Oc2ccccc2)c1C | 10.1021/jm970872k | ||
20747573 | 17118 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 593 | 13 | 2 | 8 | 5.4 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COCC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12557 | 17118 | 0 | None | - | 1 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 593 | 13 | 2 | 8 | 5.4 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COCC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
10719157 | 102268 | 0 | None | 58 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 470 | 11 | 1 | 9 | 2.9 | COc1cccc(C(OC)(c2cccc(OC)c2)C(Oc2nc(OC)cc(OC)n2)C(=O)O)c1 | 10.1021/jm960274q | ||
CHEMBL303390 | 102268 | 0 | None | 58 | 2 | Human | 7.7 | pKi | = | 7.7 | Binding | ChEMBL | 470 | 11 | 1 | 9 | 2.9 | COc1cccc(C(OC)(c2cccc(OC)c2)C(Oc2nc(OC)cc(OC)n2)C(=O)O)c1 | 10.1021/jm960274q | ||
19085508 | 39556 | 0 | None | 218 | 2 | Human | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 466 | 7 | 1 | 8 | 4.2 | COc1cc(OC)nc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)n1 | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL147365 | 39556 | 0 | None | 218 | 2 | Human | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | 466 | 7 | 1 | 8 | 4.2 | COc1cc(OC)nc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)n1 | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL315927 | 211171 | 0 | None | - | 1 | Human | 6.7 | pKi | = | 6.7 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2cccc3ccccc23)NC1=O | 10.1016/0960-894X(95)00019-P | ||||
10505434 | 4634 | 0 | None | 7 | 2 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 496 | 11 | 1 | 5 | 5.8 | Cc1ccc(CCCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL103190 | 4634 | 0 | None | 7 | 2 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 496 | 11 | 1 | 5 | 5.8 | Cc1ccc(CCCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
11801906 | 98500 | 0 | None | -1 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 612 | 13 | 1 | 8 | 6.2 | COc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(OC)c(OC)c2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)n1 | 10.1021/jm9910425 | ||
CHEMBL276288 | 98500 | 0 | None | -1 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 612 | 13 | 1 | 8 | 6.2 | COc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(OC)c(OC)c2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)n1 | 10.1021/jm9910425 | ||
44311698 | 204087 | 0 | None | -524 | 2 | Human | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | 574 | 10 | 3 | 4 | 5.3 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccccn3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL70310 | 204087 | 0 | None | -524 | 2 | Human | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | 574 | 10 | 3 | 4 | 5.3 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccccn3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
10670662 | 203425 | 0 | None | 53 | 2 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 438 | 9 | 1 | 7 | 3.5 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2cccc(C)c2)c2cccc(C)c2)n1 | 10.1021/jm960274q | ||
CHEMBL65833 | 203425 | 0 | None | 53 | 2 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 438 | 9 | 1 | 7 | 3.5 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2cccc(C)c2)c2cccc(C)c2)n1 | 10.1021/jm960274q | ||
CHEMBL87296 | 215872 | 0 | None | - | 1 | Human | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | None | None | None | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc2ccccc2)NC1=O | 10.1016/0960-894X(95)00019-P | ||||
10645256 | 41010 | 0 | None | - | 1 | Rat | 4.6 | pKi | = | 4.6 | Binding | ChEMBL | 410 | 6 | 1 | 4 | 5.2 | CC(C)Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc3c2CCCC3)cc1 | 10.1021/jm970872k | ||
CHEMBL148757 | 41010 | 0 | None | - | 1 | Rat | 4.6 | pKi | = | 4.6 | Binding | ChEMBL | 410 | 6 | 1 | 4 | 5.2 | CC(C)Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc3c2CCCC3)cc1 | 10.1021/jm970872k | ||
10552683 | 203088 | 0 | None | 5 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 478 | 9 | 1 | 7 | 4.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)n1 | 10.1021/jm960274q | ||
CHEMBL64009 | 203088 | 0 | None | 5 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 478 | 9 | 1 | 7 | 4.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)n1 | 10.1021/jm960274q | ||
18660522 | 119626 | 0 | None | - | 1 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccncn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL346862 | 119626 | 0 | None | - | 1 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccncn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
46228116 | 201199 | 0 | None | 2 | 2 | Mouse | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 598 | 10 | 1 | 9 | 4.6 | COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCBr)cc2)cc(OC)c1OC | 10.1016/j.bmc.2009.08.058 | ||
CHEMBL603635 | 201199 | 0 | None | 2 | 2 | Mouse | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 598 | 10 | 1 | 9 | 4.6 | COc1cc(CC2=C(c3ccc4c(c3)OCO4)C(=O)OC2(O)c2ccc(OCCBr)cc2)cc(OC)c1OC | 10.1016/j.bmc.2009.08.058 | ||
3921421 | 107272 | 8 | None | 9 | 2 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 468 | 10 | 1 | 5 | 5.1 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccccc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
CHEMBL317233 | 107272 | 8 | None | 9 | 2 | Human | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 468 | 10 | 1 | 5 | 5.1 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccccc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
44314832 | 161249 | 0 | None | -251 | 2 | Pig | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 1496 | 45 | 18 | 17 | 0.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL412065 | 161249 | 0 | None | -251 | 2 | Pig | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 1496 | 45 | 18 | 17 | 0.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
44274960 | 99535 | 0 | None | 12 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 450 | 10 | 1 | 6 | 4.9 | COc1cc(OC)nc(CC(C(=O)O)C(C)(Oc2ccc(C(C)C)cc2)c2ccccc2)n1 | 10.1021/jm030480f | ||
CHEMBL283637 | 99535 | 0 | None | 12 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 450 | 10 | 1 | 6 | 4.9 | COc1cc(OC)nc(CC(C(=O)O)C(C)(Oc2ccc(C(C)C)cc2)c2ccccc2)n1 | 10.1021/jm030480f | ||
44311699 | 204146 | 0 | None | -331 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 563 | 10 | 3 | 4 | 5.5 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccco3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL70686 | 204146 | 0 | None | -331 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 563 | 10 | 3 | 4 | 5.5 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccco3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
44307412 | 203635 | 0 | None | 12 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 466 | 10 | 0 | 8 | 4.5 | COC(=O)C(Oc1nc(OC)cc(OC)n1)C(C)(Oc1ccc(C(C)C)cc1)c1ccccc1 | 10.1021/jm960274q | ||
CHEMBL67325 | 203635 | 0 | None | 12 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 466 | 10 | 0 | 8 | 4.5 | COC(=O)C(Oc1nc(OC)cc(OC)n1)C(C)(Oc1ccc(C(C)C)cc1)c1ccccc1 | 10.1021/jm960274q | ||
10721484 | 107334 | 0 | None | -1 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 554 | 13 | 1 | 6 | 6.3 | CCc1ccc(C(OCCc2ccc(OC)cc2)(c2ccc(CC)cc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL317716 | 107334 | 0 | None | -1 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 554 | 13 | 1 | 6 | 6.3 | CCc1ccc(C(OCCc2ccc(OC)cc2)(c2ccc(CC)cc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
10621777 | 43044 | 0 | None | 12 | 2 | Rat | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | 415 | 7 | 1 | 6 | 4.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1[N+](=O)[O-] | 10.1021/jm970872k | ||
CHEMBL150481 | 43044 | 0 | None | 12 | 2 | Rat | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | 415 | 7 | 1 | 6 | 4.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1[N+](=O)[O-] | 10.1021/jm970872k | ||
9797546 | 40862 | 0 | None | - | 1 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 329 | 4 | 1 | 5 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccnc2)c1C | 10.1021/jm970872k | ||
CHEMBL148637 | 40862 | 0 | None | - | 1 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 329 | 4 | 1 | 5 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccnc2)c1C | 10.1021/jm970872k | ||
22103537 | 42042 | 0 | None | 144 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccno3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL149592 | 42042 | 0 | None | 144 | 2 | Human | 6.6 | pKi | = | 6.6 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccno3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
44312023 | 204441 | 0 | None | -22 | 2 | Human | 4.6 | pKi | = | 4.6 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@H](NC(=O)[C@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
CHEMBL72295 | 204441 | 0 | None | -22 | 2 | Human | 4.6 | pKi | = | 4.6 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@H](NC(=O)[C@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
10595347 | 42451 | 0 | None | 537 | 2 | Rat | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 370 | 6 | 1 | 4 | 4.7 | CCCc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
CHEMBL149953 | 42451 | 0 | None | 537 | 2 | Rat | 7.6 | pKi | = | 7.6 | Binding | ChEMBL | 370 | 6 | 1 | 4 | 4.7 | CCCc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
10741830 | 42813 | 0 | None | 3 | 2 | Rat | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | 441 | 7 | 2 | 5 | 4.9 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)c(-c2ccc(CC(C)C)cc2)c1 | 10.1021/jm970872k | ||
CHEMBL150269 | 42813 | 0 | None | 3 | 2 | Rat | 5.6 | pKi | = | 5.6 | Binding | ChEMBL | 441 | 7 | 2 | 5 | 4.9 | CC(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)c(-c2ccc(CC(C)C)cc2)c1 | 10.1021/jm970872k | ||
15297287 | 164388 | 0 | None | -3 | 2 | Human | 4.6 | pKi | = | 4.6 | Binding | ChEMBL | 424 | 5 | 2 | 4 | 5.2 | O=C(O)CN1C(=O)c2ccccc2Nc2ccc(OCc3cccc4ccccc34)cc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL421349 | 164388 | 0 | None | -3 | 2 | Human | 4.6 | pKi | = | 4.6 | Binding | ChEMBL | 424 | 5 | 2 | 4 | 5.2 | O=C(O)CN1C(=O)c2ccccc2Nc2ccc(OCc3cccc4ccccc34)cc21 | 10.1016/0960-894X(95)00019-P | ||
10599293 | 38995 | 0 | None | 128 | 2 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 441 | 9 | 2 | 5 | 5.8 | CCCNc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL146845 | 38995 | 0 | None | 128 | 2 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 441 | 9 | 2 | 5 | 5.8 | CCCNc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
10508342 | 4698 | 0 | None | -1 | 2 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 638 | 13 | 1 | 8 | 6.3 | COc1ccc(CCOC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)C(Oc2nc3c(c(OC)n2)CCC3)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
CHEMBL103605 | 4698 | 0 | None | -1 | 2 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 638 | 13 | 1 | 8 | 6.3 | COc1ccc(CCOC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)C(Oc2nc3c(c(OC)n2)CCC3)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
44311849 | 103046 | 0 | None | -5 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 694 | 14 | 2 | 7 | 5.8 | CCCCS(=O)(=O)NC(=O)C(Cc1ccc2ccccc2c1)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL307384 | 103046 | 0 | None | -5 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 694 | 14 | 2 | 7 | 5.8 | CCCCS(=O)(=O)NC(=O)C(Cc1ccc2ccccc2c1)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
11800649 | 4577 | 0 | None | 7 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 542 | 13 | 1 | 7 | 5.5 | CCOc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
CHEMBL102797 | 4577 | 0 | None | 7 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 542 | 13 | 1 | 7 | 5.5 | CCOc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
19085510 | 119529 | 0 | None | 6025 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 405 | 5 | 1 | 5 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cccnc3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL345951 | 119529 | 0 | None | 6025 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 405 | 5 | 1 | 5 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cccnc3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
10528863 | 4588 | 0 | None | 4 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 484 | 10 | 2 | 6 | 4.8 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(O)cc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
CHEMBL102868 | 4588 | 0 | None | 4 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 484 | 10 | 2 | 6 | 4.8 | Cc1cc(C)nc(OC(C(=O)O)C(OCCc2ccc(O)cc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm9910425 | ||
6433100 | 4517 | 7 | None | 2 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 528 | 12 | 1 | 7 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
CHEMBL102405 | 4517 | 7 | None | 2 | 2 | Human | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 528 | 12 | 1 | 7 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1OC | 10.1021/jm9910425 | ||
51003353 | 58036 | 0 | None | 10 | 2 | Mouse | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 886 | 26 | 1 | 17 | 5.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CCCCOc4cccnc4F)nn3)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672883 | 58036 | 0 | None | 10 | 2 | Mouse | 8.5 | pKi | = | 8.5 | Binding | ChEMBL | 886 | 26 | 1 | 17 | 5.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CCCCOc4cccnc4F)nn3)c2)cc1 | 10.1021/jm101110w | ||
10548722 | 5448 | 0 | None | 20892 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cnco3)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL107574 | 5448 | 0 | None | 20892 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 395 | 5 | 1 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cnco3)cc2)c1C | 10.1021/jm000105c | ||
44311726 | 103058 | 0 | None | -10 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 667 | 12 | 3 | 7 | 4.8 | C/C=C/S(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL307471 | 103058 | 0 | None | -10 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 667 | 12 | 3 | 7 | 4.8 | C/C=C/S(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
51003354 | 58037 | 0 | None | 74 | 2 | Mouse | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 920 | 24 | 1 | 17 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CN(C)S(=O)(=O)c4ccc(F)cc4)nn3)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672884 | 58037 | 0 | None | 74 | 2 | Mouse | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 920 | 24 | 1 | 17 | 4.5 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CN(C)S(=O)(=O)c4ccc(F)cc4)nn3)c2)cc1 | 10.1021/jm101110w | ||
18660523 | 41796 | 0 | None | - | 1 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cncnc3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL149340 | 41796 | 0 | None | - | 1 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cncnc3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
10525034 | 119648 | 0 | None | 89 | 2 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 400 | 7 | 1 | 5 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(OCC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL347125 | 119648 | 0 | None | 89 | 2 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 400 | 7 | 1 | 5 | 4.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(OCC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10505357 | 109376 | 0 | None | 10 | 2 | Human | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 494 | 10 | 1 | 5 | 5.9 | Cc1ccc(/C=C/COC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL321984 | 109376 | 0 | None | 10 | 2 | Human | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 494 | 10 | 1 | 5 | 5.9 | Cc1ccc(/C=C/COC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
10624645 | 4301 | 0 | None | 1 | 2 | Human | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 482 | 10 | 1 | 5 | 5.4 | Cc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL100954 | 4301 | 0 | None | 1 | 2 | Human | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 482 | 10 | 1 | 5 | 5.4 | Cc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
10713411 | 164921 | 0 | None | - | 1 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 358 | 5 | 1 | 5 | 3.8 | COc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
CHEMBL422496 | 164921 | 0 | None | - | 1 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 358 | 5 | 1 | 5 | 3.8 | COc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
10671031 | 102667 | 0 | None | 29 | 2 | Human | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 446 | 9 | 1 | 7 | 3.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccc(F)cc2)c2ccc(F)cc2)n1 | 10.1021/jm960274q | ||
CHEMBL304721 | 102667 | 0 | None | 29 | 2 | Human | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 446 | 9 | 1 | 7 | 3.2 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccc(F)cc2)c2ccc(F)cc2)n1 | 10.1021/jm960274q | ||
10622410 | 43999 | 0 | None | - | 1 | Rat | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 427 | 7 | 1 | 5 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2N(C)C)c1C | 10.1021/jm970872k | ||
CHEMBL151395 | 43999 | 0 | None | - | 1 | Rat | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 427 | 7 | 1 | 5 | 5.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2N(C)C)c1C | 10.1021/jm970872k | ||
19934534 | 106668 | 0 | None | -5 | 2 | Human | 4.5 | pKi | = | 4.5 | Binding | ChEMBL | 468 | 6 | 3 | 4 | 5.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)c3cc4ccccc4[nH]3)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL314364 | 106668 | 0 | None | -5 | 2 | Human | 4.5 | pKi | = | 4.5 | Binding | ChEMBL | 468 | 6 | 3 | 4 | 5.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)c3cc4ccccc4[nH]3)ccc21 | 10.1016/0960-894X(95)00019-P | ||
10741834 | 44013 | 0 | None | 85 | 2 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 441 | 8 | 2 | 5 | 5.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NC(C)C)c1C | 10.1021/jm970872k | ||
CHEMBL151422 | 44013 | 0 | None | 85 | 2 | Rat | 7.5 | pKi | = | 7.5 | Binding | ChEMBL | 441 | 8 | 2 | 5 | 5.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NC(C)C)c1C | 10.1021/jm970872k | ||
9864017 | 41298 | 0 | None | 194 | 2 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 367 | 4 | 2 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cc3ccccc3[nH]2)c1C | 10.1021/jm970872k | ||
CHEMBL148967 | 41298 | 0 | None | 194 | 2 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 367 | 4 | 2 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cc3ccccc3[nH]2)c1C | 10.1021/jm970872k | ||
10743346 | 102584 | 0 | None | 4 | 2 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 480 | 11 | 1 | 7 | 4.7 | COc1cc(OC)nc(OC(C(=O)O)C(OCCC(C)(C)C)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL304173 | 102584 | 0 | None | 4 | 2 | Human | 6.5 | pKi | = | 6.5 | Binding | ChEMBL | 480 | 11 | 1 | 7 | 4.7 | COc1cc(OC)nc(OC(C(=O)O)C(OCCC(C)(C)C)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
10709109 | 44100 | 0 | None | - | 1 | Rat | 5.5 | pKi | = | 5.5 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2ccccc2[N+](=O)[O-])c1C | 10.1021/jm970872k | ||
CHEMBL151545 | 44100 | 0 | None | - | 1 | Rat | 5.5 | pKi | = | 5.5 | Binding | ChEMBL | 297 | 4 | 1 | 6 | 2.0 | Cc1noc(NS(=O)(=O)c2ccccc2[N+](=O)[O-])c1C | 10.1021/jm970872k | ||
10691438 | 44462 | 0 | None | 51 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 384 | 7 | 1 | 4 | 5.1 | CCCCc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
CHEMBL151926 | 44462 | 0 | None | 51 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 384 | 7 | 1 | 4 | 5.1 | CCCCc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
44213540 | 39451 | 0 | None | 831 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 421 | 5 | 1 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cccc[n+]3[O-])cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL147238 | 39451 | 0 | None | 831 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 421 | 5 | 1 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cccc[n+]3[O-])cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
10693130 | 121943 | 0 | None | 16 | 2 | Rat | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 414 | 7 | 1 | 5 | 5.0 | COc1ccc(S(=O)(=O)Nc2onc(C)c2C)c(-c2ccc(CC(C)C)cc2)c1 | 10.1021/jm970872k | ||
CHEMBL359152 | 121943 | 0 | None | 16 | 2 | Rat | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 414 | 7 | 1 | 5 | 5.0 | COc1ccc(S(=O)(=O)Nc2onc(C)c2C)c(-c2ccc(CC(C)C)cc2)c1 | 10.1021/jm970872k | ||
44365561 | 42240 | 0 | None | 524 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 404 | 5 | 1 | 4 | 5.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccccc3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL149763 | 42240 | 0 | None | 524 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 404 | 5 | 1 | 4 | 5.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ccccc3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
44365878 | 42256 | 0 | None | - | 1 | Human | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 396 | 5 | 2 | 7 | 2.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nn[nH]n3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL149778 | 42256 | 0 | None | - | 1 | Human | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 396 | 5 | 2 | 7 | 2.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nn[nH]n3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
10501299 | 119828 | 0 | None | 147 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 402 | 6 | 1 | 5 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(SC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL348685 | 119828 | 0 | None | 147 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 402 | 6 | 1 | 5 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(SC(C)C)cc2)c1C | 10.1021/jm970872k | ||
11813485 | 18057 | 0 | None | -8 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 534 | 9 | 1 | 6 | 6.0 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm020138n | ||
CHEMBL126755 | 18057 | 0 | None | -8 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 534 | 9 | 1 | 6 | 6.0 | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm020138n | ||
10769887 | 107465 | 0 | None | 1 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 600 | 15 | 1 | 8 | 6.0 | CCc1ccc(C(OCCc2ccc(OC)c(OC)c2)(c2ccc(CC)cc2)C(Oc2nc(C)cc(OC)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL318535 | 107465 | 0 | None | 1 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 600 | 15 | 1 | 8 | 6.0 | CCc1ccc(C(OCCc2ccc(OC)c(OC)c2)(c2ccc(CC)cc2)C(Oc2nc(C)cc(OC)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
10526510 | 121042 | 0 | None | 12 | 2 | Rat | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 427 | 8 | 1 | 6 | 4.2 | COc1cc(OC)nc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)n1 | 10.1021/jm970872k | ||
CHEMBL356972 | 121042 | 0 | None | 12 | 2 | Rat | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 427 | 8 | 1 | 6 | 4.2 | COc1cc(OC)nc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)n1 | 10.1021/jm970872k | ||
22103385 | 121059 | 0 | None | 19054 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 396 | 5 | 1 | 7 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nnco3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL357077 | 121059 | 0 | None | 19054 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 396 | 5 | 1 | 7 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nnco3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
20747574 | 12075 | 0 | None | - | 1 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 565 | 12 | 2 | 8 | 4.8 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL11840 | 12075 | 0 | None | - | 1 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 565 | 12 | 2 | 8 | 4.8 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
9807200 | 85316 | 0 | None | 346 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 536 | 7 | 2 | 8 | 3.6 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(=O)O)ccc12 | 10.1007/s00044-004-0021-y | ||
CHEMBL2261359 | 85316 | 0 | None | 346 | 2 | Human | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 536 | 7 | 2 | 8 | 3.6 | COc1cc(C)ccc1S(=O)(=O)NC(=O)[C@@H](c1ccc2c(c1)OCO2)c1cn(C)c2cc(C(=O)O)ccc12 | 10.1007/s00044-004-0021-y | ||
51003352 | 58035 | 0 | None | 1230 | 2 | Mouse | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 1020 | 35 | 1 | 21 | 4.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCOCc3cn(CCOCCOCCOCCOc4cccnc4F)nn3)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672882 | 58035 | 0 | None | 1230 | 2 | Mouse | 8.4 | pKi | = | 8.4 | Binding | ChEMBL | 1020 | 35 | 1 | 21 | 4.7 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCOCc3cn(CCOCCOCCOCCOc4cccnc4F)nn3)c2)cc1 | 10.1021/jm101110w | ||
9908909 | 5277 | 11 | None | -1 | 3 | Rat | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 399 | 6 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2N)c1C | 10.1021/jm970872k | ||
CHEMBL106684 | 5277 | 11 | None | -1 | 3 | Rat | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 399 | 6 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2N)c1C | 10.1021/jm970872k | ||
10811477 | 4786 | 0 | None | 19952 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncoc3C)cc2)c1C | 10.1021/jm000105c | ||
CHEMBL104172 | 4786 | 0 | None | 19952 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncoc3C)cc2)c1C | 10.1021/jm000105c | ||
9908909 | 5277 | 11 | None | 1 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 399 | 6 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2N)c1C | 10.1021/jm000105c | ||
CHEMBL106684 | 5277 | 11 | None | 1 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 399 | 6 | 2 | 5 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2N)c1C | 10.1021/jm000105c | ||
443289 | 708 | 47 | None | -2 | 3 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1021/jm970872k | ||||
997 | 708 | 47 | None | -2 | 3 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1021/jm970872k | ||||
CHEMBL314691 | 708 | 47 | None | -2 | 3 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1021/jm970872k | ||||
DB12054 | 708 | 47 | None | -2 | 3 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | None | None | None | None | 10.1021/jm970872k | ||||
9950670 | 43526 | 0 | None | - | 1 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 358 | 5 | 2 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2CO)c1C | 10.1021/jm970872k | ||
CHEMBL150891 | 43526 | 0 | None | - | 1 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 358 | 5 | 2 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2CO)c1C | 10.1021/jm970872k | ||
18004820 | 16421 | 0 | None | - | 1 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 527 | 9 | 2 | 7 | 4.7 | CCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12333 | 16421 | 0 | None | - | 1 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 527 | 9 | 2 | 7 | 4.7 | CCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
10208527 | 98168 | 0 | None | - | 1 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 526 | 9 | 1 | 7 | 5.8 | CCCc1nc(Cl)c(C(C)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL274154 | 98168 | 0 | None | - | 1 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 526 | 9 | 1 | 7 | 5.8 | CCCc1nc(Cl)c(C(C)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
11795351 | 42819 | 0 | None | 109 | 2 | Rat | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 401 | 6 | 1 | 4 | 4.8 | CC(C)Cc1ccc(-c2ccccc2S(=O)(=O)Nc2ccc(Cl)nn2)cc1 | 10.1021/jm970872k | ||
CHEMBL150273 | 42819 | 0 | None | 109 | 2 | Rat | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 401 | 6 | 1 | 4 | 4.8 | CC(C)Cc1ccc(-c2ccccc2S(=O)(=O)Nc2ccc(Cl)nn2)cc1 | 10.1021/jm970872k | ||
44303148 | 203134 | 0 | None | - | 1 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 456 | 4 | 1 | 5 | 5.1 | O=C1O[C@@](O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)C1c1ccc2c(c1)OCO2 | 10.1021/jm990504b | ||
CHEMBL64200 | 203134 | 0 | None | - | 1 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 456 | 4 | 1 | 5 | 5.1 | O=C1O[C@@](O)(c2ccc(Cl)c(Cl)c2)C(Cc2ccccc2)C1c1ccc2c(c1)OCO2 | 10.1021/jm990504b | ||
19934549 | 105966 | 0 | None | -3 | 2 | Human | 4.4 | pKi | = | 4.4 | Binding | ChEMBL | 439 | 6 | 2 | 3 | 5.4 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(Cc3c[nH]c4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL313184 | 105966 | 0 | None | -3 | 2 | Human | 4.4 | pKi | = | 4.4 | Binding | ChEMBL | 439 | 6 | 2 | 3 | 5.4 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(Cc3c[nH]c4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
10280531 | 162907 | 0 | None | - | 1 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 5.1 | CCCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL417429 | 162907 | 0 | None | - | 1 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 541 | 10 | 2 | 7 | 5.1 | CCCCc1nc(Cl)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
10528341 | 14545 | 0 | None | 95 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 458 | 9 | 2 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2cccc(OCC(=O)O)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL1204523 | 14545 | 0 | None | 95 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 458 | 9 | 2 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2cccc(OCC(=O)O)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL149152 | 14545 | 0 | None | 95 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 458 | 9 | 2 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2cccc(OCC(=O)O)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
155543936 | 173211 | 0 | None | -218776 | 2 | Rat | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 2514 | 48 | 34 | 38 | -9.8 | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CC(N)=O)NC2=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00087a001 | ||
CHEMBL4524100 | 173211 | 0 | None | -218776 | 2 | Rat | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 2514 | 48 | 34 | 38 | -9.8 | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@H]2CSSC[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](CC(N)=O)NC2=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O | 10.1021/jm00087a001 | ||
10407051 | 100365 | 0 | None | 5 | 2 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 374 | 5 | 1 | 3 | 4.7 | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccc(OC)cc3)[C@@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
CHEMBL290026 | 100365 | 0 | None | 5 | 2 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | 374 | 5 | 1 | 3 | 4.7 | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccc(OC)cc3)[C@@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
10647471 | 42295 | 0 | None | 125 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 456 | 7 | 3 | 5 | 4.7 | CNC(=O)Nc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL149818 | 42295 | 0 | None | 125 | 2 | Rat | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 456 | 7 | 3 | 5 | 4.7 | CNC(=O)Nc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
10045790 | 141627 | 0 | None | 17 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 388 | 4 | 1 | 4 | 4.4 | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccc4c(c3)OCO4)[C@@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
CHEMBL38537 | 141627 | 0 | None | 17 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 388 | 4 | 1 | 4 | 4.4 | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccc4c(c3)OCO4)[C@@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
22103589 | 41146 | 0 | None | - | 1 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 394 | 5 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncc[nH]3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL148855 | 41146 | 0 | None | - | 1 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 394 | 5 | 2 | 5 | 4.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncc[nH]3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
3887 | 2059 | 45 | None | -436 | 4 | Pig | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(96)00421-0 | ||||
5311192 | 2059 | 45 | None | -436 | 4 | Pig | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(96)00421-0 | ||||
CHEMBL72410 | 2059 | 45 | None | -436 | 4 | Pig | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | None | None | None | None | 10.1016/0960-894X(96)00421-0 | ||||
3887 | 2059 | 45 | None | -436 | 4 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | None | None | None | None | 10.1016/s0960-894x(98)00387-4 | ||||
5311192 | 2059 | 45 | None | -436 | 4 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | None | None | None | None | 10.1016/s0960-894x(98)00387-4 | ||||
CHEMBL72410 | 2059 | 45 | None | -436 | 4 | Human | 6.4 | pKi | = | 6.4 | Binding | ChEMBL | None | None | None | None | 10.1016/s0960-894x(98)00387-4 | ||||
10499516 | 120952 | 0 | None | - | 1 | Rat | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 372 | 5 | 2 | 5 | 3.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(C(=O)O)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL356220 | 120952 | 0 | None | - | 1 | Rat | 5.4 | pKi | = | 5.4 | Binding | ChEMBL | 372 | 5 | 2 | 5 | 3.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(C(=O)O)cc2)c1C | 10.1021/jm970872k | ||
44311701 | 168132 | 1 | None | -213 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 564 | 10 | 3 | 5 | 4.9 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL433106 | 168132 | 1 | None | -213 | 2 | Human | 7.4 | pKi | = | 7.4 | Binding | ChEMBL | 564 | 10 | 3 | 5 | 4.9 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
10280562 | 15483 | 0 | None | - | 1 | Human | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 542 | 9 | 1 | 8 | 5.4 | CCCc1nc(Cl)c(C(=O)OC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12172 | 15483 | 0 | None | - | 1 | Human | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 542 | 9 | 1 | 8 | 5.4 | CCCc1nc(Cl)c(C(=O)OC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
10516176 | 205177 | 3 | None | - | 1 | Rat | 5.3 | pKi | = | 5.3 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccccc2F)c1C | 10.1021/jm970872k | ||
CHEMBL78499 | 205177 | 3 | None | - | 1 | Rat | 5.3 | pKi | = | 5.3 | Binding | ChEMBL | 270 | 3 | 1 | 4 | 2.2 | Cc1noc(NS(=O)(=O)c2ccccc2F)c1C | 10.1021/jm970872k | ||
10793160 | 98378 | 0 | None | -2 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 570 | 13 | 1 | 8 | 5.6 | COc1cc(/C=C/COC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc(OC)c1OC | 10.1021/jm9910425 | ||
CHEMBL275471 | 98378 | 0 | None | -2 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 570 | 13 | 1 | 8 | 5.6 | COc1cc(/C=C/COC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc(OC)c1OC | 10.1021/jm9910425 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm9505369 | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm9505369 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm980217s | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm980217s | ||
10810897 | 121467 | 0 | None | 3801 | 2 | Rat | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 398 | 6 | 1 | 4 | 5.3 | Cc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL358254 | 121467 | 0 | None | 3801 | 2 | Rat | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 398 | 6 | 1 | 4 | 5.3 | Cc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
10621010 | 164838 | 0 | None | 186 | 2 | Rat | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 400 | 6 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2cccc(O)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL421955 | 164838 | 0 | None | 186 | 2 | Rat | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 400 | 6 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2cccc(O)c2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
9871837 | 15171 | 0 | None | - | 1 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 535 | 10 | 2 | 7 | 4.9 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12106 | 15171 | 0 | None | - | 1 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 535 | 10 | 2 | 7 | 4.9 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/s0960-894x(03)00018-0 | ||
9985001 | 96980 | 0 | None | - | 1 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 549 | 10 | 2 | 7 | 5.2 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL266628 | 96980 | 0 | None | - | 1 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 549 | 10 | 2 | 7 | 5.2 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(C)c1 | 10.1016/s0960-894x(03)00018-0 | ||
44311772 | 103006 | 0 | None | -10 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 628 | 15 | 2 | 8 | 4.1 | CCCCS(=O)(=O)NC(=O)C(CCSC)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL307045 | 103006 | 0 | None | -10 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 628 | 15 | 2 | 8 | 4.1 | CCCCS(=O)(=O)NC(=O)C(CCSC)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
44311838 | 204595 | 0 | None | -13 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 655 | 12 | 3 | 7 | 4.3 | CCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL73373 | 204595 | 0 | None | -13 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 655 | 12 | 3 | 7 | 4.3 | CCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
44311850 | 103164 | 0 | None | -10 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 717 | 13 | 3 | 7 | 5.5 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NS(=O)(=O)Cc2ccccc2)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL308269 | 103164 | 0 | None | -10 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 717 | 13 | 3 | 7 | 5.5 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccno3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NS(=O)(=O)Cc2ccccc2)c1 | 10.1016/s0960-894x(98)00387-4 | ||
44311773 | 204655 | 0 | None | -7 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 582 | 13 | 2 | 7 | 3.8 | CCCCS(=O)(=O)NC(=O)C(CC)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL73835 | 204655 | 0 | None | -7 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 582 | 13 | 2 | 7 | 3.8 | CCCCS(=O)(=O)NC(=O)C(CC)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
22103743 | 42806 | 0 | None | 9332 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 411 | 5 | 1 | 6 | 4.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nccs3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL150260 | 42806 | 0 | None | 9332 | 2 | Human | 8.3 | pKi | = | 8.3 | Binding | ChEMBL | 411 | 5 | 1 | 6 | 4.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3nccs3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
10667808 | 119265 | 0 | None | 338 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 385 | 6 | 2 | 5 | 4.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(NC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL343867 | 119265 | 0 | None | 338 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 385 | 6 | 2 | 5 | 4.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(NC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10761688 | 119829 | 0 | None | 380 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 370 | 5 | 1 | 4 | 4.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(C(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL348700 | 119829 | 0 | None | 380 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 370 | 5 | 1 | 4 | 4.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(C(C)C)cc2)c1C | 10.1021/jm970872k | ||
10501166 | 41848 | 0 | None | 47 | 2 | Rat | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 400 | 6 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2cc(O)ccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL149391 | 41848 | 0 | None | 47 | 2 | Rat | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 400 | 6 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2cc(O)ccc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
44314444 | 161698 | 0 | None | -457 | 2 | Pig | 5.3 | pKi | = | 5.3 | Binding | ChEMBL | 1470 | 45 | 18 | 17 | -0.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL413604 | 161698 | 0 | None | -457 | 2 | Pig | 5.3 | pKi | = | 5.3 | Binding | ChEMBL | 1470 | 45 | 18 | 17 | -0.5 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
9799352 | 121081 | 0 | None | - | 1 | Human | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 367 | 4 | 2 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2c[nH]c3ccccc23)c1C | 10.1021/jm970872k | ||
CHEMBL357331 | 121081 | 0 | None | - | 1 | Human | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 367 | 4 | 2 | 4 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2c[nH]c3ccccc23)c1C | 10.1021/jm970872k | ||
10690608 | 121033 | 0 | None | 112 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 371 | 5 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(N(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL356901 | 121033 | 0 | None | 112 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 371 | 5 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(N(C)C)cc2)c1C | 10.1021/jm970872k | ||
44311700 | 102795 | 0 | None | -234 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 579 | 10 | 3 | 4 | 6.0 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccsc3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL305462 | 102795 | 0 | None | -234 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 579 | 10 | 3 | 4 | 6.0 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccsc3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
122272 | 97068 | 31 | None | -1 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm970872k | ||
CHEMBL267458 | 97068 | 31 | None | -1 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm970872k | ||
10521258 | 121270 | 0 | None | 416 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 342 | 4 | 1 | 4 | 4.1 | Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
CHEMBL358020 | 121270 | 0 | None | 416 | 2 | Rat | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 342 | 4 | 1 | 4 | 4.1 | Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1021/jm970872k | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm00029a001 | ||
10166104 | 15145 | 0 | None | - | 1 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 549 | 10 | 1 | 7 | 5.2 | CCCc1nc(CC)c(C(=O)N(C)C)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12102 | 15145 | 0 | None | - | 1 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 549 | 10 | 1 | 7 | 5.2 | CCCc1nc(CC)c(C(=O)N(C)C)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
17979745 | 17887 | 0 | None | - | 1 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 521 | 10 | 2 | 7 | 4.6 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12592 | 17887 | 0 | None | - | 1 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 521 | 10 | 2 | 7 | 4.6 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)cc1 | 10.1016/s0960-894x(03)00018-0 | ||
122272 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm000105c | ||
CHEMBL267458 | 97068 | 31 | None | 1 | 2 | Human | 7.3 | pKi | = | 7.3 | Binding | ChEMBL | 345 | 4 | 1 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)c1C | 10.1021/jm000105c | ||
10718666 | 121495 | 0 | None | 3 | 2 | Rat | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 457 | 9 | 3 | 6 | 4.5 | Cc1noc(NS(=O)(=O)c2ccc(NCC(=O)O)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL358461 | 121495 | 0 | None | 3 | 2 | Rat | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 457 | 9 | 3 | 6 | 4.5 | Cc1noc(NS(=O)(=O)c2ccc(NCC(=O)O)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10670536 | 121061 | 0 | None | - | 1 | Rat | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 435 | 6 | 1 | 6 | 3.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(S(=O)(=O)N(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL357099 | 121061 | 0 | None | - | 1 | Rat | 6.3 | pKi | = | 6.3 | Binding | ChEMBL | 435 | 6 | 1 | 6 | 3.0 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(S(=O)(=O)N(C)C)cc2)c1C | 10.1021/jm970872k | ||
10088869 | 144331 | 0 | None | - | 1 | Human | 5.3 | pKi | = | 5.3 | Binding | ChEMBL | 344 | 4 | 1 | 2 | 4.7 | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccccc3)[C@@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
CHEMBL39057 | 144331 | 0 | None | - | 1 | Human | 5.3 | pKi | = | 5.3 | Binding | ChEMBL | 344 | 4 | 1 | 2 | 4.7 | COc1ccc([C@H]2c3ccccc3[C@@H](c3ccccc3)[C@@H]2C(=O)O)cc1 | 10.1021/jm00037a003 | ||
10839202 | 119210 | 0 | None | 6 | 2 | Rat | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 503 | 8 | 2 | 5 | 6.2 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL343477 | 119210 | 0 | None | 6 | 2 | Rat | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 503 | 8 | 2 | 5 | 6.2 | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3)cc2-c2ccc(CC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10563752 | 40938 | 2 | None | - | 1 | Rat | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccccc2N)c1C | 10.1021/jm970872k | ||
CHEMBL148702 | 40938 | 2 | None | - | 1 | Rat | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccccc2N)c1C | 10.1021/jm970872k | ||
9953358 | 94771 | 13 | None | 102 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm030480f | ||
CHEMBL25344 | 94771 | 13 | None | 102 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm030480f | ||
44311803 | 204531 | 0 | None | -26 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 699 | 15 | 3 | 8 | 4.3 | CCOCCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL72924 | 204531 | 0 | None | -26 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 699 | 15 | 3 | 8 | 4.3 | CCOCCS(=O)(=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
177236 | 1313 | 45 | None | -2 | 3 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1021/jm030528p | ||
3508 | 1313 | 45 | None | -2 | 3 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1021/jm030528p | ||
CHEMBL23261 | 1313 | 45 | None | -2 | 3 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1021/jm030528p | ||
DB04883 | 1313 | 45 | None | -2 | 3 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1021/jm030528p | ||
9953358 | 94771 | 13 | None | 102 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL25344 | 94771 | 13 | None | 102 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COc1cc(OC)nc(OC(C(=O)O)C(OC)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
177236 | 1313 | 45 | None | 2 | 3 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
3508 | 1313 | 45 | None | 2 | 3 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
CHEMBL23261 | 1313 | 45 | None | 2 | 3 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
DB04883 | 1313 | 45 | None | 2 | 3 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 10.1016/j.bmcl.2016.06.014 | ||
11006149 | 101071 | 0 | None | 380 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 550 | 8 | 1 | 7 | 6.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C(=O)C(C)(C)C)C(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL29502 | 101071 | 0 | None | 380 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 550 | 8 | 1 | 7 | 6.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C(=O)C(C)(C)C)C(C)C)c1C | 10.1021/jm020289q | ||
10648996 | 4322 | 0 | None | 3 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 498 | 11 | 1 | 6 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
CHEMBL101069 | 4322 | 0 | None | 3 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 498 | 11 | 1 | 6 | 5.1 | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)C(Oc2nc(C)cc(C)n2)C(=O)O)cc1 | 10.1021/jm9910425 | ||
18660520 | 39534 | 0 | None | 3548 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cnccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL147340 | 39534 | 0 | None | 3548 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 406 | 5 | 1 | 6 | 4.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3cnccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
10741151 | 43037 | 0 | None | 223 | 2 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 427 | 8 | 2 | 5 | 5.4 | CCNc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL150474 | 43037 | 0 | None | 223 | 2 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 427 | 8 | 2 | 5 | 5.4 | CCNc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
10503421 | 119483 | 0 | None | 245 | 2 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 443 | 9 | 3 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NCCO)c1C | 10.1021/jm970872k | ||
CHEMBL345542 | 119483 | 0 | None | 245 | 2 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 443 | 9 | 3 | 6 | 4.4 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NCCO)c1C | 10.1021/jm970872k | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm970101g | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm970101g | ||
392 | 703 | 99 | None | 1 | 4 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm970101g | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm970101g | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm970101g | ||
104865 | 703 | 99 | None | -1 | 4 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm030528p | ||
3494 | 703 | 99 | None | -1 | 4 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm030528p | ||
392 | 703 | 99 | None | -1 | 4 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm030528p | ||
CHEMBL957 | 703 | 99 | None | -1 | 4 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm030528p | ||
DB00559 | 703 | 99 | None | -1 | 4 | Rat | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm030528p | ||
44265871 | 166894 | 0 | None | 53 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 547 | 10 | 2 | 8 | 4.6 | COc1ccccc1Cc1c(CCCO)nc(-c2ncccn2)nc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 | 10.1021/jm9505369 | ||
CHEMBL428661 | 166894 | 0 | None | 53 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 547 | 10 | 2 | 8 | 4.6 | COc1ccccc1Cc1c(CCCO)nc(-c2ncccn2)nc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 | 10.1021/jm9505369 | ||
22103787 | 40962 | 0 | None | 1380 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 394 | 5 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-n3cccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
CHEMBL148719 | 40962 | 0 | None | 1380 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 394 | 5 | 1 | 6 | 3.9 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-n3cccn3)cc2)c1C | 10.1016/s0960-894x(01)00791-0 | ||
44311989 | 204548 | 0 | None | -1 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 610 | 14 | 2 | 7 | 4.4 | CCCCS(=O)(=O)NC(=O)C(NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)CC | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL73042 | 204548 | 0 | None | -1 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 610 | 14 | 2 | 7 | 4.4 | CCCCS(=O)(=O)NC(=O)C(NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)CC | 10.1016/s0960-894x(98)00387-4 | ||
10620958 | 41679 | 0 | None | 331 | 2 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 399 | 6 | 1 | 5 | 4.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(N(C)C(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL149241 | 41679 | 0 | None | 331 | 2 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 399 | 6 | 1 | 5 | 4.6 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(N(C)C(C)C)cc2)c1C | 10.1021/jm970872k | ||
10803738 | 118962 | 0 | None | - | 1 | Rat | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 294 | 4 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2C(C)C)c1C | 10.1021/jm970872k | ||
CHEMBL342498 | 118962 | 0 | None | - | 1 | Rat | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 294 | 4 | 1 | 4 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2C(C)C)c1C | 10.1021/jm970872k | ||
5472495 | 186609 | 47 | None | - | 1 | Human | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 372 | 4 | 1 | 3 | 4.0 | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 | nan | ||
CHEMBL488025 | 186609 | 47 | None | - | 1 | Human | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 372 | 4 | 1 | 3 | 4.0 | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 | nan | ||
10691439 | 44513 | 0 | None | 245 | 2 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 384 | 4 | 1 | 4 | 5.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(C(C)(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL151971 | 44513 | 0 | None | 245 | 2 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 384 | 4 | 1 | 4 | 5.1 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(C(C)(C)C)cc2)c1C | 10.1021/jm970872k | ||
10783588 | 165658 | 0 | None | - | 1 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 343 | 4 | 2 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccc(N)c2)c1C | 10.1021/jm970872k | ||
CHEMBL424504 | 165658 | 0 | None | - | 1 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 343 | 4 | 2 | 5 | 3.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccc(N)c2)c1C | 10.1021/jm970872k | ||
44314783 | 166425 | 0 | None | -7943 | 2 | Pig | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 1576 | 47 | 19 | 18 | 0.8 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
77282213 | 166425 | 0 | None | -7943 | 2 | Pig | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 1576 | 47 | 19 | 18 | 0.8 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL427778 | 166425 | 0 | None | -7943 | 2 | Pig | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 1576 | 47 | 19 | 18 | 0.8 | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
5310990 | 166806 | 11 | None | - | 1 | Human | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
CHEMBL428504 | 166806 | 11 | None | - | 1 | Human | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 510 | 12 | 1 | 6 | 4.7 | CCCCN(CCCC)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 | 10.1021/jm9505369 | ||
10600059 | 44489 | 0 | None | - | 1 | Rat | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 460 | 8 | 1 | 4 | 6.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1Cc1ccccc1 | 10.1021/jm970872k | ||
CHEMBL151954 | 44489 | 0 | None | - | 1 | Rat | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 460 | 8 | 1 | 4 | 6.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2)c1Cc1ccccc1 | 10.1021/jm970872k | ||
9830098 | 103003 | 0 | None | -5 | 2 | Human | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
CHEMBL307033 | 103003 | 0 | None | -5 | 2 | Human | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
22574723 | 15906 | 0 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 549 | 11 | 2 | 7 | 5.2 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12233 | 15906 | 0 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 549 | 11 | 2 | 7 | 5.2 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(CC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
20747575 | 98396 | 0 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 579 | 12 | 2 | 8 | 5.0 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL275545 | 98396 | 0 | None | - | 1 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 579 | 12 | 2 | 8 | 5.0 | CCCc1nc(CC)c(C(=O)NC)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COC)c1 | 10.1016/s0960-894x(03)00018-0 | ||
10693607 | 102679 | 0 | None | 354 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 424 | 10 | 1 | 7 | 3.3 | CCOC(c1ccccc1)(c1ccccc1)C(Oc1nc(OC)cc(OC)n1)C(=O)O | 10.1021/jm960274q | ||
CHEMBL304778 | 102679 | 0 | None | 354 | 2 | Human | 8.2 | pKi | = | 8.2 | Binding | ChEMBL | 424 | 10 | 1 | 7 | 3.3 | CCOC(c1ccccc1)(c1ccccc1)C(Oc1nc(OC)cc(OC)n1)C(=O)O | 10.1021/jm960274q | ||
51002601 | 58038 | 0 | None | 123 | 2 | Mouse | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 906 | 24 | 2 | 17 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CNS(=O)(=O)c4ccc(F)cc4)nn3)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672885 | 58038 | 0 | None | 123 | 2 | Mouse | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 906 | 24 | 2 | 17 | 4.2 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CNS(=O)(=O)c4ccc(F)cc4)nn3)c2)cc1 | 10.1021/jm101110w | ||
51002602 | 58039 | 0 | None | 812 | 2 | Mouse | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 751 | 21 | 1 | 15 | 4.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CF)nn3)c2)cc1 | 10.1021/jm101110w | ||
CHEMBL1672886 | 58039 | 0 | None | 812 | 2 | Mouse | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 751 | 21 | 1 | 15 | 4.0 | COc1ccc(C2(O)OC(=O)C(c3ccc4c(c3)OCO4)=C2Cc2cc(OC)c(OC)c(OCCOCCOCCOCCn3cc(CF)nn3)c2)cc1 | 10.1021/jm101110w | ||
10549472 | 5305 | 0 | None | - | 1 | Human | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1nc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)co1 | 10.1021/jm000105c | ||
CHEMBL106846 | 5305 | 0 | None | - | 1 | Human | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 409 | 5 | 1 | 6 | 4.7 | Cc1nc(-c2ccc(-c3ccccc3S(=O)(=O)Nc3onc(C)c3C)cc2)co1 | 10.1021/jm000105c | ||
10734431 | 43301 | 0 | None | - | 1 | Rat | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.1 | Cc1noc(NS(=O)(=O)c2ccccc2C(F)(F)F)c1C | 10.1021/jm970872k | ||
CHEMBL150697 | 43301 | 0 | None | - | 1 | Rat | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 320 | 3 | 1 | 4 | 3.1 | Cc1noc(NS(=O)(=O)c2ccccc2C(F)(F)F)c1C | 10.1021/jm970872k | ||
20747572 | 16445 | 0 | None | - | 1 | Human | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 555 | 10 | 2 | 7 | 5.3 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(Cl)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12348 | 16445 | 0 | None | - | 1 | Human | 6.2 | pKi | = | 6.2 | Binding | ChEMBL | 555 | 10 | 2 | 7 | 5.3 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(Cl)c1 | 10.1016/s0960-894x(03)00018-0 | ||
19934546 | 206191 | 0 | None | 8 | 2 | Human | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 466 | 7 | 1 | 4 | 6.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(OCc3cccc4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL86581 | 206191 | 0 | None | 8 | 2 | Human | 5.2 | pKi | = | 5.2 | Binding | ChEMBL | 466 | 7 | 1 | 4 | 6.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(OCc3cccc4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
10718053 | 44083 | 0 | None | 5 | 2 | Rat | 5.1 | pKi | = | 5.1 | Binding | ChEMBL | 442 | 8 | 1 | 6 | 4.8 | CCOC(=O)c1c(C)noc1NS(=O)(=O)c1ccccc1-c1ccc(CC(C)C)cc1 | 10.1021/jm970872k | ||
CHEMBL151525 | 44083 | 0 | None | 5 | 2 | Rat | 5.1 | pKi | = | 5.1 | Binding | ChEMBL | 442 | 8 | 1 | 6 | 4.8 | CCOC(=O)c1c(C)noc1NS(=O)(=O)c1ccccc1-c1ccc(CC(C)C)cc1 | 10.1021/jm970872k | ||
10597897 | 41145 | 0 | None | 724 | 2 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 414 | 7 | 1 | 5 | 5.0 | COc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
CHEMBL148853 | 41145 | 0 | None | 724 | 2 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 414 | 7 | 1 | 5 | 5.0 | COc1cc(CC(C)C)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C | 10.1021/jm970872k | ||
10668703 | 165159 | 0 | None | 1230 | 2 | Rat | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 400 | 6 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2O)c1C | 10.1021/jm970872k | ||
CHEMBL422851 | 165159 | 0 | None | 1230 | 2 | Rat | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 400 | 6 | 2 | 5 | 4.7 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2O)c1C | 10.1021/jm970872k | ||
44311763 | 204426 | 0 | None | -6 | 2 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 610 | 14 | 2 | 7 | 4.4 | CCCCS(=O)(=O)NC(=O)C(CC(C)C)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL72217 | 204426 | 0 | None | -6 | 2 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 610 | 14 | 2 | 7 | 4.4 | CCCCS(=O)(=O)NC(=O)C(CC(C)C)NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1 | 10.1016/s0960-894x(98)00387-4 | ||
22574645 | 17761 | 0 | None | - | 1 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 597 | 14 | 2 | 8 | 5.1 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COCCF)c1 | 10.1016/s0960-894x(03)00018-0 | ||
CHEMBL12588 | 17761 | 0 | None | - | 1 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 597 | 14 | 2 | 8 | 5.1 | CCCc1nc(CC)c(C(N)=O)n1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(COCCF)c1 | 10.1016/s0960-894x(03)00018-0 | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm020289q | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm020289q | ||
392 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm020289q | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm020289q | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm020289q | ||
11071062 | 99239 | 0 | None | - | 1 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 494 | 9 | 1 | 7 | 5.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)CC(C)C)c1C | 10.1021/jm020289q | ||
CHEMBL281869 | 99239 | 0 | None | - | 1 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 494 | 9 | 1 | 7 | 5.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(-c3ncco3)cc2CN(C)CC(C)C)c1C | 10.1021/jm020289q | ||
44311873 | 204447 | 0 | None | -2 | 2 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 636 | 13 | 2 | 7 | 5.0 | CCCCS(=O)(=O)NC(=O)C(NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C1CCCCC1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL72358 | 204447 | 0 | None | -2 | 2 | Human | 8.1 | pKi | = | 8.1 | Binding | ChEMBL | 636 | 13 | 2 | 7 | 5.0 | CCCCS(=O)(=O)NC(=O)C(NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C1CCCCC1 | 10.1016/s0960-894x(98)00387-4 | ||
10548904 | 119484 | 0 | None | 380 | 2 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 398 | 7 | 1 | 4 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CCC(C)C)cc2)c1C | 10.1021/jm970872k | ||
CHEMBL345551 | 119484 | 0 | None | 380 | 2 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 398 | 7 | 1 | 4 | 5.3 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CCC(C)C)cc2)c1C | 10.1021/jm970872k | ||
10711546 | 205453 | 7 | None | - | 1 | Rat | 5.1 | pKi | = | 5.1 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2ccccc2Br)c1C | 10.1021/jm970872k | ||
CHEMBL80506 | 205453 | 7 | None | - | 1 | Rat | 5.1 | pKi | = | 5.1 | Binding | ChEMBL | 330 | 3 | 1 | 4 | 2.9 | Cc1noc(NS(=O)(=O)c2ccccc2Br)c1C | 10.1021/jm970872k | ||
19934535 | 106948 | 0 | None | -7 | 2 | Human | 4.1 | pKi | = | 4.1 | Binding | ChEMBL | 468 | 6 | 3 | 4 | 5.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)c3c[nH]c4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL315096 | 106948 | 0 | None | -7 | 2 | Human | 4.1 | pKi | = | 4.1 | Binding | ChEMBL | 468 | 6 | 3 | 4 | 5.0 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)c3c[nH]c4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
392 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | 10.1021/jm000538f | ||
9949368 | 41356 | 0 | None | - | 1 | Human | 6.1 | pKi | = | 6.1 | Binding | ChEMBL | 329 | 4 | 1 | 5 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccn2)c1C | 10.1021/jm970872k | ||
CHEMBL149018 | 41356 | 0 | None | - | 1 | Human | 6.1 | pKi | = | 6.1 | Binding | ChEMBL | 329 | 4 | 1 | 5 | 3.2 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccn2)c1C | 10.1021/jm970872k | ||
44320537 | 107124 | 0 | None | - | 1 | Human | 4.1 | pKi | = | 4.1 | Binding | ChEMBL | 479 | 6 | 2 | 4 | 5.7 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)c3cccc4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
CHEMBL316247 | 107124 | 0 | None | - | 1 | Human | 4.1 | pKi | = | 4.1 | Binding | ChEMBL | 479 | 6 | 2 | 4 | 5.7 | CCCN1c2ccccc2C(=O)N(CC(=O)O)c2cc(NC(=O)c3cccc4ccccc34)ccc21 | 10.1016/0960-894X(95)00019-P | ||
44311810 | 104763 | 0 | None | -35 | 2 | Human | 6.1 | pKi | = | 6.1 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@H](NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
CHEMBL310919 | 104763 | 0 | None | -35 | 2 | Human | 6.1 | pKi | = | 6.1 | Binding | ChEMBL | 596 | 13 | 2 | 7 | 4.0 | CCCCS(=O)(=O)NC(=O)[C@H](NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)C | 10.1016/s0960-894x(98)00388-6 | ||
10814297 | 203506 | 0 | None | 17 | 2 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 472 | 10 | 1 | 7 | 4.3 | COc1cc(OC)nc(OC(C(=O)O)C(Oc2ccccc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
CHEMBL66402 | 203506 | 0 | None | 17 | 2 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 472 | 10 | 1 | 7 | 4.3 | COc1cc(OC)nc(OC(C(=O)O)C(Oc2ccccc2)(c2ccccc2)c2ccccc2)n1 | 10.1021/jm960274q | ||
44311852 | 103057 | 0 | None | -144 | 2 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 579 | 10 | 3 | 4 | 6.0 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3cccs3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL307470 | 103057 | 0 | None | -144 | 2 | Human | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 579 | 10 | 3 | 4 | 6.0 | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3cccs3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c1 | 10.1016/s0960-894x(98)00387-4 | ||
9818889 | 121118 | 0 | None | - | 1 | Human | 5.1 | pKi | = | 5.1 | Binding | ChEMBL | 330 | 4 | 1 | 6 | 2.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ncccn2)c1C | 10.1021/jm970872k | ||
CHEMBL357678 | 121118 | 0 | None | - | 1 | Human | 5.1 | pKi | = | 5.1 | Binding | ChEMBL | 330 | 4 | 1 | 6 | 2.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ncccn2)c1C | 10.1021/jm970872k | ||
10742502 | 121241 | 0 | None | 134 | 2 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 457 | 9 | 3 | 6 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NCC(=O)O)c1C | 10.1021/jm970872k | ||
CHEMBL357823 | 121241 | 0 | None | 134 | 2 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 457 | 9 | 3 | 6 | 4.5 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccc(CC(C)C)cc2NCC(=O)O)c1C | 10.1021/jm970872k | ||
44311858 | 96574 | 0 | None | -2 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 598 | 13 | 3 | 8 | 2.8 | CCCCS(=O)(=O)NC(=O)C(NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)O | 10.1016/s0960-894x(98)00387-4 | ||
CHEMBL263301 | 96574 | 0 | None | -2 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 598 | 13 | 3 | 8 | 2.8 | CCCCS(=O)(=O)NC(=O)C(NC(=O)[C@@H](Cc1ccc(-c2ccno2)cc1)N(C)C(=O)c1cc(C)cc(C)c1)C(C)O | 10.1016/s0960-894x(98)00387-4 | ||
10257882 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm300682j | ||
8448 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm300682j | ||
CHEMBL539423 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm300682j | ||
DB12548 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm300682j | ||
10257882 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm058225d | ||
8448 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm058225d | ||
CHEMBL539423 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm058225d | ||
DB12548 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | ChEMBL | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 10.1021/jm058225d | ||
9840391 | 104512 | 6 | None | - | 1 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1C | 10.1021/jm970872k | ||
CHEMBL310427 | 104512 | 6 | None | - | 1 | Rat | 7.1 | pKi | = | 7.1 | Binding | ChEMBL | 328 | 4 | 1 | 4 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1C | 10.1021/jm970872k | ||
9840650 | 44340 | 0 | None | - | 1 | Human | 6.1 | pKi | = | 6.1 | Binding | ChEMBL | 334 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccsc2)c1C | 10.1021/jm970872k | ||
CHEMBL151819 | 44340 | 0 | None | - | 1 | Human | 6.1 | pKi | = | 6.1 | Binding | ChEMBL | 334 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2ccsc2)c1C | 10.1021/jm970872k | ||
9927658 | 121193 | 0 | None | - | 1 | Human | 6.0 | pKi | = | 6.0 | Binding | ChEMBL | 334 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccs2)c1C | 10.1021/jm970872k | ||
CHEMBL357789 | 121193 | 0 | None | - | 1 | Human | 6.0 | pKi | = | 6.0 | Binding | ChEMBL | 334 | 4 | 1 | 5 | 3.8 | Cc1noc(NS(=O)(=O)c2ccccc2-c2cccs2)c1C | 10.1021/jm970872k | ||
44314820 | 155697 | 0 | None | -380 | 2 | Pig | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 1518 | 45 | 18 | 17 | 1.0 | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
77282210 | 155697 | 0 | None | -380 | 2 | Pig | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 1518 | 45 | 18 | 17 | 1.0 | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
CHEMBL405377 | 155697 | 0 | None | -380 | 2 | Pig | 7.0 | pKi | = | 7.0 | Binding | ChEMBL | 1518 | 45 | 18 | 17 | 1.0 | CC[C@H](C)[C@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC | 10.1016/0960-894X(96)00421-0 | ||
10737908 | 41421 | 0 | None | 102 | 2 | Rat | 6.0 | pKi | = | 6.0 | Binding | ChEMBL | 370 | 6 | 1 | 4 | 4.6 | Cc1cnoc1NS(=O)(=O)c1ccccc1-c1ccc(CC(C)C)cc1 | 10.1021/jm970872k | ||
CHEMBL149060 | 41421 | 0 | None | 102 | 2 | Rat | 6.0 | pKi | = | 6.0 | Binding | ChEMBL | 370 | 6 | 1 | 4 | 4.6 | Cc1cnoc1NS(=O)(=O)c1ccccc1-c1ccc(CC(C)C)cc1 | 10.1021/jm970872k | ||
5340 | 168706 | 106 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | Drug Central | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | None | ||
CHEMBL437 | 168706 | 106 | None | - | 0 | Rat | 8.4 | pIC50 | = | 8.4 | Binding | Drug Central | 255 | 3 | 2 | 5 | 1.5 | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 | None | ||
5329 | 169452 | 119 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | Drug Central | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | None | ||
CHEMBL443 | 169452 | 119 | None | - | 0 | Rat | 8.3 | pIC50 | = | 8.3 | Binding | Drug Central | 253 | 3 | 2 | 5 | 1.4 | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 | None | ||
5344 | 173449 | 101 | None | - | 1 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | Drug Central | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | None | ||
CHEMBL453 | 173449 | 101 | None | - | 1 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | Drug Central | 267 | 3 | 2 | 5 | 1.7 | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C | None | ||
6662 | 217711 | 0 | None | - | 0 | Rat | 8.2 | pIC50 | = | 8.2 | Binding | Drug Central | 309 | 3 | 1 | 6 | 1.6 | CC(=O)N(C1=C(C)C(C)=NO1)S(=O)(=O)C1=CC=C(N)C=C1 | None | ||
104865 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
3494 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
392 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
CHEMBL957 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
DB00559 | 703 | 99 | None | - | 4 | Pig | 8.1 | pIC50 | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
16004692 | 2438 | 91 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Drug Central | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | None | ||
4809 | 2438 | 91 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Drug Central | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | None | ||
7352 | 2438 | 91 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Drug Central | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | None | ||
CHEMBL2103873 | 2438 | 91 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Drug Central | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | None | ||
DB08932 | 2438 | 91 | None | - | 0 | Human | 8.0 | pIC50 | = | 8.0 | Binding | Drug Central | 586 | 11 | 2 | 8 | 3.6 | CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br | None | ||
10605470 | 3010 | 0 | None | - | 1 | Human | 9.0 | pKd | = | 9 | Binding | Guide to Pharmacology | 823 | 17 | 3 | 10 | 6.2 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)O)/Cc1cc(OCCCC(=O)NCCc2ccc(c(c2)I)O)c(c(c1)OC)OC | 9489609 | ||
3519 | 3010 | 0 | None | - | 1 | Human | 9.0 | pKd | = | 9 | Binding | Guide to Pharmacology | 823 | 17 | 3 | 10 | 6.2 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)O)/Cc1cc(OCCCC(=O)NCCc2ccc(c(c2)I)O)c(c(c1)OC)OC | 9489609 | ||
CHEMBL2068816 | 3010 | 0 | None | - | 1 | Human | 9.0 | pKd | = | 9 | Binding | Guide to Pharmacology | 823 | 17 | 3 | 10 | 6.2 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)O)/Cc1cc(OCCCC(=O)NCCc2ccc(c(c2)I)O)c(c(c1)OC)OC | 9489609 | ||
23670447 | 3007 | 2 | None | 114 | 2 | Human | 9.4 | pKd | = | 9.4 | Binding | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
999 | 3007 | 2 | None | 114 | 2 | Human | 9.4 | pKd | = | 9.4 | Binding | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
CHEMBL1204799 | 3007 | 2 | None | 114 | 2 | Human | 9.4 | pKd | = | 9.4 | Binding | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
CHEMBL25438 | 3007 | 2 | None | 114 | 2 | Human | 9.4 | pKd | = | 9.4 | Binding | Guide to Pharmacology | 528 | 10 | 0 | 9 | 0.1 | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] | 9023329 | ||
186002 | 102815 | 23 | 125I-ENDOTHELIN | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | PDSP KiDatabase | 531 | 10 | 2 | 6 | 5.4 | CCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1C[C@H](C)C(=O)O)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | None | ||
CHEMBL305576 | 102815 | 23 | 125I-ENDOTHELIN | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | PDSP KiDatabase | 531 | 10 | 2 | 6 | 5.4 | CCCCc1ccc2c(n1)[C@@H](c1ccc(OC)cc1C[C@H](C)C(=O)O)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2 | None | ||
None | 216050 | 0 | 125I-ENDOTHELIN | 52 | 2 | Human | 9.4 | pKi | = | 9.4 | Binding | PDSP KiDatabase | 520 | 10 | 2 | 7 | 4.7 | CCCOC1=CC2=C(C=C1)C(C(C2C3=C(C=C(C=C3)OC)OCC(=O)O)C(=O)O)C4=CC5=C(C=C4)OCO5 | None | ||
3075702 | 217305 | 0 | 125I-Endothelin 1 | -2 | 37 | Human | 6.0 | pKi | = | 6 | Binding | PDSP KiDatabase | 198 | 3 | 1 | 3 | 1.5 | C1CNC1COC2=CN=C(C=C2)Cl | None | ||
44208932 | 140682 | 7 | UNDEFINED | -89125 | 37 | Human | 5.0 | pKi | = | 5 | Binding | PDSP KiDatabase | 475 | 5 | 1 | 3 | 6.8 | Cc1ccc(Cn2nc(C(=O)NC3C4(C)CCC(C4)C3(C)C)cc2-c2ccc(Cl)c(C)c2)cc1 | None | ||
CHEMBL381689 | 140682 | 7 | UNDEFINED | -89125 | 37 | Human | 5.0 | pKi | = | 5 | Binding | PDSP KiDatabase | 475 | 5 | 1 | 3 | 6.8 | Cc1ccc(Cn2nc(C(=O)NC3C4(C)CCC(C4)C3(C)C)cc2-c2ccc(Cl)c(C)c2)cc1 | None | ||
1973 | 203460 | 15 | 125I-ENDOTHELIN | -3 | 37 | Rat | 5.0 | pKi | = | 5 | Binding | PDSP KiDatabase | 462 | 3 | 1 | 7 | 3.9 | Nc1ncnc2nc(-c3ccc(N4CCOCC4)nc3)cc(-c3cccc(Br)c3)c12 | None | ||
CHEMBL1394464 | 203460 | 15 | 125I-ENDOTHELIN | -3 | 37 | Rat | 5.0 | pKi | = | 5 | Binding | PDSP KiDatabase | 462 | 3 | 1 | 7 | 3.9 | Nc1ncnc2nc(-c3ccc(N4CCOCC4)nc3)cc(-c3cccc(Br)c3)c12 | None | ||
CHEMBL66089 | 203460 | 15 | 125I-ENDOTHELIN | -3 | 37 | Rat | 5.0 | pKi | = | 5 | Binding | PDSP KiDatabase | 462 | 3 | 1 | 7 | 3.9 | Nc1ncnc2nc(-c3ccc(N4CCOCC4)nc3)cc(-c3cccc(Br)c3)c12 | None | ||
None | 216466 | 0 | 125I-ENDOTHELIN | -10471285 | 17 | Rat | 5.0 | pKi | = | 5 | Binding | PDSP KiDatabase | 372 | 2 | 1 | 3 | 4.4 | CC(C)(C)C1=CC=C(C=C1)NC(=O)N2CCN(CC2)C3=C(C=CC=N3)Cl | None | ||
104865 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
3494 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
392 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
CHEMBL957 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
DB00559 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 7.8 | pKi | = | 7.8 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
176 | 397 | 66 | None | -7 | 31 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | None | ||
2157 | 397 | 66 | None | -7 | 31 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | None | ||
2566 | 397 | 66 | None | -7 | 31 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | None | ||
CHEMBL633 | 397 | 66 | None | -7 | 31 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | None | ||
DB01118 | 397 | 66 | None | -7 | 31 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | None | ||
1481 | 2053 | 116 | None | -112 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | None | ||
3749 | 2053 | 116 | None | -112 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | None | ||
589 | 2053 | 116 | None | -112 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | None | ||
6908 | 2053 | 116 | None | -112 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | None | ||
CHEMBL1513 | 2053 | 116 | None | -112 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | None | ||
DB01029 | 2053 | 116 | None | -112 | 3 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 428 | 7 | 1 | 5 | 4.8 | CCCCC1=NC2(C(=O)N1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CCCC2 | None | ||
5472495 | 186609 | 47 | None | - | 1 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 372 | 4 | 1 | 3 | 4.0 | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 | None | ||
CHEMBL488025 | 186609 | 47 | None | - | 1 | Human | 8.3 | pKi | = | 8.3 | Binding | Drug Central | 372 | 4 | 1 | 3 | 4.0 | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(S(C)(=O)=O)cc1 | None | ||
104865 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
3494 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
392 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
CHEMBL957 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
DB00559 | 703 | 99 | None | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
104865 | 703 | 99 | None | -1 | 4 | Rat | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
3494 | 703 | 99 | None | -1 | 4 | Rat | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
392 | 703 | 99 | None | -1 | 4 | Rat | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
CHEMBL957 | 703 | 99 | None | -1 | 4 | Rat | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
DB00559 | 703 | 99 | None | -1 | 4 | Rat | 8.1 | pKi | = | 8.1 | Binding | Drug Central | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
104865 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
3494 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
392 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
CHEMBL957 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
DB00559 | 703 | 99 | 125I-ENDOTHELIN | 1 | 4 | Human | 8.1 | pKi | = | 8.1 | Binding | PDSP KiDatabase | 551 | 10 | 2 | 10 | 4.2 | OCCOc1nc(nc(c1Oc1ccccc1OC)NS(=O)(=O)c1ccc(cc1)C(C)(C)C)c1ncccn1 | None | ||
11477084 | 3583 | 53 | None | 1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
216235 | 3583 | 53 | None | 1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
3548 | 3583 | 53 | None | 1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
3950 | 3583 | 53 | None | 1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
CHEMBL282724 | 3583 | 53 | None | 1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
DB06268 | 3583 | 53 | None | 1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
11477084 | 3583 | 53 | None | -1 | 2 | Rat | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
216235 | 3583 | 53 | None | -1 | 2 | Rat | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
3548 | 3583 | 53 | None | -1 | 2 | Rat | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
3950 | 3583 | 53 | None | -1 | 2 | Rat | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
CHEMBL282724 | 3583 | 53 | None | -1 | 2 | Rat | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
DB06268 | 3583 | 53 | None | -1 | 2 | Rat | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 454 | 6 | 1 | 8 | 4.0 | O=C(c1sccc1S(=O)(=O)Nc1onc(c1Cl)C)Cc1cc2OCOc2cc1C | None | ||
3951 | 390 | 86 | None | -1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | None | ||
4337 | 390 | 86 | None | -1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | None | ||
6918493 | 390 | 86 | None | -1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | None | ||
CHEMBL1111 | 390 | 86 | None | -1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | None | ||
DB06403 | 390 | 86 | None | -1 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Drug Central | 378 | 7 | 1 | 5 | 3.5 | COC([C@@H](C(=O)O)Oc1nc(C)cc(n1)C)(c1ccccc1)c1ccccc1 | None | ||
12286 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9703472 | ||
6433095 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9703472 | ||
CHEMBL109648 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9703472 | ||
DB06677 | 945 | 36 | None | 1348 | 2 | Human | 9.9 | pKi | = | 9.9 | Binding | Guide to Pharmacology | 577 | 11 | 3 | 13 | 2.4 | Cc1cnc(cc1)S(=O)(=O)Nc1c(c(nc(n1)c1cc(ncc1)c1n[nH]nn1)OCCO)Oc1ccccc1OC | 9703472 | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
159594 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8676339 | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
3487 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8676339 | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
CHEMBL9194 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8676339 | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8632312 | ||
DB06199 | 520 | 45 | None | 1 | 3 | Human | 10.5 | pKi | = | 10.5 | Binding | Guide to Pharmacology | 510 | 12 | 1 | 6 | 4.7 | CCCCN(C(=O)CN1C[C@@H]([C@H]([C@@H]1c1ccc(cc1)OC)C(=O)O)c1ccc2c(c1)OCO2)CCCC | 8676339 | ||
13015 | 1518 | 30 | None | - | 1 | Human | 11.0 | pKi | = | 11 | Binding | Guide to Pharmacology | 536 | 8 | 1 | 7 | 5.8 | CC1=C(ON=C1NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)C4=NC=CO4)CN(C)C(=O)CC(C)(C)C)C | 12502366 | ||
156690 | 1518 | 30 | None | - | 1 | Human | 11.0 | pKi | = | 11 | Binding | Guide to Pharmacology | 536 | 8 | 1 | 7 | 5.8 | CC1=C(ON=C1NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)C4=NC=CO4)CN(C)C(=O)CC(C)(C)C)C | 12502366 | ||
CHEMBL383581 | 1518 | 30 | None | - | 1 | Human | 11.0 | pKi | = | 11 | Binding | Guide to Pharmacology | 536 | 8 | 1 | 7 | 5.8 | CC1=C(ON=C1NS(=O)(=O)C2=CC=CC=C2C3=C(C=C(C=C3)C4=NC=CO4)CN(C)C(=O)CC(C)(C)C)C | 12502366 | ||
10257882 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Guide to Pharmacology | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 16220969 | ||
8448 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Guide to Pharmacology | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 16220969 | ||
CHEMBL539423 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Guide to Pharmacology | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 16220969 | ||
DB12548 | 3619 | 43 | None | -11 | 2 | Human | 8.0 | pKi | = | 8.0 | Binding | Guide to Pharmacology | 592 | 12 | 1 | 7 | 6.5 | CCCCC1=NC2(C(=O)N1Cc1ccc(c(c1)COCC)c1ccccc1S(=O)(=O)Nc1noc(c1C)C)CCCC2 | 16220969 | ||
13016 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10956219 | ||
9843631 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10956219 | ||
CHEMBL24461 | 667 | 13 | None | 1 | 4 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 395 | 5 | 1 | 6 | 4.4 | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C4=NC=CO4 | 10956219 | ||
177236 | 1313 | 45 | None | 2 | 3 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 8667356 | ||
3508 | 1313 | 45 | None | 2 | 3 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 8667356 | ||
CHEMBL23261 | 1313 | 45 | None | 2 | 3 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 8667356 | ||
DB04883 | 1313 | 45 | None | 2 | 3 | Human | 8.9 | pKi | = | 8.9 | Binding | Guide to Pharmacology | 410 | 9 | 1 | 7 | 2.9 | COC([C@@H](C(=O)O)Oc1nc(OC)cc(n1)OC)(c1ccccc1)c1ccccc1 | 8667356 |